From 84eb23cdfb0b3b2e991f835670e145d50918634a Mon Sep 17 00:00:00 2001 From: Maple Date: Wed, 25 Jan 2023 22:51:19 -0300 Subject: [PATCH 01/21] Fix building on latest *nux --- deps/mysqlConnector/Connection.cpp | 5 +---- src/tools/nav_export/pcb.h | 1 + src/tools/pcb_reader/pcb.h | 1 + 3 files changed, 3 insertions(+), 4 deletions(-) diff --git a/deps/mysqlConnector/Connection.cpp b/deps/mysqlConnector/Connection.cpp index df6a28f0..20d1f006 100644 --- a/deps/mysqlConnector/Connection.cpp +++ b/deps/mysqlConnector/Connection.cpp @@ -3,11 +3,8 @@ #include "Statement.h" #include "PreparedStatement.h" #include +#include -#ifdef _MSC_VER - // fixes compile error when compiling with vs2019 - #include -#endif #include Mysql::Connection::Connection( std::shared_ptr< MySqlBase > pBase, diff --git a/src/tools/nav_export/pcb.h b/src/tools/nav_export/pcb.h index 647c56ca..afec2518 100644 --- a/src/tools/nav_export/pcb.h +++ b/src/tools/nav_export/pcb.h @@ -3,6 +3,7 @@ #include #include +#include struct PCB_HEADER { diff --git a/src/tools/pcb_reader/pcb.h b/src/tools/pcb_reader/pcb.h index 647c56ca..afec2518 100644 --- a/src/tools/pcb_reader/pcb.h +++ b/src/tools/pcb_reader/pcb.h @@ -3,6 +3,7 @@ #include #include +#include struct PCB_HEADER { From 41423b431a7ba32c072017d06113ef860fb817ad Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 03:08:54 -0300 Subject: [PATCH 02/21] Fix ExdData for Patch 6.31 --- src/common/Exd/ExdDataGenerated.cpp | 2236 +++++++++++++++++------ src/common/Exd/ExdDataGenerated.h | 2540 +++++++++++++++++++++++++-- src/world/Actor/PlayerQuest.cpp | 12 +- 3 files changed, 4124 insertions(+), 664 deletions(-) diff --git a/src/common/Exd/ExdDataGenerated.cpp b/src/common/Exd/ExdDataGenerated.cpp index 201cc540..24f5eea9 100644 --- a/src/common/Exd/ExdDataGenerated.cpp +++ b/src/common/Exd/ExdDataGenerated.cpp @@ -65,7 +65,7 @@ Sapphire::Data::Action::Action( uint32_t row_id, Sapphire::Data::ExdDataGenerate icon = exdData->getField< uint16_t >( row, 2 ); actionCategory = exdData->getField< uint8_t >( row, 3 ); animationStart = exdData->getField< uint8_t >( row, 5 ); - vFX = exdData->getField< uint8_t >( row, 6 ); + vFX = exdData->getField< uint16_t >( row, 6 ); animationEnd = exdData->getField< int16_t >( row, 7 ); actionTimelineHit = exdData->getField< uint16_t >( row, 8 ); classJob = exdData->getField< int8_t >( row, 10 ); @@ -89,20 +89,20 @@ Sapphire::Data::Action::Action( uint32_t row_id, Sapphire::Data::ExdDataGenerate actionCombo = exdData->getField< uint16_t >( row, 35 ); preservesCombo = exdData->getField< bool >( row, 36 ); cast100ms = exdData->getField< uint16_t >( row, 37 ); - recast100ms = exdData->getField< uint16_t >( row, 38 ); - cooldownGroup = exdData->getField< uint8_t >( row, 39 ); - additionalCooldownGroup = exdData->getField< uint8_t >( row, 40 ); - maxCharges = exdData->getField< uint8_t >( row, 41 ); - attackType = exdData->getField< int8_t >( row, 42 ); - aspect = exdData->getField< uint8_t >( row, 43 ); - actionProcStatus = exdData->getField< uint8_t >( row, 44 ); - statusGainSelf = exdData->getField< uint16_t >( row, 46 ); - unlockLink = exdData->getField< uint32_t >( row, 47 ); - classJobCategory = exdData->getField< uint8_t >( row, 48 ); - affectsPosition = exdData->getField< bool >( row, 51 ); - omen = exdData->getField< uint16_t >( row, 52 ); - isPvP = exdData->getField< bool >( row, 53 ); - isPlayerAction = exdData->getField< bool >( row, 65 ); + recast100ms = exdData->getField< uint16_t >( row, 39 ); + cooldownGroup = exdData->getField< uint8_t >( row, 40 ); + additionalCooldownGroup = exdData->getField< uint8_t >( row, 41 ); + maxCharges = exdData->getField< uint8_t >( row, 42 ); + attackType = exdData->getField< int8_t >( row, 43 ); + aspect = exdData->getField< uint8_t >( row, 44 ); + actionProcStatus = exdData->getField< uint8_t >( row, 45 ); + statusGainSelf = exdData->getField< uint16_t >( row, 47 ); + unlockLink = exdData->getField< uint32_t >( row, 48 ); + classJobCategory = exdData->getField< uint8_t >( row, 49 ); + affectsPosition = exdData->getField< bool >( row, 52 ); + omen = exdData->getField< uint16_t >( row, 53 ); + isPvP = exdData->getField< bool >( row, 55 ); + isPlayerAction = exdData->getField< bool >( row, 67 ); } Sapphire::Data::ActionCastTimeline::ActionCastTimeline( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -261,6 +261,7 @@ Sapphire::Data::AdventureExPhase::AdventureExPhase( uint32_t row_id, Sapphire::D quest = exdData->getField< uint32_t >( row, 0 ); adventureBegin = exdData->getField< uint32_t >( row, 1 ); adventureEnd = exdData->getField< uint32_t >( row, 2 ); + expansion = exdData->getField< uint8_t >( row, 3 ); } Sapphire::Data::AetherCurrent::AetherCurrent( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -273,6 +274,7 @@ Sapphire::Data::AetherCurrentCompFlgSet::AetherCurrentCompFlgSet( uint32_t row_i { auto row = exdData->m_AetherCurrentCompFlgSetDat.get_row( row_id ); territory = exdData->getField< int32_t >( row, 0 ); + aetherCurrent.push_back( exdData->getField< int32_t >( row, 1 ) ); aetherCurrent.push_back( exdData->getField< int32_t >( row, 2 ) ); aetherCurrent.push_back( exdData->getField< int32_t >( row, 3 ) ); aetherCurrent.push_back( exdData->getField< int32_t >( row, 4 ) ); @@ -287,7 +289,6 @@ Sapphire::Data::AetherCurrentCompFlgSet::AetherCurrentCompFlgSet( uint32_t row_i aetherCurrent.push_back( exdData->getField< int32_t >( row, 13 ) ); aetherCurrent.push_back( exdData->getField< int32_t >( row, 14 ) ); aetherCurrent.push_back( exdData->getField< int32_t >( row, 15 ) ); - aetherCurrent.push_back( exdData->getField< int32_t >( row, 16 ) ); } Sapphire::Data::AetherialWheel::AetherialWheel( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -323,6 +324,7 @@ Sapphire::Data::Aetheryte::Aetheryte( uint32_t row_id, Sapphire::Data::ExdDataGe map = exdData->getField< uint16_t >( row, 20 ); aetherstreamX = exdData->getField< int16_t >( row, 21 ); aetherstreamY = exdData->getField< int16_t >( row, 22 ); + order = exdData->getField< uint8_t >( row, 23 ); } Sapphire::Data::AetheryteSystemDefine::AetheryteSystemDefine( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -332,6 +334,11 @@ Sapphire::Data::AetheryteSystemDefine::AetheryteSystemDefine( uint32_t row_id, S defineValue = exdData->getField< uint32_t >( row, 1 ); } +Sapphire::Data::AetheryteTransient::AetheryteTransient( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_AetheryteTransientDat.get_row( row_id ); +} + Sapphire::Data::AirshipExplorationLevel::AirshipExplorationLevel( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_AirshipExplorationLevelDat.get_row( row_id ); @@ -371,13 +378,27 @@ Sapphire::Data::AirshipExplorationPoint::AirshipExplorationPoint( uint32_t row_i auto row = exdData->m_AirshipExplorationPointDat.get_row( row_id ); name = exdData->getField< std::string >( row, 0 ); nameShort = exdData->getField< std::string >( row, 1 ); - requiredLevel = exdData->getField< uint8_t >( row, 5 ); - requiredFuel = exdData->getField< uint16_t >( row, 6 ); - durationmin = exdData->getField< uint16_t >( row, 7 ); - requiredSurveillance = exdData->getField< uint8_t >( row, 10 ); + passengers = exdData->getField< bool >( row, 2 ); + x = exdData->getField< int16_t >( row, 3 ); + y = exdData->getField< int16_t >( row, 4 ); + rankReq = exdData->getField< uint8_t >( row, 5 ); + ceruleumTankReq = exdData->getField< uint16_t >( row, 6 ); + surveyDurationmin = exdData->getField< uint16_t >( row, 7 ); + surveyDistance = exdData->getField< uint16_t >( row, 8 ); + surveillanceReq = exdData->getField< uint8_t >( row, 10 ); expReward = exdData->getField< uint32_t >( row, 13 ); } +Sapphire::Data::AkatsukiNote::AkatsukiNote( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_AkatsukiNoteDat.get_row( row_id, subRow ); +} + +Sapphire::Data::AkatsukiNoteString::AkatsukiNoteString( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_AkatsukiNoteStringDat.get_row( row_id ); +} + Sapphire::Data::AnimationLOD::AnimationLOD( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_AnimationLODDat.get_row( row_id ); @@ -609,6 +630,11 @@ Sapphire::Data::AquariumWater::AquariumWater( uint32_t row_id, Sapphire::Data::E name = exdData->getField< std::string >( row, 1 ); } +Sapphire::Data::ArchiveItem::ArchiveItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ArchiveItemDat.get_row( row_id, subRow ); +} + Sapphire::Data::ArrayEventHandler::ArrayEventHandler( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ArrayEventHandlerDat.get_row( row_id ); @@ -636,6 +662,16 @@ Sapphire::Data::AttackType::AttackType( uint32_t row_id, Sapphire::Data::ExdData name = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::Attract::Attract( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_AttractDat.get_row( row_id ); + maxDistance = exdData->getField< uint16_t >( row, 0 ); + speed = exdData->getField< uint16_t >( row, 1 ); + minRemainingDistance = exdData->getField< int16_t >( row, 2 ); + useDistanceBetweenHitboxes = exdData->getField< bool >( row, 3 ); + direction = exdData->getField< uint8_t >( row, 4 ); +} + Sapphire::Data::BacklightColor::BacklightColor( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_BacklightColorDat.get_row( row_id ); @@ -663,6 +699,97 @@ Sapphire::Data::Balloon::Balloon( uint32_t row_id, Sapphire::Data::ExdDataGenera dialogue = exdData->getField< std::string >( row, 1 ); } +Sapphire::Data::BannerBg::BannerBg( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerBgDat.get_row( row_id ); + image = exdData->getField< int32_t >( row, 0 ); + icon = exdData->getField< int32_t >( row, 1 ); + unlockCondition = exdData->getField< uint16_t >( row, 2 ); + sortKey = exdData->getField< uint16_t >( row, 3 ); + name = exdData->getField< std::string >( row, 4 ); +} + +Sapphire::Data::BannerCondition::BannerCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerConditionDat.get_row( row_id ); + unlockType1 = exdData->getField< uint8_t >( row, 0 ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 1 ) ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 2 ) ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 3 ) ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 4 ) ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 5 ) ); + unlockCriteria1.push_back( exdData->getField< uint32_t >( row, 6 ) ); + unlockType2 = exdData->getField< uint8_t >( row, 7 ); + unlockCriteria2 = exdData->getField< uint32_t >( row, 8 ); + unlockCriteria3 = exdData->getField< uint32_t >( row, 9 ); + unlockCriteria4 = exdData->getField< uint32_t >( row, 10 ); + prerequisiteType = exdData->getField< uint8_t >( row, 11 ); + prerequisite = exdData->getField< uint32_t >( row, 12 ); + unlockHint = exdData->getField< uint8_t >( row, 13 ); +} + +Sapphire::Data::BannerDecoration::BannerDecoration( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerDecorationDat.get_row( row_id ); + image = exdData->getField< int32_t >( row, 0 ); + icon = exdData->getField< int32_t >( row, 1 ); + unlockCondition = exdData->getField< uint16_t >( row, 2 ); + sortKey = exdData->getField< uint16_t >( row, 3 ); + name = exdData->getField< std::string >( row, 4 ); +} + +Sapphire::Data::BannerDesignPreset::BannerDesignPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerDesignPresetDat.get_row( row_id ); + background = exdData->getField< uint16_t >( row, 0 ); + frame = exdData->getField< uint16_t >( row, 1 ); + decoration = exdData->getField< uint16_t >( row, 2 ); + sortKey = exdData->getField< uint16_t >( row, 3 ); + name = exdData->getField< std::string >( row, 4 ); +} + +Sapphire::Data::BannerFacial::BannerFacial( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerFacialDat.get_row( row_id ); + emote = exdData->getField< uint16_t >( row, 0 ); + unlockCondition = exdData->getField< uint16_t >( row, 1 ); + sortKey = exdData->getField< uint8_t >( row, 2 ); +} + +Sapphire::Data::BannerFrame::BannerFrame( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerFrameDat.get_row( row_id ); + image = exdData->getField< int32_t >( row, 0 ); + icon = exdData->getField< int32_t >( row, 1 ); + unlockCondition = exdData->getField< uint16_t >( row, 2 ); + sortKey = exdData->getField< uint16_t >( row, 3 ); + name = exdData->getField< std::string >( row, 4 ); +} + +Sapphire::Data::BannerObtainHintType::BannerObtainHintType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerObtainHintTypeDat.get_row( row_id ); + text = exdData->getField< std::string >( row, 0 ); +} + +Sapphire::Data::BannerPreset::BannerPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerPresetDat.get_row( row_id ); +} + +Sapphire::Data::BannerTimeline::BannerTimeline( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BannerTimelineDat.get_row( row_id ); + type = exdData->getField< uint8_t >( row, 0 ); + additionalData = exdData->getField< uint32_t >( row, 1 ); + acceptClassJobCategory = exdData->getField< uint8_t >( row, 2 ); + category = exdData->getField< uint8_t >( row, 3 ); + unlockCondition = exdData->getField< uint16_t >( row, 4 ); + sortKey = exdData->getField< uint16_t >( row, 5 ); + icon = exdData->getField< int32_t >( row, 6 ); + name = exdData->getField< std::string >( row, 7 ); +} + Sapphire::Data::BaseParam::BaseParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_BaseParamDat.get_row( row_id ); @@ -670,27 +797,26 @@ Sapphire::Data::BaseParam::BaseParam( uint32_t row_id, Sapphire::Data::ExdDataGe name = exdData->getField< std::string >( row, 1 ); description = exdData->getField< std::string >( row, 2 ); orderPriority = exdData->getField< uint8_t >( row, 3 ); - oneHWpn = exdData->getField< uint8_t >( row, 4 ); - oH = exdData->getField< uint8_t >( row, 5 ); - head = exdData->getField< uint8_t >( row, 6 ); - chest = exdData->getField< uint8_t >( row, 7 ); - hands = exdData->getField< uint8_t >( row, 8 ); - waist = exdData->getField< uint8_t >( row, 9 ); - legs = exdData->getField< uint8_t >( row, 10 ); - feet = exdData->getField< uint8_t >( row, 11 ); - earring = exdData->getField< uint8_t >( row, 12 ); - necklace = exdData->getField< uint8_t >( row, 13 ); - bracelet = exdData->getField< uint8_t >( row, 14 ); - ring = exdData->getField< uint8_t >( row, 15 ); - twoHWpn = exdData->getField< uint8_t >( row, 16 ); - underArmor = exdData->getField< uint8_t >( row, 17 ); - chestHead = exdData->getField< uint8_t >( row, 18 ); - chestHeadLegsFeet = exdData->getField< uint8_t >( row, 19 ); - legsFeet = exdData->getField< uint8_t >( row, 21 ); - headChestHandsLegsFeet = exdData->getField< uint8_t >( row, 22 ); - chestLegsGloves = exdData->getField< uint8_t >( row, 23 ); - chestLegsFeet = exdData->getField< uint8_t >( row, 24 ); - meldParam.push_back( exdData->getField< uint8_t >( row, 25 ) ); + oneHWpn = exdData->getField< uint16_t >( row, 4 ); + oH = exdData->getField< uint16_t >( row, 5 ); + head = exdData->getField< uint16_t >( row, 6 ); + chest = exdData->getField< uint16_t >( row, 7 ); + hands = exdData->getField< uint16_t >( row, 8 ); + waist = exdData->getField< uint16_t >( row, 9 ); + legs = exdData->getField< uint16_t >( row, 10 ); + feet = exdData->getField< uint16_t >( row, 11 ); + earring = exdData->getField< uint16_t >( row, 12 ); + necklace = exdData->getField< uint16_t >( row, 13 ); + bracelet = exdData->getField< uint16_t >( row, 14 ); + ring = exdData->getField< uint16_t >( row, 15 ); + twoHWpn = exdData->getField< uint16_t >( row, 16 ); + underArmor = exdData->getField< uint16_t >( row, 17 ); + chestHead = exdData->getField< uint16_t >( row, 18 ); + chestHeadLegsFeet = exdData->getField< uint16_t >( row, 19 ); + legsFeet = exdData->getField< uint16_t >( row, 21 ); + headChestHandsLegsFeet = exdData->getField< uint16_t >( row, 22 ); + chestLegsGloves = exdData->getField< uint16_t >( row, 23 ); + chestLegsFeet = exdData->getField< uint16_t >( row, 24 ); meldParam.push_back( exdData->getField< uint8_t >( row, 26 ) ); meldParam.push_back( exdData->getField< uint8_t >( row, 27 ) ); meldParam.push_back( exdData->getField< uint8_t >( row, 28 ) ); @@ -703,6 +829,7 @@ Sapphire::Data::BaseParam::BaseParam( uint32_t row_id, Sapphire::Data::ExdDataGe meldParam.push_back( exdData->getField< uint8_t >( row, 35 ) ); meldParam.push_back( exdData->getField< uint8_t >( row, 36 ) ); meldParam.push_back( exdData->getField< uint8_t >( row, 37 ) ); + meldParam.push_back( exdData->getField< uint8_t >( row, 38 ) ); } Sapphire::Data::BattleLeve::BattleLeve( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -853,7 +980,7 @@ Sapphire::Data::Behavior::Behavior( uint32_t row_id, uint32_t subRow, Sapphire:: auto row = exdData->m_BehaviorDat.get_row( row_id, subRow ); condition0Target = exdData->getField< uint8_t >( row, 2 ); condition0Type = exdData->getField< uint8_t >( row, 3 ); - balloon = exdData->getField< int32_t >( row, 4 ); + balloon = exdData->getField< uint16_t >( row, 8 ); condition1Target = exdData->getField< uint8_t >( row, 9 ); condition1Type = exdData->getField< uint8_t >( row, 10 ); contentArgument0 = exdData->getField< uint32_t >( row, 11 ); @@ -982,9 +1109,14 @@ Sapphire::Data::BNpcBase::BNpcBase( uint32_t row_id, Sapphire::Data::ExdDataGene special = exdData->getField< uint16_t >( row, 8 ); sEPack = exdData->getField< uint8_t >( row, 9 ); arrayEventHandler = exdData->getField< int32_t >( row, 11 ); - bNpcParts = exdData->getField< uint8_t >( row, 12 ); - isTargetLine = exdData->getField< bool >( row, 14 ); - isDisplayLevel = exdData->getField< bool >( row, 15 ); + bNpcParts = exdData->getField< uint8_t >( row, 13 ); + isTargetLine = exdData->getField< bool >( row, 16 ); + isDisplayLevel = exdData->getField< bool >( row, 17 ); +} + +Sapphire::Data::BNpcBasePopVfx::BNpcBasePopVfx( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BNpcBasePopVfxDat.get_row( row_id ); } Sapphire::Data::BNpcCustomize::BNpcCustomize( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -1081,6 +1213,11 @@ Sapphire::Data::BNpcState::BNpcState( uint32_t row_id, Sapphire::Data::ExdDataGe loopTimeline = exdData->getField< int32_t >( row, 13 ); } +Sapphire::Data::Booster::Booster( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_BoosterDat.get_row( row_id ); +} + Sapphire::Data::Buddy::Buddy( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_BuddyDat.get_row( row_id ); @@ -1250,6 +1387,65 @@ Sapphire::Data::Channeling::Channeling( uint32_t row_id, Sapphire::Data::ExdData widthScale = exdData->getField< uint8_t >( row, 1 ); } +Sapphire::Data::CharaCardBase::CharaCardBase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardBaseDat.get_row( row_id ); + image = exdData->getField< int32_t >( row, 0 ); + fontColor = exdData->getField< uint8_t >( row, 1 ); + unlockCondition = exdData->getField< uint16_t >( row, 5 ); + sortKey = exdData->getField< uint16_t >( row, 6 ); + name = exdData->getField< std::string >( row, 7 ); +} + +Sapphire::Data::CharaCardDecoration::CharaCardDecoration( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardDecorationDat.get_row( row_id ); + category = exdData->getField< uint8_t >( row, 0 ); + image = exdData->getField< int32_t >( row, 2 ); + unlockCondition = exdData->getField< uint16_t >( row, 4 ); + sortKey = exdData->getField< uint16_t >( row, 5 ); + name = exdData->getField< std::string >( row, 6 ); +} + +Sapphire::Data::CharaCardDesignPreset::CharaCardDesignPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardDesignPresetDat.get_row( row_id ); + basePlate = exdData->getField< uint16_t >( row, 0 ); + topBorder = exdData->getField< uint8_t >( row, 1 ); + bottomBorder = exdData->getField< uint8_t >( row, 2 ); + backing = exdData->getField< uint16_t >( row, 3 ); + patternOverlay = exdData->getField< uint16_t >( row, 4 ); + portraitFrame = exdData->getField< uint16_t >( row, 5 ); + plateFrame = exdData->getField< uint16_t >( row, 6 ); + accent = exdData->getField< uint16_t >( row, 7 ); + sortKey = exdData->getField< uint16_t >( row, 8 ); + name = exdData->getField< std::string >( row, 9 ); +} + +Sapphire::Data::CharaCardDesignType::CharaCardDesignType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardDesignTypeDat.get_row( row_id ); +} + +Sapphire::Data::CharaCardHeader::CharaCardHeader( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardHeaderDat.get_row( row_id ); + topImage = exdData->getField< int32_t >( row, 0 ); + bottomImage = exdData->getField< int32_t >( row, 1 ); + fontColor = exdData->getField< uint8_t >( row, 2 ); + unlockCondition = exdData->getField< uint16_t >( row, 6 ); + sortKey = exdData->getField< uint8_t >( row, 7 ); + name = exdData->getField< std::string >( row, 8 ); +} + +Sapphire::Data::CharaCardPlayStyle::CharaCardPlayStyle( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_CharaCardPlayStyleDat.get_row( row_id ); + icon = exdData->getField< int32_t >( row, 0 ); + sortKey = exdData->getField< uint8_t >( row, 1 ); + name = exdData->getField< std::string >( row, 2 ); +} + Sapphire::Data::CharaMakeClassEquip::CharaMakeClassEquip( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_CharaMakeClassEquipDat.get_row( row_id ); @@ -1318,9 +1514,9 @@ Sapphire::Data::CharaMakeName::CharaMakeName( uint32_t row_id, Sapphire::Data::E hrothgarHellionsLastName = exdData->getField< std::string >( row, 38 ); hrothgarLostFirstName = exdData->getField< std::string >( row, 39 ); hrothgarLostLastName = exdData->getField< std::string >( row, 40 ); - vieraFirstName = exdData->getField< std::string >( row, 41 ); - vieraRavaLastName = exdData->getField< std::string >( row, 42 ); - vieraVeenaLastName = exdData->getField< std::string >( row, 43 ); + vieraFirstName = exdData->getField< std::string >( row, 44 ); + vieraRavaLastName = exdData->getField< std::string >( row, 45 ); + vieraVeenaLastName = exdData->getField< std::string >( row, 46 ); } Sapphire::Data::CharaMakeType::CharaMakeType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -1679,8 +1875,13 @@ Sapphire::Data::ClassJob::ClassJob( uint32_t row_id, Sapphire::Data::ExdDataGene prerequisite = exdData->getField< uint32_t >( row, 41 ); startingLevel = exdData->getField< uint8_t >( row, 42 ); partyBonus = exdData->getField< uint8_t >( row, 43 ); - isLimitedJob = exdData->getField< bool >( row, 44 ); - canQueueForDuty = exdData->getField< bool >( row, 45 ); + isLimitedJob = exdData->getField< bool >( row, 45 ); + canQueueForDuty = exdData->getField< bool >( row, 46 ); +} + +Sapphire::Data::ClassJobActionSort::ClassJobActionSort( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ClassJobActionSortDat.get_row( row_id ); } Sapphire::Data::ClassJobCategory::ClassJobCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -1726,6 +1927,8 @@ Sapphire::Data::ClassJobCategory::ClassJobCategory( uint32_t row_id, Sapphire::D bLU = exdData->getField< bool >( row, 37 ); gNB = exdData->getField< bool >( row, 38 ); dNC = exdData->getField< bool >( row, 39 ); + rPR = exdData->getField< bool >( row, 40 ); + sGE = exdData->getField< bool >( row, 41 ); } Sapphire::Data::CollectablesShop::CollectablesShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -1815,15 +2018,12 @@ Sapphire::Data::Companion::Companion( uint32_t row_id, Sapphire::Data::ExdDataGe special = exdData->getField< uint8_t >( row, 15 ); wanderingWait = exdData->getField< uint8_t >( row, 16 ); priority = exdData->getField< uint16_t >( row, 17 ); - roulette = exdData->getField< bool >( row, 18 ); - battle = exdData->getField< bool >( row, 20 ); - lookAt = exdData->getField< bool >( row, 21 ); - poke = exdData->getField< bool >( row, 22 ); enemy = exdData->getField< uint16_t >( row, 23 ); - stroke = exdData->getField< bool >( row, 24 ); - clapping = exdData->getField< bool >( row, 25 ); + battle = exdData->getField< bool >( row, 24 ); + roulette = exdData->getField< bool >( row, 25 ); icon = exdData->getField< uint16_t >( row, 26 ); order = exdData->getField< uint16_t >( row, 27 ); + idleAnimation = exdData->getField< bool >( row, 28 ); cost = exdData->getField< uint8_t >( row, 30 ); hP = exdData->getField< uint16_t >( row, 31 ); skillAngle = exdData->getField< uint16_t >( row, 33 ); @@ -2085,6 +2285,11 @@ Sapphire::Data::ContentCloseCycle::ContentCloseCycle( uint32_t row_id, Sapphire: timeSeconds = exdData->getField< uint32_t >( row, 1 ); } +Sapphire::Data::ContentEventItem::ContentEventItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ContentEventItemDat.get_row( row_id, subRow ); +} + Sapphire::Data::ContentExAction::ContentExAction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ContentExActionDat.get_row( row_id ); @@ -2103,35 +2308,35 @@ Sapphire::Data::ContentFinderCondition::ContentFinderCondition( uint32_t row_id, acceptClassJobCategory = exdData->getField< uint8_t >( row, 8 ); contentMemberType = exdData->getField< uint8_t >( row, 9 ); unlockQuest = exdData->getField< uint32_t >( row, 13 ); - classJobLevelRequired = exdData->getField< uint8_t >( row, 15 ); - classJobLevelSync = exdData->getField< uint8_t >( row, 16 ); - itemLevelRequired = exdData->getField< uint16_t >( row, 17 ); - itemLevelSync = exdData->getField< uint16_t >( row, 18 ); - allowUndersized = exdData->getField< bool >( row, 20 ); - allowReplacement = exdData->getField< bool >( row, 21 ); - allowExplorerMode = exdData->getField< bool >( row, 23 ); - highEndDuty = exdData->getField< bool >( row, 28 ); - dutyRecorderAllowed = exdData->getField< bool >( row, 32 ); - name = exdData->getField< std::string >( row, 37 ); - nameShort = exdData->getField< std::string >( row, 38 ); - contentType = exdData->getField< uint8_t >( row, 39 ); - transientKey = exdData->getField< uint8_t >( row, 40 ); - transient = exdData->getField< uint32_t >( row, 41 ); - sortKey = exdData->getField< uint16_t >( row, 42 ); - image = exdData->getField< uint32_t >( row, 43 ); - icon = exdData->getField< uint32_t >( row, 44 ); - level506070Roulette = exdData->getField< bool >( row, 46 ); - levelingRoulette = exdData->getField< bool >( row, 47 ); - mSQRoulette = exdData->getField< bool >( row, 48 ); - guildHestRoulette = exdData->getField< bool >( row, 49 ); - expertRoulette = exdData->getField< bool >( row, 50 ); - trialRoulette = exdData->getField< bool >( row, 51 ); - dailyFrontlineChallenge = exdData->getField< bool >( row, 52 ); - level80Roulette = exdData->getField< bool >( row, 53 ); - mentorRoulette = exdData->getField< bool >( row, 54 ); - allianceRoulette = exdData->getField< bool >( row, 60 ); - feastTeamRoulette = exdData->getField< bool >( row, 61 ); - normalRaidRoulette = exdData->getField< bool >( row, 62 ); + classJobLevelRequired = exdData->getField< uint8_t >( row, 16 ); + classJobLevelSync = exdData->getField< uint8_t >( row, 17 ); + itemLevelRequired = exdData->getField< uint16_t >( row, 18 ); + itemLevelSync = exdData->getField< uint16_t >( row, 19 ); + allowUndersized = exdData->getField< bool >( row, 21 ); + allowReplacement = exdData->getField< bool >( row, 23 ); + allowExplorerMode = exdData->getField< bool >( row, 25 ); + highEndDuty = exdData->getField< bool >( row, 31 ); + dutyRecorderAllowed = exdData->getField< bool >( row, 36 ); + name = exdData->getField< std::string >( row, 41 ); + nameShort = exdData->getField< std::string >( row, 42 ); + contentType = exdData->getField< uint8_t >( row, 43 ); + transientKey = exdData->getField< uint8_t >( row, 44 ); + transient = exdData->getField< uint32_t >( row, 45 ); + sortKey = exdData->getField< uint16_t >( row, 46 ); + image = exdData->getField< uint32_t >( row, 47 ); + icon = exdData->getField< uint32_t >( row, 48 ); + levelingRoulette = exdData->getField< bool >( row, 53 ); + highLevelRoulette = exdData->getField< bool >( row, 54 ); + mSQRoulette = exdData->getField< bool >( row, 55 ); + guildHestRoulette = exdData->getField< bool >( row, 56 ); + expertRoulette = exdData->getField< bool >( row, 57 ); + trialRoulette = exdData->getField< bool >( row, 58 ); + dailyFrontlineChallenge = exdData->getField< bool >( row, 59 ); + levelCapRoulette = exdData->getField< bool >( row, 60 ); + mentorRoulette = exdData->getField< bool >( row, 61 ); + allianceRoulette = exdData->getField< bool >( row, 67 ); + feastTeamRoulette = exdData->getField< bool >( row, 68 ); + normalRaidRoulette = exdData->getField< bool >( row, 69 ); } Sapphire::Data::ContentFinderConditionTransient::ContentFinderConditionTransient( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2143,9 +2348,9 @@ Sapphire::Data::ContentFinderConditionTransient::ContentFinderConditionTransient Sapphire::Data::ContentGauge::ContentGauge( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ContentGaugeDat.get_row( row_id ); - name = exdData->getField< std::string >( row, 0 ); - color = exdData->getField< uint8_t >( row, 1 ); - textString = exdData->getField< std::string >( row, 3 ); + name = exdData->getField< std::string >( row, 1 ); + color = exdData->getField< uint8_t >( row, 2 ); + textString = exdData->getField< std::string >( row, 4 ); } Sapphire::Data::ContentGaugeColor::ContentGaugeColor( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2192,8 +2397,10 @@ Sapphire::Data::ContentRoulette::ContentRoulette( uint32_t row_id, Sapphire::Dat category = exdData->getField< std::string >( row, 1 ); description = exdData->getField< std::string >( row, 3 ); dutyType = exdData->getField< std::string >( row, 4 ); + isGoldSaucer = exdData->getField< bool >( row, 7 ); isInDutyFinder = exdData->getField< bool >( row, 8 ); openRule = exdData->getField< uint8_t >( row, 9 ); + isPvP = exdData->getField< bool >( row, 10 ); requiredLevel = exdData->getField< uint8_t >( row, 11 ); itemLevelRequired = exdData->getField< uint16_t >( row, 13 ); icon = exdData->getField< uint32_t >( row, 15 ); @@ -2203,9 +2410,9 @@ Sapphire::Data::ContentRoulette::ContentRoulette( uint32_t row_id, Sapphire::Dat rewardTomeC = exdData->getField< uint16_t >( row, 19 ); sortKey = exdData->getField< uint8_t >( row, 22 ); contentMemberType = exdData->getField< uint8_t >( row, 24 ); - requireAllDuties = exdData->getField< bool >( row, 34 ); - contentRouletteOpenRule = exdData->getField< uint8_t >( row, 36 ); - instanceContent = exdData->getField< uint16_t >( row, 37 ); + requireAllDuties = exdData->getField< bool >( row, 35 ); + contentRouletteOpenRule = exdData->getField< uint8_t >( row, 37 ); + instanceContent = exdData->getField< uint16_t >( row, 38 ); } Sapphire::Data::ContentRouletteOpenRule::ContentRouletteOpenRule( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2320,8 +2527,6 @@ Sapphire::Data::CraftLevelDifference::CraftLevelDifference( uint32_t row_id, Sap { auto row = exdData->m_CraftLevelDifferenceDat.get_row( row_id ); difference = exdData->getField< int16_t >( row, 0 ); - progressFactor = exdData->getField< int16_t >( row, 1 ); - qualityFactor = exdData->getField< int16_t >( row, 2 ); } Sapphire::Data::CraftLeveTalk::CraftLeveTalk( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2519,50 +2724,47 @@ Sapphire::Data::DawnContent::DawnContent( uint32_t row_id, Sapphire::Data::ExdDa { auto row = exdData->m_DawnContentDat.get_row( row_id ); content = exdData->getField< uint32_t >( row, 0 ); - exp = exdData->getField< uint32_t >( row, 1 ); + expBelowExMaxLvl = exdData->getField< uint32_t >( row, 4 ); + expAboveExMaxLvl = exdData->getField< uint32_t >( row, 5 ); +} + +Sapphire::Data::DawnContentParticipable::DawnContentParticipable( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_DawnContentParticipableDat.get_row( row_id, subRow ); } Sapphire::Data::DawnGrowMember::DawnGrowMember( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_DawnGrowMemberDat.get_row( row_id ); - member = exdData->getField< uint32_t >( row, 0 ); - imageName = exdData->getField< uint32_t >( row, 1 ); - bigImageOld = exdData->getField< uint32_t >( row, 2 ); - bigImageNew = exdData->getField< uint32_t >( row, 3 ); - smallImageOld = exdData->getField< uint32_t >( row, 4 ); - smallImageNew = exdData->getField< uint32_t >( row, 5 ); + selectImage.push_back( exdData->getField< uint32_t >( row, 0 ) ); + selectImage.push_back( exdData->getField< uint32_t >( row, 1 ) ); + selectImage.push_back( exdData->getField< uint32_t >( row, 2 ) ); + portraitImage.push_back( exdData->getField< uint32_t >( row, 3 ) ); + portraitImage.push_back( exdData->getField< uint32_t >( row, 4 ) ); + portraitImage.push_back( exdData->getField< uint32_t >( row, 5 ) ); _class = exdData->getField< uint8_t >( row, 6 ); } +Sapphire::Data::DawnMember::DawnMember( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_DawnMemberDat.get_row( row_id ); +} + Sapphire::Data::DawnMemberUIParam::DawnMemberUIParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_DawnMemberUIParamDat.get_row( row_id ); classSingular = exdData->getField< std::string >( row, 0 ); - voiceLine = exdData->getField< uint32_t >( row, 1 ); - classPlural = exdData->getField< std::string >( row, 2 ); -} - -Sapphire::Data::DawnQuestAnnounce::DawnQuestAnnounce( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) -{ - auto row = exdData->m_DawnQuestAnnounceDat.get_row( row_id ); - quest = exdData->getField< uint32_t >( row, 0 ); - content = exdData->getField< uint8_t >( row, 1 ); - eNPC.push_back( exdData->getField< uint32_t >( row, 2 ) ); - eNPC.push_back( exdData->getField< uint32_t >( row, 3 ) ); - eNPC.push_back( exdData->getField< uint32_t >( row, 4 ) ); - eNPC.push_back( exdData->getField< uint32_t >( row, 5 ) ); - eNPC.push_back( exdData->getField< uint32_t >( row, 6 ) ); - eNPC.push_back( exdData->getField< uint32_t >( row, 7 ) ); + voiceLine = exdData->getField< uint32_t >( row, 2 ); + classPlural = exdData->getField< std::string >( row, 3 ); } Sapphire::Data::DawnQuestMember::DawnQuestMember( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_DawnQuestMemberDat.get_row( row_id ); - member = exdData->getField< uint32_t >( row, 0 ); - imageName = exdData->getField< uint32_t >( row, 1 ); - bigImageOld = exdData->getField< uint32_t >( row, 2 ); - bigImageNew = exdData->getField< uint32_t >( row, 3 ); - _class = exdData->getField< uint8_t >( row, 4 ); + member = exdData->getField< uint32_t >( row, 2 ); + bigImageOld = exdData->getField< uint32_t >( row, 3 ); + bigImageNew = exdData->getField< uint32_t >( row, 4 ); + _class = exdData->getField< uint8_t >( row, 5 ); } Sapphire::Data::DeepDungeon::DeepDungeon( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2590,8 +2792,9 @@ Sapphire::Data::DeepDungeon::DeepDungeon( uint32_t row_id, Sapphire::Data::ExdDa magiciteSlot.push_back( exdData->getField< uint8_t >( row, 19 ) ); magiciteSlot.push_back( exdData->getField< uint8_t >( row, 20 ) ); magiciteSlot.push_back( exdData->getField< uint8_t >( row, 21 ) ); - name = exdData->getField< std::string >( row, 22 ); - contentFinderConditionStart = exdData->getField< uint16_t >( row, 23 ); + magiciteSlot.push_back( exdData->getField< uint8_t >( row, 22 ) ); + name = exdData->getField< std::string >( row, 23 ); + contentFinderConditionStart = exdData->getField< uint16_t >( row, 24 ); } Sapphire::Data::DeepDungeonBan::DeepDungeonBan( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2610,6 +2813,11 @@ Sapphire::Data::DeepDungeonDanger::DeepDungeonDanger( uint32_t row_id, Sapphire: name = exdData->getField< uint16_t >( row, 2 ); } +Sapphire::Data::DeepDungeonDemiclone::DeepDungeonDemiclone( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_DeepDungeonDemicloneDat.get_row( row_id ); +} + Sapphire::Data::DeepDungeonEquipment::DeepDungeonEquipment( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_DeepDungeonEquipmentDat.get_row( row_id ); @@ -2730,11 +2938,11 @@ Sapphire::Data::DeliveryQuest::DeliveryQuest( uint32_t row_id, Sapphire::Data::E Sapphire::Data::Description::Description( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_DescriptionDat.get_row( row_id ); - quest = exdData->getField< uint32_t >( row, 0 ); - textLong = exdData->getField< std::string >( row, 1 ); - textShort = exdData->getField< std::string >( row, 2 ); - textCommentary = exdData->getField< std::string >( row, 3 ); - section = exdData->getField< uint32_t >( row, 5 ); + quest = exdData->getField< uint32_t >( row, 1 ); + textLong = exdData->getField< std::string >( row, 2 ); + textShort = exdData->getField< std::string >( row, 3 ); + textCommentary = exdData->getField< std::string >( row, 4 ); + section = exdData->getField< uint32_t >( row, 6 ); } Sapphire::Data::DescriptionPage::DescriptionPage( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2780,11 +2988,11 @@ Sapphire::Data::DpsChallenge::DpsChallenge( uint32_t row_id, Sapphire::Data::Exd { auto row = exdData->m_DpsChallengeDat.get_row( row_id ); playerLevel = exdData->getField< uint16_t >( row, 0 ); - placeName = exdData->getField< uint16_t >( row, 1 ); - icon = exdData->getField< uint32_t >( row, 2 ); - order = exdData->getField< uint16_t >( row, 3 ); - name = exdData->getField< std::string >( row, 4 ); - description = exdData->getField< std::string >( row, 5 ); + placeName = exdData->getField< uint16_t >( row, 3 ); + icon = exdData->getField< uint32_t >( row, 4 ); + order = exdData->getField< uint16_t >( row, 5 ); + name = exdData->getField< std::string >( row, 6 ); + description = exdData->getField< std::string >( row, 7 ); } Sapphire::Data::DpsChallengeOfficer::DpsChallengeOfficer( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -2886,12 +3094,12 @@ Sapphire::Data::Emote::Emote( uint32_t row_id, Sapphire::Data::ExdDataGenerated* emoteMode = exdData->getField< uint8_t >( row, 12 ); hasCancelEmote = exdData->getField< bool >( row, 15 ); drawsWeapon = exdData->getField< bool >( row, 16 ); - order = exdData->getField< uint16_t >( row, 17 ); - textCommand = exdData->getField< int32_t >( row, 18 ); - icon = exdData->getField< uint16_t >( row, 19 ); - logMessageTargeted = exdData->getField< uint16_t >( row, 20 ); - logMessageUntargeted = exdData->getField< uint16_t >( row, 21 ); - unlockLink = exdData->getField< uint32_t >( row, 22 ); + order = exdData->getField< uint16_t >( row, 18 ); + textCommand = exdData->getField< int32_t >( row, 19 ); + icon = exdData->getField< uint16_t >( row, 20 ); + logMessageTargeted = exdData->getField< uint16_t >( row, 21 ); + logMessageUntargeted = exdData->getField< uint16_t >( row, 22 ); + unlockLink = exdData->getField< uint32_t >( row, 23 ); } Sapphire::Data::EmoteCategory::EmoteCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3305,6 +3513,11 @@ Sapphire::Data::EventItemTimeline::EventItemTimeline( uint32_t row_id, Sapphire: actionTimeline = exdData->getField< uint32_t >( row, 0 ); } +Sapphire::Data::EventPathMove::EventPathMove( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_EventPathMoveDat.get_row( row_id ); +} + Sapphire::Data::EventSystemDefine::EventSystemDefine( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_EventSystemDefineDat.get_row( row_id ); @@ -3317,7 +3530,9 @@ Sapphire::Data::ExportedGatheringPoint::ExportedGatheringPoint( uint32_t row_id, auto row = exdData->m_ExportedGatheringPointDat.get_row( row_id ); x = exdData->getField< float >( row, 0 ); y = exdData->getField< float >( row, 1 ); - radius = exdData->getField< uint8_t >( row, 2 ); + gatheringType = exdData->getField< uint8_t >( row, 2 ); + gatheringPointType = exdData->getField< uint8_t >( row, 3 ); + radius = exdData->getField< uint16_t >( row, 4 ); } Sapphire::Data::ExportedSG::ExportedSG( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3326,6 +3541,15 @@ Sapphire::Data::ExportedSG::ExportedSG( uint32_t row_id, Sapphire::Data::ExdData sgbPath = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::ExtraCommand::ExtraCommand( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ExtraCommandDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); + description = exdData->getField< std::string >( row, 1 ); + icon = exdData->getField< int32_t >( row, 2 ); + order = exdData->getField< int8_t >( row, 3 ); +} + Sapphire::Data::ExVersion::ExVersion( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ExVersionDat.get_row( row_id ); @@ -3334,6 +3558,18 @@ Sapphire::Data::ExVersion::ExVersion( uint32_t row_id, Sapphire::Data::ExdDataGe completeJingle = exdData->getField< uint16_t >( row, 2 ); } +Sapphire::Data::FashionCheckThemeCategory::FashionCheckThemeCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FashionCheckThemeCategoryDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); +} + +Sapphire::Data::FashionCheckWeeklyTheme::FashionCheckWeeklyTheme( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FashionCheckWeeklyThemeDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); +} + Sapphire::Data::Fate::Fate( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_FateDat.get_row( row_id ); @@ -3370,14 +3606,14 @@ Sapphire::Data::Fate::Fate( uint32_t row_id, Sapphire::Data::ExdDataGenerated* e arrayIndex = exdData->getField< uint32_t >( row, 36 ); reqEventItem = exdData->getField< uint32_t >( row, 38 ); turnInEventItem = exdData->getField< uint32_t >( row, 39 ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 43 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 44 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 45 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 46 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 47 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 48 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 49 ) ); - objectiveIcon.push_back( exdData->getField< uint16_t >( row, 50 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 43 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 44 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 45 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 46 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 47 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 48 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 49 ) ); + objectiveIcon.push_back( exdData->getField< uint32_t >( row, 50 ) ); } Sapphire::Data::FateEvent::FateEvent( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3465,7 +3701,22 @@ Sapphire::Data::FateProgressUI::FateProgressUI( uint32_t row_id, Sapphire::Data: achievement = exdData->getField< int32_t >( row, 1 ); reqFatesToRank2 = exdData->getField< uint8_t >( row, 2 ); reqFatesToRank3 = exdData->getField< uint8_t >( row, 3 ); - displayOrder = exdData->getField< uint8_t >( row, 4 ); + displayOrder = exdData->getField< uint8_t >( row, 5 ); +} + +Sapphire::Data::FateShop::FateShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FateShopDat.get_row( row_id ); + specialShop.push_back( exdData->getField< uint32_t >( row, 0 ) ); + specialShop.push_back( exdData->getField< uint32_t >( row, 1 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 2 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 3 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 4 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 5 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 6 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 7 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 8 ) ); + defaultTalk.push_back( exdData->getField< uint32_t >( row, 9 ) ); } Sapphire::Data::FateTokenType::FateTokenType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3545,6 +3796,7 @@ Sapphire::Data::FCRank::FCRank( uint32_t row_id, Sapphire::Data::ExdDataGenerate rights = exdData->getField< uint16_t >( row, 2 ); fCActionActiveNum = exdData->getField< uint8_t >( row, 5 ); fCActionStockNum = exdData->getField< uint8_t >( row, 6 ); + fCChestCompartments = exdData->getField< uint8_t >( row, 7 ); } Sapphire::Data::FCReputation::FCReputation( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3581,6 +3833,11 @@ Sapphire::Data::FieldMarker::FieldMarker( uint32_t row_id, Sapphire::Data::ExdDa name = exdData->getField< std::string >( row, 3 ); } +Sapphire::Data::FishingBaitParameter::FishingBaitParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FishingBaitParameterDat.get_row( row_id ); +} + Sapphire::Data::FishingRecordType::FishingRecordType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_FishingRecordTypeDat.get_row( row_id ); @@ -3589,6 +3846,8 @@ Sapphire::Data::FishingRecordType::FishingRecordType( uint32_t row_id, Sapphire: rankARequirement = exdData->getField< uint16_t >( row, 2 ); rankAARequirement = exdData->getField< uint16_t >( row, 3 ); rankAAARequirement = exdData->getField< uint16_t >( row, 4 ); + rankSRequirement = exdData->getField< uint16_t >( row, 5 ); + isSpearfishing = exdData->getField< uint8_t >( row, 6 ); } Sapphire::Data::FishingRecordTypeTransient::FishingRecordTypeTransient( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3622,7 +3881,7 @@ Sapphire::Data::FishingSpot::FishingSpot( uint32_t row_id, Sapphire::Data::ExdDa item.push_back( exdData->getField< int32_t >( row, 20 ) ); item.push_back( exdData->getField< int32_t >( row, 21 ) ); placeName = exdData->getField< uint16_t >( row, 22 ); - order = exdData->getField< uint8_t >( row, 23 ); + order = exdData->getField< uint16_t >( row, 23 ); } Sapphire::Data::FishParameter::FishParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3633,11 +3892,31 @@ Sapphire::Data::FishParameter::FishParameter( uint32_t row_id, Sapphire::Data::E gatheringItemLevel = exdData->getField< uint16_t >( row, 2 ); isHidden = exdData->getField< bool >( row, 4 ); fishingRecordType = exdData->getField< uint8_t >( row, 6 ); - territoryType = exdData->getField< int32_t >( row, 7 ); - gatheringSubCategory = exdData->getField< uint16_t >( row, 8 ); - isInLog = exdData->getField< bool >( row, 9 ); - timeRestricted = exdData->getField< bool >( row, 10 ); - weatherRestricted = exdData->getField< bool >( row, 11 ); + fishingSpot = exdData->getField< uint16_t >( row, 8 ); + gatheringSubCategory = exdData->getField< uint16_t >( row, 9 ); + isInLog = exdData->getField< bool >( row, 10 ); + timeRestricted = exdData->getField< bool >( row, 11 ); + weatherRestricted = exdData->getField< bool >( row, 12 ); +} + +Sapphire::Data::FittingShop::FittingShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FittingShopDat.get_row( row_id ); +} + +Sapphire::Data::FittingShopCategory::FittingShopCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FittingShopCategoryDat.get_row( row_id ); +} + +Sapphire::Data::FittingShopCategoryItem::FittingShopCategoryItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FittingShopCategoryItemDat.get_row( row_id, subRow ); +} + +Sapphire::Data::FittingShopItemSet::FittingShopItemSet( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_FittingShopItemSetDat.get_row( row_id ); } Sapphire::Data::Frontline03::Frontline03( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3679,6 +3958,11 @@ Sapphire::Data::FurnitureCatalogItemList::FurnitureCatalogItemList( uint32_t row patch = exdData->getField< uint16_t >( row, 2 ); } +Sapphire::Data::GameRewardObtainType::GameRewardObtainType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_GameRewardObtainTypeDat.get_row( row_id ); +} + Sapphire::Data::GardeningSeed::GardeningSeed( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_GardeningSeedDat.get_row( row_id ); @@ -3688,6 +3972,16 @@ Sapphire::Data::GardeningSeed::GardeningSeed( uint32_t row_id, Sapphire::Data::E sE = exdData->getField< bool >( row, 3 ); } +Sapphire::Data::GathererCrafterTool::GathererCrafterTool( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_GathererCrafterToolDat.get_row( row_id ); +} + +Sapphire::Data::GathererReductionReward::GathererReductionReward( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_GathererReductionRewardDat.get_row( row_id, subRow ); +} + Sapphire::Data::GatheringCondition::GatheringCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_GatheringConditionDat.get_row( row_id ); @@ -3705,7 +3999,8 @@ Sapphire::Data::GatheringItem::GatheringItem( uint32_t row_id, Sapphire::Data::E auto row = exdData->m_GatheringItemDat.get_row( row_id ); item = exdData->getField< int32_t >( row, 0 ); gatheringItemLevel = exdData->getField< uint16_t >( row, 1 ); - isHidden = exdData->getField< bool >( row, 4 ); + quest = exdData->getField< uint16_t >( row, 3 ); + isHidden = exdData->getField< bool >( row, 5 ); } Sapphire::Data::GatheringItemLevelConvertTable::GatheringItemLevelConvertTable( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3865,13 +4160,13 @@ Sapphire::Data::GatheringPoint::GatheringPoint( uint32_t row_id, Sapphire::Data: { auto row = exdData->m_GatheringPointDat.get_row( row_id ); type = exdData->getField< uint8_t >( row, 0 ); - gatheringPointBase = exdData->getField< int32_t >( row, 1 ); - count = exdData->getField< uint8_t >( row, 2 ); - gatheringPointBonus.push_back( exdData->getField< uint16_t >( row, 3 ) ); + gatheringPointBase = exdData->getField< int32_t >( row, 2 ); + count = exdData->getField< uint8_t >( row, 3 ); gatheringPointBonus.push_back( exdData->getField< uint16_t >( row, 4 ) ); - territoryType = exdData->getField< uint16_t >( row, 5 ); - placeName = exdData->getField< uint16_t >( row, 6 ); - gatheringSubCategory = exdData->getField< uint16_t >( row, 7 ); + gatheringPointBonus.push_back( exdData->getField< uint16_t >( row, 5 ) ); + territoryType = exdData->getField< uint16_t >( row, 6 ); + placeName = exdData->getField< uint16_t >( row, 7 ); + gatheringSubCategory = exdData->getField< uint16_t >( row, 8 ); } Sapphire::Data::GatheringPointBase::GatheringPointBase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3887,7 +4182,6 @@ Sapphire::Data::GatheringPointBase::GatheringPointBase( uint32_t row_id, Sapphir item.push_back( exdData->getField< int32_t >( row, 7 ) ); item.push_back( exdData->getField< int32_t >( row, 8 ) ); item.push_back( exdData->getField< int32_t >( row, 9 ) ); - isLimited = exdData->getField< bool >( row, 10 ); } Sapphire::Data::GatheringPointBonus::GatheringPointBonus( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -3935,6 +4229,7 @@ Sapphire::Data::GatheringSubCategory::GatheringSubCategory( uint32_t row_id, Sap auto row = exdData->m_GatheringSubCategoryDat.get_row( row_id ); gatheringType = exdData->getField< uint8_t >( row, 0 ); classJob = exdData->getField< uint8_t >( row, 1 ); + quest = exdData->getField< uint32_t >( row, 2 ); division = exdData->getField< uint16_t >( row, 3 ); item = exdData->getField< int32_t >( row, 4 ); folkloreBook = exdData->getField< std::string >( row, 5 ); @@ -4393,7 +4688,21 @@ Sapphire::Data::GeneralAction::GeneralAction( uint32_t row_id, Sapphire::Data::E Sapphire::Data::GFATE::GFATE( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_GFATEDat.get_row( row_id ); - icon.push_back( exdData->getField< uint32_t >( row, 22 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 7 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 8 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 9 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 10 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 11 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 12 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 13 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 14 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 15 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 16 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 17 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 18 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 19 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 20 ) ); + lGBPopRange.push_back( exdData->getField< uint32_t >( row, 21 ) ); icon.push_back( exdData->getField< uint32_t >( row, 23 ) ); icon.push_back( exdData->getField< uint32_t >( row, 24 ) ); icon.push_back( exdData->getField< uint32_t >( row, 25 ) ); @@ -4535,7 +4844,7 @@ Sapphire::Data::GroupPoseStamp::GroupPoseStamp( uint32_t row_id, Sapphire::Data: auto row = exdData->m_GroupPoseStampDat.get_row( row_id ); stampIcon = exdData->getField< int32_t >( row, 0 ); category = exdData->getField< int32_t >( row, 2 ); - name = exdData->getField< std::string >( row, 8 ); + name = exdData->getField< std::string >( row, 10 ); } Sapphire::Data::GroupPoseStampCategory::GroupPoseStampCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -4957,7 +5266,7 @@ Sapphire::Data::HousingUnitedExterior::HousingUnitedExterior( uint32_t row_id, S Sapphire::Data::HousingYardObject::HousingYardObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_HousingYardObjectDat.get_row( row_id ); - modelKey = exdData->getField< uint8_t >( row, 0 ); + modelKey = exdData->getField< uint16_t >( row, 0 ); housingItemCategory = exdData->getField< uint8_t >( row, 1 ); usageType = exdData->getField< uint8_t >( row, 2 ); usageParameter = exdData->getField< uint32_t >( row, 3 ); @@ -5016,23 +5325,23 @@ Sapphire::Data::HugeCraftworksNpc::HugeCraftworksNpc( uint32_t row_id, Sapphire: qtyRequested.push_back( exdData->getField< uint8_t >( row, 10 ) ); qtyRequested.push_back( exdData->getField< uint8_t >( row, 11 ) ); qtyRequested.push_back( exdData->getField< uint8_t >( row, 12 ) ); - itemReward.push_back( exdData->getField< uint32_t >( row, 52 ) ); - itemReward.push_back( exdData->getField< uint32_t >( row, 53 ) ); - itemReward.push_back( exdData->getField< uint32_t >( row, 54 ) ); - itemReward.push_back( exdData->getField< uint32_t >( row, 55 ) ); - qtyItemReward.push_back( exdData->getField< uint8_t >( row, 64 ) ); - qtyItemReward.push_back( exdData->getField< uint8_t >( row, 65 ) ); - qtyItemReward.push_back( exdData->getField< uint8_t >( row, 66 ) ); - qtyItemReward.push_back( exdData->getField< uint8_t >( row, 67 ) ); - itemUnkown.push_back( exdData->getField< uint32_t >( row, 70 ) ); - itemUnkown.push_back( exdData->getField< uint32_t >( row, 71 ) ); - itemUnkown.push_back( exdData->getField< uint32_t >( row, 72 ) ); - itemUnkown.push_back( exdData->getField< uint32_t >( row, 73 ) ); - qtyItemUnkown.push_back( exdData->getField< uint8_t >( row, 82 ) ); - qtyItemUnkown.push_back( exdData->getField< uint8_t >( row, 83 ) ); - qtyItemUnkown.push_back( exdData->getField< uint8_t >( row, 84 ) ); - qtyItemUnkown.push_back( exdData->getField< uint8_t >( row, 85 ) ); - transient = exdData->getField< std::string >( row, 86 ); + itemReward.push_back( exdData->getField< uint8_t >( row, 52 ) ); + itemReward.push_back( exdData->getField< uint8_t >( row, 53 ) ); + itemReward.push_back( exdData->getField< uint8_t >( row, 54 ) ); + itemReward.push_back( exdData->getField< uint8_t >( row, 55 ) ); + qtyItemReward.push_back( exdData->getField< bool >( row, 64 ) ); + qtyItemReward.push_back( exdData->getField< bool >( row, 65 ) ); + qtyItemReward.push_back( exdData->getField< bool >( row, 66 ) ); + qtyItemReward.push_back( exdData->getField< bool >( row, 67 ) ); + itemUnkown.push_back( exdData->getField< uint8_t >( row, 70 ) ); + itemUnkown.push_back( exdData->getField< uint8_t >( row, 71 ) ); + itemUnkown.push_back( exdData->getField< uint8_t >( row, 72 ) ); + itemUnkown.push_back( exdData->getField< uint8_t >( row, 73 ) ); + qtyItemUnkown.push_back( exdData->getField< bool >( row, 82 ) ); + qtyItemUnkown.push_back( exdData->getField< bool >( row, 83 ) ); + qtyItemUnkown.push_back( exdData->getField< bool >( row, 84 ) ); + qtyItemUnkown.push_back( exdData->getField< bool >( row, 85 ) ); + transient = exdData->getField< uint8_t >( row, 86 ); } Sapphire::Data::HugeCraftworksRank::HugeCraftworksRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -5990,7 +6299,7 @@ Sapphire::Data::HWDLevelChangeDeception::HWDLevelChangeDeception( uint32_t row_i Sapphire::Data::HWDSharedGroup::HWDSharedGroup( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_HWDSharedGroupDat.get_row( row_id, subRow ); - lGB = exdData->getField< uint32_t >( row, 0 ); + lGBSharedGroup = exdData->getField< uint32_t >( row, 0 ); param = exdData->getField< uint8_t >( row, 1 ); } @@ -6000,6 +6309,11 @@ Sapphire::Data::HWDSharedGroupControlParam::HWDSharedGroupControlParam( uint32_t paramValue = exdData->getField< uint8_t >( row, 1 ); } +Sapphire::Data::IconLanguage::IconLanguage( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_IconLanguageDat.get_row( row_id ); +} + Sapphire::Data::IKDContentBonus::IKDContentBonus( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_IKDContentBonusDat.get_row( row_id ); @@ -6041,7 +6355,6 @@ Sapphire::Data::IKDSpot::IKDSpot( uint32_t row_id, Sapphire::Data::ExdDataGenera Sapphire::Data::InclusionShop::InclusionShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_InclusionShopDat.get_row( row_id ); - category.push_back( exdData->getField< uint16_t >( row, 2 ) ); category.push_back( exdData->getField< uint16_t >( row, 3 ) ); category.push_back( exdData->getField< uint16_t >( row, 4 ) ); category.push_back( exdData->getField< uint16_t >( row, 5 ) ); @@ -6071,6 +6384,7 @@ Sapphire::Data::InclusionShop::InclusionShop( uint32_t row_id, Sapphire::Data::E category.push_back( exdData->getField< uint16_t >( row, 29 ) ); category.push_back( exdData->getField< uint16_t >( row, 30 ) ); category.push_back( exdData->getField< uint16_t >( row, 31 ) ); + category.push_back( exdData->getField< uint16_t >( row, 32 ) ); } Sapphire::Data::InclusionShopCategory::InclusionShopCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6087,6 +6401,16 @@ Sapphire::Data::InclusionShopSeries::InclusionShopSeries( uint32_t row_id, uint3 specialShop = exdData->getField< uint32_t >( row, 0 ); } +Sapphire::Data::InclusionShopWelcom::InclusionShopWelcom( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_InclusionShopWelcomDat.get_row( row_id ); +} + +Sapphire::Data::InclusionShopWelcomText::InclusionShopWelcomText( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_InclusionShopWelcomTextDat.get_row( row_id ); +} + Sapphire::Data::IndividualWeather::IndividualWeather( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_IndividualWeatherDat.get_row( row_id ); @@ -6122,18 +6446,20 @@ Sapphire::Data::InstanceContent::InstanceContent( uint32_t row_id, Sapphire::Dat instanceContentTextDataObjectiveStart = exdData->getField< uint32_t >( row, 14 ); instanceContentTextDataObjectiveEnd = exdData->getField< uint32_t >( row, 15 ); sortKey = exdData->getField< uint16_t >( row, 16 ); - instanceClearExp = exdData->getField< uint32_t >( row, 17 ); + newPlayerBonusGil = exdData->getField< uint32_t >( row, 17 ); + newPlayerBonusExp = exdData->getField< uint32_t >( row, 18 ); newPlayerBonusA = exdData->getField< uint16_t >( row, 19 ); - finalBossCurrencyC = exdData->getField< uint16_t >( row, 20 ); - finalBossCurrencyA = exdData->getField< uint32_t >( row, 22 ); - finalBossCurrencyB = exdData->getField< uint16_t >( row, 23 ); - newPlayerBonusB = exdData->getField< uint16_t >( row, 24 ); - instanceClearGil = exdData->getField< uint32_t >( row, 46 ); - instanceContentRewardItem = exdData->getField< uint32_t >( row, 47 ); - finalBossExp = exdData->getField< uint8_t >( row, 49 ); - instanceContentBuff = exdData->getField< uint32_t >( row, 50 ); - reqInstance = exdData->getField< int32_t >( row, 51 ); - partyCondition = exdData->getField< int16_t >( row, 53 ); + newPlayerBonusB = exdData->getField< uint16_t >( row, 20 ); + finalBossExp = exdData->getField< uint32_t >( row, 21 ); + finalBossCurrencyA = exdData->getField< uint16_t >( row, 23 ); + finalBossCurrencyB = exdData->getField< uint16_t >( row, 24 ); + finalBossCurrencyC = exdData->getField< uint16_t >( row, 25 ); + instanceClearExp = exdData->getField< uint32_t >( row, 46 ); + instanceClearGil = exdData->getField< uint32_t >( row, 47 ); + instanceContentRewardItem = exdData->getField< uint32_t >( row, 48 ); + instanceContentBuff = exdData->getField< int32_t >( row, 51 ); + reqInstance = exdData->getField< uint32_t >( row, 53 ); + partyCondition = exdData->getField< int16_t >( row, 54 ); } Sapphire::Data::InstanceContentBuff::InstanceContentBuff( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6156,6 +6482,11 @@ Sapphire::Data::InstanceContentGuide::InstanceContentGuide( uint32_t row_id, Sap instance = exdData->getField< uint32_t >( row, 0 ); } +Sapphire::Data::InstanceContentQICData::InstanceContentQICData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_InstanceContentQICDataDat.get_row( row_id ); +} + Sapphire::Data::InstanceContentTextData::InstanceContentTextData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_InstanceContentTextDataDat.get_row( row_id ); @@ -6194,6 +6525,7 @@ Sapphire::Data::Item::Item( uint32_t row_id, Sapphire::Data::ExdDataGenerated* e isDyeable = exdData->getField< bool >( row, 28 ); isCrestWorthy = exdData->getField< bool >( row, 29 ); itemAction = exdData->getField< uint16_t >( row, 30 ); + castTimes = exdData->getField< uint8_t >( row, 31 ); cooldowns = exdData->getField< uint16_t >( row, 32 ); classJobRepair = exdData->getField< uint8_t >( row, 33 ); itemRepair = exdData->getField< int32_t >( row, 34 ); @@ -6360,6 +6692,22 @@ Sapphire::Data::ItemLevel::ItemLevel( uint32_t row_id, Sapphire::Data::ExdDataGe perception = exdData->getField< uint16_t >( row, 72 ); } +Sapphire::Data::ItemRepairPrice::ItemRepairPrice( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ItemRepairPriceDat.get_row( row_id ); +} + +Sapphire::Data::ItemRepairResource::ItemRepairResource( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ItemRepairResourceDat.get_row( row_id ); + item = exdData->getField< uint32_t >( row, 0 ); +} + +Sapphire::Data::ItemRetainerLevelUp::ItemRetainerLevelUp( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ItemRetainerLevelUpDat.get_row( row_id ); +} + Sapphire::Data::ItemSearchCategory::ItemSearchCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ItemSearchCategoryDat.get_row( row_id ); @@ -6388,6 +6736,11 @@ Sapphire::Data::ItemSpecialBonus::ItemSpecialBonus( uint32_t row_id, Sapphire::D name = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::ItemStainCondition::ItemStainCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ItemStainConditionDat.get_row( row_id ); +} + Sapphire::Data::ItemUICategory::ItemUICategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ItemUICategoryDat.get_row( row_id ); @@ -6460,7 +6813,7 @@ Sapphire::Data::LegacyQuest::LegacyQuest( uint32_t row_id, Sapphire::Data::ExdDa text = exdData->getField< std::string >( row, 1 ); string = exdData->getField< std::string >( row, 2 ); sortKey = exdData->getField< uint16_t >( row, 3 ); - genre = exdData->getField< uint8_t >( row, 4 ); + genre = exdData->getField< uint32_t >( row, 4 ); } Sapphire::Data::Leve::Leve( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6477,24 +6830,24 @@ Sapphire::Data::Leve::Leve( uint32_t row_id, Sapphire::Data::ExdDataGenerated* e evaluation = exdData->getField< int32_t >( row, 9 ); placeNameStart = exdData->getField< int32_t >( row, 10 ); placeNameIssued = exdData->getField< int32_t >( row, 11 ); - classJobCategory = exdData->getField< uint8_t >( row, 13 ); - journalGenre = exdData->getField< int32_t >( row, 14 ); - placeNameStartZone = exdData->getField< int32_t >( row, 16 ); - iconCityState = exdData->getField< int32_t >( row, 17 ); - dataId = exdData->getField< int32_t >( row, 18 ); - canCancel = exdData->getField< bool >( row, 19 ); - maxDifficulty = exdData->getField< uint8_t >( row, 20 ); - expFactor = exdData->getField< float >( row, 21 ); - expReward = exdData->getField< uint32_t >( row, 22 ); - gilReward = exdData->getField< uint32_t >( row, 23 ); - leveRewardItem = exdData->getField< uint16_t >( row, 24 ); - leveVfx = exdData->getField< uint8_t >( row, 25 ); - leveVfxFrame = exdData->getField< uint8_t >( row, 26 ); - levelLevemete = exdData->getField< uint32_t >( row, 27 ); - iconIssuer = exdData->getField< int32_t >( row, 28 ); - lockedLeve = exdData->getField< bool >( row, 29 ); - levelStart = exdData->getField< uint32_t >( row, 30 ); - bGM = exdData->getField< uint16_t >( row, 31 ); + classJobCategory = exdData->getField< uint8_t >( row, 15 ); + journalGenre = exdData->getField< uint32_t >( row, 16 ); + placeNameStartZone = exdData->getField< int32_t >( row, 18 ); + iconCityState = exdData->getField< int32_t >( row, 19 ); + dataId = exdData->getField< int32_t >( row, 20 ); + canCancel = exdData->getField< bool >( row, 21 ); + maxDifficulty = exdData->getField< uint8_t >( row, 22 ); + expFactor = exdData->getField< float >( row, 23 ); + expReward = exdData->getField< uint32_t >( row, 24 ); + gilReward = exdData->getField< uint32_t >( row, 25 ); + leveRewardItem = exdData->getField< uint16_t >( row, 26 ); + leveVfx = exdData->getField< uint8_t >( row, 27 ); + leveVfxFrame = exdData->getField< uint8_t >( row, 28 ); + levelLevemete = exdData->getField< uint32_t >( row, 29 ); + iconIssuer = exdData->getField< int32_t >( row, 30 ); + lockedLeve = exdData->getField< bool >( row, 31 ); + levelStart = exdData->getField< uint32_t >( row, 32 ); + bGM = exdData->getField< uint16_t >( row, 33 ); } Sapphire::Data::LeveAssignmentType::LeveAssignmentType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6677,8 +7030,8 @@ Sapphire::Data::MainCommand::MainCommand( uint32_t row_id, Sapphire::Data::ExdDa category = exdData->getField< uint8_t >( row, 1 ); mainCommandCategory = exdData->getField< uint8_t >( row, 2 ); sortID = exdData->getField< int8_t >( row, 3 ); - name = exdData->getField< std::string >( row, 4 ); - description = exdData->getField< std::string >( row, 5 ); + name = exdData->getField< std::string >( row, 5 ); + description = exdData->getField< std::string >( row, 6 ); } Sapphire::Data::MainCommandCategory::MainCommandCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6725,7 +7078,12 @@ Sapphire::Data::Map::Map( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exd Sapphire::Data::MapCondition::MapCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MapConditionDat.get_row( row_id ); - quest = exdData->getField< uint16_t >( row, 0 ); + quest = exdData->getField< int32_t >( row, 1 ); +} + +Sapphire::Data::MapExclusive::MapExclusive( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MapExclusiveDat.get_row( row_id ); } Sapphire::Data::MapMarker::MapMarker( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) @@ -6748,6 +7106,11 @@ Sapphire::Data::MapMarkerRegion::MapMarkerRegion( uint32_t row_id, Sapphire::Dat x = exdData->getField< int16_t >( row, 1 ); } +Sapphire::Data::MapReplace::MapReplace( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MapReplaceDat.get_row( row_id, subRow ); +} + Sapphire::Data::MapSymbol::MapSymbol( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MapSymbolDat.get_row( row_id ); @@ -6756,6 +7119,16 @@ Sapphire::Data::MapSymbol::MapSymbol( uint32_t row_id, Sapphire::Data::ExdDataGe displayNavi = exdData->getField< bool >( row, 2 ); } +Sapphire::Data::MapTransientPvPMap::MapTransientPvPMap( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MapTransientPvPMapDat.get_row( row_id ); +} + +Sapphire::Data::MapType::MapType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MapTypeDat.get_row( row_id ); +} + Sapphire::Data::Marker::Marker( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MarkerDat.get_row( row_id ); @@ -6789,6 +7162,11 @@ Sapphire::Data::Materia::Materia( uint32_t row_id, Sapphire::Data::ExdDataGenera value.push_back( exdData->getField< int16_t >( row, 20 ) ); } +Sapphire::Data::MateriaGrade::MateriaGrade( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MateriaGradeDat.get_row( row_id ); +} + Sapphire::Data::MateriaJoinRate::MateriaJoinRate( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MateriaJoinRateDat.get_row( row_id ); @@ -6821,6 +7199,20 @@ Sapphire::Data::MateriaTomestoneRate::MateriaTomestoneRate( uint32_t row_id, Sap rate = exdData->getField< uint32_t >( row, 0 ); } +Sapphire::Data::McGuffin::McGuffin( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_McGuffinDat.get_row( row_id ); + uIData = exdData->getField< uint8_t >( row, 0 ); +} + +Sapphire::Data::McGuffinUIData::McGuffinUIData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_McGuffinUIDataDat.get_row( row_id ); + order = exdData->getField< uint16_t >( row, 0 ); + icon = exdData->getField< uint32_t >( row, 1 ); + name = exdData->getField< std::string >( row, 2 ); +} + Sapphire::Data::MiniGameRA::MiniGameRA( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MiniGameRADat.get_row( row_id ); @@ -6848,6 +7240,368 @@ Sapphire::Data::MinionSkillType::MinionSkillType( uint32_t row_id, Sapphire::Dat name = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::MJIAnimals::MJIAnimals( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIAnimalsDat.get_row( row_id ); + bNpcBase = exdData->getField< uint32_t >( row, 0 ); + size = exdData->getField< uint8_t >( row, 1 ); + reward.push_back( exdData->getField< uint32_t >( row, 4 ) ); + reward.push_back( exdData->getField< uint32_t >( row, 5 ) ); + icon = exdData->getField< int32_t >( row, 6 ); +} + +Sapphire::Data::MJIBuilding::MJIBuilding( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIBuildingDat.get_row( row_id, subRow ); + sgb0 = exdData->getField< uint16_t >( row, 1 ); + sgb1 = exdData->getField< uint16_t >( row, 4 ); + sgb2 = exdData->getField< uint16_t >( row, 6 ); + sgb3 = exdData->getField< uint16_t >( row, 8 ); + sgb4 = exdData->getField< uint16_t >( row, 10 ); + material.push_back( exdData->getField< uint8_t >( row, 19 ) ); + material.push_back( exdData->getField< uint8_t >( row, 20 ) ); + material.push_back( exdData->getField< uint8_t >( row, 21 ) ); + material.push_back( exdData->getField< uint8_t >( row, 22 ) ); + material.push_back( exdData->getField< uint8_t >( row, 23 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 24 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 25 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 26 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 27 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 28 ) ); + name = exdData->getField< uint32_t >( row, 29 ); + icon = exdData->getField< uint32_t >( row, 31 ); +} + +Sapphire::Data::MJIBuildingPlace::MJIBuildingPlace( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIBuildingPlaceDat.get_row( row_id ); + name = exdData->getField< uint32_t >( row, 1 ); + sGB = exdData->getField< uint32_t >( row, 2 ); +} + +Sapphire::Data::MJICraftworksObject::MJICraftworksObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksObjectDat.get_row( row_id ); + item = exdData->getField< uint16_t >( row, 0 ); + theme.push_back( exdData->getField< uint16_t >( row, 1 ) ); + theme.push_back( exdData->getField< uint16_t >( row, 2 ) ); + levelReq = exdData->getField< uint16_t >( row, 12 ); + craftingTime = exdData->getField< uint16_t >( row, 13 ); + value = exdData->getField< uint16_t >( row, 14 ); +} + +Sapphire::Data::MJICraftworksObjectTheme::MJICraftworksObjectTheme( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksObjectThemeDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); +} + +Sapphire::Data::MJICraftworksPopularity::MJICraftworksPopularity( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksPopularityDat.get_row( row_id ); + popularity.push_back( exdData->getField< uint8_t >( row, 0 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 1 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 2 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 3 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 4 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 5 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 6 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 7 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 8 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 9 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 10 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 11 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 12 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 13 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 14 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 15 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 16 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 17 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 18 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 19 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 20 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 21 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 22 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 23 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 24 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 25 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 26 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 27 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 28 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 29 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 30 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 31 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 32 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 33 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 34 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 35 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 36 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 37 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 38 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 39 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 40 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 41 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 42 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 43 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 44 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 45 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 46 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 47 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 48 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 49 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 50 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 51 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 52 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 53 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 54 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 55 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 56 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 57 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 58 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 59 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 60 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 61 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 62 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 63 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 64 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 65 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 66 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 67 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 68 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 69 ) ); + popularity.push_back( exdData->getField< uint8_t >( row, 70 ) ); +} + +Sapphire::Data::MJICraftworksPopularityType::MJICraftworksPopularityType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksPopularityTypeDat.get_row( row_id ); + ratio = exdData->getField< uint16_t >( row, 0 ); +} + +Sapphire::Data::MJICraftworksRankRatio::MJICraftworksRankRatio( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksRankRatioDat.get_row( row_id ); + ratio = exdData->getField< uint16_t >( row, 0 ); +} + +Sapphire::Data::MJICraftworksSupplyDefine::MJICraftworksSupplyDefine( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksSupplyDefineDat.get_row( row_id ); + supply = exdData->getField< int16_t >( row, 0 ); + ratio = exdData->getField< uint16_t >( row, 1 ); +} + +Sapphire::Data::MJICraftworksTension::MJICraftworksTension( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICraftworksTensionDat.get_row( row_id ); +} + +Sapphire::Data::MJICropSeed::MJICropSeed( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJICropSeedDat.get_row( row_id ); + item = exdData->getField< uint32_t >( row, 0 ); + sGB = exdData->getField< uint16_t >( row, 1 ); + name = exdData->getField< uint32_t >( row, 2 ); +} + +Sapphire::Data::MJIDisposalShopItem::MJIDisposalShopItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIDisposalShopItemDat.get_row( row_id ); + category = exdData->getField< uint8_t >( row, 3 ); +} + +Sapphire::Data::MJIDisposalShopUICategory::MJIDisposalShopUICategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIDisposalShopUICategoryDat.get_row( row_id ); + category = exdData->getField< std::string >( row, 0 ); +} + +Sapphire::Data::MJIFarmPastureRank::MJIFarmPastureRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIFarmPastureRankDat.get_row( row_id ); +} + +Sapphire::Data::MJIFunction::MJIFunction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIFunctionDat.get_row( row_id ); +} + +Sapphire::Data::MJIGathering::MJIGathering( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIGatheringDat.get_row( row_id ); + gatheringObject = exdData->getField< uint8_t >( row, 0 ); +} + +Sapphire::Data::MJIGatheringItem::MJIGatheringItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIGatheringItemDat.get_row( row_id ); + item = exdData->getField< uint32_t >( row, 0 ); + sort = exdData->getField< uint8_t >( row, 1 ); + x = exdData->getField< int16_t >( row, 3 ); + y = exdData->getField< int16_t >( row, 4 ); + radius = exdData->getField< uint16_t >( row, 5 ); +} + +Sapphire::Data::MJIGatheringObject::MJIGatheringObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIGatheringObjectDat.get_row( row_id ); + sGB = exdData->getField< uint16_t >( row, 0 ); + mapIcon = exdData->getField< uint32_t >( row, 1 ); + name = exdData->getField< uint32_t >( row, 3 ); +} + +Sapphire::Data::MJIGatheringTool::MJIGatheringTool( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIGatheringToolDat.get_row( row_id ); +} + +Sapphire::Data::MJIHudMode::MJIHudMode( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIHudModeDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); + title = exdData->getField< std::string >( row, 1 ); + icon = exdData->getField< uint32_t >( row, 2 ); +} + +Sapphire::Data::MJIItemCategory::MJIItemCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIItemCategoryDat.get_row( row_id ); + singular = exdData->getField< std::string >( row, 0 ); + plural = exdData->getField< std::string >( row, 1 ); +} + +Sapphire::Data::MJIItemPouch::MJIItemPouch( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIItemPouchDat.get_row( row_id ); + item = exdData->getField< uint32_t >( row, 0 ); + category = exdData->getField< int32_t >( row, 1 ); + crop = exdData->getField< uint8_t >( row, 2 ); +} + +Sapphire::Data::MJIKeyItem::MJIKeyItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIKeyItemDat.get_row( row_id ); + item = exdData->getField< int32_t >( row, 0 ); +} + +Sapphire::Data::MJILandmark::MJILandmark( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJILandmarkDat.get_row( row_id ); + sGB0 = exdData->getField< uint16_t >( row, 3 ); + sGB1 = exdData->getField< uint16_t >( row, 5 ); + sGB2 = exdData->getField< uint16_t >( row, 7 ); + sGB3 = exdData->getField< uint16_t >( row, 9 ); + sGB4 = exdData->getField< uint16_t >( row, 11 ); + material.push_back( exdData->getField< uint16_t >( row, 18 ) ); + material.push_back( exdData->getField< uint16_t >( row, 19 ) ); + material.push_back( exdData->getField< uint16_t >( row, 20 ) ); + material.push_back( exdData->getField< uint16_t >( row, 21 ) ); + material.push_back( exdData->getField< uint16_t >( row, 22 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 23 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 24 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 25 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 26 ) ); + amount.push_back( exdData->getField< uint8_t >( row, 27 ) ); + name = exdData->getField< uint32_t >( row, 28 ); + icon = exdData->getField< uint32_t >( row, 30 ); +} + +Sapphire::Data::MJILandmarkPlace::MJILandmarkPlace( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJILandmarkPlaceDat.get_row( row_id ); + name = exdData->getField< uint32_t >( row, 1 ); + sGB = exdData->getField< uint32_t >( row, 2 ); +} + +Sapphire::Data::MJILivelyActor::MJILivelyActor( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJILivelyActorDat.get_row( row_id, subRow ); + eNPC = exdData->getField< uint32_t >( row, 0 ); + behavior = exdData->getField< uint16_t >( row, 1 ); + x = exdData->getField< float >( row, 2 ); + y = exdData->getField< float >( row, 3 ); + z = exdData->getField< float >( row, 4 ); + rot = exdData->getField< float >( row, 5 ); +} + +Sapphire::Data::MJIMinionPopAreas::MJIMinionPopAreas( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIMinionPopAreasDat.get_row( row_id ); +} + +Sapphire::Data::MJIProgress::MJIProgress( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIProgressDat.get_row( row_id ); + vision = exdData->getField< std::string >( row, 0 ); + objective = exdData->getField< std::string >( row, 1 ); + previousObjective = exdData->getField< std::string >( row, 2 ); +} + +Sapphire::Data::MJIRank::MJIRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIRankDat.get_row( row_id ); + expToNext = exdData->getField< uint32_t >( row, 0 ); + logMessage.push_back( exdData->getField< uint32_t >( row, 2 ) ); + logMessage.push_back( exdData->getField< uint32_t >( row, 3 ) ); + logMessage.push_back( exdData->getField< uint32_t >( row, 4 ) ); +} + +Sapphire::Data::MJIRecipe::MJIRecipe( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIRecipeDat.get_row( row_id ); + logMessage = exdData->getField< uint32_t >( row, 0 ); + keyItem = exdData->getField< uint8_t >( row, 1 ); + itemPouch = exdData->getField< uint8_t >( row, 2 ); + order = exdData->getField< uint8_t >( row, 14 ); +} + +Sapphire::Data::MJIRecipeMaterial::MJIRecipeMaterial( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIRecipeMaterialDat.get_row( row_id ); + itemPouch = exdData->getField< int32_t >( row, 0 ); +} + +Sapphire::Data::MJIStockyardManagementArea::MJIStockyardManagementArea( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIStockyardManagementAreaDat.get_row( row_id ); + rareMaterial = exdData->getField< uint8_t >( row, 0 ); + area = exdData->getField< uint16_t >( row, 2 ); +} + +Sapphire::Data::MJIStockyardManagementTable::MJIStockyardManagementTable( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIStockyardManagementTableDat.get_row( row_id, subRow ); + material = exdData->getField< uint8_t >( row, 0 ); +} + +Sapphire::Data::MJIText::MJIText( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJITextDat.get_row( row_id ); + text = exdData->getField< std::string >( row, 0 ); +} + +Sapphire::Data::MJIVillageAppearanceSG::MJIVillageAppearanceSG( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIVillageAppearanceSGDat.get_row( row_id ); + sGB.push_back( exdData->getField< uint16_t >( row, 0 ) ); + sGB.push_back( exdData->getField< uint16_t >( row, 1 ) ); + sGB.push_back( exdData->getField< uint16_t >( row, 2 ) ); +} + +Sapphire::Data::MJIVillageAppearanceUI::MJIVillageAppearanceUI( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIVillageAppearanceUIDat.get_row( row_id, subRow ); + floor = exdData->getField< int32_t >( row, 0 ); +} + +Sapphire::Data::MJIVillageDevelopment::MJIVillageDevelopment( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MJIVillageDevelopmentDat.get_row( row_id ); + eNPC = exdData->getField< uint32_t >( row, 0 ); + behavior0 = exdData->getField< uint16_t >( row, 9 ); + behavior1 = exdData->getField< uint16_t >( row, 11 ); +} + Sapphire::Data::MobHuntOrder::MobHuntOrder( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MobHuntOrderDat.get_row( row_id, subRow ); @@ -7017,38 +7771,40 @@ Sapphire::Data::MountAction::MountAction( uint32_t row_id, Sapphire::Data::ExdDa Sapphire::Data::MountCustomize::MountCustomize( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MountCustomizeDat.get_row( row_id ); - hyurMaleScale = exdData->getField< uint16_t >( row, 1 ); - hyurFemaleScale = exdData->getField< uint16_t >( row, 2 ); - elezenMaleScale = exdData->getField< uint16_t >( row, 3 ); - elezenFemaleScale = exdData->getField< uint16_t >( row, 4 ); - lalaMaleScale = exdData->getField< uint16_t >( row, 5 ); - lalaFemaleScale = exdData->getField< uint16_t >( row, 6 ); - miqoMaleScale = exdData->getField< uint16_t >( row, 7 ); - miqoFemaleScale = exdData->getField< uint16_t >( row, 8 ); - roeMaleScale = exdData->getField< uint16_t >( row, 9 ); - roeFemaleScale = exdData->getField< uint16_t >( row, 10 ); - auRaMaleScale = exdData->getField< uint16_t >( row, 11 ); - auRaFemaleScale = exdData->getField< uint16_t >( row, 12 ); - hrothgarMaleScale = exdData->getField< uint16_t >( row, 13 ); - hrothgarFemaleScale = exdData->getField< uint16_t >( row, 14 ); - vieraMaleScale = exdData->getField< uint16_t >( row, 15 ); - vieraFemaleScale = exdData->getField< uint16_t >( row, 16 ); - hyurMaleCameraHeight = exdData->getField< uint8_t >( row, 17 ); - hyurFemaleCameraHeight = exdData->getField< uint8_t >( row, 18 ); - elezenMaleCameraHeight = exdData->getField< uint8_t >( row, 19 ); - elezenFemaleCameraHeight = exdData->getField< uint8_t >( row, 20 ); - lalaMaleCameraHeight = exdData->getField< uint8_t >( row, 21 ); - lalaFemaleCameraHeight = exdData->getField< uint8_t >( row, 22 ); - miqoMaleCameraHeight = exdData->getField< uint8_t >( row, 23 ); - miqoFemaleCameraHeight = exdData->getField< uint8_t >( row, 24 ); - roeMaleCameraHeight = exdData->getField< uint8_t >( row, 25 ); - roeFemaleCameraHeight = exdData->getField< uint8_t >( row, 26 ); - auRaMaleCameraHeight = exdData->getField< uint8_t >( row, 27 ); - auRaFemaleCameraHeight = exdData->getField< uint8_t >( row, 28 ); - hrothgarMaleCameraHeight = exdData->getField< uint8_t >( row, 29 ); - hrothgarRoeFemaleCameraHeight = exdData->getField< uint8_t >( row, 30 ); - vieraMaleCameraHeight = exdData->getField< uint8_t >( row, 31 ); - vieraFemaleCameraHeight = exdData->getField< uint8_t >( row, 32 ); + hyurMidlanderMaleScale = exdData->getField< uint16_t >( row, 1 ); + hyurMidlanderFemaleScale = exdData->getField< uint16_t >( row, 2 ); + hyurHighlanderMaleScale = exdData->getField< uint16_t >( row, 3 ); + hyurHighlanderFemaleScale = exdData->getField< uint16_t >( row, 4 ); + elezenMaleScale = exdData->getField< uint16_t >( row, 5 ); + elezenFemaleScale = exdData->getField< uint16_t >( row, 6 ); + lalaMaleScale = exdData->getField< uint16_t >( row, 7 ); + lalaFemaleScale = exdData->getField< uint16_t >( row, 8 ); + miqoMaleScale = exdData->getField< uint16_t >( row, 9 ); + miqoFemaleScale = exdData->getField< uint16_t >( row, 10 ); + roeMaleScale = exdData->getField< uint16_t >( row, 11 ); + roeFemaleScale = exdData->getField< uint16_t >( row, 12 ); + auRaMaleScale = exdData->getField< uint16_t >( row, 13 ); + auRaFemaleScale = exdData->getField< uint16_t >( row, 14 ); + hrothgarMaleScale = exdData->getField< uint16_t >( row, 15 ); + vieraMaleScale = exdData->getField< uint16_t >( row, 16 ); + vieraFemaleScale = exdData->getField< uint16_t >( row, 17 ); + hyurMidlanderMaleCameraHeight = exdData->getField< uint16_t >( row, 18 ); + hyurMidlanderFemaleCameraHeight = exdData->getField< uint8_t >( row, 19 ); + hyurHighlanderMaleCameraHeight = exdData->getField< uint8_t >( row, 20 ); + hyurHighlanderFemaleCameraHeight = exdData->getField< uint8_t >( row, 21 ); + elezenMaleCameraHeight = exdData->getField< uint8_t >( row, 22 ); + elezenFemaleCameraHeight = exdData->getField< uint8_t >( row, 23 ); + lalaMaleCameraHeight = exdData->getField< uint8_t >( row, 24 ); + lalaFemaleCameraHeight = exdData->getField< uint8_t >( row, 25 ); + miqoMaleCameraHeight = exdData->getField< uint8_t >( row, 26 ); + miqoFemaleCameraHeight = exdData->getField< uint8_t >( row, 27 ); + roeMaleCameraHeight = exdData->getField< uint8_t >( row, 28 ); + roeFemaleCameraHeight = exdData->getField< uint8_t >( row, 29 ); + auRaMaleCameraHeight = exdData->getField< uint8_t >( row, 30 ); + auRaFemaleCameraHeight = exdData->getField< uint8_t >( row, 31 ); + hrothgarMaleCameraHeight = exdData->getField< uint8_t >( row, 32 ); + vieraMaleCameraHeight = exdData->getField< uint8_t >( row, 33 ); + vieraFemaleCameraHeight = exdData->getField< uint8_t >( row, 34 ); } Sapphire::Data::MountFlyingCondition::MountFlyingCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -7122,6 +7878,21 @@ Sapphire::Data::MovieSubtitleVoyage::MovieSubtitleVoyage( uint32_t row_id, Sapph endTime = exdData->getField< float >( row, 1 ); } +Sapphire::Data::MultipleHelp::MultipleHelp( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MultipleHelpDat.get_row( row_id ); +} + +Sapphire::Data::MultipleHelpPage::MultipleHelpPage( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MultipleHelpPageDat.get_row( row_id, subRow ); +} + +Sapphire::Data::MultipleHelpString::MultipleHelpString( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_MultipleHelpStringDat.get_row( row_id ); +} + Sapphire::Data::MYCTemporaryItem::MYCTemporaryItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_MYCTemporaryItemDat.get_row( row_id ); @@ -7219,10 +7990,10 @@ Sapphire::Data::NpcEquip::NpcEquip( uint32_t row_id, Sapphire::Data::ExdDataGene Sapphire::Data::NpcYell::NpcYell( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_NpcYellDat.get_row( row_id ); - outputType = exdData->getField< uint8_t >( row, 5 ); - balloonTime = exdData->getField< float >( row, 6 ); - isBalloonSlow = exdData->getField< bool >( row, 7 ); - battleTalkTime = exdData->getField< bool >( row, 8 ); + outputType = exdData->getField< uint8_t >( row, 4 ); + balloonTime = exdData->getField< float >( row, 5 ); + isBalloonSlow = exdData->getField< bool >( row, 6 ); + battleTalkTime = exdData->getField< bool >( row, 7 ); text = exdData->getField< std::string >( row, 10 ); } @@ -7236,6 +8007,16 @@ Sapphire::Data::Omen::Omen( uint32_t row_id, Sapphire::Data::ExdDataGenerated* e largeScale = exdData->getField< bool >( row, 4 ); } +Sapphire::Data::Omikuji::Omikuji( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_OmikujiDat.get_row( row_id ); +} + +Sapphire::Data::OmikujiGuidance::OmikujiGuidance( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_OmikujiGuidanceDat.get_row( row_id ); +} + Sapphire::Data::OnlineStatus::OnlineStatus( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_OnlineStatusDat.get_row( row_id ); @@ -7328,16 +8109,21 @@ Sapphire::Data::Ornament::Ornament( uint32_t row_id, Sapphire::Data::ExdDataGene { auto row = exdData->m_OrnamentDat.get_row( row_id ); model = exdData->getField< uint16_t >( row, 0 ); - order = exdData->getField< int16_t >( row, 4 ); - icon = exdData->getField< uint16_t >( row, 5 ); - transient = exdData->getField< uint16_t >( row, 6 ); - singular = exdData->getField< std::string >( row, 7 ); - adjective = exdData->getField< int8_t >( row, 8 ); - plural = exdData->getField< std::string >( row, 9 ); - possessivePronoun = exdData->getField< int8_t >( row, 10 ); - startsWithVowel = exdData->getField< int8_t >( row, 11 ); - pronoun = exdData->getField< int8_t >( row, 13 ); - article = exdData->getField< int8_t >( row, 14 ); + order = exdData->getField< int16_t >( row, 5 ); + icon = exdData->getField< uint16_t >( row, 6 ); + transient = exdData->getField< uint16_t >( row, 7 ); + singular = exdData->getField< std::string >( row, 8 ); + adjective = exdData->getField< int8_t >( row, 9 ); + plural = exdData->getField< std::string >( row, 10 ); + possessivePronoun = exdData->getField< int8_t >( row, 11 ); + startsWithVowel = exdData->getField< int8_t >( row, 12 ); + pronoun = exdData->getField< int8_t >( row, 14 ); + article = exdData->getField< int8_t >( row, 15 ); +} + +Sapphire::Data::OrnamentAction::OrnamentAction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_OrnamentActionDat.get_row( row_id ); } Sapphire::Data::ParamGrow::ParamGrow( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -7515,8 +8301,8 @@ Sapphire::Data::PhysicsWind::PhysicsWind( uint32_t row_id, Sapphire::Data::ExdDa Sapphire::Data::Picture::Picture( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_PictureDat.get_row( row_id ); - item = exdData->getField< int32_t >( row, 0 ); - image = exdData->getField< int32_t >( row, 1 ); + image = exdData->getField< int32_t >( row, 0 ); + signature = exdData->getField< int32_t >( row, 1 ); } Sapphire::Data::PlaceName::PlaceName( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -7540,6 +8326,16 @@ Sapphire::Data::PlantPotFlowerSeed::PlantPotFlowerSeed( uint32_t row_id, Sapphir seedIcon.push_back( exdData->getField< uint32_t >( row, 8 ) ); } +Sapphire::Data::PlayerSearchLocation::PlayerSearchLocation( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PlayerSearchLocationDat.get_row( row_id ); +} + +Sapphire::Data::PlayerSearchSubLocation::PlayerSearchSubLocation( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PlayerSearchSubLocationDat.get_row( row_id ); +} + Sapphire::Data::PreHandler::PreHandler( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_PreHandlerDat.get_row( row_id ); @@ -7563,13 +8359,13 @@ Sapphire::Data::PresetCamera::PresetCamera( uint32_t row_id, Sapphire::Data::Exd roe = exdData->getField< float >( row, 7 ); hrothgar = exdData->getField< float >( row, 8 ); viera = exdData->getField< float >( row, 9 ); - hyur_F = exdData->getField< float >( row, 10 ); - elezen_F = exdData->getField< float >( row, 11 ); - lalafell_F = exdData->getField< float >( row, 12 ); - miqote_F = exdData->getField< float >( row, 13 ); - roe_F = exdData->getField< float >( row, 14 ); - hrothgar_F = exdData->getField< float >( row, 15 ); - viera_F = exdData->getField< float >( row, 16 ); + hyur_F = exdData->getField< float >( row, 11 ); + elezen_F = exdData->getField< float >( row, 12 ); + lalafell_F = exdData->getField< float >( row, 13 ); + miqote_F = exdData->getField< float >( row, 14 ); + roe_F = exdData->getField< float >( row, 15 ); + hrothgar_F = exdData->getField< float >( row, 16 ); + viera_F = exdData->getField< float >( row, 17 ); } Sapphire::Data::PresetCameraAdjust::PresetCameraAdjust( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -7591,6 +8387,11 @@ Sapphire::Data::PresetCameraAdjust::PresetCameraAdjust( uint32_t row_id, Sapphir viera_F = exdData->getField< float >( row, 13 ); } +Sapphire::Data::PreviewableItems::PreviewableItems( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PreviewableItemsDat.get_row( row_id ); +} + Sapphire::Data::PublicContent::PublicContent( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_PublicContentDat.get_row( row_id ); @@ -7637,6 +8438,11 @@ Sapphire::Data::PvPActionSort::PvPActionSort( uint32_t row_id, uint32_t subRow, action = exdData->getField< uint16_t >( row, 1 ); } +Sapphire::Data::PvPBaseParamValue::PvPBaseParamValue( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PvPBaseParamValueDat.get_row( row_id ); +} + Sapphire::Data::PvPRank::PvPRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_PvPRankDat.get_row( row_id ); @@ -7651,6 +8457,16 @@ Sapphire::Data::PvPSelectTrait::PvPSelectTrait( uint32_t row_id, Sapphire::Data: value = exdData->getField< int16_t >( row, 2 ); } +Sapphire::Data::PvPSeries::PvPSeries( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PvPSeriesDat.get_row( row_id ); +} + +Sapphire::Data::PvPSeriesLevel::PvPSeriesLevel( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_PvPSeriesLevelDat.get_row( row_id ); +} + Sapphire::Data::PvPTrait::PvPTrait( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_PvPTraitDat.get_row( row_id ); @@ -8883,30 +9699,6 @@ Sapphire::Data::Quest::Quest( uint32_t row_id, Sapphire::Data::ExdDataGenerated* toDoQty.push_back( exdData->getField< uint8_t >( row, 1218 ) ); toDoQty.push_back( exdData->getField< uint8_t >( row, 1219 ) ); toDoQty.push_back( exdData->getField< uint8_t >( row, 1220 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1221 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1222 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1223 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1224 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1225 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1226 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1227 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1228 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1229 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1230 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1231 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1232 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1233 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1234 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1235 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1236 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1237 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1238 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1239 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1240 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1241 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1242 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1243 ) ); - toDoMainLocation.push_back( exdData->getField< uint32_t >( row, 1244 ) ); countableNum.push_back( exdData->getField< uint8_t >( row, 1413 ) ); countableNum.push_back( exdData->getField< uint8_t >( row, 1414 ) ); countableNum.push_back( exdData->getField< uint8_t >( row, 1415 ) ); @@ -8933,9 +9725,11 @@ Sapphire::Data::Quest::Quest( uint32_t row_id, Sapphire::Data::ExdDataGenerated* countableNum.push_back( exdData->getField< uint8_t >( row, 1436 ) ); levelMax = exdData->getField< uint8_t >( row, 1437 ); classJobRequired = exdData->getField< uint8_t >( row, 1438 ); + questRewardOtherDisplay = exdData->getField< uint8_t >( row, 1439 ); expFactor = exdData->getField< uint16_t >( row, 1440 ); gilReward = exdData->getField< uint32_t >( row, 1441 ); - gCSeals = exdData->getField< uint32_t >( row, 1443 ); + currencyReward = exdData->getField< uint32_t >( row, 1442 ); + currencyRewardCount = exdData->getField< uint32_t >( row, 1443 ); itemCatalyst.push_back( exdData->getField< uint8_t >( row, 1444 ) ); itemCatalyst.push_back( exdData->getField< uint8_t >( row, 1445 ) ); itemCatalyst.push_back( exdData->getField< uint8_t >( row, 1446 ) ); @@ -8943,65 +9737,68 @@ Sapphire::Data::Quest::Quest( uint32_t row_id, Sapphire::Data::ExdDataGenerated* itemCountCatalyst.push_back( exdData->getField< uint8_t >( row, 1448 ) ); itemCountCatalyst.push_back( exdData->getField< uint8_t >( row, 1449 ) ); itemRewardType = exdData->getField< uint8_t >( row, 1450 ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1451 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1452 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1453 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1454 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1455 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1456 ) ); - itemReward0.push_back( exdData->getField< uint32_t >( row, 1457 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1458 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1459 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1460 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1461 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1462 ) ); - itemCountReward0.push_back( exdData->getField< uint8_t >( row, 1463 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1465 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1466 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1467 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1468 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1469 ) ); - stainReward0.push_back( exdData->getField< uint8_t >( row, 1470 ) ); - itemReward1.push_back( exdData->getField< uint32_t >( row, 1472 ) ); - itemReward1.push_back( exdData->getField< uint32_t >( row, 1473 ) ); - itemReward1.push_back( exdData->getField< uint32_t >( row, 1474 ) ); - itemReward1.push_back( exdData->getField< uint32_t >( row, 1475 ) ); - itemReward1.push_back( exdData->getField< uint32_t >( row, 1476 ) ); - itemCountReward1.push_back( exdData->getField< uint8_t >( row, 1477 ) ); - itemCountReward1.push_back( exdData->getField< uint8_t >( row, 1478 ) ); - itemCountReward1.push_back( exdData->getField< uint8_t >( row, 1479 ) ); - itemCountReward1.push_back( exdData->getField< uint8_t >( row, 1480 ) ); - itemCountReward1.push_back( exdData->getField< uint8_t >( row, 1481 ) ); - isHQReward1.push_back( exdData->getField< bool >( row, 1482 ) ); - isHQReward1.push_back( exdData->getField< bool >( row, 1483 ) ); - isHQReward1.push_back( exdData->getField< bool >( row, 1484 ) ); - isHQReward1.push_back( exdData->getField< bool >( row, 1485 ) ); - isHQReward1.push_back( exdData->getField< bool >( row, 1486 ) ); - stainReward1.push_back( exdData->getField< uint8_t >( row, 1487 ) ); - stainReward1.push_back( exdData->getField< uint8_t >( row, 1488 ) ); - stainReward1.push_back( exdData->getField< uint8_t >( row, 1489 ) ); - stainReward1.push_back( exdData->getField< uint8_t >( row, 1490 ) ); - stainReward1.push_back( exdData->getField< uint8_t >( row, 1491 ) ); - emoteReward = exdData->getField< uint8_t >( row, 1492 ); - actionReward = exdData->getField< uint16_t >( row, 1493 ); - generalActionReward.push_back( exdData->getField< uint8_t >( row, 1494 ) ); - generalActionReward.push_back( exdData->getField< uint8_t >( row, 1495 ) ); - systemReward0 = exdData->getField< uint16_t >( row, 1496 ); - otherReward = exdData->getField< uint8_t >( row, 1497 ); - systemReward1 = exdData->getField< uint16_t >( row, 1498 ); - gCTypeReward = exdData->getField< uint16_t >( row, 1499 ); - instanceContentUnlock = exdData->getField< uint32_t >( row, 1500 ); - tomestoneReward = exdData->getField< uint8_t >( row, 1502 ); - tomestoneCountReward = exdData->getField< uint8_t >( row, 1503 ); - reputationReward = exdData->getField< uint8_t >( row, 1504 ); - placeName = exdData->getField< uint16_t >( row, 1505 ); - journalGenre = exdData->getField< uint8_t >( row, 1506 ); - icon = exdData->getField< uint32_t >( row, 1508 ); - iconSpecial = exdData->getField< uint32_t >( row, 1509 ); - introduction = exdData->getField< bool >( row, 1510 ); - hideOfferIcon = exdData->getField< bool >( row, 1511 ); - eventIconType = exdData->getField< uint8_t >( row, 1512 ); - sortKey = exdData->getField< uint16_t >( row, 1514 ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1451 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1452 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1453 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1454 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1455 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1456 ) ); + itemReward.push_back( exdData->getField< uint32_t >( row, 1457 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1458 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1459 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1460 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1461 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1462 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1463 ) ); + itemCountReward.push_back( exdData->getField< uint8_t >( row, 1464 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1472 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1473 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1474 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1475 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1476 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1477 ) ); + stainReward.push_back( exdData->getField< uint8_t >( row, 1478 ) ); + optionalItemReward.push_back( exdData->getField< uint32_t >( row, 1479 ) ); + optionalItemReward.push_back( exdData->getField< uint32_t >( row, 1480 ) ); + optionalItemReward.push_back( exdData->getField< uint32_t >( row, 1481 ) ); + optionalItemReward.push_back( exdData->getField< uint32_t >( row, 1482 ) ); + optionalItemReward.push_back( exdData->getField< uint32_t >( row, 1483 ) ); + optionalItemCountReward.push_back( exdData->getField< uint8_t >( row, 1484 ) ); + optionalItemCountReward.push_back( exdData->getField< uint8_t >( row, 1485 ) ); + optionalItemCountReward.push_back( exdData->getField< uint8_t >( row, 1486 ) ); + optionalItemCountReward.push_back( exdData->getField< uint8_t >( row, 1487 ) ); + optionalItemCountReward.push_back( exdData->getField< uint8_t >( row, 1488 ) ); + optionalItemIsHQReward.push_back( exdData->getField< bool >( row, 1489 ) ); + optionalItemIsHQReward.push_back( exdData->getField< bool >( row, 1490 ) ); + optionalItemIsHQReward.push_back( exdData->getField< bool >( row, 1491 ) ); + optionalItemIsHQReward.push_back( exdData->getField< bool >( row, 1492 ) ); + optionalItemIsHQReward.push_back( exdData->getField< bool >( row, 1493 ) ); + optionalItemStainReward.push_back( exdData->getField< uint8_t >( row, 1494 ) ); + optionalItemStainReward.push_back( exdData->getField< uint8_t >( row, 1495 ) ); + optionalItemStainReward.push_back( exdData->getField< uint8_t >( row, 1496 ) ); + optionalItemStainReward.push_back( exdData->getField< uint8_t >( row, 1497 ) ); + optionalItemStainReward.push_back( exdData->getField< uint8_t >( row, 1498 ) ); + emoteReward = exdData->getField< uint8_t >( row, 1499 ); + actionReward = exdData->getField< uint16_t >( row, 1500 ); + generalActionReward.push_back( exdData->getField< uint8_t >( row, 1501 ) ); + generalActionReward.push_back( exdData->getField< uint8_t >( row, 1502 ) ); + systemReward0 = exdData->getField< uint16_t >( row, 1503 ); + otherReward = exdData->getField< uint8_t >( row, 1504 ); + systemReward1 = exdData->getField< uint16_t >( row, 1505 ); + gCTypeReward = exdData->getField< uint16_t >( row, 1506 ); + instanceContentUnlock = exdData->getField< uint32_t >( row, 1507 ); + tomestone = exdData->getField< uint8_t >( row, 1508 ); + tomestoneReward = exdData->getField< uint8_t >( row, 1509 ); + tomestoneCountReward = exdData->getField< uint8_t >( row, 1510 ); + reputationReward = exdData->getField< uint8_t >( row, 1511 ); + placeName = exdData->getField< uint16_t >( row, 1512 ); + journalGenre = exdData->getField< uint32_t >( row, 1513 ); + icon = exdData->getField< uint32_t >( row, 1515 ); + iconSpecial = exdData->getField< uint32_t >( row, 1516 ); + introduction = exdData->getField< bool >( row, 1517 ); + hideOfferIcon = exdData->getField< bool >( row, 1518 ); + eventIconType = exdData->getField< uint8_t >( row, 1519 ); + sortKey = exdData->getField< uint16_t >( row, 1521 ); } Sapphire::Data::QuestAcceptAdditionCondition::QuestAcceptAdditionCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -9459,6 +10256,11 @@ Sapphire::Data::QuestClassJobSupply::QuestClassJobSupply( uint32_t row_id, uint3 itemHQ = exdData->getField< bool >( row, 5 ); } +Sapphire::Data::QuestDefineClient::QuestDefineClient( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_QuestDefineClientDat.get_row( row_id, subRow ); +} + Sapphire::Data::QuestDerivedClass::QuestDerivedClass( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_QuestDerivedClassDat.get_row( row_id ); @@ -9476,12 +10278,21 @@ Sapphire::Data::QuestEffectDefine::QuestEffectDefine( uint32_t row_id, uint32_t effect = exdData->getField< uint16_t >( row, 0 ); } +Sapphire::Data::QuestLinkMarker::QuestLinkMarker( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_QuestLinkMarkerDat.get_row( row_id, subRow ); +} + +Sapphire::Data::QuestLinkMarkerSet::QuestLinkMarkerSet( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_QuestLinkMarkerSetDat.get_row( row_id ); +} + Sapphire::Data::QuestRedo::QuestRedo( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_QuestRedoDat.get_row( row_id ); finalQuest = exdData->getField< uint32_t >( row, 0 ); - chapter = exdData->getField< uint16_t >( row, 2 ); - quest.push_back( exdData->getField< uint32_t >( row, 3 ) ); + chapter = exdData->getField< uint16_t >( row, 3 ); quest.push_back( exdData->getField< uint32_t >( row, 4 ) ); quest.push_back( exdData->getField< uint32_t >( row, 5 ) ); quest.push_back( exdData->getField< uint32_t >( row, 6 ) ); @@ -9513,20 +10324,21 @@ Sapphire::Data::QuestRedo::QuestRedo( uint32_t row_id, Sapphire::Data::ExdDataGe quest.push_back( exdData->getField< uint32_t >( row, 32 ) ); quest.push_back( exdData->getField< uint32_t >( row, 33 ) ); quest.push_back( exdData->getField< uint32_t >( row, 34 ) ); + quest.push_back( exdData->getField< uint32_t >( row, 35 ) ); } Sapphire::Data::QuestRedoChapterUI::QuestRedoChapterUI( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_QuestRedoChapterUIDat.get_row( row_id ); quest = exdData->getField< uint32_t >( row, 0 ); - uITab = exdData->getField< uint8_t >( row, 1 ); - category = exdData->getField< uint8_t >( row, 2 ); - questRedoUISmall = exdData->getField< uint32_t >( row, 4 ); - questRedoUILarge = exdData->getField< uint32_t >( row, 5 ); - questRedoUIWide = exdData->getField< uint32_t >( row, 6 ); - chapterName = exdData->getField< std::string >( row, 7 ); - chapterPart = exdData->getField< std::string >( row, 8 ); - transient = exdData->getField< std::string >( row, 9 ); + uITab = exdData->getField< uint8_t >( row, 2 ); + category = exdData->getField< uint8_t >( row, 3 ); + questRedoUISmall = exdData->getField< uint32_t >( row, 5 ); + questRedoUILarge = exdData->getField< uint32_t >( row, 6 ); + questRedoUIWide = exdData->getField< uint32_t >( row, 7 ); + chapterName = exdData->getField< std::string >( row, 8 ); + chapterPart = exdData->getField< std::string >( row, 9 ); + transient = exdData->getField< std::string >( row, 10 ); } Sapphire::Data::QuestRedoChapterUICategory::QuestRedoChapterUICategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -9562,6 +10374,16 @@ Sapphire::Data::QuestRewardOther::QuestRewardOther( uint32_t row_id, Sapphire::D name = exdData->getField< std::string >( row, 1 ); } +Sapphire::Data::QuestSelectTitle::QuestSelectTitle( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_QuestSelectTitleDat.get_row( row_id ); +} + +Sapphire::Data::QuestSetDefine::QuestSetDefine( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_QuestSetDefineDat.get_row( row_id, subRow ); +} + Sapphire::Data::QuickChat::QuickChat( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_QuickChatDat.get_row( row_id ); @@ -9630,6 +10452,21 @@ Sapphire::Data::RacingChocoboParam::RacingChocoboParam( uint32_t row_id, Sapphir name = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::RaidFinderParam::RaidFinderParam( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_RaidFinderParamDat.get_row( row_id, subRow ); +} + +Sapphire::Data::ReactionEventObject::ReactionEventObject( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ReactionEventObjectDat.get_row( row_id, subRow ); +} + +Sapphire::Data::ReactionEventObjectInfo::ReactionEventObjectInfo( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ReactionEventObjectInfoDat.get_row( row_id, subRow ); +} + Sapphire::Data::RecastNavimesh::RecastNavimesh( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_RecastNavimeshDat.get_row( row_id ); @@ -9657,16 +10494,19 @@ Sapphire::Data::Recipe::Recipe( uint32_t row_id, Sapphire::Data::ExdDataGenerate recipeLevelTable = exdData->getField< uint16_t >( row, 2 ); itemResult = exdData->getField< int32_t >( row, 3 ); amountResult = exdData->getField< uint8_t >( row, 4 ); + recipeNotebookList = exdData->getField< uint16_t >( row, 25 ); isSecondary = exdData->getField< bool >( row, 26 ); materialQualityFactor = exdData->getField< uint8_t >( row, 27 ); difficultyFactor = exdData->getField< uint16_t >( row, 28 ); qualityFactor = exdData->getField< uint16_t >( row, 29 ); durabilityFactor = exdData->getField< uint16_t >( row, 30 ); + requiredQuality = exdData->getField< uint32_t >( row, 31 ); requiredCraftsmanship = exdData->getField< uint16_t >( row, 32 ); requiredControl = exdData->getField< uint16_t >( row, 33 ); quickSynthCraftsmanship = exdData->getField< uint16_t >( row, 34 ); quickSynthControl = exdData->getField< uint16_t >( row, 35 ); secretRecipeBook = exdData->getField< uint16_t >( row, 36 ); + quest = exdData->getField< uint32_t >( row, 37 ); canQuickSynth = exdData->getField< bool >( row, 38 ); canHq = exdData->getField< bool >( row, 39 ); expRewarded = exdData->getField< bool >( row, 40 ); @@ -9674,7 +10514,7 @@ Sapphire::Data::Recipe::Recipe( uint32_t row_id, Sapphire::Data::ExdDataGenerate itemRequired = exdData->getField< int32_t >( row, 42 ); isSpecializationRequired = exdData->getField< bool >( row, 43 ); isExpert = exdData->getField< bool >( row, 44 ); - patchNumber = exdData->getField< uint16_t >( row, 45 ); + patchNumber = exdData->getField< uint16_t >( row, 47 ); } Sapphire::Data::RecipeLevelTable::RecipeLevelTable( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -9686,8 +10526,12 @@ Sapphire::Data::RecipeLevelTable::RecipeLevelTable( uint32_t row_id, Sapphire::D suggestedControl = exdData->getField< uint16_t >( row, 3 ); difficulty = exdData->getField< uint16_t >( row, 4 ); quality = exdData->getField< uint32_t >( row, 5 ); - durability = exdData->getField< uint16_t >( row, 6 ); - conditionsFlag = exdData->getField< uint16_t >( row, 7 ); + progressDivider = exdData->getField< uint8_t >( row, 6 ); + qualityDivider = exdData->getField< uint8_t >( row, 7 ); + progressModifier = exdData->getField< uint8_t >( row, 8 ); + qualityModifier = exdData->getField< uint8_t >( row, 9 ); + durability = exdData->getField< uint16_t >( row, 10 ); + conditionsFlag = exdData->getField< uint16_t >( row, 11 ); } Sapphire::Data::RecipeLookup::RecipeLookup( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -9997,11 +10841,13 @@ Sapphire::Data::RetainerTaskNormal::RetainerTaskNormal( uint32_t row_id, Sapphir { auto row = exdData->m_RetainerTaskNormalDat.get_row( row_id ); item = exdData->getField< int32_t >( row, 0 ); - quantity0 = exdData->getField< uint8_t >( row, 1 ); - quantity1 = exdData->getField< uint8_t >( row, 2 ); - quantity2 = exdData->getField< uint8_t >( row, 3 ); - gatheringLog = exdData->getField< int16_t >( row, 4 ); - fishingLog = exdData->getField< int16_t >( row, 5 ); + quantity.push_back( exdData->getField< uint8_t >( row, 1 ) ); + quantity.push_back( exdData->getField< uint8_t >( row, 2 ) ); + quantity.push_back( exdData->getField< uint8_t >( row, 3 ) ); + quantity.push_back( exdData->getField< uint8_t >( row, 4 ) ); + quantity.push_back( exdData->getField< uint8_t >( row, 5 ) ); + gatheringLog = exdData->getField< int16_t >( row, 6 ); + fishingLog = exdData->getField< int16_t >( row, 7 ); } Sapphire::Data::RetainerTaskParameter::RetainerTaskParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10009,10 +10855,16 @@ Sapphire::Data::RetainerTaskParameter::RetainerTaskParameter( uint32_t row_id, S auto row = exdData->m_RetainerTaskParameterDat.get_row( row_id ); itemLevelDoW.push_back( exdData->getField< int16_t >( row, 0 ) ); itemLevelDoW.push_back( exdData->getField< int16_t >( row, 1 ) ); - gatheringDoL.push_back( exdData->getField< int16_t >( row, 2 ) ); - gatheringDoL.push_back( exdData->getField< int16_t >( row, 3 ) ); - gatheringFSH.push_back( exdData->getField< int16_t >( row, 4 ) ); - gatheringFSH.push_back( exdData->getField< int16_t >( row, 5 ) ); + itemLevelDoW.push_back( exdData->getField< int16_t >( row, 2 ) ); + itemLevelDoW.push_back( exdData->getField< int16_t >( row, 3 ) ); + perceptionDoL.push_back( exdData->getField< int16_t >( row, 4 ) ); + perceptionDoL.push_back( exdData->getField< int16_t >( row, 5 ) ); + perceptionDoL.push_back( exdData->getField< int16_t >( row, 6 ) ); + perceptionDoL.push_back( exdData->getField< int16_t >( row, 7 ) ); + perceptionFSH.push_back( exdData->getField< int16_t >( row, 8 ) ); + perceptionFSH.push_back( exdData->getField< int16_t >( row, 9 ) ); + perceptionFSH.push_back( exdData->getField< int16_t >( row, 10 ) ); + perceptionFSH.push_back( exdData->getField< int16_t >( row, 11 ) ); } Sapphire::Data::RetainerTaskRandom::RetainerTaskRandom( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10076,9 +10928,16 @@ Sapphire::Data::RPParameter::RPParameter( uint32_t row_id, Sapphire::Data::ExdDa Sapphire::Data::SatisfactionArbitration::SatisfactionArbitration( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SatisfactionArbitrationDat.get_row( row_id, subRow ); + satisfactionLevel = exdData->getField< uint8_t >( row, 0 ); + satisfactionNpc = exdData->getField< uint8_t >( row, 1 ); quest = exdData->getField< uint32_t >( row, 2 ); } +Sapphire::Data::SatisfactionBonusGuarantee::SatisfactionBonusGuarantee( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SatisfactionBonusGuaranteeDat.get_row( row_id ); +} + Sapphire::Data::SatisfactionNpc::SatisfactionNpc( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SatisfactionNpcDat.get_row( row_id ); @@ -10098,7 +10957,7 @@ Sapphire::Data::SatisfactionNpc::SatisfactionNpc( uint32_t row_id, Sapphire::Dat satisfactionRequired.push_back( exdData->getField< uint16_t >( row, 13 ) ); satisfactionRequired.push_back( exdData->getField< uint16_t >( row, 14 ) ); satisfactionRequired.push_back( exdData->getField< uint16_t >( row, 15 ) ); - icon = exdData->getField< int32_t >( row, 70 ); + icon = exdData->getField< int32_t >( row, 88 ); } Sapphire::Data::SatisfactionSupply::SatisfactionSupply( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10128,7 +10987,9 @@ Sapphire::Data::ScenarioTree::ScenarioTree( uint32_t row_id, Sapphire::Data::Exd { auto row = exdData->m_ScenarioTreeDat.get_row( row_id ); type = exdData->getField< uint8_t >( row, 0 ); - image = exdData->getField< uint16_t >( row, 1 ); + addon = exdData->getField< uint32_t >( row, 2 ); + questChapter = exdData->getField< uint32_t >( row, 3 ); + name = exdData->getField< std::string >( row, 4 ); } Sapphire::Data::ScenarioTreeTips::ScenarioTreeTips( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10169,6 +11030,21 @@ Sapphire::Data::SecretRecipeBook::SecretRecipeBook( uint32_t row_id, Sapphire::D name = exdData->getField< std::string >( row, 1 ); } +Sapphire::Data::SharlayanCraftWorks::SharlayanCraftWorks( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SharlayanCraftWorksDat.get_row( row_id ); +} + +Sapphire::Data::SharlayanCraftWorksSupply::SharlayanCraftWorksSupply( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SharlayanCraftWorksSupplyDat.get_row( row_id ); +} + +Sapphire::Data::ShellFixedFromCommand::ShellFixedFromCommand( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_ShellFixedFromCommandDat.get_row( row_id ); +} + Sapphire::Data::SkyIsland2Mission::SkyIsland2Mission( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SkyIsland2MissionDat.get_row( row_id ); @@ -10207,6 +11083,37 @@ Sapphire::Data::SkyIsland2RangeType::SkyIsland2RangeType( uint32_t row_id, Sapph type = exdData->getField< uint8_t >( row, 0 ); } +Sapphire::Data::Snipe::Snipe( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SnipeDat.get_row( row_id ); + lGBTargetMarker = exdData->getField< uint32_t >( row, 0 ); + vFXFire = exdData->getField< std::string >( row, 11 ); + vFXHit = exdData->getField< std::string >( row, 12 ); + vFXMiss = exdData->getField< std::string >( row, 13 ); + vFXAdditional = exdData->getField< std::string >( row, 14 ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 17 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 18 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 19 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 20 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 21 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 22 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 23 ) ); + lGBEventNPC0.push_back( exdData->getField< uint32_t >( row, 24 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 73 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 74 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 75 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 76 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 77 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 78 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 79 ) ); + lGBEventNPC1.push_back( exdData->getField< uint32_t >( row, 80 ) ); + objective0 = exdData->getField< std::string >( row, 93 ); + hint0 = exdData->getField< std::string >( row, 94 ); + objective1 = exdData->getField< std::string >( row, 95 ); + hint1 = exdData->getField< std::string >( row, 96 ); + actionText = exdData->getField< std::string >( row, 104 ); +} + Sapphire::Data::SnipeTalk::SnipeTalk( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SnipeTalkDat.get_row( row_id ); @@ -10220,15 +11127,20 @@ Sapphire::Data::SnipeTalkName::SnipeTalkName( uint32_t row_id, Sapphire::Data::E name = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::SpearfishingComboTarget::SpearfishingComboTarget( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SpearfishingComboTargetDat.get_row( row_id ); +} + Sapphire::Data::SpearfishingItem::SpearfishingItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SpearfishingItemDat.get_row( row_id ); description = exdData->getField< std::string >( row, 0 ); item = exdData->getField< int32_t >( row, 1 ); gatheringItemLevel = exdData->getField< uint16_t >( row, 2 ); - fishingRecordType = exdData->getField< uint8_t >( row, 3 ); - territoryType = exdData->getField< uint16_t >( row, 4 ); - isVisible = exdData->getField< bool >( row, 5 ); + fishingRecordType = exdData->getField< uint8_t >( row, 5 ); + territoryType = exdData->getField< uint16_t >( row, 6 ); + isVisible = exdData->getField< bool >( row, 9 ); } Sapphire::Data::SpearfishingNotebook::SpearfishingNotebook( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10251,6 +11163,11 @@ Sapphire::Data::SpearfishingRecordPage::SpearfishingRecordPage( uint32_t row_id, image = exdData->getField< int32_t >( row, 4 ); } +Sapphire::Data::SpearfishingSilhouette::SpearfishingSilhouette( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_SpearfishingSilhouetteDat.get_row( row_id ); +} + Sapphire::Data::SpecialShop::SpecialShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_SpecialShopDat.get_row( row_id ); @@ -10315,130 +11232,130 @@ Sapphire::Data::SpecialShop::SpecialShop( uint32_t row_id, Sapphire::Data::ExdDa questItem.push_back( exdData->getField< int32_t >( row, 1258 ) ); questItem.push_back( exdData->getField< int32_t >( row, 1259 ) ); questItem.push_back( exdData->getField< int32_t >( row, 1260 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1321 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1322 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1323 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1324 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1325 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1326 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1327 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1328 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1329 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1330 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1331 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1332 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1333 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1334 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1335 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1336 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1337 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1338 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1339 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1340 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1341 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1342 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1343 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1344 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1345 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1346 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1347 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1348 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1349 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1350 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1351 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1352 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1353 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1354 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1355 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1356 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1357 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1358 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1359 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1360 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1361 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1362 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1363 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1364 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1365 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1366 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1367 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1368 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1369 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1370 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1371 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1372 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1373 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1374 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1375 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1376 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1377 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1378 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1379 ) ); - achievementUnlock.push_back( exdData->getField< int32_t >( row, 1380 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1441 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1442 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1443 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1444 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1445 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1446 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1447 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1448 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1449 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1450 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1451 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1452 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1453 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1454 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1455 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1456 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1457 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1458 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1459 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1460 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1461 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1462 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1463 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1464 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1465 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1466 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1467 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1468 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1469 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1470 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1471 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1472 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1473 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1474 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1475 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1476 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1477 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1478 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1479 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1480 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1481 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1482 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1483 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1484 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1485 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1486 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1487 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1488 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1489 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1490 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1491 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1492 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1493 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1494 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1495 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1496 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1497 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1498 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1499 ) ); - patchNumber.push_back( exdData->getField< uint16_t >( row, 1500 ) ); - useCurrencyType = exdData->getField< uint8_t >( row, 1501 ); - questUnlock = exdData->getField< uint32_t >( row, 1502 ); - completeText = exdData->getField< int32_t >( row, 1503 ); - notCompleteText = exdData->getField< int32_t >( row, 1504 ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1441 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1442 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1443 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1444 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1445 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1446 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1447 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1448 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1449 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1450 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1451 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1452 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1453 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1454 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1455 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1456 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1457 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1458 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1459 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1460 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1461 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1462 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1463 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1464 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1465 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1466 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1467 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1468 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1469 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1470 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1471 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1472 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1473 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1474 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1475 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1476 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1477 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1478 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1479 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1480 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1481 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1482 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1483 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1484 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1485 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1486 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1487 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1488 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1489 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1490 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1491 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1492 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1493 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1494 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1495 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1496 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1497 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1498 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1499 ) ); + achievementUnlock.push_back( exdData->getField< int32_t >( row, 1500 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1561 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1562 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1563 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1564 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1565 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1566 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1567 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1568 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1569 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1570 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1571 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1572 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1573 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1574 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1575 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1576 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1577 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1578 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1579 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1580 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1581 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1582 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1583 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1584 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1585 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1586 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1587 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1588 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1589 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1590 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1591 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1592 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1593 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1594 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1595 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1596 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1597 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1598 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1599 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1600 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1601 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1602 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1603 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1604 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1605 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1606 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1607 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1608 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1609 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1610 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1611 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1612 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1613 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1614 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1615 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1616 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1617 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1618 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1619 ) ); + patchNumber.push_back( exdData->getField< uint16_t >( row, 1620 ) ); + useCurrencyType = exdData->getField< uint8_t >( row, 1621 ); + questUnlock = exdData->getField< uint32_t >( row, 1622 ); + completeText = exdData->getField< int32_t >( row, 1623 ); + notCompleteText = exdData->getField< int32_t >( row, 1624 ); } Sapphire::Data::SpecialShopItemCategory::SpecialShopItemCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -10476,21 +11393,29 @@ Sapphire::Data::Status::Status( uint32_t row_id, Sapphire::Data::ExdDataGenerate name = exdData->getField< std::string >( row, 0 ); description = exdData->getField< std::string >( row, 1 ); icon = exdData->getField< uint16_t >( row, 2 ); - maxStacks = exdData->getField< uint8_t >( row, 3 ); - category = exdData->getField< uint8_t >( row, 5 ); - hitEffect = exdData->getField< uint8_t >( row, 6 ); - vFX = exdData->getField< uint16_t >( row, 7 ); - lockMovement = exdData->getField< bool >( row, 8 ); - lockActions = exdData->getField< bool >( row, 10 ); - lockControl = exdData->getField< bool >( row, 11 ); - transfiguration = exdData->getField< bool >( row, 12 ); - canDispel = exdData->getField< bool >( row, 14 ); - inflictedByActor = exdData->getField< bool >( row, 15 ); - isPermanent = exdData->getField< bool >( row, 16 ); - partyListPriority = exdData->getField< uint8_t >( row, 17 ); - log = exdData->getField< uint16_t >( row, 24 ); - isFcBuff = exdData->getField< bool >( row, 25 ); - invisibility = exdData->getField< bool >( row, 26 ); + maxStacks = exdData->getField< uint8_t >( row, 4 ); + classJobCategory = exdData->getField< uint8_t >( row, 5 ); + statusCategory = exdData->getField< uint8_t >( row, 6 ); + hitEffect = exdData->getField< uint8_t >( row, 7 ); + vFX = exdData->getField< uint16_t >( row, 8 ); + lockMovement = exdData->getField< bool >( row, 9 ); + lockActions = exdData->getField< bool >( row, 11 ); + lockControl = exdData->getField< bool >( row, 12 ); + transfiguration = exdData->getField< bool >( row, 13 ); + isGaze = exdData->getField< bool >( row, 14 ); + canDispel = exdData->getField< bool >( row, 15 ); + inflictedByActor = exdData->getField< bool >( row, 16 ); + isPermanent = exdData->getField< bool >( row, 17 ); + partyListPriority = exdData->getField< uint8_t >( row, 18 ); + canIncreaseRewards = exdData->getField< uint8_t >( row, 19 ); + paramModifier = exdData->getField< int16_t >( row, 22 ); + paramEffect = exdData->getField< uint8_t >( row, 23 ); + canStatusOff = exdData->getField< bool >( row, 24 ); + log = exdData->getField< uint16_t >( row, 25 ); + isFcBuff = exdData->getField< bool >( row, 26 ); + invisibility = exdData->getField< bool >( row, 28 ); + targetType = exdData->getField< uint8_t >( row, 29 ); + flags = exdData->getField< uint8_t >( row, 30 ); } Sapphire::Data::StatusHitEffect::StatusHitEffect( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -12380,12 +13305,16 @@ Sapphire::Data::SubmarineExploration::SubmarineExploration( uint32_t row_id, Sap auto row = exdData->m_SubmarineExplorationDat.get_row( row_id ); destination = exdData->getField< std::string >( row, 0 ); location = exdData->getField< std::string >( row, 1 ); + x = exdData->getField< int16_t >( row, 2 ); + y = exdData->getField< int16_t >( row, 3 ); + z = exdData->getField< int16_t >( row, 4 ); map = exdData->getField< uint8_t >( row, 5 ); + passengers = exdData->getField< bool >( row, 6 ); stars = exdData->getField< uint8_t >( row, 7 ); rankReq = exdData->getField< uint8_t >( row, 8 ); ceruleumTankReq = exdData->getField< uint8_t >( row, 9 ); - durationmin = exdData->getField< uint16_t >( row, 10 ); - distanceForSurvey = exdData->getField< uint8_t >( row, 11 ); + surveyDurationmin = exdData->getField< uint16_t >( row, 10 ); + surveyDistance = exdData->getField< uint8_t >( row, 11 ); expReward = exdData->getField< uint32_t >( row, 12 ); } @@ -12436,6 +13365,11 @@ Sapphire::Data::SwitchTalkVariation::SwitchTalkVariation( uint32_t row_id, uint3 defaultTalk = exdData->getField< uint32_t >( row, 3 ); } +Sapphire::Data::TelepoRelay::TelepoRelay( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TelepoRelayDat.get_row( row_id ); +} + Sapphire::Data::TerritoryType::TerritoryType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_TerritoryTypeDat.get_row( row_id ); @@ -12468,6 +13402,11 @@ Sapphire::Data::TerritoryType::TerritoryType( uint32_t row_id, Sapphire::Data::E mountSpeed = exdData->getField< uint8_t >( row, 33 ); } +Sapphire::Data::TerritoryTypeTelepo::TerritoryTypeTelepo( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TerritoryTypeTelepoDat.get_row( row_id ); +} + Sapphire::Data::TerritoryTypeTransient::TerritoryTypeTransient( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_TerritoryTypeTransientDat.get_row( row_id ); @@ -12500,6 +13439,21 @@ Sapphire::Data::Title::Title( uint32_t row_id, Sapphire::Data::ExdDataGenerated* order = exdData->getField< uint16_t >( row, 3 ); } +Sapphire::Data::TofuEditParam::TofuEditParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TofuEditParamDat.get_row( row_id ); +} + +Sapphire::Data::TofuObject::TofuObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TofuObjectDat.get_row( row_id ); +} + +Sapphire::Data::TofuObjectCategory::TofuObjectCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TofuObjectCategoryDat.get_row( row_id ); +} + Sapphire::Data::Tomestones::Tomestones( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_TomestonesDat.get_row( row_id ); @@ -12568,21 +13522,21 @@ Sapphire::Data::Transformation::Transformation( uint32_t row_id, Sapphire::Data: action5 = exdData->getField< uint16_t >( row, 16 ); rPParameter = exdData->getField< uint16_t >( row, 18 ); removeAction = exdData->getField< uint16_t >( row, 19 ); - speed = exdData->getField< float >( row, 23 ); - scale = exdData->getField< float >( row, 24 ); - isPvP = exdData->getField< bool >( row, 25 ); - isEvent = exdData->getField< bool >( row, 26 ); - playerCamera = exdData->getField< bool >( row, 27 ); - startVFX = exdData->getField< uint16_t >( row, 30 ); - endVFX = exdData->getField< uint16_t >( row, 31 ); - action6 = exdData->getField< uint32_t >( row, 32 ); - action7 = exdData->getField< uint16_t >( row, 35 ); + speed = exdData->getField< float >( row, 24 ); + scale = exdData->getField< float >( row, 25 ); + isPvP = exdData->getField< bool >( row, 26 ); + isEvent = exdData->getField< bool >( row, 27 ); + playerCamera = exdData->getField< bool >( row, 28 ); + startVFX = exdData->getField< uint16_t >( row, 31 ); + endVFX = exdData->getField< uint16_t >( row, 32 ); + action6 = exdData->getField< uint32_t >( row, 33 ); + action7 = exdData->getField< uint16_t >( row, 36 ); } Sapphire::Data::Treasure::Treasure( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_TreasureDat.get_row( row_id ); - item = exdData->getField< uint32_t >( row, 8 ); + sGB = exdData->getField< uint32_t >( row, 8 ); } Sapphire::Data::TreasureHuntRank::TreasureHuntRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -12667,6 +13621,11 @@ Sapphire::Data::TripleTriadCard::TripleTriadCard( uint32_t row_id, Sapphire::Dat description = exdData->getField< std::string >( row, 8 ); } +Sapphire::Data::TripleTriadCardObtain::TripleTriadCardObtain( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_TripleTriadCardObtainDat.get_row( row_id ); +} + Sapphire::Data::TripleTriadCardRarity::TripleTriadCardRarity( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_TripleTriadCardRarityDat.get_row( row_id ); @@ -12799,6 +13758,11 @@ Sapphire::Data::UIColor::UIColor( uint32_t row_id, Sapphire::Data::ExdDataGenera uIGlow = exdData->getField< uint32_t >( row, 1 ); } +Sapphire::Data::UIConst::UIConst( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_UIConstDat.get_row( row_id ); +} + Sapphire::Data::VaseFlower::VaseFlower( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_VaseFlowerDat.get_row( row_id ); @@ -12811,6 +13775,49 @@ Sapphire::Data::VFX::VFX( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exd location = exdData->getField< std::string >( row, 0 ); } +Sapphire::Data::VVDData::VVDData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_VVDDataDat.get_row( row_id ); +} + +Sapphire::Data::VVDNotebookContents::VVDNotebookContents( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_VVDNotebookContentsDat.get_row( row_id ); + icon = exdData->getField< int32_t >( row, 0 ); + image = exdData->getField< int32_t >( row, 1 ); + name = exdData->getField< std::string >( row, 2 ); + description = exdData->getField< std::string >( row, 3 ); +} + +Sapphire::Data::VVDNotebookSeries::VVDNotebookSeries( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_VVDNotebookSeriesDat.get_row( row_id ); + name = exdData->getField< std::string >( row, 0 ); + contents.push_back( exdData->getField< int32_t >( row, 1 ) ); + contents.push_back( exdData->getField< int32_t >( row, 2 ) ); + contents.push_back( exdData->getField< int32_t >( row, 3 ) ); + contents.push_back( exdData->getField< int32_t >( row, 4 ) ); + contents.push_back( exdData->getField< int32_t >( row, 5 ) ); + contents.push_back( exdData->getField< int32_t >( row, 6 ) ); + contents.push_back( exdData->getField< int32_t >( row, 7 ) ); + contents.push_back( exdData->getField< int32_t >( row, 8 ) ); + contents.push_back( exdData->getField< int32_t >( row, 9 ) ); + contents.push_back( exdData->getField< int32_t >( row, 10 ) ); + contents.push_back( exdData->getField< int32_t >( row, 11 ) ); + contents.push_back( exdData->getField< int32_t >( row, 12 ) ); +} + +Sapphire::Data::VVDRouteData::VVDRouteData( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_VVDRouteDataDat.get_row( row_id, subRow ); +} + +Sapphire::Data::VVDVariantAction::VVDVariantAction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) +{ + auto row = exdData->m_VVDVariantActionDat.get_row( row_id ); + action = exdData->getField< uint32_t >( row, 0 ); +} + Sapphire::Data::Warp::Warp( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_WarpDat.get_row( row_id ); @@ -12978,10 +13985,12 @@ Sapphire::Data::WeeklyLotBonus::WeeklyLotBonus( uint32_t row_id, Sapphire::Data: Sapphire::Data::World::World( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_WorldDat.get_row( row_id ); - name = exdData->getField< std::string >( row, 0 ); - userType = exdData->getField< uint8_t >( row, 1 ); - dataCenter = exdData->getField< uint8_t >( row, 2 ); - isPublic = exdData->getField< bool >( row, 3 ); + internalName = exdData->getField< std::string >( row, 0 ); + name = exdData->getField< std::string >( row, 1 ); + region = exdData->getField< uint8_t >( row, 2 ); + userType = exdData->getField< uint8_t >( row, 3 ); + dataCenter = exdData->getField< uint8_t >( row, 4 ); + isPublic = exdData->getField< bool >( row, 5 ); } Sapphire::Data::WorldDCGroupType::WorldDCGroupType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ) @@ -13020,12 +14029,19 @@ Sapphire::Data::YKW::YKW( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exd Sapphire::Data::ZoneSharedGroup::ZoneSharedGroup( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ) { auto row = exdData->m_ZoneSharedGroupDat.get_row( row_id, subRow ); - quest1 = exdData->getField< uint32_t >( row, 2 ); - quest2 = exdData->getField< uint32_t >( row, 6 ); - quest3 = exdData->getField< uint32_t >( row, 10 ); - quest4 = exdData->getField< uint32_t >( row, 14 ); - quest5 = exdData->getField< uint32_t >( row, 18 ); - quest6 = exdData->getField< uint32_t >( row, 22 ); + lGBSharedGroup = exdData->getField< uint32_t >( row, 0 ); + quest0 = exdData->getField< uint32_t >( row, 2 ); + seq0 = exdData->getField< uint32_t >( row, 3 ); + quest1 = exdData->getField< uint32_t >( row, 6 ); + seq1 = exdData->getField< uint32_t >( row, 7 ); + quest2 = exdData->getField< uint32_t >( row, 10 ); + seq2 = exdData->getField< uint32_t >( row, 11 ); + quest3 = exdData->getField< uint32_t >( row, 14 ); + seq3 = exdData->getField< uint32_t >( row, 15 ); + quest4 = exdData->getField< uint32_t >( row, 18 ); + seq4 = exdData->getField< uint32_t >( row, 19 ); + quest5 = exdData->getField< uint32_t >( row, 22 ); + seq5 = exdData->getField< uint32_t >( row, 23 ); } @@ -13091,11 +14107,14 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_AetherialWheelDat = setupDatAccess( "AetherialWheel", xiv::exd::Language::none ); m_AetheryteDat = setupDatAccess( "Aetheryte", xiv::exd::Language::en ); m_AetheryteSystemDefineDat = setupDatAccess( "AetheryteSystemDefine", xiv::exd::Language::none ); + m_AetheryteTransientDat = setupDatAccess( "AetheryteTransient", xiv::exd::Language::none ); m_AirshipExplorationLevelDat = setupDatAccess( "AirshipExplorationLevel", xiv::exd::Language::none ); m_AirshipExplorationLogDat = setupDatAccess( "AirshipExplorationLog", xiv::exd::Language::en ); m_AirshipExplorationParamTypeDat = setupDatAccess( "AirshipExplorationParamType", xiv::exd::Language::en ); m_AirshipExplorationPartDat = setupDatAccess( "AirshipExplorationPart", xiv::exd::Language::none ); m_AirshipExplorationPointDat = setupDatAccess( "AirshipExplorationPoint", xiv::exd::Language::en ); + m_AkatsukiNoteDat = setupDatAccess( "AkatsukiNote", xiv::exd::Language::none ); + m_AkatsukiNoteStringDat = setupDatAccess( "AkatsukiNoteString", xiv::exd::Language::en ); m_AnimationLODDat = setupDatAccess( "AnimationLOD", xiv::exd::Language::none ); m_AnimaWeapon5Dat = setupDatAccess( "AnimaWeapon5", xiv::exd::Language::none ); m_AnimaWeapon5ParamDat = setupDatAccess( "AnimaWeapon5Param", xiv::exd::Language::en ); @@ -13117,11 +14136,22 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_AOZScoreDat = setupDatAccess( "AOZScore", xiv::exd::Language::en ); m_AquariumFishDat = setupDatAccess( "AquariumFish", xiv::exd::Language::none ); m_AquariumWaterDat = setupDatAccess( "AquariumWater", xiv::exd::Language::en ); + m_ArchiveItemDat = setupDatAccess( "ArchiveItem", xiv::exd::Language::none ); m_ArrayEventHandlerDat = setupDatAccess( "ArrayEventHandler", xiv::exd::Language::none ); m_AttackTypeDat = setupDatAccess( "AttackType", xiv::exd::Language::en ); + m_AttractDat = setupDatAccess( "Attract", xiv::exd::Language::none ); m_BacklightColorDat = setupDatAccess( "BacklightColor", xiv::exd::Language::none ); m_BallistaDat = setupDatAccess( "Ballista", xiv::exd::Language::none ); m_BalloonDat = setupDatAccess( "Balloon", xiv::exd::Language::en ); + m_BannerBgDat = setupDatAccess( "BannerBg", xiv::exd::Language::en ); + m_BannerConditionDat = setupDatAccess( "BannerCondition", xiv::exd::Language::none ); + m_BannerDecorationDat = setupDatAccess( "BannerDecoration", xiv::exd::Language::en ); + m_BannerDesignPresetDat = setupDatAccess( "BannerDesignPreset", xiv::exd::Language::en ); + m_BannerFacialDat = setupDatAccess( "BannerFacial", xiv::exd::Language::none ); + m_BannerFrameDat = setupDatAccess( "BannerFrame", xiv::exd::Language::en ); + m_BannerObtainHintTypeDat = setupDatAccess( "BannerObtainHintType", xiv::exd::Language::en ); + m_BannerPresetDat = setupDatAccess( "BannerPreset", xiv::exd::Language::none ); + m_BannerTimelineDat = setupDatAccess( "BannerTimeline", xiv::exd::Language::en ); m_BaseParamDat = setupDatAccess( "BaseParam", xiv::exd::Language::en ); m_BattleLeveDat = setupDatAccess( "BattleLeve", xiv::exd::Language::none ); m_BattleLeveRuleDat = setupDatAccess( "BattleLeveRule", xiv::exd::Language::none ); @@ -13140,10 +14170,12 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_BGMSystemDefineDat = setupDatAccess( "BGMSystemDefine", xiv::exd::Language::none ); m_BNpcAnnounceIconDat = setupDatAccess( "BNpcAnnounceIcon", xiv::exd::Language::none ); m_BNpcBaseDat = setupDatAccess( "BNpcBase", xiv::exd::Language::none ); + m_BNpcBasePopVfxDat = setupDatAccess( "BNpcBasePopVfx", xiv::exd::Language::none ); m_BNpcCustomizeDat = setupDatAccess( "BNpcCustomize", xiv::exd::Language::none ); m_BNpcNameDat = setupDatAccess( "BNpcName", xiv::exd::Language::en ); m_BNpcPartsDat = setupDatAccess( "BNpcParts", xiv::exd::Language::none ); m_BNpcStateDat = setupDatAccess( "BNpcState", xiv::exd::Language::none ); + m_BoosterDat = setupDatAccess( "Booster", xiv::exd::Language::none ); m_BuddyDat = setupDatAccess( "Buddy", xiv::exd::Language::none ); m_BuddyActionDat = setupDatAccess( "BuddyAction", xiv::exd::Language::en ); m_BuddyEquipDat = setupDatAccess( "BuddyEquip", xiv::exd::Language::en ); @@ -13155,6 +14187,12 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_CalendarDat = setupDatAccess( "Calendar", xiv::exd::Language::none ); m_CarryDat = setupDatAccess( "Carry", xiv::exd::Language::none ); m_ChannelingDat = setupDatAccess( "Channeling", xiv::exd::Language::none ); + m_CharaCardBaseDat = setupDatAccess( "CharaCardBase", xiv::exd::Language::en ); + m_CharaCardDecorationDat = setupDatAccess( "CharaCardDecoration", xiv::exd::Language::en ); + m_CharaCardDesignPresetDat = setupDatAccess( "CharaCardDesignPreset", xiv::exd::Language::en ); + m_CharaCardDesignTypeDat = setupDatAccess( "CharaCardDesignType", xiv::exd::Language::none ); + m_CharaCardHeaderDat = setupDatAccess( "CharaCardHeader", xiv::exd::Language::en ); + m_CharaCardPlayStyleDat = setupDatAccess( "CharaCardPlayStyle", xiv::exd::Language::en ); m_CharaMakeClassEquipDat = setupDatAccess( "CharaMakeClassEquip", xiv::exd::Language::none ); m_CharaMakeCustomizeDat = setupDatAccess( "CharaMakeCustomize", xiv::exd::Language::none ); m_CharaMakeNameDat = setupDatAccess( "CharaMakeName", xiv::exd::Language::en ); @@ -13172,6 +14210,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_ChocoboTaxiStandDat = setupDatAccess( "ChocoboTaxiStand", xiv::exd::Language::en ); m_CircleActivityDat = setupDatAccess( "CircleActivity", xiv::exd::Language::en ); m_ClassJobDat = setupDatAccess( "ClassJob", xiv::exd::Language::en ); + m_ClassJobActionSortDat = setupDatAccess( "ClassJobActionSort", xiv::exd::Language::none ); m_ClassJobCategoryDat = setupDatAccess( "ClassJobCategory", xiv::exd::Language::en ); m_CollectablesShopDat = setupDatAccess( "CollectablesShop", xiv::exd::Language::en ); m_CollectablesShopItemDat = setupDatAccess( "CollectablesShopItem", xiv::exd::Language::none ); @@ -13199,6 +14238,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_ConditionDat = setupDatAccess( "Condition", xiv::exd::Language::none ); m_ConfigKeyDat = setupDatAccess( "ConfigKey", xiv::exd::Language::en ); m_ContentCloseCycleDat = setupDatAccess( "ContentCloseCycle", xiv::exd::Language::none ); + m_ContentEventItemDat = setupDatAccess( "ContentEventItem", xiv::exd::Language::none ); m_ContentExActionDat = setupDatAccess( "ContentExAction", xiv::exd::Language::none ); m_ContentFinderConditionDat = setupDatAccess( "ContentFinderCondition", xiv::exd::Language::en ); m_ContentFinderConditionTransientDat = setupDatAccess( "ContentFinderConditionTransient", xiv::exd::Language::en ); @@ -13236,13 +14276,15 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_CycleTimeDat = setupDatAccess( "CycleTime", xiv::exd::Language::none ); m_DailySupplyItemDat = setupDatAccess( "DailySupplyItem", xiv::exd::Language::none ); m_DawnContentDat = setupDatAccess( "DawnContent", xiv::exd::Language::none ); + m_DawnContentParticipableDat = setupDatAccess( "DawnContentParticipable", xiv::exd::Language::none ); m_DawnGrowMemberDat = setupDatAccess( "DawnGrowMember", xiv::exd::Language::none ); + m_DawnMemberDat = setupDatAccess( "DawnMember", xiv::exd::Language::none ); m_DawnMemberUIParamDat = setupDatAccess( "DawnMemberUIParam", xiv::exd::Language::en ); - m_DawnQuestAnnounceDat = setupDatAccess( "DawnQuestAnnounce", xiv::exd::Language::none ); m_DawnQuestMemberDat = setupDatAccess( "DawnQuestMember", xiv::exd::Language::none ); m_DeepDungeonDat = setupDatAccess( "DeepDungeon", xiv::exd::Language::en ); m_DeepDungeonBanDat = setupDatAccess( "DeepDungeonBan", xiv::exd::Language::none ); m_DeepDungeonDangerDat = setupDatAccess( "DeepDungeonDanger", xiv::exd::Language::none ); + m_DeepDungeonDemicloneDat = setupDatAccess( "DeepDungeonDemiclone", xiv::exd::Language::en ); m_DeepDungeonEquipmentDat = setupDatAccess( "DeepDungeonEquipment", xiv::exd::Language::en ); m_DeepDungeonFloorEffectUIDat = setupDatAccess( "DeepDungeonFloorEffectUI", xiv::exd::Language::en ); m_DeepDungeonItemDat = setupDatAccess( "DeepDungeonItem", xiv::exd::Language::en ); @@ -13297,14 +14339,19 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_EventItemCastTimelineDat = setupDatAccess( "EventItemCastTimeline", xiv::exd::Language::none ); m_EventItemHelpDat = setupDatAccess( "EventItemHelp", xiv::exd::Language::en ); m_EventItemTimelineDat = setupDatAccess( "EventItemTimeline", xiv::exd::Language::none ); + m_EventPathMoveDat = setupDatAccess( "EventPathMove", xiv::exd::Language::en ); m_EventSystemDefineDat = setupDatAccess( "EventSystemDefine", xiv::exd::Language::none ); m_ExportedGatheringPointDat = setupDatAccess( "ExportedGatheringPoint", xiv::exd::Language::none ); m_ExportedSGDat = setupDatAccess( "ExportedSG", xiv::exd::Language::none ); + m_ExtraCommandDat = setupDatAccess( "ExtraCommand", xiv::exd::Language::en ); m_ExVersionDat = setupDatAccess( "ExVersion", xiv::exd::Language::en ); + m_FashionCheckThemeCategoryDat = setupDatAccess( "FashionCheckThemeCategory", xiv::exd::Language::en ); + m_FashionCheckWeeklyThemeDat = setupDatAccess( "FashionCheckWeeklyTheme", xiv::exd::Language::en ); m_FateDat = setupDatAccess( "Fate", xiv::exd::Language::en ); m_FateEventDat = setupDatAccess( "FateEvent", xiv::exd::Language::en ); m_FateModeDat = setupDatAccess( "FateMode", xiv::exd::Language::none ); m_FateProgressUIDat = setupDatAccess( "FateProgressUI", xiv::exd::Language::none ); + m_FateShopDat = setupDatAccess( "FateShop", xiv::exd::Language::none ); m_FateTokenTypeDat = setupDatAccess( "FateTokenType", xiv::exd::Language::none ); m_FCActivityDat = setupDatAccess( "FCActivity", xiv::exd::Language::en ); m_FCActivityCategoryDat = setupDatAccess( "FCActivityCategory", xiv::exd::Language::en ); @@ -13320,15 +14367,23 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_FCRightsDat = setupDatAccess( "FCRights", xiv::exd::Language::en ); m_FestivalDat = setupDatAccess( "Festival", xiv::exd::Language::none ); m_FieldMarkerDat = setupDatAccess( "FieldMarker", xiv::exd::Language::en ); + m_FishingBaitParameterDat = setupDatAccess( "FishingBaitParameter", xiv::exd::Language::none ); m_FishingRecordTypeDat = setupDatAccess( "FishingRecordType", xiv::exd::Language::none ); m_FishingRecordTypeTransientDat = setupDatAccess( "FishingRecordTypeTransient", xiv::exd::Language::none ); m_FishingSpotDat = setupDatAccess( "FishingSpot", xiv::exd::Language::en ); m_FishParameterDat = setupDatAccess( "FishParameter", xiv::exd::Language::en ); + m_FittingShopDat = setupDatAccess( "FittingShop", xiv::exd::Language::none ); + m_FittingShopCategoryDat = setupDatAccess( "FittingShopCategory", xiv::exd::Language::en ); + m_FittingShopCategoryItemDat = setupDatAccess( "FittingShopCategoryItem", xiv::exd::Language::none ); + m_FittingShopItemSetDat = setupDatAccess( "FittingShopItemSet", xiv::exd::Language::en ); m_Frontline03Dat = setupDatAccess( "Frontline03", xiv::exd::Language::none ); m_Frontline04Dat = setupDatAccess( "Frontline04", xiv::exd::Language::none ); m_FurnitureCatalogCategoryDat = setupDatAccess( "FurnitureCatalogCategory", xiv::exd::Language::en ); m_FurnitureCatalogItemListDat = setupDatAccess( "FurnitureCatalogItemList", xiv::exd::Language::none ); + m_GameRewardObtainTypeDat = setupDatAccess( "GameRewardObtainType", xiv::exd::Language::none ); m_GardeningSeedDat = setupDatAccess( "GardeningSeed", xiv::exd::Language::none ); + m_GathererCrafterToolDat = setupDatAccess( "GathererCrafterTool", xiv::exd::Language::none ); + m_GathererReductionRewardDat = setupDatAccess( "GathererReductionReward", xiv::exd::Language::none ); m_GatheringConditionDat = setupDatAccess( "GatheringCondition", xiv::exd::Language::en ); m_GatheringExpDat = setupDatAccess( "GatheringExp", xiv::exd::Language::none ); m_GatheringItemDat = setupDatAccess( "GatheringItem", xiv::exd::Language::none ); @@ -13432,6 +14487,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_HWDLevelChangeDeceptionDat = setupDatAccess( "HWDLevelChangeDeception", xiv::exd::Language::none ); m_HWDSharedGroupDat = setupDatAccess( "HWDSharedGroup", xiv::exd::Language::none ); m_HWDSharedGroupControlParamDat = setupDatAccess( "HWDSharedGroupControlParam", xiv::exd::Language::none ); + m_IconLanguageDat = setupDatAccess( "IconLanguage", xiv::exd::Language::none ); m_IKDContentBonusDat = setupDatAccess( "IKDContentBonus", xiv::exd::Language::en ); m_IKDFishParamDat = setupDatAccess( "IKDFishParam", xiv::exd::Language::none ); m_IKDRouteDat = setupDatAccess( "IKDRoute", xiv::exd::Language::en ); @@ -13440,11 +14496,14 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_InclusionShopDat = setupDatAccess( "InclusionShop", xiv::exd::Language::en ); m_InclusionShopCategoryDat = setupDatAccess( "InclusionShopCategory", xiv::exd::Language::en ); m_InclusionShopSeriesDat = setupDatAccess( "InclusionShopSeries", xiv::exd::Language::none ); + m_InclusionShopWelcomDat = setupDatAccess( "InclusionShopWelcom", xiv::exd::Language::none ); + m_InclusionShopWelcomTextDat = setupDatAccess( "InclusionShopWelcomText", xiv::exd::Language::en ); m_IndividualWeatherDat = setupDatAccess( "IndividualWeather", xiv::exd::Language::none ); m_InstanceContentDat = setupDatAccess( "InstanceContent", xiv::exd::Language::none ); m_InstanceContentBuffDat = setupDatAccess( "InstanceContentBuff", xiv::exd::Language::none ); m_InstanceContentCSBonusDat = setupDatAccess( "InstanceContentCSBonus", xiv::exd::Language::none ); m_InstanceContentGuideDat = setupDatAccess( "InstanceContentGuide", xiv::exd::Language::none ); + m_InstanceContentQICDataDat = setupDatAccess( "InstanceContentQICData", xiv::exd::Language::none ); m_InstanceContentTextDataDat = setupDatAccess( "InstanceContentTextData", xiv::exd::Language::en ); m_ItemDat = setupDatAccess( "Item", xiv::exd::Language::en ); m_ItemActionDat = setupDatAccess( "ItemAction", xiv::exd::Language::none ); @@ -13452,10 +14511,14 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_ItemBarterCheckDat = setupDatAccess( "ItemBarterCheck", xiv::exd::Language::none ); m_ItemFoodDat = setupDatAccess( "ItemFood", xiv::exd::Language::none ); m_ItemLevelDat = setupDatAccess( "ItemLevel", xiv::exd::Language::none ); + m_ItemRepairPriceDat = setupDatAccess( "ItemRepairPrice", xiv::exd::Language::none ); + m_ItemRepairResourceDat = setupDatAccess( "ItemRepairResource", xiv::exd::Language::none ); + m_ItemRetainerLevelUpDat = setupDatAccess( "ItemRetainerLevelUp", xiv::exd::Language::none ); m_ItemSearchCategoryDat = setupDatAccess( "ItemSearchCategory", xiv::exd::Language::en ); m_ItemSeriesDat = setupDatAccess( "ItemSeries", xiv::exd::Language::en ); m_ItemSortCategoryDat = setupDatAccess( "ItemSortCategory", xiv::exd::Language::none ); m_ItemSpecialBonusDat = setupDatAccess( "ItemSpecialBonus", xiv::exd::Language::en ); + m_ItemStainConditionDat = setupDatAccess( "ItemStainCondition", xiv::exd::Language::none ); m_ItemUICategoryDat = setupDatAccess( "ItemUICategory", xiv::exd::Language::en ); m_JingleDat = setupDatAccess( "Jingle", xiv::exd::Language::none ); m_JobHudManualDat = setupDatAccess( "JobHudManual", xiv::exd::Language::none ); @@ -13485,18 +14548,62 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_ManeuversArmorDat = setupDatAccess( "ManeuversArmor", xiv::exd::Language::en ); m_MapDat = setupDatAccess( "Map", xiv::exd::Language::none ); m_MapConditionDat = setupDatAccess( "MapCondition", xiv::exd::Language::none ); + m_MapExclusiveDat = setupDatAccess( "MapExclusive", xiv::exd::Language::none ); m_MapMarkerDat = setupDatAccess( "MapMarker", xiv::exd::Language::none ); m_MapMarkerRegionDat = setupDatAccess( "MapMarkerRegion", xiv::exd::Language::none ); + m_MapReplaceDat = setupDatAccess( "MapReplace", xiv::exd::Language::none ); m_MapSymbolDat = setupDatAccess( "MapSymbol", xiv::exd::Language::none ); + m_MapTransientPvPMapDat = setupDatAccess( "MapTransientPvPMap", xiv::exd::Language::none ); + m_MapTypeDat = setupDatAccess( "MapType", xiv::exd::Language::none ); m_MarkerDat = setupDatAccess( "Marker", xiv::exd::Language::en ); m_MateriaDat = setupDatAccess( "Materia", xiv::exd::Language::none ); + m_MateriaGradeDat = setupDatAccess( "MateriaGrade", xiv::exd::Language::none ); m_MateriaJoinRateDat = setupDatAccess( "MateriaJoinRate", xiv::exd::Language::none ); m_MateriaJoinRateGatherCraftDat = setupDatAccess( "MateriaJoinRateGatherCraft", xiv::exd::Language::none ); m_MateriaTomestoneRateDat = setupDatAccess( "MateriaTomestoneRate", xiv::exd::Language::none ); + m_McGuffinDat = setupDatAccess( "McGuffin", xiv::exd::Language::none ); + m_McGuffinUIDataDat = setupDatAccess( "McGuffinUIData", xiv::exd::Language::en ); m_MiniGameRADat = setupDatAccess( "MiniGameRA", xiv::exd::Language::none ); m_MinionRaceDat = setupDatAccess( "MinionRace", xiv::exd::Language::en ); m_MinionRulesDat = setupDatAccess( "MinionRules", xiv::exd::Language::en ); m_MinionSkillTypeDat = setupDatAccess( "MinionSkillType", xiv::exd::Language::en ); + m_MJIAnimalsDat = setupDatAccess( "MJIAnimals", xiv::exd::Language::none ); + m_MJIBuildingDat = setupDatAccess( "MJIBuilding", xiv::exd::Language::none ); + m_MJIBuildingPlaceDat = setupDatAccess( "MJIBuildingPlace", xiv::exd::Language::none ); + m_MJICraftworksObjectDat = setupDatAccess( "MJICraftworksObject", xiv::exd::Language::none ); + m_MJICraftworksObjectThemeDat = setupDatAccess( "MJICraftworksObjectTheme", xiv::exd::Language::en ); + m_MJICraftworksPopularityDat = setupDatAccess( "MJICraftworksPopularity", xiv::exd::Language::none ); + m_MJICraftworksPopularityTypeDat = setupDatAccess( "MJICraftworksPopularityType", xiv::exd::Language::none ); + m_MJICraftworksRankRatioDat = setupDatAccess( "MJICraftworksRankRatio", xiv::exd::Language::none ); + m_MJICraftworksSupplyDefineDat = setupDatAccess( "MJICraftworksSupplyDefine", xiv::exd::Language::none ); + m_MJICraftworksTensionDat = setupDatAccess( "MJICraftworksTension", xiv::exd::Language::none ); + m_MJICropSeedDat = setupDatAccess( "MJICropSeed", xiv::exd::Language::none ); + m_MJIDisposalShopItemDat = setupDatAccess( "MJIDisposalShopItem", xiv::exd::Language::none ); + m_MJIDisposalShopUICategoryDat = setupDatAccess( "MJIDisposalShopUICategory", xiv::exd::Language::en ); + m_MJIFarmPastureRankDat = setupDatAccess( "MJIFarmPastureRank", xiv::exd::Language::none ); + m_MJIFunctionDat = setupDatAccess( "MJIFunction", xiv::exd::Language::none ); + m_MJIGatheringDat = setupDatAccess( "MJIGathering", xiv::exd::Language::none ); + m_MJIGatheringItemDat = setupDatAccess( "MJIGatheringItem", xiv::exd::Language::none ); + m_MJIGatheringObjectDat = setupDatAccess( "MJIGatheringObject", xiv::exd::Language::none ); + m_MJIGatheringToolDat = setupDatAccess( "MJIGatheringTool", xiv::exd::Language::none ); + m_MJIHudModeDat = setupDatAccess( "MJIHudMode", xiv::exd::Language::en ); + m_MJIItemCategoryDat = setupDatAccess( "MJIItemCategory", xiv::exd::Language::en ); + m_MJIItemPouchDat = setupDatAccess( "MJIItemPouch", xiv::exd::Language::none ); + m_MJIKeyItemDat = setupDatAccess( "MJIKeyItem", xiv::exd::Language::none ); + m_MJILandmarkDat = setupDatAccess( "MJILandmark", xiv::exd::Language::none ); + m_MJILandmarkPlaceDat = setupDatAccess( "MJILandmarkPlace", xiv::exd::Language::none ); + m_MJILivelyActorDat = setupDatAccess( "MJILivelyActor", xiv::exd::Language::none ); + m_MJIMinionPopAreasDat = setupDatAccess( "MJIMinionPopAreas", xiv::exd::Language::none ); + m_MJIProgressDat = setupDatAccess( "MJIProgress", xiv::exd::Language::en ); + m_MJIRankDat = setupDatAccess( "MJIRank", xiv::exd::Language::none ); + m_MJIRecipeDat = setupDatAccess( "MJIRecipe", xiv::exd::Language::none ); + m_MJIRecipeMaterialDat = setupDatAccess( "MJIRecipeMaterial", xiv::exd::Language::none ); + m_MJIStockyardManagementAreaDat = setupDatAccess( "MJIStockyardManagementArea", xiv::exd::Language::none ); + m_MJIStockyardManagementTableDat = setupDatAccess( "MJIStockyardManagementTable", xiv::exd::Language::none ); + m_MJITextDat = setupDatAccess( "MJIText", xiv::exd::Language::en ); + m_MJIVillageAppearanceSGDat = setupDatAccess( "MJIVillageAppearanceSG", xiv::exd::Language::none ); + m_MJIVillageAppearanceUIDat = setupDatAccess( "MJIVillageAppearanceUI", xiv::exd::Language::none ); + m_MJIVillageDevelopmentDat = setupDatAccess( "MJIVillageDevelopment", xiv::exd::Language::none ); m_MobHuntOrderDat = setupDatAccess( "MobHuntOrder", xiv::exd::Language::none ); m_MobHuntOrderTypeDat = setupDatAccess( "MobHuntOrderType", xiv::exd::Language::none ); m_MobHuntRewardDat = setupDatAccess( "MobHuntReward", xiv::exd::Language::none ); @@ -13521,6 +14628,9 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_MovieSubtitleDat = setupDatAccess( "MovieSubtitle", xiv::exd::Language::en ); m_MovieSubtitle500Dat = setupDatAccess( "MovieSubtitle500", xiv::exd::Language::en ); m_MovieSubtitleVoyageDat = setupDatAccess( "MovieSubtitleVoyage", xiv::exd::Language::en ); + m_MultipleHelpDat = setupDatAccess( "MultipleHelp", xiv::exd::Language::en ); + m_MultipleHelpPageDat = setupDatAccess( "MultipleHelpPage", xiv::exd::Language::none ); + m_MultipleHelpStringDat = setupDatAccess( "MultipleHelpString", xiv::exd::Language::en ); m_MYCTemporaryItemDat = setupDatAccess( "MYCTemporaryItem", xiv::exd::Language::none ); m_MYCTemporaryItemUICategoryDat = setupDatAccess( "MYCTemporaryItemUICategory", xiv::exd::Language::en ); m_MYCWarResultNotebookDat = setupDatAccess( "MYCWarResultNotebook", xiv::exd::Language::en ); @@ -13530,6 +14640,8 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_NpcEquipDat = setupDatAccess( "NpcEquip", xiv::exd::Language::none ); m_NpcYellDat = setupDatAccess( "NpcYell", xiv::exd::Language::en ); m_OmenDat = setupDatAccess( "Omen", xiv::exd::Language::none ); + m_OmikujiDat = setupDatAccess( "Omikuji", xiv::exd::Language::en ); + m_OmikujiGuidanceDat = setupDatAccess( "OmikujiGuidance", xiv::exd::Language::en ); m_OnlineStatusDat = setupDatAccess( "OnlineStatus", xiv::exd::Language::en ); m_OpenContentDat = setupDatAccess( "OpenContent", xiv::exd::Language::none ); m_OpenContentCandidateNameDat = setupDatAccess( "OpenContentCandidateName", xiv::exd::Language::en ); @@ -13539,6 +14651,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_OrchestrionPathDat = setupDatAccess( "OrchestrionPath", xiv::exd::Language::none ); m_OrchestrionUiparamDat = setupDatAccess( "OrchestrionUiparam", xiv::exd::Language::none ); m_OrnamentDat = setupDatAccess( "Ornament", xiv::exd::Language::en ); + m_OrnamentActionDat = setupDatAccess( "OrnamentAction", xiv::exd::Language::none ); m_ParamGrowDat = setupDatAccess( "ParamGrow", xiv::exd::Language::none ); m_PartyContentDat = setupDatAccess( "PartyContent", xiv::exd::Language::none ); m_PartyContentCutsceneDat = setupDatAccess( "PartyContentCutscene", xiv::exd::Language::none ); @@ -13555,16 +14668,22 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_PictureDat = setupDatAccess( "Picture", xiv::exd::Language::none ); m_PlaceNameDat = setupDatAccess( "PlaceName", xiv::exd::Language::en ); m_PlantPotFlowerSeedDat = setupDatAccess( "PlantPotFlowerSeed", xiv::exd::Language::none ); + m_PlayerSearchLocationDat = setupDatAccess( "PlayerSearchLocation", xiv::exd::Language::en ); + m_PlayerSearchSubLocationDat = setupDatAccess( "PlayerSearchSubLocation", xiv::exd::Language::en ); m_PreHandlerDat = setupDatAccess( "PreHandler", xiv::exd::Language::en ); m_PresetCameraDat = setupDatAccess( "PresetCamera", xiv::exd::Language::none ); m_PresetCameraAdjustDat = setupDatAccess( "PresetCameraAdjust", xiv::exd::Language::none ); + m_PreviewableItemsDat = setupDatAccess( "PreviewableItems", xiv::exd::Language::none ); m_PublicContentDat = setupDatAccess( "PublicContent", xiv::exd::Language::en ); m_PublicContentCutsceneDat = setupDatAccess( "PublicContentCutscene", xiv::exd::Language::none ); m_PublicContentTextDataDat = setupDatAccess( "PublicContentTextData", xiv::exd::Language::en ); m_PvPActionDat = setupDatAccess( "PvPAction", xiv::exd::Language::none ); m_PvPActionSortDat = setupDatAccess( "PvPActionSort", xiv::exd::Language::none ); + m_PvPBaseParamValueDat = setupDatAccess( "PvPBaseParamValue", xiv::exd::Language::none ); m_PvPRankDat = setupDatAccess( "PvPRank", xiv::exd::Language::none ); m_PvPSelectTraitDat = setupDatAccess( "PvPSelectTrait", xiv::exd::Language::en ); + m_PvPSeriesDat = setupDatAccess( "PvPSeries", xiv::exd::Language::none ); + m_PvPSeriesLevelDat = setupDatAccess( "PvPSeriesLevel", xiv::exd::Language::none ); m_PvPTraitDat = setupDatAccess( "PvPTrait", xiv::exd::Language::none ); m_QuestDat = setupDatAccess( "Quest", xiv::exd::Language::en ); m_QuestAcceptAdditionConditionDat = setupDatAccess( "QuestAcceptAdditionCondition", xiv::exd::Language::none ); @@ -13572,9 +14691,12 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_QuestChapterDat = setupDatAccess( "QuestChapter", xiv::exd::Language::none ); m_QuestClassJobRewardDat = setupDatAccess( "QuestClassJobReward", xiv::exd::Language::none ); m_QuestClassJobSupplyDat = setupDatAccess( "QuestClassJobSupply", xiv::exd::Language::none ); + m_QuestDefineClientDat = setupDatAccess( "QuestDefineClient", xiv::exd::Language::none ); m_QuestDerivedClassDat = setupDatAccess( "QuestDerivedClass", xiv::exd::Language::none ); m_QuestEffectDat = setupDatAccess( "QuestEffect", xiv::exd::Language::none ); m_QuestEffectDefineDat = setupDatAccess( "QuestEffectDefine", xiv::exd::Language::none ); + m_QuestLinkMarkerDat = setupDatAccess( "QuestLinkMarker", xiv::exd::Language::none ); + m_QuestLinkMarkerSetDat = setupDatAccess( "QuestLinkMarkerSet", xiv::exd::Language::none ); m_QuestRedoDat = setupDatAccess( "QuestRedo", xiv::exd::Language::none ); m_QuestRedoChapterUIDat = setupDatAccess( "QuestRedoChapterUI", xiv::exd::Language::en ); m_QuestRedoChapterUICategoryDat = setupDatAccess( "QuestRedoChapterUICategory", xiv::exd::Language::en ); @@ -13582,6 +14704,8 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_QuestRedoIncompChapterDat = setupDatAccess( "QuestRedoIncompChapter", xiv::exd::Language::none ); m_QuestRepeatFlagDat = setupDatAccess( "QuestRepeatFlag", xiv::exd::Language::none ); m_QuestRewardOtherDat = setupDatAccess( "QuestRewardOther", xiv::exd::Language::en ); + m_QuestSelectTitleDat = setupDatAccess( "QuestSelectTitle", xiv::exd::Language::none ); + m_QuestSetDefineDat = setupDatAccess( "QuestSetDefine", xiv::exd::Language::none ); m_QuickChatDat = setupDatAccess( "QuickChat", xiv::exd::Language::en ); m_QuickChatTransientDat = setupDatAccess( "QuickChatTransient", xiv::exd::Language::en ); m_RaceDat = setupDatAccess( "Race", xiv::exd::Language::en ); @@ -13590,6 +14714,9 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_RacingChocoboNameCategoryDat = setupDatAccess( "RacingChocoboNameCategory", xiv::exd::Language::en ); m_RacingChocoboNameInfoDat = setupDatAccess( "RacingChocoboNameInfo", xiv::exd::Language::none ); m_RacingChocoboParamDat = setupDatAccess( "RacingChocoboParam", xiv::exd::Language::en ); + m_RaidFinderParamDat = setupDatAccess( "RaidFinderParam", xiv::exd::Language::none ); + m_ReactionEventObjectDat = setupDatAccess( "ReactionEventObject", xiv::exd::Language::none ); + m_ReactionEventObjectInfoDat = setupDatAccess( "ReactionEventObjectInfo", xiv::exd::Language::none ); m_RecastNavimeshDat = setupDatAccess( "RecastNavimesh", xiv::exd::Language::none ); m_RecipeDat = setupDatAccess( "Recipe", xiv::exd::Language::none ); m_RecipeLevelTableDat = setupDatAccess( "RecipeLevelTable", xiv::exd::Language::none ); @@ -13614,6 +14741,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_RideShootingTextDataDat = setupDatAccess( "RideShootingTextData", xiv::exd::Language::en ); m_RPParameterDat = setupDatAccess( "RPParameter", xiv::exd::Language::none ); m_SatisfactionArbitrationDat = setupDatAccess( "SatisfactionArbitration", xiv::exd::Language::none ); + m_SatisfactionBonusGuaranteeDat = setupDatAccess( "SatisfactionBonusGuarantee", xiv::exd::Language::none ); m_SatisfactionNpcDat = setupDatAccess( "SatisfactionNpc", xiv::exd::Language::none ); m_SatisfactionSupplyDat = setupDatAccess( "SatisfactionSupply", xiv::exd::Language::none ); m_SatisfactionSupplyRewardDat = setupDatAccess( "SatisfactionSupplyReward", xiv::exd::Language::none ); @@ -13623,15 +14751,21 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_ScenarioTypeDat = setupDatAccess( "ScenarioType", xiv::exd::Language::en ); m_ScreenImageDat = setupDatAccess( "ScreenImage", xiv::exd::Language::none ); m_SecretRecipeBookDat = setupDatAccess( "SecretRecipeBook", xiv::exd::Language::en ); + m_SharlayanCraftWorksDat = setupDatAccess( "SharlayanCraftWorks", xiv::exd::Language::en ); + m_SharlayanCraftWorksSupplyDat = setupDatAccess( "SharlayanCraftWorksSupply", xiv::exd::Language::none ); + m_ShellFixedFromCommandDat = setupDatAccess( "ShellFixedFromCommand", xiv::exd::Language::none ); m_SkyIsland2MissionDat = setupDatAccess( "SkyIsland2Mission", xiv::exd::Language::en ); m_SkyIsland2MissionDetailDat = setupDatAccess( "SkyIsland2MissionDetail", xiv::exd::Language::en ); m_SkyIsland2MissionTypeDat = setupDatAccess( "SkyIsland2MissionType", xiv::exd::Language::none ); m_SkyIsland2RangeTypeDat = setupDatAccess( "SkyIsland2RangeType", xiv::exd::Language::none ); + m_SnipeDat = setupDatAccess( "Snipe", xiv::exd::Language::en ); m_SnipeTalkDat = setupDatAccess( "SnipeTalk", xiv::exd::Language::en ); m_SnipeTalkNameDat = setupDatAccess( "SnipeTalkName", xiv::exd::Language::en ); + m_SpearfishingComboTargetDat = setupDatAccess( "SpearfishingComboTarget", xiv::exd::Language::en ); m_SpearfishingItemDat = setupDatAccess( "SpearfishingItem", xiv::exd::Language::en ); m_SpearfishingNotebookDat = setupDatAccess( "SpearfishingNotebook", xiv::exd::Language::none ); m_SpearfishingRecordPageDat = setupDatAccess( "SpearfishingRecordPage", xiv::exd::Language::none ); + m_SpearfishingSilhouetteDat = setupDatAccess( "SpearfishingSilhouette", xiv::exd::Language::none ); m_SpecialShopDat = setupDatAccess( "SpecialShop", xiv::exd::Language::en ); m_SpecialShopItemCategoryDat = setupDatAccess( "SpecialShopItemCategory", xiv::exd::Language::en ); m_StainDat = setupDatAccess( "Stain", xiv::exd::Language::en ); @@ -13647,11 +14781,16 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_SubmarineRankDat = setupDatAccess( "SubmarineRank", xiv::exd::Language::none ); m_SwitchTalkDat = setupDatAccess( "SwitchTalk", xiv::exd::Language::none ); m_SwitchTalkVariationDat = setupDatAccess( "SwitchTalkVariation", xiv::exd::Language::none ); + m_TelepoRelayDat = setupDatAccess( "TelepoRelay", xiv::exd::Language::none ); m_TerritoryTypeDat = setupDatAccess( "TerritoryType", xiv::exd::Language::none ); + m_TerritoryTypeTelepoDat = setupDatAccess( "TerritoryTypeTelepo", xiv::exd::Language::none ); m_TerritoryTypeTransientDat = setupDatAccess( "TerritoryTypeTransient", xiv::exd::Language::none ); m_TextCommandDat = setupDatAccess( "TextCommand", xiv::exd::Language::en ); m_TextCommandParamDat = setupDatAccess( "TextCommandParam", xiv::exd::Language::en ); m_TitleDat = setupDatAccess( "Title", xiv::exd::Language::en ); + m_TofuEditParamDat = setupDatAccess( "TofuEditParam", xiv::exd::Language::en ); + m_TofuObjectDat = setupDatAccess( "TofuObject", xiv::exd::Language::en ); + m_TofuObjectCategoryDat = setupDatAccess( "TofuObjectCategory", xiv::exd::Language::en ); m_TomestonesDat = setupDatAccess( "Tomestones", xiv::exd::Language::none ); m_TomestonesItemDat = setupDatAccess( "TomestonesItem", xiv::exd::Language::none ); m_TopicSelectDat = setupDatAccess( "TopicSelect", xiv::exd::Language::en ); @@ -13667,6 +14806,7 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_TribeDat = setupDatAccess( "Tribe", xiv::exd::Language::en ); m_TripleTriadDat = setupDatAccess( "TripleTriad", xiv::exd::Language::none ); m_TripleTriadCardDat = setupDatAccess( "TripleTriadCard", xiv::exd::Language::en ); + m_TripleTriadCardObtainDat = setupDatAccess( "TripleTriadCardObtain", xiv::exd::Language::none ); m_TripleTriadCardRarityDat = setupDatAccess( "TripleTriadCardRarity", xiv::exd::Language::none ); m_TripleTriadCardResidentDat = setupDatAccess( "TripleTriadCardResident", xiv::exd::Language::none ); m_TripleTriadCardTypeDat = setupDatAccess( "TripleTriadCardType", xiv::exd::Language::en ); @@ -13680,8 +14820,14 @@ bool Sapphire::Data::ExdDataGenerated::init( const std::string& path ) m_UDS_EventDat = setupDatAccess( "UDS_Event", xiv::exd::Language::none ); m_UDS_PropertyDat = setupDatAccess( "UDS_Property", xiv::exd::Language::none ); m_UIColorDat = setupDatAccess( "UIColor", xiv::exd::Language::none ); + m_UIConstDat = setupDatAccess( "UIConst", xiv::exd::Language::none ); m_VaseFlowerDat = setupDatAccess( "VaseFlower", xiv::exd::Language::none ); m_VFXDat = setupDatAccess( "VFX", xiv::exd::Language::none ); + m_VVDDataDat = setupDatAccess( "VVDData", xiv::exd::Language::none ); + m_VVDNotebookContentsDat = setupDatAccess( "VVDNotebookContents", xiv::exd::Language::en ); + m_VVDNotebookSeriesDat = setupDatAccess( "VVDNotebookSeries", xiv::exd::Language::en ); + m_VVDRouteDataDat = setupDatAccess( "VVDRouteData", xiv::exd::Language::none ); + m_VVDVariantActionDat = setupDatAccess( "VVDVariantAction", xiv::exd::Language::none ); m_WarpDat = setupDatAccess( "Warp", xiv::exd::Language::en ); m_WarpConditionDat = setupDatAccess( "WarpCondition", xiv::exd::Language::none ); m_WarpLogicDat = setupDatAccess( "WarpLogic", xiv::exd::Language::en ); diff --git a/src/common/Exd/ExdDataGenerated.h b/src/common/Exd/ExdDataGenerated.h index 7f890fdd..77ad81cc 100644 --- a/src/common/Exd/ExdDataGenerated.h +++ b/src/common/Exd/ExdDataGenerated.h @@ -51,11 +51,14 @@ struct AetherCurrentCompFlgSet; struct AetherialWheel; struct Aetheryte; struct AetheryteSystemDefine; +struct AetheryteTransient; struct AirshipExplorationLevel; struct AirshipExplorationLog; struct AirshipExplorationParamType; struct AirshipExplorationPart; struct AirshipExplorationPoint; +struct AkatsukiNote; +struct AkatsukiNoteString; struct AnimationLOD; struct AnimaWeapon5; struct AnimaWeapon5Param; @@ -77,11 +80,22 @@ struct AOZReport; struct AOZScore; struct AquariumFish; struct AquariumWater; +struct ArchiveItem; struct ArrayEventHandler; struct AttackType; +struct Attract; struct BacklightColor; struct Ballista; struct Balloon; +struct BannerBg; +struct BannerCondition; +struct BannerDecoration; +struct BannerDesignPreset; +struct BannerFacial; +struct BannerFrame; +struct BannerObtainHintType; +struct BannerPreset; +struct BannerTimeline; struct BaseParam; struct BattleLeve; struct BattleLeveRule; @@ -100,10 +114,12 @@ struct BGMSwitch; struct BGMSystemDefine; struct BNpcAnnounceIcon; struct BNpcBase; +struct BNpcBasePopVfx; struct BNpcCustomize; struct BNpcName; struct BNpcParts; struct BNpcState; +struct Booster; struct Buddy; struct BuddyAction; struct BuddyEquip; @@ -115,6 +131,12 @@ struct CabinetCategory; struct Calendar; struct Carry; struct Channeling; +struct CharaCardBase; +struct CharaCardDecoration; +struct CharaCardDesignPreset; +struct CharaCardDesignType; +struct CharaCardHeader; +struct CharaCardPlayStyle; struct CharaMakeClassEquip; struct CharaMakeCustomize; struct CharaMakeName; @@ -132,6 +154,7 @@ struct ChocoboTaxi; struct ChocoboTaxiStand; struct CircleActivity; struct ClassJob; +struct ClassJobActionSort; struct ClassJobCategory; struct CollectablesShop; struct CollectablesShopItem; @@ -159,6 +182,7 @@ struct Completion; struct Condition; struct ConfigKey; struct ContentCloseCycle; +struct ContentEventItem; struct ContentExAction; struct ContentFinderCondition; struct ContentFinderConditionTransient; @@ -196,13 +220,15 @@ struct CutScreenImage; struct CycleTime; struct DailySupplyItem; struct DawnContent; +struct DawnContentParticipable; struct DawnGrowMember; +struct DawnMember; struct DawnMemberUIParam; -struct DawnQuestAnnounce; struct DawnQuestMember; struct DeepDungeon; struct DeepDungeonBan; struct DeepDungeonDanger; +struct DeepDungeonDemiclone; struct DeepDungeonEquipment; struct DeepDungeonFloorEffectUI; struct DeepDungeonItem; @@ -257,14 +283,19 @@ struct EventItem; struct EventItemCastTimeline; struct EventItemHelp; struct EventItemTimeline; +struct EventPathMove; struct EventSystemDefine; struct ExportedGatheringPoint; struct ExportedSG; +struct ExtraCommand; struct ExVersion; +struct FashionCheckThemeCategory; +struct FashionCheckWeeklyTheme; struct Fate; struct FateEvent; struct FateMode; struct FateProgressUI; +struct FateShop; struct FateTokenType; struct FCActivity; struct FCActivityCategory; @@ -280,15 +311,23 @@ struct FCReputation; struct FCRights; struct Festival; struct FieldMarker; +struct FishingBaitParameter; struct FishingRecordType; struct FishingRecordTypeTransient; struct FishingSpot; struct FishParameter; +struct FittingShop; +struct FittingShopCategory; +struct FittingShopCategoryItem; +struct FittingShopItemSet; struct Frontline03; struct Frontline04; struct FurnitureCatalogCategory; struct FurnitureCatalogItemList; +struct GameRewardObtainType; struct GardeningSeed; +struct GathererCrafterTool; +struct GathererReductionReward; struct GatheringCondition; struct GatheringExp; struct GatheringItem; @@ -392,6 +431,7 @@ struct HWDInfoBoardArticleType; struct HWDLevelChangeDeception; struct HWDSharedGroup; struct HWDSharedGroupControlParam; +struct IconLanguage; struct IKDContentBonus; struct IKDFishParam; struct IKDRoute; @@ -400,11 +440,14 @@ struct IKDSpot; struct InclusionShop; struct InclusionShopCategory; struct InclusionShopSeries; +struct InclusionShopWelcom; +struct InclusionShopWelcomText; struct IndividualWeather; struct InstanceContent; struct InstanceContentBuff; struct InstanceContentCSBonus; struct InstanceContentGuide; +struct InstanceContentQICData; struct InstanceContentTextData; struct Item; struct ItemAction; @@ -412,10 +455,14 @@ struct ItemActionTelepo; struct ItemBarterCheck; struct ItemFood; struct ItemLevel; +struct ItemRepairPrice; +struct ItemRepairResource; +struct ItemRetainerLevelUp; struct ItemSearchCategory; struct ItemSeries; struct ItemSortCategory; struct ItemSpecialBonus; +struct ItemStainCondition; struct ItemUICategory; struct Jingle; struct JobHudManual; @@ -445,18 +492,62 @@ struct MainCommandCategory; struct ManeuversArmor; struct Map; struct MapCondition; +struct MapExclusive; struct MapMarker; struct MapMarkerRegion; +struct MapReplace; struct MapSymbol; +struct MapTransientPvPMap; +struct MapType; struct Marker; struct Materia; +struct MateriaGrade; struct MateriaJoinRate; struct MateriaJoinRateGatherCraft; struct MateriaTomestoneRate; +struct McGuffin; +struct McGuffinUIData; struct MiniGameRA; struct MinionRace; struct MinionRules; struct MinionSkillType; +struct MJIAnimals; +struct MJIBuilding; +struct MJIBuildingPlace; +struct MJICraftworksObject; +struct MJICraftworksObjectTheme; +struct MJICraftworksPopularity; +struct MJICraftworksPopularityType; +struct MJICraftworksRankRatio; +struct MJICraftworksSupplyDefine; +struct MJICraftworksTension; +struct MJICropSeed; +struct MJIDisposalShopItem; +struct MJIDisposalShopUICategory; +struct MJIFarmPastureRank; +struct MJIFunction; +struct MJIGathering; +struct MJIGatheringItem; +struct MJIGatheringObject; +struct MJIGatheringTool; +struct MJIHudMode; +struct MJIItemCategory; +struct MJIItemPouch; +struct MJIKeyItem; +struct MJILandmark; +struct MJILandmarkPlace; +struct MJILivelyActor; +struct MJIMinionPopAreas; +struct MJIProgress; +struct MJIRank; +struct MJIRecipe; +struct MJIRecipeMaterial; +struct MJIStockyardManagementArea; +struct MJIStockyardManagementTable; +struct MJIText; +struct MJIVillageAppearanceSG; +struct MJIVillageAppearanceUI; +struct MJIVillageDevelopment; struct MobHuntOrder; struct MobHuntOrderType; struct MobHuntReward; @@ -481,6 +572,9 @@ struct MovieStaffList; struct MovieSubtitle; struct MovieSubtitle500; struct MovieSubtitleVoyage; +struct MultipleHelp; +struct MultipleHelpPage; +struct MultipleHelpString; struct MYCTemporaryItem; struct MYCTemporaryItemUICategory; struct MYCWarResultNotebook; @@ -490,6 +584,8 @@ struct NotoriousMonster; struct NpcEquip; struct NpcYell; struct Omen; +struct Omikuji; +struct OmikujiGuidance; struct OnlineStatus; struct OpenContent; struct OpenContentCandidateName; @@ -499,6 +595,7 @@ struct OrchestrionCategory; struct OrchestrionPath; struct OrchestrionUiparam; struct Ornament; +struct OrnamentAction; struct ParamGrow; struct PartyContent; struct PartyContentCutscene; @@ -515,16 +612,22 @@ struct PhysicsWind; struct Picture; struct PlaceName; struct PlantPotFlowerSeed; +struct PlayerSearchLocation; +struct PlayerSearchSubLocation; struct PreHandler; struct PresetCamera; struct PresetCameraAdjust; +struct PreviewableItems; struct PublicContent; struct PublicContentCutscene; struct PublicContentTextData; struct PvPAction; struct PvPActionSort; +struct PvPBaseParamValue; struct PvPRank; struct PvPSelectTrait; +struct PvPSeries; +struct PvPSeriesLevel; struct PvPTrait; struct Quest; struct QuestAcceptAdditionCondition; @@ -532,9 +635,12 @@ struct QuestBattle; struct QuestChapter; struct QuestClassJobReward; struct QuestClassJobSupply; +struct QuestDefineClient; struct QuestDerivedClass; struct QuestEffect; struct QuestEffectDefine; +struct QuestLinkMarker; +struct QuestLinkMarkerSet; struct QuestRedo; struct QuestRedoChapterUI; struct QuestRedoChapterUICategory; @@ -542,6 +648,8 @@ struct QuestRedoChapterUITab; struct QuestRedoIncompChapter; struct QuestRepeatFlag; struct QuestRewardOther; +struct QuestSelectTitle; +struct QuestSetDefine; struct QuickChat; struct QuickChatTransient; struct Race; @@ -550,6 +658,9 @@ struct RacingChocoboName; struct RacingChocoboNameCategory; struct RacingChocoboNameInfo; struct RacingChocoboParam; +struct RaidFinderParam; +struct ReactionEventObject; +struct ReactionEventObjectInfo; struct RecastNavimesh; struct Recipe; struct RecipeLevelTable; @@ -574,6 +685,7 @@ struct RideShootingTargetType; struct RideShootingTextData; struct RPParameter; struct SatisfactionArbitration; +struct SatisfactionBonusGuarantee; struct SatisfactionNpc; struct SatisfactionSupply; struct SatisfactionSupplyReward; @@ -583,15 +695,21 @@ struct ScenarioTreeTipsClassQuest; struct ScenarioType; struct ScreenImage; struct SecretRecipeBook; +struct SharlayanCraftWorks; +struct SharlayanCraftWorksSupply; +struct ShellFixedFromCommand; struct SkyIsland2Mission; struct SkyIsland2MissionDetail; struct SkyIsland2MissionType; struct SkyIsland2RangeType; +struct Snipe; struct SnipeTalk; struct SnipeTalkName; +struct SpearfishingComboTarget; struct SpearfishingItem; struct SpearfishingNotebook; struct SpearfishingRecordPage; +struct SpearfishingSilhouette; struct SpecialShop; struct SpecialShopItemCategory; struct Stain; @@ -607,11 +725,16 @@ struct SubmarinePart; struct SubmarineRank; struct SwitchTalk; struct SwitchTalkVariation; +struct TelepoRelay; struct TerritoryType; +struct TerritoryTypeTelepo; struct TerritoryTypeTransient; struct TextCommand; struct TextCommandParam; struct Title; +struct TofuEditParam; +struct TofuObject; +struct TofuObjectCategory; struct Tomestones; struct TomestonesItem; struct TopicSelect; @@ -627,6 +750,7 @@ struct TreasureSpot; struct Tribe; struct TripleTriad; struct TripleTriadCard; +struct TripleTriadCardObtain; struct TripleTriadCardRarity; struct TripleTriadCardResident; struct TripleTriadCardType; @@ -640,8 +764,14 @@ struct TutorialTank; struct UDS_Event; struct UDS_Property; struct UIColor; +struct UIConst; struct VaseFlower; struct VFX; +struct VVDData; +struct VVDNotebookContents; +struct VVDNotebookSeries; +struct VVDRouteData; +struct VVDVariantAction; struct Warp; struct WarpCondition; struct WarpLogic; @@ -726,7 +856,7 @@ struct Action uint16_t icon; uint8_t actionCategory; uint8_t animationStart; - uint8_t vFX; + uint16_t vFX; int16_t animationEnd; uint16_t actionTimelineHit; int8_t classJob; @@ -937,6 +1067,7 @@ struct AdventureExPhase uint32_t quest; uint32_t adventureBegin; uint32_t adventureEnd; + uint8_t expansion; AdventureExPhase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -986,6 +1117,7 @@ struct Aetheryte uint16_t map; int16_t aetherstreamX; int16_t aetherstreamY; + uint8_t order; Aetheryte( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -998,6 +1130,12 @@ struct AetheryteSystemDefine AetheryteSystemDefine( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct AetheryteTransient +{ + + AetheryteTransient( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct AirshipExplorationLevel { uint16_t capacity; @@ -1040,15 +1178,31 @@ struct AirshipExplorationPoint { std::string name; std::string nameShort; - uint8_t requiredLevel; - uint16_t requiredFuel; - uint16_t durationmin; - uint8_t requiredSurveillance; + bool passengers; + int16_t x; + int16_t y; + uint8_t rankReq; + uint16_t ceruleumTankReq; + uint16_t surveyDurationmin; + uint16_t surveyDistance; + uint8_t surveillanceReq; uint32_t expReward; AirshipExplorationPoint( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct AkatsukiNote +{ + + AkatsukiNote( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct AkatsukiNoteString +{ + + AkatsukiNoteString( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct AnimationLOD { float cameraDistance; @@ -1277,6 +1431,12 @@ struct AquariumWater AquariumWater( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ArchiveItem +{ + + ArchiveItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ArrayEventHandler { std::vector< uint32_t > data; @@ -1291,6 +1451,17 @@ struct AttackType AttackType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct Attract +{ + uint16_t maxDistance; + uint16_t speed; + int16_t minRemainingDistance; + bool useDistanceBetweenHitboxes; + uint8_t direction; + + Attract( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct BacklightColor { uint32_t color; @@ -1321,32 +1492,127 @@ struct Balloon Balloon( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct BannerBg +{ + int32_t image; + int32_t icon; + uint16_t unlockCondition; + uint16_t sortKey; + std::string name; + + BannerBg( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerCondition +{ + uint8_t unlockType1; + std::vector< uint32_t > unlockCriteria1; + uint8_t unlockType2; + uint32_t unlockCriteria2; + uint32_t unlockCriteria3; + uint32_t unlockCriteria4; + uint8_t prerequisiteType; + uint32_t prerequisite; + uint8_t unlockHint; + + BannerCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerDecoration +{ + int32_t image; + int32_t icon; + uint16_t unlockCondition; + uint16_t sortKey; + std::string name; + + BannerDecoration( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerDesignPreset +{ + uint16_t background; + uint16_t frame; + uint16_t decoration; + uint16_t sortKey; + std::string name; + + BannerDesignPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerFacial +{ + uint16_t emote; + uint16_t unlockCondition; + uint8_t sortKey; + + BannerFacial( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerFrame +{ + int32_t image; + int32_t icon; + uint16_t unlockCondition; + uint16_t sortKey; + std::string name; + + BannerFrame( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerObtainHintType +{ + std::string text; + + BannerObtainHintType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerPreset +{ + + BannerPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct BannerTimeline +{ + uint8_t type; + uint32_t additionalData; + uint8_t acceptClassJobCategory; + uint8_t category; + uint16_t unlockCondition; + uint16_t sortKey; + int32_t icon; + std::string name; + + BannerTimeline( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct BaseParam { int8_t packetIndex; std::string name; std::string description; uint8_t orderPriority; - uint8_t oneHWpn; - uint8_t oH; - uint8_t head; - uint8_t chest; - uint8_t hands; - uint8_t waist; - uint8_t legs; - uint8_t feet; - uint8_t earring; - uint8_t necklace; - uint8_t bracelet; - uint8_t ring; - uint8_t twoHWpn; - uint8_t underArmor; - uint8_t chestHead; - uint8_t chestHeadLegsFeet; - uint8_t legsFeet; - uint8_t headChestHandsLegsFeet; - uint8_t chestLegsGloves; - uint8_t chestLegsFeet; + uint16_t oneHWpn; + uint16_t oH; + uint16_t head; + uint16_t chest; + uint16_t hands; + uint16_t waist; + uint16_t legs; + uint16_t feet; + uint16_t earring; + uint16_t necklace; + uint16_t bracelet; + uint16_t ring; + uint16_t twoHWpn; + uint16_t underArmor; + uint16_t chestHead; + uint16_t chestHeadLegsFeet; + uint16_t legsFeet; + uint16_t headChestHandsLegsFeet; + uint16_t chestLegsGloves; + uint16_t chestLegsFeet; std::vector< uint8_t > meldParam; BaseParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); @@ -1434,7 +1700,7 @@ struct Behavior { uint8_t condition0Target; uint8_t condition0Type; - int32_t balloon; + uint16_t balloon; uint8_t condition1Target; uint8_t condition1Type; uint32_t contentArgument0; @@ -1581,6 +1847,12 @@ struct BNpcBase BNpcBase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct BNpcBasePopVfx +{ + + BNpcBasePopVfx( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct BNpcCustomize { uint8_t race; @@ -1679,6 +1951,12 @@ struct BNpcState BNpcState( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct Booster +{ + + Booster( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Buddy { uint8_t base; @@ -1797,6 +2075,71 @@ struct Channeling Channeling( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct CharaCardBase +{ + int32_t image; + uint8_t fontColor; + uint16_t unlockCondition; + uint16_t sortKey; + std::string name; + + CharaCardBase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct CharaCardDecoration +{ + uint8_t category; + int32_t image; + uint16_t unlockCondition; + uint16_t sortKey; + std::string name; + + CharaCardDecoration( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct CharaCardDesignPreset +{ + uint16_t basePlate; + uint8_t topBorder; + uint8_t bottomBorder; + uint16_t backing; + uint16_t patternOverlay; + uint16_t portraitFrame; + uint16_t plateFrame; + uint16_t accent; + uint16_t sortKey; + std::string name; + + CharaCardDesignPreset( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct CharaCardDesignType +{ + + CharaCardDesignType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct CharaCardHeader +{ + int32_t topImage; + int32_t bottomImage; + uint8_t fontColor; + uint16_t unlockCondition; + uint8_t sortKey; + std::string name; + + CharaCardHeader( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct CharaCardPlayStyle +{ + int32_t icon; + uint8_t sortKey; + std::string name; + + CharaCardPlayStyle( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct CharaMakeClassEquip { uint64_t helmet; @@ -2033,6 +2376,12 @@ struct ClassJob ClassJob( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ClassJobActionSort +{ + + ClassJobActionSort( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ClassJobCategory { std::string name; @@ -2075,6 +2424,8 @@ struct ClassJobCategory bool bLU; bool gNB; bool dNC; + bool rPR; + bool sGE; ClassJobCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -2161,15 +2512,12 @@ struct Companion uint8_t special; uint8_t wanderingWait; uint16_t priority; - bool roulette; - bool battle; - bool lookAt; - bool poke; uint16_t enemy; - bool stroke; - bool clapping; + bool battle; + bool roulette; uint16_t icon; uint16_t order; + bool idleAnimation; uint8_t cost; uint16_t hP; uint16_t skillAngle; @@ -2364,6 +2712,12 @@ struct ContentCloseCycle ContentCloseCycle( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ContentEventItem +{ + + ContentEventItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ContentExAction { uint32_t name; @@ -2399,14 +2753,14 @@ struct ContentFinderCondition uint16_t sortKey; uint32_t image; uint32_t icon; - bool level506070Roulette; bool levelingRoulette; + bool highLevelRoulette; bool mSQRoulette; bool guildHestRoulette; bool expertRoulette; bool trialRoulette; bool dailyFrontlineChallenge; - bool level80Roulette; + bool levelCapRoulette; bool mentorRoulette; bool allianceRoulette; bool feastTeamRoulette; @@ -2471,8 +2825,10 @@ struct ContentRoulette std::string category; std::string description; std::string dutyType; + bool isGoldSaucer; bool isInDutyFinder; uint8_t openRule; + bool isPvP; uint8_t requiredLevel; uint16_t itemLevelRequired; uint32_t icon; @@ -2603,8 +2959,6 @@ struct CraftLeve struct CraftLevelDifference { int16_t difference; - int16_t progressFactor; - int16_t qualityFactor; CraftLevelDifference( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -2756,24 +3110,33 @@ struct DailySupplyItem struct DawnContent { uint32_t content; - uint32_t exp; + uint32_t expBelowExMaxLvl; + uint32_t expAboveExMaxLvl; DawnContent( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct DawnContentParticipable +{ + + DawnContentParticipable( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct DawnGrowMember { - uint32_t member; - uint32_t imageName; - uint32_t bigImageOld; - uint32_t bigImageNew; - uint32_t smallImageOld; - uint32_t smallImageNew; + std::vector< uint32_t > selectImage; + std::vector< uint32_t > portraitImage; uint8_t _class; DawnGrowMember( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct DawnMember +{ + + DawnMember( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct DawnMemberUIParam { std::string classSingular; @@ -2783,19 +3146,9 @@ struct DawnMemberUIParam DawnMemberUIParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; -struct DawnQuestAnnounce -{ - uint32_t quest; - uint8_t content; - std::vector< uint32_t > eNPC; - - DawnQuestAnnounce( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); -}; - struct DawnQuestMember { uint32_t member; - uint32_t imageName; uint32_t bigImageOld; uint32_t bigImageNew; uint8_t _class; @@ -2833,6 +3186,12 @@ struct DeepDungeonDanger DeepDungeonDanger( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct DeepDungeonDemiclone +{ + + DeepDungeonDemiclone( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct DeepDungeonEquipment { uint32_t icon; @@ -3444,6 +3803,12 @@ struct EventItemTimeline EventItemTimeline( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct EventPathMove +{ + + EventPathMove( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct EventSystemDefine { std::string text; @@ -3456,7 +3821,9 @@ struct ExportedGatheringPoint { float x; float y; - uint8_t radius; + uint8_t gatheringType; + uint8_t gatheringPointType; + uint16_t radius; ExportedGatheringPoint( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3468,6 +3835,16 @@ struct ExportedSG ExportedSG( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ExtraCommand +{ + std::string name; + std::string description; + int32_t icon; + int8_t order; + + ExtraCommand( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ExVersion { std::string name; @@ -3477,6 +3854,20 @@ struct ExVersion ExVersion( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct FashionCheckThemeCategory +{ + std::string name; + + FashionCheckThemeCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct FashionCheckWeeklyTheme +{ + std::string name; + + FashionCheckWeeklyTheme( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Fate { std::string name; @@ -3508,7 +3899,7 @@ struct Fate uint32_t arrayIndex; uint32_t reqEventItem; uint32_t turnInEventItem; - std::vector< uint16_t > objectiveIcon; + std::vector< uint32_t > objectiveIcon; Fate( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3548,6 +3939,14 @@ struct FateProgressUI FateProgressUI( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct FateShop +{ + std::vector< uint32_t > specialShop; + std::vector< uint32_t > defaultTalk; + + FateShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct FateTokenType { uint32_t currency; @@ -3634,6 +4033,7 @@ struct FCRank uint16_t rights; uint8_t fCActionActiveNum; uint8_t fCActionStockNum; + uint8_t fCChestCompartments; FCRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3676,6 +4076,12 @@ struct FieldMarker FieldMarker( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct FishingBaitParameter +{ + + FishingBaitParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct FishingRecordType { int32_t addon; @@ -3683,6 +4089,8 @@ struct FishingRecordType uint16_t rankARequirement; uint16_t rankAARequirement; uint16_t rankAAARequirement; + uint16_t rankSRequirement; + uint8_t isSpearfishing; FishingRecordType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3709,7 +4117,7 @@ struct FishingSpot uint16_t radius; std::vector< int32_t > item; uint16_t placeName; - uint8_t order; + uint16_t order; FishingSpot( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3721,7 +4129,7 @@ struct FishParameter uint16_t gatheringItemLevel; bool isHidden; uint8_t fishingRecordType; - int32_t territoryType; + uint16_t fishingSpot; uint16_t gatheringSubCategory; bool isInLog; bool timeRestricted; @@ -3730,6 +4138,30 @@ struct FishParameter FishParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct FittingShop +{ + + FittingShop( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct FittingShopCategory +{ + + FittingShopCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct FittingShopCategoryItem +{ + + FittingShopCategoryItem( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct FittingShopItemSet +{ + + FittingShopItemSet( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Frontline03 { std::vector< uint32_t > emptyIcon; @@ -3765,6 +4197,12 @@ struct FurnitureCatalogItemList FurnitureCatalogItemList( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct GameRewardObtainType +{ + + GameRewardObtainType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct GardeningSeed { uint32_t item; @@ -3775,6 +4213,18 @@ struct GardeningSeed GardeningSeed( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct GathererCrafterTool +{ + + GathererCrafterTool( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct GathererReductionReward +{ + + GathererReductionReward( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct GatheringCondition { std::string text; @@ -3793,6 +4243,7 @@ struct GatheringItem { int32_t item; uint16_t gatheringItemLevel; + uint16_t quest; bool isHidden; GatheringItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); @@ -3873,7 +4324,6 @@ struct GatheringPointBase int32_t gatheringType; uint8_t gatheringLevel; std::vector< int32_t > item; - bool isLimited; GatheringPointBase( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -3927,6 +4377,7 @@ struct GatheringSubCategory { uint8_t gatheringType; uint8_t classJob; + uint32_t quest; uint16_t division; int32_t item; std::string folkloreBook; @@ -4171,6 +4622,7 @@ struct GeneralAction struct GFATE { + std::vector< uint32_t > lGBPopRange; std::vector< uint32_t > icon; GFATE( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); @@ -4561,7 +5013,7 @@ struct HousingUnitedExterior struct HousingYardObject { - uint8_t modelKey; + uint16_t modelKey; uint8_t housingItemCategory; uint8_t usageType; uint32_t usageParameter; @@ -4608,11 +5060,11 @@ struct HugeCraftworksNpc uint16_t classJobCategory; std::vector< uint32_t > itemRequested; std::vector< uint8_t > qtyRequested; - std::vector< uint32_t > itemReward; - std::vector< uint8_t > qtyItemReward; - std::vector< uint32_t > itemUnkown; - std::vector< uint8_t > qtyItemUnkown; - std::string transient; + std::vector< uint8_t > itemReward; + std::vector< bool > qtyItemReward; + std::vector< uint8_t > itemUnkown; + std::vector< bool > qtyItemUnkown; + uint8_t transient; HugeCraftworksNpc( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -4755,7 +5207,7 @@ struct HWDLevelChangeDeception struct HWDSharedGroup { - uint32_t lGB; + uint32_t lGBSharedGroup; uint8_t param; HWDSharedGroup( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); @@ -4768,6 +5220,12 @@ struct HWDSharedGroupControlParam HWDSharedGroupControlParam( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct IconLanguage +{ + + IconLanguage( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct IKDContentBonus { std::string objective; @@ -4834,6 +5292,18 @@ struct InclusionShopSeries InclusionShopSeries( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct InclusionShopWelcom +{ + + InclusionShopWelcom( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct InclusionShopWelcomText +{ + + InclusionShopWelcomText( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct IndividualWeather { std::vector< uint8_t > weather; @@ -4859,17 +5329,19 @@ struct InstanceContent uint32_t instanceContentTextDataObjectiveStart; uint32_t instanceContentTextDataObjectiveEnd; uint16_t sortKey; - uint32_t instanceClearExp; + uint32_t newPlayerBonusGil; + uint32_t newPlayerBonusExp; uint16_t newPlayerBonusA; - uint16_t finalBossCurrencyC; - uint32_t finalBossCurrencyA; - uint16_t finalBossCurrencyB; uint16_t newPlayerBonusB; + uint32_t finalBossExp; + uint16_t finalBossCurrencyA; + uint16_t finalBossCurrencyB; + uint16_t finalBossCurrencyC; + uint32_t instanceClearExp; uint32_t instanceClearGil; uint32_t instanceContentRewardItem; - uint8_t finalBossExp; - uint32_t instanceContentBuff; - int32_t reqInstance; + int32_t instanceContentBuff; + uint32_t reqInstance; int16_t partyCondition; InstanceContent( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); @@ -4898,6 +5370,12 @@ struct InstanceContentGuide InstanceContentGuide( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct InstanceContentQICData +{ + + InstanceContentQICData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct InstanceContentTextData { std::string text; @@ -4936,6 +5414,7 @@ struct Item bool isDyeable; bool isCrestWorthy; uint16_t itemAction; + uint8_t castTimes; uint16_t cooldowns; uint8_t classJobRepair; int32_t itemRepair; @@ -5094,6 +5573,25 @@ struct ItemLevel ItemLevel( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ItemRepairPrice +{ + + ItemRepairPrice( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct ItemRepairResource +{ + uint32_t item; + + ItemRepairResource( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct ItemRetainerLevelUp +{ + + ItemRetainerLevelUp( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ItemSearchCategory { std::string name; @@ -5126,6 +5624,12 @@ struct ItemSpecialBonus ItemSpecialBonus( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct ItemStainCondition +{ + + ItemStainCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ItemUICategory { std::string name; @@ -5203,7 +5707,7 @@ struct LegacyQuest std::string text; std::string string; uint16_t sortKey; - uint8_t genre; + uint32_t genre; LegacyQuest( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -5222,7 +5726,7 @@ struct Leve int32_t placeNameStart; int32_t placeNameIssued; uint8_t classJobCategory; - int32_t journalGenre; + uint32_t journalGenre; int32_t placeNameStartZone; int32_t iconCityState; int32_t dataId; @@ -5419,11 +5923,17 @@ struct Map struct MapCondition { - uint16_t quest; + int32_t quest; MapCondition( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MapExclusive +{ + + MapExclusive( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MapMarker { int16_t x; @@ -5446,6 +5956,12 @@ struct MapMarkerRegion MapMarkerRegion( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MapReplace +{ + + MapReplace( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MapSymbol { int32_t icon; @@ -5455,6 +5971,18 @@ struct MapSymbol MapSymbol( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MapTransientPvPMap +{ + + MapTransientPvPMap( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MapType +{ + + MapType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Marker { int32_t icon; @@ -5472,6 +6000,12 @@ struct Materia Materia( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MateriaGrade +{ + + MateriaGrade( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MateriaJoinRate { std::vector< float > NQOvermeldSlot; @@ -5495,6 +6029,22 @@ struct MateriaTomestoneRate MateriaTomestoneRate( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct McGuffin +{ + uint8_t uIData; + + McGuffin( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct McGuffinUIData +{ + uint16_t order; + uint32_t icon; + std::string name; + + McGuffinUIData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MiniGameRA { int32_t icon; @@ -5526,6 +6076,313 @@ struct MinionSkillType MinionSkillType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MJIAnimals +{ + uint32_t bNpcBase; + uint8_t size; + std::vector< uint32_t > reward; + int32_t icon; + + MJIAnimals( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIBuilding +{ + uint16_t sgb0; + uint16_t sgb1; + uint16_t sgb2; + uint16_t sgb3; + uint16_t sgb4; + std::vector< uint8_t > material; + std::vector< uint8_t > amount; + uint32_t name; + uint32_t icon; + + MJIBuilding( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIBuildingPlace +{ + uint32_t name; + uint32_t sGB; + + MJIBuildingPlace( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksObject +{ + uint16_t item; + std::vector< uint16_t > theme; + uint16_t levelReq; + uint16_t craftingTime; + uint16_t value; + + MJICraftworksObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksObjectTheme +{ + std::string name; + + MJICraftworksObjectTheme( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksPopularity +{ + std::vector< uint8_t > popularity; + + MJICraftworksPopularity( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksPopularityType +{ + uint16_t ratio; + + MJICraftworksPopularityType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksRankRatio +{ + uint16_t ratio; + + MJICraftworksRankRatio( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksSupplyDefine +{ + int16_t supply; + uint16_t ratio; + + MJICraftworksSupplyDefine( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICraftworksTension +{ + + MJICraftworksTension( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJICropSeed +{ + uint32_t item; + uint16_t sGB; + uint32_t name; + + MJICropSeed( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIDisposalShopItem +{ + uint8_t category; + + MJIDisposalShopItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIDisposalShopUICategory +{ + std::string category; + + MJIDisposalShopUICategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIFarmPastureRank +{ + + MJIFarmPastureRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIFunction +{ + + MJIFunction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIGathering +{ + uint8_t gatheringObject; + + MJIGathering( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIGatheringItem +{ + uint32_t item; + uint8_t sort; + int16_t x; + int16_t y; + uint16_t radius; + + MJIGatheringItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIGatheringObject +{ + uint16_t sGB; + uint32_t mapIcon; + uint32_t name; + + MJIGatheringObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIGatheringTool +{ + + MJIGatheringTool( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIHudMode +{ + std::string name; + std::string title; + uint32_t icon; + + MJIHudMode( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIItemCategory +{ + std::string singular; + std::string plural; + + MJIItemCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIItemPouch +{ + uint32_t item; + int32_t category; + uint8_t crop; + + MJIItemPouch( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIKeyItem +{ + int32_t item; + + MJIKeyItem( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJILandmark +{ + uint16_t sGB0; + uint16_t sGB1; + uint16_t sGB2; + uint16_t sGB3; + uint16_t sGB4; + std::vector< uint16_t > material; + std::vector< uint8_t > amount; + uint32_t name; + uint32_t icon; + + MJILandmark( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJILandmarkPlace +{ + uint32_t name; + uint32_t sGB; + + MJILandmarkPlace( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJILivelyActor +{ + uint32_t eNPC; + uint16_t behavior; + float x; + float y; + float z; + float rot; + + MJILivelyActor( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIMinionPopAreas +{ + + MJIMinionPopAreas( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIProgress +{ + std::string vision; + std::string objective; + std::string previousObjective; + + MJIProgress( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIRank +{ + uint32_t expToNext; + std::vector< uint32_t > logMessage; + + MJIRank( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIRecipe +{ + uint32_t logMessage; + uint8_t keyItem; + uint8_t itemPouch; + uint8_t order; + + MJIRecipe( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIRecipeMaterial +{ + int32_t itemPouch; + + MJIRecipeMaterial( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIStockyardManagementArea +{ + uint8_t rareMaterial; + uint16_t area; + + MJIStockyardManagementArea( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIStockyardManagementTable +{ + uint8_t material; + + MJIStockyardManagementTable( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIText +{ + std::string text; + + MJIText( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIVillageAppearanceSG +{ + std::vector< uint16_t > sGB; + + MJIVillageAppearanceSG( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIVillageAppearanceUI +{ + int32_t floor; + + MJIVillageAppearanceUI( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MJIVillageDevelopment +{ + uint32_t eNPC; + uint16_t behavior0; + uint16_t behavior1; + + MJIVillageDevelopment( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MobHuntOrder { uint16_t target; @@ -5697,8 +6554,10 @@ struct MountAction struct MountCustomize { - uint16_t hyurMaleScale; - uint16_t hyurFemaleScale; + uint16_t hyurMidlanderMaleScale; + uint16_t hyurMidlanderFemaleScale; + uint16_t hyurHighlanderMaleScale; + uint16_t hyurHighlanderFemaleScale; uint16_t elezenMaleScale; uint16_t elezenFemaleScale; uint16_t lalaMaleScale; @@ -5710,11 +6569,12 @@ struct MountCustomize uint16_t auRaMaleScale; uint16_t auRaFemaleScale; uint16_t hrothgarMaleScale; - uint16_t hrothgarFemaleScale; uint16_t vieraMaleScale; uint16_t vieraFemaleScale; - uint8_t hyurMaleCameraHeight; - uint8_t hyurFemaleCameraHeight; + uint16_t hyurMidlanderMaleCameraHeight; + uint8_t hyurMidlanderFemaleCameraHeight; + uint8_t hyurHighlanderMaleCameraHeight; + uint8_t hyurHighlanderFemaleCameraHeight; uint8_t elezenMaleCameraHeight; uint8_t elezenFemaleCameraHeight; uint8_t lalaMaleCameraHeight; @@ -5726,7 +6586,6 @@ struct MountCustomize uint8_t auRaMaleCameraHeight; uint8_t auRaFemaleCameraHeight; uint8_t hrothgarMaleCameraHeight; - uint8_t hrothgarRoeFemaleCameraHeight; uint8_t vieraMaleCameraHeight; uint8_t vieraFemaleCameraHeight; @@ -5813,6 +6672,24 @@ struct MovieSubtitleVoyage MovieSubtitleVoyage( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct MultipleHelp +{ + + MultipleHelp( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MultipleHelpPage +{ + + MultipleHelpPage( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct MultipleHelpString +{ + + MultipleHelpString( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct MYCTemporaryItem { uint8_t category; @@ -5936,6 +6813,18 @@ struct Omen Omen( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct Omikuji +{ + + Omikuji( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct OmikujiGuidance +{ + + OmikujiGuidance( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct OnlineStatus { bool list; @@ -6019,6 +6908,12 @@ struct Ornament Ornament( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct OrnamentAction +{ + + OrnamentAction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct ParamGrow { int32_t expToNext; @@ -6166,8 +7061,8 @@ struct PhysicsWind struct Picture { - int32_t item; int32_t image; + int32_t signature; Picture( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -6187,6 +7082,18 @@ struct PlantPotFlowerSeed PlantPotFlowerSeed( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct PlayerSearchLocation +{ + + PlayerSearchLocation( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct PlayerSearchSubLocation +{ + + PlayerSearchSubLocation( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct PreHandler { uint32_t image; @@ -6241,6 +7148,12 @@ struct PresetCameraAdjust PresetCameraAdjust( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct PreviewableItems +{ + + PreviewableItems( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct PublicContent { uint8_t type; @@ -6290,6 +7203,12 @@ struct PvPActionSort PvPActionSort( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct PvPBaseParamValue +{ + + PvPBaseParamValue( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct PvPRank { uint32_t expRequired; @@ -6306,6 +7225,18 @@ struct PvPSelectTrait PvPSelectTrait( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct PvPSeries +{ + + PvPSeries( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct PvPSeriesLevel +{ + + PvPSeriesLevel( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct PvPTrait { uint16_t trait1; @@ -6382,23 +7313,24 @@ struct Quest std::vector< bool > canTargetBool; std::vector< uint8_t > toDoCompleteSeq; std::vector< uint8_t > toDoQty; - std::vector< uint32_t > toDoMainLocation; std::vector< uint8_t > countableNum; uint8_t levelMax; uint8_t classJobRequired; + uint8_t questRewardOtherDisplay; uint16_t expFactor; uint32_t gilReward; - uint32_t gCSeals; + uint32_t currencyReward; + uint32_t currencyRewardCount; std::vector< uint8_t > itemCatalyst; std::vector< uint8_t > itemCountCatalyst; uint8_t itemRewardType; - std::vector< uint32_t > itemReward0; - std::vector< uint8_t > itemCountReward0; - std::vector< uint8_t > stainReward0; - std::vector< uint32_t > itemReward1; - std::vector< uint8_t > itemCountReward1; - std::vector< bool > isHQReward1; - std::vector< uint8_t > stainReward1; + std::vector< uint32_t > itemReward; + std::vector< uint8_t > itemCountReward; + std::vector< uint8_t > stainReward; + std::vector< uint32_t > optionalItemReward; + std::vector< uint8_t > optionalItemCountReward; + std::vector< bool > optionalItemIsHQReward; + std::vector< uint8_t > optionalItemStainReward; uint8_t emoteReward; uint16_t actionReward; std::vector< uint8_t > generalActionReward; @@ -6407,11 +7339,12 @@ struct Quest uint16_t systemReward1; uint16_t gCTypeReward; uint32_t instanceContentUnlock; + uint8_t tomestone; uint8_t tomestoneReward; uint8_t tomestoneCountReward; uint8_t reputationReward; uint16_t placeName; - uint8_t journalGenre; + uint32_t journalGenre; uint32_t icon; uint32_t iconSpecial; bool introduction; @@ -6472,6 +7405,12 @@ struct QuestClassJobSupply QuestClassJobSupply( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct QuestDefineClient +{ + + QuestDefineClient( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct QuestDerivedClass { uint8_t classJob; @@ -6492,6 +7431,18 @@ struct QuestEffectDefine QuestEffectDefine( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct QuestLinkMarker +{ + + QuestLinkMarker( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct QuestLinkMarkerSet +{ + + QuestLinkMarkerSet( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct QuestRedo { uint32_t finalQuest; @@ -6554,6 +7505,18 @@ struct QuestRewardOther QuestRewardOther( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct QuestSelectTitle +{ + + QuestSelectTitle( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct QuestSetDefine +{ + + QuestSetDefine( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct QuickChat { std::string nameAction; @@ -6627,6 +7590,24 @@ struct RacingChocoboParam RacingChocoboParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct RaidFinderParam +{ + + RaidFinderParam( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct ReactionEventObject +{ + + ReactionEventObject( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct ReactionEventObjectInfo +{ + + ReactionEventObjectInfo( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct RecastNavimesh { float tileSize; @@ -6654,16 +7635,19 @@ struct Recipe uint16_t recipeLevelTable; int32_t itemResult; uint8_t amountResult; + uint16_t recipeNotebookList; bool isSecondary; uint8_t materialQualityFactor; uint16_t difficultyFactor; uint16_t qualityFactor; uint16_t durabilityFactor; + uint32_t requiredQuality; uint16_t requiredCraftsmanship; uint16_t requiredControl; uint16_t quickSynthCraftsmanship; uint16_t quickSynthControl; uint16_t secretRecipeBook; + uint32_t quest; bool canQuickSynth; bool canHq; bool expRewarded; @@ -6684,6 +7668,10 @@ struct RecipeLevelTable uint16_t suggestedControl; uint16_t difficulty; uint32_t quality; + uint8_t progressDivider; + uint8_t qualityDivider; + uint8_t progressModifier; + uint8_t qualityModifier; uint16_t durability; uint16_t conditionsFlag; @@ -6843,9 +7831,7 @@ struct RetainerTaskLvRange struct RetainerTaskNormal { int32_t item; - uint8_t quantity0; - uint8_t quantity1; - uint8_t quantity2; + std::vector< uint8_t > quantity; int16_t gatheringLog; int16_t fishingLog; @@ -6855,8 +7841,8 @@ struct RetainerTaskNormal struct RetainerTaskParameter { std::vector< int16_t > itemLevelDoW; - std::vector< int16_t > gatheringDoL; - std::vector< int16_t > gatheringFSH; + std::vector< int16_t > perceptionDoL; + std::vector< int16_t > perceptionFSH; RetainerTaskParameter( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -6905,11 +7891,19 @@ struct RPParameter struct SatisfactionArbitration { + uint8_t satisfactionLevel; + uint8_t satisfactionNpc; uint32_t quest; SatisfactionArbitration( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct SatisfactionBonusGuarantee +{ + + SatisfactionBonusGuarantee( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct SatisfactionNpc { int32_t npc; @@ -6951,7 +7945,9 @@ struct SatisfactionSupplyReward struct ScenarioTree { uint8_t type; - uint16_t image; + uint32_t addon; + uint32_t questChapter; + std::string name; ScenarioTree( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -6999,6 +7995,24 @@ struct SecretRecipeBook SecretRecipeBook( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct SharlayanCraftWorks +{ + + SharlayanCraftWorks( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct SharlayanCraftWorksSupply +{ + + SharlayanCraftWorksSupply( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct ShellFixedFromCommand +{ + + ShellFixedFromCommand( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct SkyIsland2Mission { uint32_t item1; @@ -7041,6 +8055,24 @@ struct SkyIsland2RangeType SkyIsland2RangeType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct Snipe +{ + uint32_t lGBTargetMarker; + std::string vFXFire; + std::string vFXHit; + std::string vFXMiss; + std::string vFXAdditional; + std::vector< uint32_t > lGBEventNPC0; + std::vector< uint32_t > lGBEventNPC1; + std::string objective0; + std::string hint0; + std::string objective1; + std::string hint1; + std::string actionText; + + Snipe( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct SnipeTalk { uint16_t name; @@ -7056,6 +8088,12 @@ struct SnipeTalkName SnipeTalkName( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct SpearfishingComboTarget +{ + + SpearfishingComboTarget( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct SpearfishingItem { std::string description; @@ -7090,6 +8128,12 @@ struct SpearfishingRecordPage SpearfishingRecordPage( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct SpearfishingSilhouette +{ + + SpearfishingSilhouette( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct SpecialShop { std::string name; @@ -7142,20 +8186,28 @@ struct Status std::string description; uint16_t icon; uint8_t maxStacks; - uint8_t category; + uint8_t classJobCategory; + uint8_t statusCategory; uint8_t hitEffect; uint16_t vFX; bool lockMovement; bool lockActions; bool lockControl; bool transfiguration; + bool isGaze; bool canDispel; bool inflictedByActor; bool isPermanent; uint8_t partyListPriority; + uint8_t canIncreaseRewards; + int16_t paramModifier; + uint8_t paramEffect; + bool canStatusOff; uint16_t log; bool isFcBuff; bool invisibility; + uint8_t targetType; + uint8_t flags; Status( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -7208,12 +8260,16 @@ struct SubmarineExploration { std::string destination; std::string location; + int16_t x; + int16_t y; + int16_t z; uint8_t map; + bool passengers; uint8_t stars; uint8_t rankReq; uint8_t ceruleumTankReq; - uint16_t durationmin; - uint8_t distanceForSurvey; + uint16_t surveyDurationmin; + uint8_t surveyDistance; uint32_t expReward; SubmarineExploration( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); @@ -7271,6 +8327,12 @@ struct SwitchTalkVariation SwitchTalkVariation( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct TelepoRelay +{ + + TelepoRelay( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct TerritoryType { std::string name; @@ -7304,6 +8366,12 @@ struct TerritoryType TerritoryType( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct TerritoryTypeTelepo +{ + + TerritoryTypeTelepo( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct TerritoryTypeTransient { int16_t offsetZ; @@ -7340,6 +8408,24 @@ struct Title Title( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct TofuEditParam +{ + + TofuEditParam( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct TofuObject +{ + + TofuObject( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct TofuObjectCategory +{ + + TofuObjectCategory( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Tomestones { uint16_t weeklyLimit; @@ -7429,7 +8515,7 @@ struct Transformation struct Treasure { - uint32_t item; + uint32_t sGB; Treasure( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -7508,6 +8594,12 @@ struct TripleTriadCard TripleTriadCard( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct TripleTriadCardObtain +{ + + TripleTriadCardObtain( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct TripleTriadCardRarity { uint8_t stars; @@ -7622,6 +8714,12 @@ struct UIColor UIColor( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct UIConst +{ + + UIConst( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct VaseFlower { uint32_t item; @@ -7636,6 +8734,43 @@ struct VFX VFX( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); }; +struct VVDData +{ + + VVDData( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct VVDNotebookContents +{ + int32_t icon; + int32_t image; + std::string name; + std::string description; + + VVDNotebookContents( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct VVDNotebookSeries +{ + std::string name; + std::vector< int32_t > contents; + + VVDNotebookSeries( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct VVDRouteData +{ + + VVDRouteData( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); +}; + +struct VVDVariantAction +{ + uint32_t action; + + VVDVariantAction( uint32_t row_id, Sapphire::Data::ExdDataGenerated* exdData ); +}; + struct Warp { uint32_t popRange; @@ -7778,7 +8913,9 @@ struct WeeklyLotBonus struct World { + std::string internalName; std::string name; + uint8_t region; uint8_t userType; uint8_t dataCenter; bool isPublic; @@ -7820,12 +8957,19 @@ struct YKW struct ZoneSharedGroup { + uint32_t lGBSharedGroup; + uint32_t quest0; + uint32_t seq0; uint32_t quest1; + uint32_t seq1; uint32_t quest2; + uint32_t seq2; uint32_t quest3; + uint32_t seq3; uint32_t quest4; + uint32_t seq4; uint32_t quest5; - uint32_t quest6; + uint32_t seq5; ZoneSharedGroup( uint32_t row_id, uint32_t subRow, Sapphire::Data::ExdDataGenerated* exdData ); }; @@ -7917,11 +9061,14 @@ struct ZoneSharedGroup xiv::exd::Exd m_AetherialWheelDat; xiv::exd::Exd m_AetheryteDat; xiv::exd::Exd m_AetheryteSystemDefineDat; + xiv::exd::Exd m_AetheryteTransientDat; xiv::exd::Exd m_AirshipExplorationLevelDat; xiv::exd::Exd m_AirshipExplorationLogDat; xiv::exd::Exd m_AirshipExplorationParamTypeDat; xiv::exd::Exd m_AirshipExplorationPartDat; xiv::exd::Exd m_AirshipExplorationPointDat; + xiv::exd::Exd m_AkatsukiNoteDat; + xiv::exd::Exd m_AkatsukiNoteStringDat; xiv::exd::Exd m_AnimationLODDat; xiv::exd::Exd m_AnimaWeapon5Dat; xiv::exd::Exd m_AnimaWeapon5ParamDat; @@ -7943,11 +9090,22 @@ struct ZoneSharedGroup xiv::exd::Exd m_AOZScoreDat; xiv::exd::Exd m_AquariumFishDat; xiv::exd::Exd m_AquariumWaterDat; + xiv::exd::Exd m_ArchiveItemDat; xiv::exd::Exd m_ArrayEventHandlerDat; xiv::exd::Exd m_AttackTypeDat; + xiv::exd::Exd m_AttractDat; xiv::exd::Exd m_BacklightColorDat; xiv::exd::Exd m_BallistaDat; xiv::exd::Exd m_BalloonDat; + xiv::exd::Exd m_BannerBgDat; + xiv::exd::Exd m_BannerConditionDat; + xiv::exd::Exd m_BannerDecorationDat; + xiv::exd::Exd m_BannerDesignPresetDat; + xiv::exd::Exd m_BannerFacialDat; + xiv::exd::Exd m_BannerFrameDat; + xiv::exd::Exd m_BannerObtainHintTypeDat; + xiv::exd::Exd m_BannerPresetDat; + xiv::exd::Exd m_BannerTimelineDat; xiv::exd::Exd m_BaseParamDat; xiv::exd::Exd m_BattleLeveDat; xiv::exd::Exd m_BattleLeveRuleDat; @@ -7966,10 +9124,12 @@ struct ZoneSharedGroup xiv::exd::Exd m_BGMSystemDefineDat; xiv::exd::Exd m_BNpcAnnounceIconDat; xiv::exd::Exd m_BNpcBaseDat; + xiv::exd::Exd m_BNpcBasePopVfxDat; xiv::exd::Exd m_BNpcCustomizeDat; xiv::exd::Exd m_BNpcNameDat; xiv::exd::Exd m_BNpcPartsDat; xiv::exd::Exd m_BNpcStateDat; + xiv::exd::Exd m_BoosterDat; xiv::exd::Exd m_BuddyDat; xiv::exd::Exd m_BuddyActionDat; xiv::exd::Exd m_BuddyEquipDat; @@ -7981,6 +9141,12 @@ struct ZoneSharedGroup xiv::exd::Exd m_CalendarDat; xiv::exd::Exd m_CarryDat; xiv::exd::Exd m_ChannelingDat; + xiv::exd::Exd m_CharaCardBaseDat; + xiv::exd::Exd m_CharaCardDecorationDat; + xiv::exd::Exd m_CharaCardDesignPresetDat; + xiv::exd::Exd m_CharaCardDesignTypeDat; + xiv::exd::Exd m_CharaCardHeaderDat; + xiv::exd::Exd m_CharaCardPlayStyleDat; xiv::exd::Exd m_CharaMakeClassEquipDat; xiv::exd::Exd m_CharaMakeCustomizeDat; xiv::exd::Exd m_CharaMakeNameDat; @@ -7998,6 +9164,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_ChocoboTaxiStandDat; xiv::exd::Exd m_CircleActivityDat; xiv::exd::Exd m_ClassJobDat; + xiv::exd::Exd m_ClassJobActionSortDat; xiv::exd::Exd m_ClassJobCategoryDat; xiv::exd::Exd m_CollectablesShopDat; xiv::exd::Exd m_CollectablesShopItemDat; @@ -8025,6 +9192,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_ConditionDat; xiv::exd::Exd m_ConfigKeyDat; xiv::exd::Exd m_ContentCloseCycleDat; + xiv::exd::Exd m_ContentEventItemDat; xiv::exd::Exd m_ContentExActionDat; xiv::exd::Exd m_ContentFinderConditionDat; xiv::exd::Exd m_ContentFinderConditionTransientDat; @@ -8062,13 +9230,15 @@ struct ZoneSharedGroup xiv::exd::Exd m_CycleTimeDat; xiv::exd::Exd m_DailySupplyItemDat; xiv::exd::Exd m_DawnContentDat; + xiv::exd::Exd m_DawnContentParticipableDat; xiv::exd::Exd m_DawnGrowMemberDat; + xiv::exd::Exd m_DawnMemberDat; xiv::exd::Exd m_DawnMemberUIParamDat; - xiv::exd::Exd m_DawnQuestAnnounceDat; xiv::exd::Exd m_DawnQuestMemberDat; xiv::exd::Exd m_DeepDungeonDat; xiv::exd::Exd m_DeepDungeonBanDat; xiv::exd::Exd m_DeepDungeonDangerDat; + xiv::exd::Exd m_DeepDungeonDemicloneDat; xiv::exd::Exd m_DeepDungeonEquipmentDat; xiv::exd::Exd m_DeepDungeonFloorEffectUIDat; xiv::exd::Exd m_DeepDungeonItemDat; @@ -8123,14 +9293,19 @@ struct ZoneSharedGroup xiv::exd::Exd m_EventItemCastTimelineDat; xiv::exd::Exd m_EventItemHelpDat; xiv::exd::Exd m_EventItemTimelineDat; + xiv::exd::Exd m_EventPathMoveDat; xiv::exd::Exd m_EventSystemDefineDat; xiv::exd::Exd m_ExportedGatheringPointDat; xiv::exd::Exd m_ExportedSGDat; + xiv::exd::Exd m_ExtraCommandDat; xiv::exd::Exd m_ExVersionDat; + xiv::exd::Exd m_FashionCheckThemeCategoryDat; + xiv::exd::Exd m_FashionCheckWeeklyThemeDat; xiv::exd::Exd m_FateDat; xiv::exd::Exd m_FateEventDat; xiv::exd::Exd m_FateModeDat; xiv::exd::Exd m_FateProgressUIDat; + xiv::exd::Exd m_FateShopDat; xiv::exd::Exd m_FateTokenTypeDat; xiv::exd::Exd m_FCActivityDat; xiv::exd::Exd m_FCActivityCategoryDat; @@ -8146,15 +9321,23 @@ struct ZoneSharedGroup xiv::exd::Exd m_FCRightsDat; xiv::exd::Exd m_FestivalDat; xiv::exd::Exd m_FieldMarkerDat; + xiv::exd::Exd m_FishingBaitParameterDat; xiv::exd::Exd m_FishingRecordTypeDat; xiv::exd::Exd m_FishingRecordTypeTransientDat; xiv::exd::Exd m_FishingSpotDat; xiv::exd::Exd m_FishParameterDat; + xiv::exd::Exd m_FittingShopDat; + xiv::exd::Exd m_FittingShopCategoryDat; + xiv::exd::Exd m_FittingShopCategoryItemDat; + xiv::exd::Exd m_FittingShopItemSetDat; xiv::exd::Exd m_Frontline03Dat; xiv::exd::Exd m_Frontline04Dat; xiv::exd::Exd m_FurnitureCatalogCategoryDat; xiv::exd::Exd m_FurnitureCatalogItemListDat; + xiv::exd::Exd m_GameRewardObtainTypeDat; xiv::exd::Exd m_GardeningSeedDat; + xiv::exd::Exd m_GathererCrafterToolDat; + xiv::exd::Exd m_GathererReductionRewardDat; xiv::exd::Exd m_GatheringConditionDat; xiv::exd::Exd m_GatheringExpDat; xiv::exd::Exd m_GatheringItemDat; @@ -8258,6 +9441,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_HWDLevelChangeDeceptionDat; xiv::exd::Exd m_HWDSharedGroupDat; xiv::exd::Exd m_HWDSharedGroupControlParamDat; + xiv::exd::Exd m_IconLanguageDat; xiv::exd::Exd m_IKDContentBonusDat; xiv::exd::Exd m_IKDFishParamDat; xiv::exd::Exd m_IKDRouteDat; @@ -8266,11 +9450,14 @@ struct ZoneSharedGroup xiv::exd::Exd m_InclusionShopDat; xiv::exd::Exd m_InclusionShopCategoryDat; xiv::exd::Exd m_InclusionShopSeriesDat; + xiv::exd::Exd m_InclusionShopWelcomDat; + xiv::exd::Exd m_InclusionShopWelcomTextDat; xiv::exd::Exd m_IndividualWeatherDat; xiv::exd::Exd m_InstanceContentDat; xiv::exd::Exd m_InstanceContentBuffDat; xiv::exd::Exd m_InstanceContentCSBonusDat; xiv::exd::Exd m_InstanceContentGuideDat; + xiv::exd::Exd m_InstanceContentQICDataDat; xiv::exd::Exd m_InstanceContentTextDataDat; xiv::exd::Exd m_ItemDat; xiv::exd::Exd m_ItemActionDat; @@ -8278,10 +9465,14 @@ struct ZoneSharedGroup xiv::exd::Exd m_ItemBarterCheckDat; xiv::exd::Exd m_ItemFoodDat; xiv::exd::Exd m_ItemLevelDat; + xiv::exd::Exd m_ItemRepairPriceDat; + xiv::exd::Exd m_ItemRepairResourceDat; + xiv::exd::Exd m_ItemRetainerLevelUpDat; xiv::exd::Exd m_ItemSearchCategoryDat; xiv::exd::Exd m_ItemSeriesDat; xiv::exd::Exd m_ItemSortCategoryDat; xiv::exd::Exd m_ItemSpecialBonusDat; + xiv::exd::Exd m_ItemStainConditionDat; xiv::exd::Exd m_ItemUICategoryDat; xiv::exd::Exd m_JingleDat; xiv::exd::Exd m_JobHudManualDat; @@ -8311,18 +9502,62 @@ struct ZoneSharedGroup xiv::exd::Exd m_ManeuversArmorDat; xiv::exd::Exd m_MapDat; xiv::exd::Exd m_MapConditionDat; + xiv::exd::Exd m_MapExclusiveDat; xiv::exd::Exd m_MapMarkerDat; xiv::exd::Exd m_MapMarkerRegionDat; + xiv::exd::Exd m_MapReplaceDat; xiv::exd::Exd m_MapSymbolDat; + xiv::exd::Exd m_MapTransientPvPMapDat; + xiv::exd::Exd m_MapTypeDat; xiv::exd::Exd m_MarkerDat; xiv::exd::Exd m_MateriaDat; + xiv::exd::Exd m_MateriaGradeDat; xiv::exd::Exd m_MateriaJoinRateDat; xiv::exd::Exd m_MateriaJoinRateGatherCraftDat; xiv::exd::Exd m_MateriaTomestoneRateDat; + xiv::exd::Exd m_McGuffinDat; + xiv::exd::Exd m_McGuffinUIDataDat; xiv::exd::Exd m_MiniGameRADat; xiv::exd::Exd m_MinionRaceDat; xiv::exd::Exd m_MinionRulesDat; xiv::exd::Exd m_MinionSkillTypeDat; + xiv::exd::Exd m_MJIAnimalsDat; + xiv::exd::Exd m_MJIBuildingDat; + xiv::exd::Exd m_MJIBuildingPlaceDat; + xiv::exd::Exd m_MJICraftworksObjectDat; + xiv::exd::Exd m_MJICraftworksObjectThemeDat; + xiv::exd::Exd m_MJICraftworksPopularityDat; + xiv::exd::Exd m_MJICraftworksPopularityTypeDat; + xiv::exd::Exd m_MJICraftworksRankRatioDat; + xiv::exd::Exd m_MJICraftworksSupplyDefineDat; + xiv::exd::Exd m_MJICraftworksTensionDat; + xiv::exd::Exd m_MJICropSeedDat; + xiv::exd::Exd m_MJIDisposalShopItemDat; + xiv::exd::Exd m_MJIDisposalShopUICategoryDat; + xiv::exd::Exd m_MJIFarmPastureRankDat; + xiv::exd::Exd m_MJIFunctionDat; + xiv::exd::Exd m_MJIGatheringDat; + xiv::exd::Exd m_MJIGatheringItemDat; + xiv::exd::Exd m_MJIGatheringObjectDat; + xiv::exd::Exd m_MJIGatheringToolDat; + xiv::exd::Exd m_MJIHudModeDat; + xiv::exd::Exd m_MJIItemCategoryDat; + xiv::exd::Exd m_MJIItemPouchDat; + xiv::exd::Exd m_MJIKeyItemDat; + xiv::exd::Exd m_MJILandmarkDat; + xiv::exd::Exd m_MJILandmarkPlaceDat; + xiv::exd::Exd m_MJILivelyActorDat; + xiv::exd::Exd m_MJIMinionPopAreasDat; + xiv::exd::Exd m_MJIProgressDat; + xiv::exd::Exd m_MJIRankDat; + xiv::exd::Exd m_MJIRecipeDat; + xiv::exd::Exd m_MJIRecipeMaterialDat; + xiv::exd::Exd m_MJIStockyardManagementAreaDat; + xiv::exd::Exd m_MJIStockyardManagementTableDat; + xiv::exd::Exd m_MJITextDat; + xiv::exd::Exd m_MJIVillageAppearanceSGDat; + xiv::exd::Exd m_MJIVillageAppearanceUIDat; + xiv::exd::Exd m_MJIVillageDevelopmentDat; xiv::exd::Exd m_MobHuntOrderDat; xiv::exd::Exd m_MobHuntOrderTypeDat; xiv::exd::Exd m_MobHuntRewardDat; @@ -8347,6 +9582,9 @@ struct ZoneSharedGroup xiv::exd::Exd m_MovieSubtitleDat; xiv::exd::Exd m_MovieSubtitle500Dat; xiv::exd::Exd m_MovieSubtitleVoyageDat; + xiv::exd::Exd m_MultipleHelpDat; + xiv::exd::Exd m_MultipleHelpPageDat; + xiv::exd::Exd m_MultipleHelpStringDat; xiv::exd::Exd m_MYCTemporaryItemDat; xiv::exd::Exd m_MYCTemporaryItemUICategoryDat; xiv::exd::Exd m_MYCWarResultNotebookDat; @@ -8356,6 +9594,8 @@ struct ZoneSharedGroup xiv::exd::Exd m_NpcEquipDat; xiv::exd::Exd m_NpcYellDat; xiv::exd::Exd m_OmenDat; + xiv::exd::Exd m_OmikujiDat; + xiv::exd::Exd m_OmikujiGuidanceDat; xiv::exd::Exd m_OnlineStatusDat; xiv::exd::Exd m_OpenContentDat; xiv::exd::Exd m_OpenContentCandidateNameDat; @@ -8365,6 +9605,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_OrchestrionPathDat; xiv::exd::Exd m_OrchestrionUiparamDat; xiv::exd::Exd m_OrnamentDat; + xiv::exd::Exd m_OrnamentActionDat; xiv::exd::Exd m_ParamGrowDat; xiv::exd::Exd m_PartyContentDat; xiv::exd::Exd m_PartyContentCutsceneDat; @@ -8381,16 +9622,22 @@ struct ZoneSharedGroup xiv::exd::Exd m_PictureDat; xiv::exd::Exd m_PlaceNameDat; xiv::exd::Exd m_PlantPotFlowerSeedDat; + xiv::exd::Exd m_PlayerSearchLocationDat; + xiv::exd::Exd m_PlayerSearchSubLocationDat; xiv::exd::Exd m_PreHandlerDat; xiv::exd::Exd m_PresetCameraDat; xiv::exd::Exd m_PresetCameraAdjustDat; + xiv::exd::Exd m_PreviewableItemsDat; xiv::exd::Exd m_PublicContentDat; xiv::exd::Exd m_PublicContentCutsceneDat; xiv::exd::Exd m_PublicContentTextDataDat; xiv::exd::Exd m_PvPActionDat; xiv::exd::Exd m_PvPActionSortDat; + xiv::exd::Exd m_PvPBaseParamValueDat; xiv::exd::Exd m_PvPRankDat; xiv::exd::Exd m_PvPSelectTraitDat; + xiv::exd::Exd m_PvPSeriesDat; + xiv::exd::Exd m_PvPSeriesLevelDat; xiv::exd::Exd m_PvPTraitDat; xiv::exd::Exd m_QuestDat; xiv::exd::Exd m_QuestAcceptAdditionConditionDat; @@ -8398,9 +9645,12 @@ struct ZoneSharedGroup xiv::exd::Exd m_QuestChapterDat; xiv::exd::Exd m_QuestClassJobRewardDat; xiv::exd::Exd m_QuestClassJobSupplyDat; + xiv::exd::Exd m_QuestDefineClientDat; xiv::exd::Exd m_QuestDerivedClassDat; xiv::exd::Exd m_QuestEffectDat; xiv::exd::Exd m_QuestEffectDefineDat; + xiv::exd::Exd m_QuestLinkMarkerDat; + xiv::exd::Exd m_QuestLinkMarkerSetDat; xiv::exd::Exd m_QuestRedoDat; xiv::exd::Exd m_QuestRedoChapterUIDat; xiv::exd::Exd m_QuestRedoChapterUICategoryDat; @@ -8408,6 +9658,8 @@ struct ZoneSharedGroup xiv::exd::Exd m_QuestRedoIncompChapterDat; xiv::exd::Exd m_QuestRepeatFlagDat; xiv::exd::Exd m_QuestRewardOtherDat; + xiv::exd::Exd m_QuestSelectTitleDat; + xiv::exd::Exd m_QuestSetDefineDat; xiv::exd::Exd m_QuickChatDat; xiv::exd::Exd m_QuickChatTransientDat; xiv::exd::Exd m_RaceDat; @@ -8416,6 +9668,9 @@ struct ZoneSharedGroup xiv::exd::Exd m_RacingChocoboNameCategoryDat; xiv::exd::Exd m_RacingChocoboNameInfoDat; xiv::exd::Exd m_RacingChocoboParamDat; + xiv::exd::Exd m_RaidFinderParamDat; + xiv::exd::Exd m_ReactionEventObjectDat; + xiv::exd::Exd m_ReactionEventObjectInfoDat; xiv::exd::Exd m_RecastNavimeshDat; xiv::exd::Exd m_RecipeDat; xiv::exd::Exd m_RecipeLevelTableDat; @@ -8440,6 +9695,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_RideShootingTextDataDat; xiv::exd::Exd m_RPParameterDat; xiv::exd::Exd m_SatisfactionArbitrationDat; + xiv::exd::Exd m_SatisfactionBonusGuaranteeDat; xiv::exd::Exd m_SatisfactionNpcDat; xiv::exd::Exd m_SatisfactionSupplyDat; xiv::exd::Exd m_SatisfactionSupplyRewardDat; @@ -8449,15 +9705,21 @@ struct ZoneSharedGroup xiv::exd::Exd m_ScenarioTypeDat; xiv::exd::Exd m_ScreenImageDat; xiv::exd::Exd m_SecretRecipeBookDat; + xiv::exd::Exd m_SharlayanCraftWorksDat; + xiv::exd::Exd m_SharlayanCraftWorksSupplyDat; + xiv::exd::Exd m_ShellFixedFromCommandDat; xiv::exd::Exd m_SkyIsland2MissionDat; xiv::exd::Exd m_SkyIsland2MissionDetailDat; xiv::exd::Exd m_SkyIsland2MissionTypeDat; xiv::exd::Exd m_SkyIsland2RangeTypeDat; + xiv::exd::Exd m_SnipeDat; xiv::exd::Exd m_SnipeTalkDat; xiv::exd::Exd m_SnipeTalkNameDat; + xiv::exd::Exd m_SpearfishingComboTargetDat; xiv::exd::Exd m_SpearfishingItemDat; xiv::exd::Exd m_SpearfishingNotebookDat; xiv::exd::Exd m_SpearfishingRecordPageDat; + xiv::exd::Exd m_SpearfishingSilhouetteDat; xiv::exd::Exd m_SpecialShopDat; xiv::exd::Exd m_SpecialShopItemCategoryDat; xiv::exd::Exd m_StainDat; @@ -8473,11 +9735,16 @@ struct ZoneSharedGroup xiv::exd::Exd m_SubmarineRankDat; xiv::exd::Exd m_SwitchTalkDat; xiv::exd::Exd m_SwitchTalkVariationDat; + xiv::exd::Exd m_TelepoRelayDat; xiv::exd::Exd m_TerritoryTypeDat; + xiv::exd::Exd m_TerritoryTypeTelepoDat; xiv::exd::Exd m_TerritoryTypeTransientDat; xiv::exd::Exd m_TextCommandDat; xiv::exd::Exd m_TextCommandParamDat; xiv::exd::Exd m_TitleDat; + xiv::exd::Exd m_TofuEditParamDat; + xiv::exd::Exd m_TofuObjectDat; + xiv::exd::Exd m_TofuObjectCategoryDat; xiv::exd::Exd m_TomestonesDat; xiv::exd::Exd m_TomestonesItemDat; xiv::exd::Exd m_TopicSelectDat; @@ -8493,6 +9760,7 @@ struct ZoneSharedGroup xiv::exd::Exd m_TribeDat; xiv::exd::Exd m_TripleTriadDat; xiv::exd::Exd m_TripleTriadCardDat; + xiv::exd::Exd m_TripleTriadCardObtainDat; xiv::exd::Exd m_TripleTriadCardRarityDat; xiv::exd::Exd m_TripleTriadCardResidentDat; xiv::exd::Exd m_TripleTriadCardTypeDat; @@ -8506,8 +9774,14 @@ struct ZoneSharedGroup xiv::exd::Exd m_UDS_EventDat; xiv::exd::Exd m_UDS_PropertyDat; xiv::exd::Exd m_UIColorDat; + xiv::exd::Exd m_UIConstDat; xiv::exd::Exd m_VaseFlowerDat; xiv::exd::Exd m_VFXDat; + xiv::exd::Exd m_VVDDataDat; + xiv::exd::Exd m_VVDNotebookContentsDat; + xiv::exd::Exd m_VVDNotebookSeriesDat; + xiv::exd::Exd m_VVDRouteDataDat; + xiv::exd::Exd m_VVDVariantActionDat; xiv::exd::Exd m_WarpDat; xiv::exd::Exd m_WarpConditionDat; xiv::exd::Exd m_WarpLogicDat; @@ -8560,11 +9834,14 @@ struct ZoneSharedGroup using AetherialWheelPtr = std::shared_ptr< AetherialWheel >; using AetherytePtr = std::shared_ptr< Aetheryte >; using AetheryteSystemDefinePtr = std::shared_ptr< AetheryteSystemDefine >; + using AetheryteTransientPtr = std::shared_ptr< AetheryteTransient >; using AirshipExplorationLevelPtr = std::shared_ptr< AirshipExplorationLevel >; using AirshipExplorationLogPtr = std::shared_ptr< AirshipExplorationLog >; using AirshipExplorationParamTypePtr = std::shared_ptr< AirshipExplorationParamType >; using AirshipExplorationPartPtr = std::shared_ptr< AirshipExplorationPart >; using AirshipExplorationPointPtr = std::shared_ptr< AirshipExplorationPoint >; + using AkatsukiNotePtr = std::shared_ptr< AkatsukiNote >; + using AkatsukiNoteStringPtr = std::shared_ptr< AkatsukiNoteString >; using AnimationLODPtr = std::shared_ptr< AnimationLOD >; using AnimaWeapon5Ptr = std::shared_ptr< AnimaWeapon5 >; using AnimaWeapon5ParamPtr = std::shared_ptr< AnimaWeapon5Param >; @@ -8586,11 +9863,22 @@ struct ZoneSharedGroup using AOZScorePtr = std::shared_ptr< AOZScore >; using AquariumFishPtr = std::shared_ptr< AquariumFish >; using AquariumWaterPtr = std::shared_ptr< AquariumWater >; + using ArchiveItemPtr = std::shared_ptr< ArchiveItem >; using ArrayEventHandlerPtr = std::shared_ptr< ArrayEventHandler >; using AttackTypePtr = std::shared_ptr< AttackType >; + using AttractPtr = std::shared_ptr< Attract >; using BacklightColorPtr = std::shared_ptr< BacklightColor >; using BallistaPtr = std::shared_ptr< Ballista >; using BalloonPtr = std::shared_ptr< Balloon >; + using BannerBgPtr = std::shared_ptr< BannerBg >; + using BannerConditionPtr = std::shared_ptr< BannerCondition >; + using BannerDecorationPtr = std::shared_ptr< BannerDecoration >; + using BannerDesignPresetPtr = std::shared_ptr< BannerDesignPreset >; + using BannerFacialPtr = std::shared_ptr< BannerFacial >; + using BannerFramePtr = std::shared_ptr< BannerFrame >; + using BannerObtainHintTypePtr = std::shared_ptr< BannerObtainHintType >; + using BannerPresetPtr = std::shared_ptr< BannerPreset >; + using BannerTimelinePtr = std::shared_ptr< BannerTimeline >; using BaseParamPtr = std::shared_ptr< BaseParam >; using BattleLevePtr = std::shared_ptr< BattleLeve >; using BattleLeveRulePtr = std::shared_ptr< BattleLeveRule >; @@ -8609,10 +9897,12 @@ struct ZoneSharedGroup using BGMSystemDefinePtr = std::shared_ptr< BGMSystemDefine >; using BNpcAnnounceIconPtr = std::shared_ptr< BNpcAnnounceIcon >; using BNpcBasePtr = std::shared_ptr< BNpcBase >; + using BNpcBasePopVfxPtr = std::shared_ptr< BNpcBasePopVfx >; using BNpcCustomizePtr = std::shared_ptr< BNpcCustomize >; using BNpcNamePtr = std::shared_ptr< BNpcName >; using BNpcPartsPtr = std::shared_ptr< BNpcParts >; using BNpcStatePtr = std::shared_ptr< BNpcState >; + using BoosterPtr = std::shared_ptr< Booster >; using BuddyPtr = std::shared_ptr< Buddy >; using BuddyActionPtr = std::shared_ptr< BuddyAction >; using BuddyEquipPtr = std::shared_ptr< BuddyEquip >; @@ -8624,6 +9914,12 @@ struct ZoneSharedGroup using CalendarPtr = std::shared_ptr< Calendar >; using CarryPtr = std::shared_ptr< Carry >; using ChannelingPtr = std::shared_ptr< Channeling >; + using CharaCardBasePtr = std::shared_ptr< CharaCardBase >; + using CharaCardDecorationPtr = std::shared_ptr< CharaCardDecoration >; + using CharaCardDesignPresetPtr = std::shared_ptr< CharaCardDesignPreset >; + using CharaCardDesignTypePtr = std::shared_ptr< CharaCardDesignType >; + using CharaCardHeaderPtr = std::shared_ptr< CharaCardHeader >; + using CharaCardPlayStylePtr = std::shared_ptr< CharaCardPlayStyle >; using CharaMakeClassEquipPtr = std::shared_ptr< CharaMakeClassEquip >; using CharaMakeCustomizePtr = std::shared_ptr< CharaMakeCustomize >; using CharaMakeNamePtr = std::shared_ptr< CharaMakeName >; @@ -8641,6 +9937,7 @@ struct ZoneSharedGroup using ChocoboTaxiStandPtr = std::shared_ptr< ChocoboTaxiStand >; using CircleActivityPtr = std::shared_ptr< CircleActivity >; using ClassJobPtr = std::shared_ptr< ClassJob >; + using ClassJobActionSortPtr = std::shared_ptr< ClassJobActionSort >; using ClassJobCategoryPtr = std::shared_ptr< ClassJobCategory >; using CollectablesShopPtr = std::shared_ptr< CollectablesShop >; using CollectablesShopItemPtr = std::shared_ptr< CollectablesShopItem >; @@ -8668,6 +9965,7 @@ struct ZoneSharedGroup using ConditionPtr = std::shared_ptr< Condition >; using ConfigKeyPtr = std::shared_ptr< ConfigKey >; using ContentCloseCyclePtr = std::shared_ptr< ContentCloseCycle >; + using ContentEventItemPtr = std::shared_ptr< ContentEventItem >; using ContentExActionPtr = std::shared_ptr< ContentExAction >; using ContentFinderConditionPtr = std::shared_ptr< ContentFinderCondition >; using ContentFinderConditionTransientPtr = std::shared_ptr< ContentFinderConditionTransient >; @@ -8705,13 +10003,15 @@ struct ZoneSharedGroup using CycleTimePtr = std::shared_ptr< CycleTime >; using DailySupplyItemPtr = std::shared_ptr< DailySupplyItem >; using DawnContentPtr = std::shared_ptr< DawnContent >; + using DawnContentParticipablePtr = std::shared_ptr< DawnContentParticipable >; using DawnGrowMemberPtr = std::shared_ptr< DawnGrowMember >; + using DawnMemberPtr = std::shared_ptr< DawnMember >; using DawnMemberUIParamPtr = std::shared_ptr< DawnMemberUIParam >; - using DawnQuestAnnouncePtr = std::shared_ptr< DawnQuestAnnounce >; using DawnQuestMemberPtr = std::shared_ptr< DawnQuestMember >; using DeepDungeonPtr = std::shared_ptr< DeepDungeon >; using DeepDungeonBanPtr = std::shared_ptr< DeepDungeonBan >; using DeepDungeonDangerPtr = std::shared_ptr< DeepDungeonDanger >; + using DeepDungeonDemiclonePtr = std::shared_ptr< DeepDungeonDemiclone >; using DeepDungeonEquipmentPtr = std::shared_ptr< DeepDungeonEquipment >; using DeepDungeonFloorEffectUIPtr = std::shared_ptr< DeepDungeonFloorEffectUI >; using DeepDungeonItemPtr = std::shared_ptr< DeepDungeonItem >; @@ -8766,14 +10066,19 @@ struct ZoneSharedGroup using EventItemCastTimelinePtr = std::shared_ptr< EventItemCastTimeline >; using EventItemHelpPtr = std::shared_ptr< EventItemHelp >; using EventItemTimelinePtr = std::shared_ptr< EventItemTimeline >; + using EventPathMovePtr = std::shared_ptr< EventPathMove >; using EventSystemDefinePtr = std::shared_ptr< EventSystemDefine >; using ExportedGatheringPointPtr = std::shared_ptr< ExportedGatheringPoint >; using ExportedSGPtr = std::shared_ptr< ExportedSG >; + using ExtraCommandPtr = std::shared_ptr< ExtraCommand >; using ExVersionPtr = std::shared_ptr< ExVersion >; + using FashionCheckThemeCategoryPtr = std::shared_ptr< FashionCheckThemeCategory >; + using FashionCheckWeeklyThemePtr = std::shared_ptr< FashionCheckWeeklyTheme >; using FatePtr = std::shared_ptr< Fate >; using FateEventPtr = std::shared_ptr< FateEvent >; using FateModePtr = std::shared_ptr< FateMode >; using FateProgressUIPtr = std::shared_ptr< FateProgressUI >; + using FateShopPtr = std::shared_ptr< FateShop >; using FateTokenTypePtr = std::shared_ptr< FateTokenType >; using FCActivityPtr = std::shared_ptr< FCActivity >; using FCActivityCategoryPtr = std::shared_ptr< FCActivityCategory >; @@ -8789,15 +10094,23 @@ struct ZoneSharedGroup using FCRightsPtr = std::shared_ptr< FCRights >; using FestivalPtr = std::shared_ptr< Festival >; using FieldMarkerPtr = std::shared_ptr< FieldMarker >; + using FishingBaitParameterPtr = std::shared_ptr< FishingBaitParameter >; using FishingRecordTypePtr = std::shared_ptr< FishingRecordType >; using FishingRecordTypeTransientPtr = std::shared_ptr< FishingRecordTypeTransient >; using FishingSpotPtr = std::shared_ptr< FishingSpot >; using FishParameterPtr = std::shared_ptr< FishParameter >; + using FittingShopPtr = std::shared_ptr< FittingShop >; + using FittingShopCategoryPtr = std::shared_ptr< FittingShopCategory >; + using FittingShopCategoryItemPtr = std::shared_ptr< FittingShopCategoryItem >; + using FittingShopItemSetPtr = std::shared_ptr< FittingShopItemSet >; using Frontline03Ptr = std::shared_ptr< Frontline03 >; using Frontline04Ptr = std::shared_ptr< Frontline04 >; using FurnitureCatalogCategoryPtr = std::shared_ptr< FurnitureCatalogCategory >; using FurnitureCatalogItemListPtr = std::shared_ptr< FurnitureCatalogItemList >; + using GameRewardObtainTypePtr = std::shared_ptr< GameRewardObtainType >; using GardeningSeedPtr = std::shared_ptr< GardeningSeed >; + using GathererCrafterToolPtr = std::shared_ptr< GathererCrafterTool >; + using GathererReductionRewardPtr = std::shared_ptr< GathererReductionReward >; using GatheringConditionPtr = std::shared_ptr< GatheringCondition >; using GatheringExpPtr = std::shared_ptr< GatheringExp >; using GatheringItemPtr = std::shared_ptr< GatheringItem >; @@ -8901,6 +10214,7 @@ struct ZoneSharedGroup using HWDLevelChangeDeceptionPtr = std::shared_ptr< HWDLevelChangeDeception >; using HWDSharedGroupPtr = std::shared_ptr< HWDSharedGroup >; using HWDSharedGroupControlParamPtr = std::shared_ptr< HWDSharedGroupControlParam >; + using IconLanguagePtr = std::shared_ptr< IconLanguage >; using IKDContentBonusPtr = std::shared_ptr< IKDContentBonus >; using IKDFishParamPtr = std::shared_ptr< IKDFishParam >; using IKDRoutePtr = std::shared_ptr< IKDRoute >; @@ -8909,11 +10223,14 @@ struct ZoneSharedGroup using InclusionShopPtr = std::shared_ptr< InclusionShop >; using InclusionShopCategoryPtr = std::shared_ptr< InclusionShopCategory >; using InclusionShopSeriesPtr = std::shared_ptr< InclusionShopSeries >; + using InclusionShopWelcomPtr = std::shared_ptr< InclusionShopWelcom >; + using InclusionShopWelcomTextPtr = std::shared_ptr< InclusionShopWelcomText >; using IndividualWeatherPtr = std::shared_ptr< IndividualWeather >; using InstanceContentPtr = std::shared_ptr< InstanceContent >; using InstanceContentBuffPtr = std::shared_ptr< InstanceContentBuff >; using InstanceContentCSBonusPtr = std::shared_ptr< InstanceContentCSBonus >; using InstanceContentGuidePtr = std::shared_ptr< InstanceContentGuide >; + using InstanceContentQICDataPtr = std::shared_ptr< InstanceContentQICData >; using InstanceContentTextDataPtr = std::shared_ptr< InstanceContentTextData >; using ItemPtr = std::shared_ptr< Item >; using ItemActionPtr = std::shared_ptr< ItemAction >; @@ -8921,10 +10238,14 @@ struct ZoneSharedGroup using ItemBarterCheckPtr = std::shared_ptr< ItemBarterCheck >; using ItemFoodPtr = std::shared_ptr< ItemFood >; using ItemLevelPtr = std::shared_ptr< ItemLevel >; + using ItemRepairPricePtr = std::shared_ptr< ItemRepairPrice >; + using ItemRepairResourcePtr = std::shared_ptr< ItemRepairResource >; + using ItemRetainerLevelUpPtr = std::shared_ptr< ItemRetainerLevelUp >; using ItemSearchCategoryPtr = std::shared_ptr< ItemSearchCategory >; using ItemSeriesPtr = std::shared_ptr< ItemSeries >; using ItemSortCategoryPtr = std::shared_ptr< ItemSortCategory >; using ItemSpecialBonusPtr = std::shared_ptr< ItemSpecialBonus >; + using ItemStainConditionPtr = std::shared_ptr< ItemStainCondition >; using ItemUICategoryPtr = std::shared_ptr< ItemUICategory >; using JinglePtr = std::shared_ptr< Jingle >; using JobHudManualPtr = std::shared_ptr< JobHudManual >; @@ -8954,18 +10275,62 @@ struct ZoneSharedGroup using ManeuversArmorPtr = std::shared_ptr< ManeuversArmor >; using MapPtr = std::shared_ptr< Map >; using MapConditionPtr = std::shared_ptr< MapCondition >; + using MapExclusivePtr = std::shared_ptr< MapExclusive >; using MapMarkerPtr = std::shared_ptr< MapMarker >; using MapMarkerRegionPtr = std::shared_ptr< MapMarkerRegion >; + using MapReplacePtr = std::shared_ptr< MapReplace >; using MapSymbolPtr = std::shared_ptr< MapSymbol >; + using MapTransientPvPMapPtr = std::shared_ptr< MapTransientPvPMap >; + using MapTypePtr = std::shared_ptr< MapType >; using MarkerPtr = std::shared_ptr< Marker >; using MateriaPtr = std::shared_ptr< Materia >; + using MateriaGradePtr = std::shared_ptr< MateriaGrade >; using MateriaJoinRatePtr = std::shared_ptr< MateriaJoinRate >; using MateriaJoinRateGatherCraftPtr = std::shared_ptr< MateriaJoinRateGatherCraft >; using MateriaTomestoneRatePtr = std::shared_ptr< MateriaTomestoneRate >; + using McGuffinPtr = std::shared_ptr< McGuffin >; + using McGuffinUIDataPtr = std::shared_ptr< McGuffinUIData >; using MiniGameRAPtr = std::shared_ptr< MiniGameRA >; using MinionRacePtr = std::shared_ptr< MinionRace >; using MinionRulesPtr = std::shared_ptr< MinionRules >; using MinionSkillTypePtr = std::shared_ptr< MinionSkillType >; + using MJIAnimalsPtr = std::shared_ptr< MJIAnimals >; + using MJIBuildingPtr = std::shared_ptr< MJIBuilding >; + using MJIBuildingPlacePtr = std::shared_ptr< MJIBuildingPlace >; + using MJICraftworksObjectPtr = std::shared_ptr< MJICraftworksObject >; + using MJICraftworksObjectThemePtr = std::shared_ptr< MJICraftworksObjectTheme >; + using MJICraftworksPopularityPtr = std::shared_ptr< MJICraftworksPopularity >; + using MJICraftworksPopularityTypePtr = std::shared_ptr< MJICraftworksPopularityType >; + using MJICraftworksRankRatioPtr = std::shared_ptr< MJICraftworksRankRatio >; + using MJICraftworksSupplyDefinePtr = std::shared_ptr< MJICraftworksSupplyDefine >; + using MJICraftworksTensionPtr = std::shared_ptr< MJICraftworksTension >; + using MJICropSeedPtr = std::shared_ptr< MJICropSeed >; + using MJIDisposalShopItemPtr = std::shared_ptr< MJIDisposalShopItem >; + using MJIDisposalShopUICategoryPtr = std::shared_ptr< MJIDisposalShopUICategory >; + using MJIFarmPastureRankPtr = std::shared_ptr< MJIFarmPastureRank >; + using MJIFunctionPtr = std::shared_ptr< MJIFunction >; + using MJIGatheringPtr = std::shared_ptr< MJIGathering >; + using MJIGatheringItemPtr = std::shared_ptr< MJIGatheringItem >; + using MJIGatheringObjectPtr = std::shared_ptr< MJIGatheringObject >; + using MJIGatheringToolPtr = std::shared_ptr< MJIGatheringTool >; + using MJIHudModePtr = std::shared_ptr< MJIHudMode >; + using MJIItemCategoryPtr = std::shared_ptr< MJIItemCategory >; + using MJIItemPouchPtr = std::shared_ptr< MJIItemPouch >; + using MJIKeyItemPtr = std::shared_ptr< MJIKeyItem >; + using MJILandmarkPtr = std::shared_ptr< MJILandmark >; + using MJILandmarkPlacePtr = std::shared_ptr< MJILandmarkPlace >; + using MJILivelyActorPtr = std::shared_ptr< MJILivelyActor >; + using MJIMinionPopAreasPtr = std::shared_ptr< MJIMinionPopAreas >; + using MJIProgressPtr = std::shared_ptr< MJIProgress >; + using MJIRankPtr = std::shared_ptr< MJIRank >; + using MJIRecipePtr = std::shared_ptr< MJIRecipe >; + using MJIRecipeMaterialPtr = std::shared_ptr< MJIRecipeMaterial >; + using MJIStockyardManagementAreaPtr = std::shared_ptr< MJIStockyardManagementArea >; + using MJIStockyardManagementTablePtr = std::shared_ptr< MJIStockyardManagementTable >; + using MJITextPtr = std::shared_ptr< MJIText >; + using MJIVillageAppearanceSGPtr = std::shared_ptr< MJIVillageAppearanceSG >; + using MJIVillageAppearanceUIPtr = std::shared_ptr< MJIVillageAppearanceUI >; + using MJIVillageDevelopmentPtr = std::shared_ptr< MJIVillageDevelopment >; using MobHuntOrderPtr = std::shared_ptr< MobHuntOrder >; using MobHuntOrderTypePtr = std::shared_ptr< MobHuntOrderType >; using MobHuntRewardPtr = std::shared_ptr< MobHuntReward >; @@ -8990,6 +10355,9 @@ struct ZoneSharedGroup using MovieSubtitlePtr = std::shared_ptr< MovieSubtitle >; using MovieSubtitle500Ptr = std::shared_ptr< MovieSubtitle500 >; using MovieSubtitleVoyagePtr = std::shared_ptr< MovieSubtitleVoyage >; + using MultipleHelpPtr = std::shared_ptr< MultipleHelp >; + using MultipleHelpPagePtr = std::shared_ptr< MultipleHelpPage >; + using MultipleHelpStringPtr = std::shared_ptr< MultipleHelpString >; using MYCTemporaryItemPtr = std::shared_ptr< MYCTemporaryItem >; using MYCTemporaryItemUICategoryPtr = std::shared_ptr< MYCTemporaryItemUICategory >; using MYCWarResultNotebookPtr = std::shared_ptr< MYCWarResultNotebook >; @@ -8999,6 +10367,8 @@ struct ZoneSharedGroup using NpcEquipPtr = std::shared_ptr< NpcEquip >; using NpcYellPtr = std::shared_ptr< NpcYell >; using OmenPtr = std::shared_ptr< Omen >; + using OmikujiPtr = std::shared_ptr< Omikuji >; + using OmikujiGuidancePtr = std::shared_ptr< OmikujiGuidance >; using OnlineStatusPtr = std::shared_ptr< OnlineStatus >; using OpenContentPtr = std::shared_ptr< OpenContent >; using OpenContentCandidateNamePtr = std::shared_ptr< OpenContentCandidateName >; @@ -9008,6 +10378,7 @@ struct ZoneSharedGroup using OrchestrionPathPtr = std::shared_ptr< OrchestrionPath >; using OrchestrionUiparamPtr = std::shared_ptr< OrchestrionUiparam >; using OrnamentPtr = std::shared_ptr< Ornament >; + using OrnamentActionPtr = std::shared_ptr< OrnamentAction >; using ParamGrowPtr = std::shared_ptr< ParamGrow >; using PartyContentPtr = std::shared_ptr< PartyContent >; using PartyContentCutscenePtr = std::shared_ptr< PartyContentCutscene >; @@ -9024,16 +10395,22 @@ struct ZoneSharedGroup using PicturePtr = std::shared_ptr< Picture >; using PlaceNamePtr = std::shared_ptr< PlaceName >; using PlantPotFlowerSeedPtr = std::shared_ptr< PlantPotFlowerSeed >; + using PlayerSearchLocationPtr = std::shared_ptr< PlayerSearchLocation >; + using PlayerSearchSubLocationPtr = std::shared_ptr< PlayerSearchSubLocation >; using PreHandlerPtr = std::shared_ptr< PreHandler >; using PresetCameraPtr = std::shared_ptr< PresetCamera >; using PresetCameraAdjustPtr = std::shared_ptr< PresetCameraAdjust >; + using PreviewableItemsPtr = std::shared_ptr< PreviewableItems >; using PublicContentPtr = std::shared_ptr< PublicContent >; using PublicContentCutscenePtr = std::shared_ptr< PublicContentCutscene >; using PublicContentTextDataPtr = std::shared_ptr< PublicContentTextData >; using PvPActionPtr = std::shared_ptr< PvPAction >; using PvPActionSortPtr = std::shared_ptr< PvPActionSort >; + using PvPBaseParamValuePtr = std::shared_ptr< PvPBaseParamValue >; using PvPRankPtr = std::shared_ptr< PvPRank >; using PvPSelectTraitPtr = std::shared_ptr< PvPSelectTrait >; + using PvPSeriesPtr = std::shared_ptr< PvPSeries >; + using PvPSeriesLevelPtr = std::shared_ptr< PvPSeriesLevel >; using PvPTraitPtr = std::shared_ptr< PvPTrait >; using QuestPtr = std::shared_ptr< Quest >; using QuestAcceptAdditionConditionPtr = std::shared_ptr< QuestAcceptAdditionCondition >; @@ -9041,9 +10418,12 @@ struct ZoneSharedGroup using QuestChapterPtr = std::shared_ptr< QuestChapter >; using QuestClassJobRewardPtr = std::shared_ptr< QuestClassJobReward >; using QuestClassJobSupplyPtr = std::shared_ptr< QuestClassJobSupply >; + using QuestDefineClientPtr = std::shared_ptr< QuestDefineClient >; using QuestDerivedClassPtr = std::shared_ptr< QuestDerivedClass >; using QuestEffectPtr = std::shared_ptr< QuestEffect >; using QuestEffectDefinePtr = std::shared_ptr< QuestEffectDefine >; + using QuestLinkMarkerPtr = std::shared_ptr< QuestLinkMarker >; + using QuestLinkMarkerSetPtr = std::shared_ptr< QuestLinkMarkerSet >; using QuestRedoPtr = std::shared_ptr< QuestRedo >; using QuestRedoChapterUIPtr = std::shared_ptr< QuestRedoChapterUI >; using QuestRedoChapterUICategoryPtr = std::shared_ptr< QuestRedoChapterUICategory >; @@ -9051,6 +10431,8 @@ struct ZoneSharedGroup using QuestRedoIncompChapterPtr = std::shared_ptr< QuestRedoIncompChapter >; using QuestRepeatFlagPtr = std::shared_ptr< QuestRepeatFlag >; using QuestRewardOtherPtr = std::shared_ptr< QuestRewardOther >; + using QuestSelectTitlePtr = std::shared_ptr< QuestSelectTitle >; + using QuestSetDefinePtr = std::shared_ptr< QuestSetDefine >; using QuickChatPtr = std::shared_ptr< QuickChat >; using QuickChatTransientPtr = std::shared_ptr< QuickChatTransient >; using RacePtr = std::shared_ptr< Race >; @@ -9059,6 +10441,9 @@ struct ZoneSharedGroup using RacingChocoboNameCategoryPtr = std::shared_ptr< RacingChocoboNameCategory >; using RacingChocoboNameInfoPtr = std::shared_ptr< RacingChocoboNameInfo >; using RacingChocoboParamPtr = std::shared_ptr< RacingChocoboParam >; + using RaidFinderParamPtr = std::shared_ptr< RaidFinderParam >; + using ReactionEventObjectPtr = std::shared_ptr< ReactionEventObject >; + using ReactionEventObjectInfoPtr = std::shared_ptr< ReactionEventObjectInfo >; using RecastNavimeshPtr = std::shared_ptr< RecastNavimesh >; using RecipePtr = std::shared_ptr< Recipe >; using RecipeLevelTablePtr = std::shared_ptr< RecipeLevelTable >; @@ -9083,6 +10468,7 @@ struct ZoneSharedGroup using RideShootingTextDataPtr = std::shared_ptr< RideShootingTextData >; using RPParameterPtr = std::shared_ptr< RPParameter >; using SatisfactionArbitrationPtr = std::shared_ptr< SatisfactionArbitration >; + using SatisfactionBonusGuaranteePtr = std::shared_ptr< SatisfactionBonusGuarantee >; using SatisfactionNpcPtr = std::shared_ptr< SatisfactionNpc >; using SatisfactionSupplyPtr = std::shared_ptr< SatisfactionSupply >; using SatisfactionSupplyRewardPtr = std::shared_ptr< SatisfactionSupplyReward >; @@ -9092,15 +10478,21 @@ struct ZoneSharedGroup using ScenarioTypePtr = std::shared_ptr< ScenarioType >; using ScreenImagePtr = std::shared_ptr< ScreenImage >; using SecretRecipeBookPtr = std::shared_ptr< SecretRecipeBook >; + using SharlayanCraftWorksPtr = std::shared_ptr< SharlayanCraftWorks >; + using SharlayanCraftWorksSupplyPtr = std::shared_ptr< SharlayanCraftWorksSupply >; + using ShellFixedFromCommandPtr = std::shared_ptr< ShellFixedFromCommand >; using SkyIsland2MissionPtr = std::shared_ptr< SkyIsland2Mission >; using SkyIsland2MissionDetailPtr = std::shared_ptr< SkyIsland2MissionDetail >; using SkyIsland2MissionTypePtr = std::shared_ptr< SkyIsland2MissionType >; using SkyIsland2RangeTypePtr = std::shared_ptr< SkyIsland2RangeType >; + using SnipePtr = std::shared_ptr< Snipe >; using SnipeTalkPtr = std::shared_ptr< SnipeTalk >; using SnipeTalkNamePtr = std::shared_ptr< SnipeTalkName >; + using SpearfishingComboTargetPtr = std::shared_ptr< SpearfishingComboTarget >; using SpearfishingItemPtr = std::shared_ptr< SpearfishingItem >; using SpearfishingNotebookPtr = std::shared_ptr< SpearfishingNotebook >; using SpearfishingRecordPagePtr = std::shared_ptr< SpearfishingRecordPage >; + using SpearfishingSilhouettePtr = std::shared_ptr< SpearfishingSilhouette >; using SpecialShopPtr = std::shared_ptr< SpecialShop >; using SpecialShopItemCategoryPtr = std::shared_ptr< SpecialShopItemCategory >; using StainPtr = std::shared_ptr< Stain >; @@ -9116,11 +10508,16 @@ struct ZoneSharedGroup using SubmarineRankPtr = std::shared_ptr< SubmarineRank >; using SwitchTalkPtr = std::shared_ptr< SwitchTalk >; using SwitchTalkVariationPtr = std::shared_ptr< SwitchTalkVariation >; + using TelepoRelayPtr = std::shared_ptr< TelepoRelay >; using TerritoryTypePtr = std::shared_ptr< TerritoryType >; + using TerritoryTypeTelepoPtr = std::shared_ptr< TerritoryTypeTelepo >; using TerritoryTypeTransientPtr = std::shared_ptr< TerritoryTypeTransient >; using TextCommandPtr = std::shared_ptr< TextCommand >; using TextCommandParamPtr = std::shared_ptr< TextCommandParam >; using TitlePtr = std::shared_ptr< Title >; + using TofuEditParamPtr = std::shared_ptr< TofuEditParam >; + using TofuObjectPtr = std::shared_ptr< TofuObject >; + using TofuObjectCategoryPtr = std::shared_ptr< TofuObjectCategory >; using TomestonesPtr = std::shared_ptr< Tomestones >; using TomestonesItemPtr = std::shared_ptr< TomestonesItem >; using TopicSelectPtr = std::shared_ptr< TopicSelect >; @@ -9136,6 +10533,7 @@ struct ZoneSharedGroup using TribePtr = std::shared_ptr< Tribe >; using TripleTriadPtr = std::shared_ptr< TripleTriad >; using TripleTriadCardPtr = std::shared_ptr< TripleTriadCard >; + using TripleTriadCardObtainPtr = std::shared_ptr< TripleTriadCardObtain >; using TripleTriadCardRarityPtr = std::shared_ptr< TripleTriadCardRarity >; using TripleTriadCardResidentPtr = std::shared_ptr< TripleTriadCardResident >; using TripleTriadCardTypePtr = std::shared_ptr< TripleTriadCardType >; @@ -9149,8 +10547,14 @@ struct ZoneSharedGroup using UDS_EventPtr = std::shared_ptr< UDS_Event >; using UDS_PropertyPtr = std::shared_ptr< UDS_Property >; using UIColorPtr = std::shared_ptr< UIColor >; + using UIConstPtr = std::shared_ptr< UIConst >; using VaseFlowerPtr = std::shared_ptr< VaseFlower >; using VFXPtr = std::shared_ptr< VFX >; + using VVDDataPtr = std::shared_ptr< VVDData >; + using VVDNotebookContentsPtr = std::shared_ptr< VVDNotebookContents >; + using VVDNotebookSeriesPtr = std::shared_ptr< VVDNotebookSeries >; + using VVDRouteDataPtr = std::shared_ptr< VVDRouteData >; + using VVDVariantActionPtr = std::shared_ptr< VVDVariantAction >; using WarpPtr = std::shared_ptr< Warp >; using WarpConditionPtr = std::shared_ptr< WarpCondition >; using WarpLogicPtr = std::shared_ptr< WarpLogic >; @@ -9203,11 +10607,14 @@ struct ZoneSharedGroup std::set< uint32_t > m_AetherialWheelIdList; std::set< uint32_t > m_AetheryteIdList; std::set< uint32_t > m_AetheryteSystemDefineIdList; + std::set< uint32_t > m_AetheryteTransientIdList; std::set< uint32_t > m_AirshipExplorationLevelIdList; std::set< uint32_t > m_AirshipExplorationLogIdList; std::set< uint32_t > m_AirshipExplorationParamTypeIdList; std::set< uint32_t > m_AirshipExplorationPartIdList; std::set< uint32_t > m_AirshipExplorationPointIdList; + std::set< uint32_t > m_AkatsukiNoteIdList; + std::set< uint32_t > m_AkatsukiNoteStringIdList; std::set< uint32_t > m_AnimationLODIdList; std::set< uint32_t > m_AnimaWeapon5IdList; std::set< uint32_t > m_AnimaWeapon5ParamIdList; @@ -9229,11 +10636,22 @@ struct ZoneSharedGroup std::set< uint32_t > m_AOZScoreIdList; std::set< uint32_t > m_AquariumFishIdList; std::set< uint32_t > m_AquariumWaterIdList; + std::set< uint32_t > m_ArchiveItemIdList; std::set< uint32_t > m_ArrayEventHandlerIdList; std::set< uint32_t > m_AttackTypeIdList; + std::set< uint32_t > m_AttractIdList; std::set< uint32_t > m_BacklightColorIdList; std::set< uint32_t > m_BallistaIdList; std::set< uint32_t > m_BalloonIdList; + std::set< uint32_t > m_BannerBgIdList; + std::set< uint32_t > m_BannerConditionIdList; + std::set< uint32_t > m_BannerDecorationIdList; + std::set< uint32_t > m_BannerDesignPresetIdList; + std::set< uint32_t > m_BannerFacialIdList; + std::set< uint32_t > m_BannerFrameIdList; + std::set< uint32_t > m_BannerObtainHintTypeIdList; + std::set< uint32_t > m_BannerPresetIdList; + std::set< uint32_t > m_BannerTimelineIdList; std::set< uint32_t > m_BaseParamIdList; std::set< uint32_t > m_BattleLeveIdList; std::set< uint32_t > m_BattleLeveRuleIdList; @@ -9252,10 +10670,12 @@ struct ZoneSharedGroup std::set< uint32_t > m_BGMSystemDefineIdList; std::set< uint32_t > m_BNpcAnnounceIconIdList; std::set< uint32_t > m_BNpcBaseIdList; + std::set< uint32_t > m_BNpcBasePopVfxIdList; std::set< uint32_t > m_BNpcCustomizeIdList; std::set< uint32_t > m_BNpcNameIdList; std::set< uint32_t > m_BNpcPartsIdList; std::set< uint32_t > m_BNpcStateIdList; + std::set< uint32_t > m_BoosterIdList; std::set< uint32_t > m_BuddyIdList; std::set< uint32_t > m_BuddyActionIdList; std::set< uint32_t > m_BuddyEquipIdList; @@ -9267,6 +10687,12 @@ struct ZoneSharedGroup std::set< uint32_t > m_CalendarIdList; std::set< uint32_t > m_CarryIdList; std::set< uint32_t > m_ChannelingIdList; + std::set< uint32_t > m_CharaCardBaseIdList; + std::set< uint32_t > m_CharaCardDecorationIdList; + std::set< uint32_t > m_CharaCardDesignPresetIdList; + std::set< uint32_t > m_CharaCardDesignTypeIdList; + std::set< uint32_t > m_CharaCardHeaderIdList; + std::set< uint32_t > m_CharaCardPlayStyleIdList; std::set< uint32_t > m_CharaMakeClassEquipIdList; std::set< uint32_t > m_CharaMakeCustomizeIdList; std::set< uint32_t > m_CharaMakeNameIdList; @@ -9284,6 +10710,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_ChocoboTaxiStandIdList; std::set< uint32_t > m_CircleActivityIdList; std::set< uint32_t > m_ClassJobIdList; + std::set< uint32_t > m_ClassJobActionSortIdList; std::set< uint32_t > m_ClassJobCategoryIdList; std::set< uint32_t > m_CollectablesShopIdList; std::set< uint32_t > m_CollectablesShopItemIdList; @@ -9311,6 +10738,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_ConditionIdList; std::set< uint32_t > m_ConfigKeyIdList; std::set< uint32_t > m_ContentCloseCycleIdList; + std::set< uint32_t > m_ContentEventItemIdList; std::set< uint32_t > m_ContentExActionIdList; std::set< uint32_t > m_ContentFinderConditionIdList; std::set< uint32_t > m_ContentFinderConditionTransientIdList; @@ -9348,13 +10776,15 @@ struct ZoneSharedGroup std::set< uint32_t > m_CycleTimeIdList; std::set< uint32_t > m_DailySupplyItemIdList; std::set< uint32_t > m_DawnContentIdList; + std::set< uint32_t > m_DawnContentParticipableIdList; std::set< uint32_t > m_DawnGrowMemberIdList; + std::set< uint32_t > m_DawnMemberIdList; std::set< uint32_t > m_DawnMemberUIParamIdList; - std::set< uint32_t > m_DawnQuestAnnounceIdList; std::set< uint32_t > m_DawnQuestMemberIdList; std::set< uint32_t > m_DeepDungeonIdList; std::set< uint32_t > m_DeepDungeonBanIdList; std::set< uint32_t > m_DeepDungeonDangerIdList; + std::set< uint32_t > m_DeepDungeonDemicloneIdList; std::set< uint32_t > m_DeepDungeonEquipmentIdList; std::set< uint32_t > m_DeepDungeonFloorEffectUIIdList; std::set< uint32_t > m_DeepDungeonItemIdList; @@ -9409,14 +10839,19 @@ struct ZoneSharedGroup std::set< uint32_t > m_EventItemCastTimelineIdList; std::set< uint32_t > m_EventItemHelpIdList; std::set< uint32_t > m_EventItemTimelineIdList; + std::set< uint32_t > m_EventPathMoveIdList; std::set< uint32_t > m_EventSystemDefineIdList; std::set< uint32_t > m_ExportedGatheringPointIdList; std::set< uint32_t > m_ExportedSGIdList; + std::set< uint32_t > m_ExtraCommandIdList; std::set< uint32_t > m_ExVersionIdList; + std::set< uint32_t > m_FashionCheckThemeCategoryIdList; + std::set< uint32_t > m_FashionCheckWeeklyThemeIdList; std::set< uint32_t > m_FateIdList; std::set< uint32_t > m_FateEventIdList; std::set< uint32_t > m_FateModeIdList; std::set< uint32_t > m_FateProgressUIIdList; + std::set< uint32_t > m_FateShopIdList; std::set< uint32_t > m_FateTokenTypeIdList; std::set< uint32_t > m_FCActivityIdList; std::set< uint32_t > m_FCActivityCategoryIdList; @@ -9432,15 +10867,23 @@ struct ZoneSharedGroup std::set< uint32_t > m_FCRightsIdList; std::set< uint32_t > m_FestivalIdList; std::set< uint32_t > m_FieldMarkerIdList; + std::set< uint32_t > m_FishingBaitParameterIdList; std::set< uint32_t > m_FishingRecordTypeIdList; std::set< uint32_t > m_FishingRecordTypeTransientIdList; std::set< uint32_t > m_FishingSpotIdList; std::set< uint32_t > m_FishParameterIdList; + std::set< uint32_t > m_FittingShopIdList; + std::set< uint32_t > m_FittingShopCategoryIdList; + std::set< uint32_t > m_FittingShopCategoryItemIdList; + std::set< uint32_t > m_FittingShopItemSetIdList; std::set< uint32_t > m_Frontline03IdList; std::set< uint32_t > m_Frontline04IdList; std::set< uint32_t > m_FurnitureCatalogCategoryIdList; std::set< uint32_t > m_FurnitureCatalogItemListIdList; + std::set< uint32_t > m_GameRewardObtainTypeIdList; std::set< uint32_t > m_GardeningSeedIdList; + std::set< uint32_t > m_GathererCrafterToolIdList; + std::set< uint32_t > m_GathererReductionRewardIdList; std::set< uint32_t > m_GatheringConditionIdList; std::set< uint32_t > m_GatheringExpIdList; std::set< uint32_t > m_GatheringItemIdList; @@ -9544,6 +10987,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_HWDLevelChangeDeceptionIdList; std::set< uint32_t > m_HWDSharedGroupIdList; std::set< uint32_t > m_HWDSharedGroupControlParamIdList; + std::set< uint32_t > m_IconLanguageIdList; std::set< uint32_t > m_IKDContentBonusIdList; std::set< uint32_t > m_IKDFishParamIdList; std::set< uint32_t > m_IKDRouteIdList; @@ -9552,11 +10996,14 @@ struct ZoneSharedGroup std::set< uint32_t > m_InclusionShopIdList; std::set< uint32_t > m_InclusionShopCategoryIdList; std::set< uint32_t > m_InclusionShopSeriesIdList; + std::set< uint32_t > m_InclusionShopWelcomIdList; + std::set< uint32_t > m_InclusionShopWelcomTextIdList; std::set< uint32_t > m_IndividualWeatherIdList; std::set< uint32_t > m_InstanceContentIdList; std::set< uint32_t > m_InstanceContentBuffIdList; std::set< uint32_t > m_InstanceContentCSBonusIdList; std::set< uint32_t > m_InstanceContentGuideIdList; + std::set< uint32_t > m_InstanceContentQICDataIdList; std::set< uint32_t > m_InstanceContentTextDataIdList; std::set< uint32_t > m_ItemIdList; std::set< uint32_t > m_ItemActionIdList; @@ -9564,10 +11011,14 @@ struct ZoneSharedGroup std::set< uint32_t > m_ItemBarterCheckIdList; std::set< uint32_t > m_ItemFoodIdList; std::set< uint32_t > m_ItemLevelIdList; + std::set< uint32_t > m_ItemRepairPriceIdList; + std::set< uint32_t > m_ItemRepairResourceIdList; + std::set< uint32_t > m_ItemRetainerLevelUpIdList; std::set< uint32_t > m_ItemSearchCategoryIdList; std::set< uint32_t > m_ItemSeriesIdList; std::set< uint32_t > m_ItemSortCategoryIdList; std::set< uint32_t > m_ItemSpecialBonusIdList; + std::set< uint32_t > m_ItemStainConditionIdList; std::set< uint32_t > m_ItemUICategoryIdList; std::set< uint32_t > m_JingleIdList; std::set< uint32_t > m_JobHudManualIdList; @@ -9597,18 +11048,62 @@ struct ZoneSharedGroup std::set< uint32_t > m_ManeuversArmorIdList; std::set< uint32_t > m_MapIdList; std::set< uint32_t > m_MapConditionIdList; + std::set< uint32_t > m_MapExclusiveIdList; std::set< uint32_t > m_MapMarkerIdList; std::set< uint32_t > m_MapMarkerRegionIdList; + std::set< uint32_t > m_MapReplaceIdList; std::set< uint32_t > m_MapSymbolIdList; + std::set< uint32_t > m_MapTransientPvPMapIdList; + std::set< uint32_t > m_MapTypeIdList; std::set< uint32_t > m_MarkerIdList; std::set< uint32_t > m_MateriaIdList; + std::set< uint32_t > m_MateriaGradeIdList; std::set< uint32_t > m_MateriaJoinRateIdList; std::set< uint32_t > m_MateriaJoinRateGatherCraftIdList; std::set< uint32_t > m_MateriaTomestoneRateIdList; + std::set< uint32_t > m_McGuffinIdList; + std::set< uint32_t > m_McGuffinUIDataIdList; std::set< uint32_t > m_MiniGameRAIdList; std::set< uint32_t > m_MinionRaceIdList; std::set< uint32_t > m_MinionRulesIdList; std::set< uint32_t > m_MinionSkillTypeIdList; + std::set< uint32_t > m_MJIAnimalsIdList; + std::set< uint32_t > m_MJIBuildingIdList; + std::set< uint32_t > m_MJIBuildingPlaceIdList; + std::set< uint32_t > m_MJICraftworksObjectIdList; + std::set< uint32_t > m_MJICraftworksObjectThemeIdList; + std::set< uint32_t > m_MJICraftworksPopularityIdList; + std::set< uint32_t > m_MJICraftworksPopularityTypeIdList; + std::set< uint32_t > m_MJICraftworksRankRatioIdList; + std::set< uint32_t > m_MJICraftworksSupplyDefineIdList; + std::set< uint32_t > m_MJICraftworksTensionIdList; + std::set< uint32_t > m_MJICropSeedIdList; + std::set< uint32_t > m_MJIDisposalShopItemIdList; + std::set< uint32_t > m_MJIDisposalShopUICategoryIdList; + std::set< uint32_t > m_MJIFarmPastureRankIdList; + std::set< uint32_t > m_MJIFunctionIdList; + std::set< uint32_t > m_MJIGatheringIdList; + std::set< uint32_t > m_MJIGatheringItemIdList; + std::set< uint32_t > m_MJIGatheringObjectIdList; + std::set< uint32_t > m_MJIGatheringToolIdList; + std::set< uint32_t > m_MJIHudModeIdList; + std::set< uint32_t > m_MJIItemCategoryIdList; + std::set< uint32_t > m_MJIItemPouchIdList; + std::set< uint32_t > m_MJIKeyItemIdList; + std::set< uint32_t > m_MJILandmarkIdList; + std::set< uint32_t > m_MJILandmarkPlaceIdList; + std::set< uint32_t > m_MJILivelyActorIdList; + std::set< uint32_t > m_MJIMinionPopAreasIdList; + std::set< uint32_t > m_MJIProgressIdList; + std::set< uint32_t > m_MJIRankIdList; + std::set< uint32_t > m_MJIRecipeIdList; + std::set< uint32_t > m_MJIRecipeMaterialIdList; + std::set< uint32_t > m_MJIStockyardManagementAreaIdList; + std::set< uint32_t > m_MJIStockyardManagementTableIdList; + std::set< uint32_t > m_MJITextIdList; + std::set< uint32_t > m_MJIVillageAppearanceSGIdList; + std::set< uint32_t > m_MJIVillageAppearanceUIIdList; + std::set< uint32_t > m_MJIVillageDevelopmentIdList; std::set< uint32_t > m_MobHuntOrderIdList; std::set< uint32_t > m_MobHuntOrderTypeIdList; std::set< uint32_t > m_MobHuntRewardIdList; @@ -9633,6 +11128,9 @@ struct ZoneSharedGroup std::set< uint32_t > m_MovieSubtitleIdList; std::set< uint32_t > m_MovieSubtitle500IdList; std::set< uint32_t > m_MovieSubtitleVoyageIdList; + std::set< uint32_t > m_MultipleHelpIdList; + std::set< uint32_t > m_MultipleHelpPageIdList; + std::set< uint32_t > m_MultipleHelpStringIdList; std::set< uint32_t > m_MYCTemporaryItemIdList; std::set< uint32_t > m_MYCTemporaryItemUICategoryIdList; std::set< uint32_t > m_MYCWarResultNotebookIdList; @@ -9642,6 +11140,8 @@ struct ZoneSharedGroup std::set< uint32_t > m_NpcEquipIdList; std::set< uint32_t > m_NpcYellIdList; std::set< uint32_t > m_OmenIdList; + std::set< uint32_t > m_OmikujiIdList; + std::set< uint32_t > m_OmikujiGuidanceIdList; std::set< uint32_t > m_OnlineStatusIdList; std::set< uint32_t > m_OpenContentIdList; std::set< uint32_t > m_OpenContentCandidateNameIdList; @@ -9651,6 +11151,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_OrchestrionPathIdList; std::set< uint32_t > m_OrchestrionUiparamIdList; std::set< uint32_t > m_OrnamentIdList; + std::set< uint32_t > m_OrnamentActionIdList; std::set< uint32_t > m_ParamGrowIdList; std::set< uint32_t > m_PartyContentIdList; std::set< uint32_t > m_PartyContentCutsceneIdList; @@ -9667,16 +11168,22 @@ struct ZoneSharedGroup std::set< uint32_t > m_PictureIdList; std::set< uint32_t > m_PlaceNameIdList; std::set< uint32_t > m_PlantPotFlowerSeedIdList; + std::set< uint32_t > m_PlayerSearchLocationIdList; + std::set< uint32_t > m_PlayerSearchSubLocationIdList; std::set< uint32_t > m_PreHandlerIdList; std::set< uint32_t > m_PresetCameraIdList; std::set< uint32_t > m_PresetCameraAdjustIdList; + std::set< uint32_t > m_PreviewableItemsIdList; std::set< uint32_t > m_PublicContentIdList; std::set< uint32_t > m_PublicContentCutsceneIdList; std::set< uint32_t > m_PublicContentTextDataIdList; std::set< uint32_t > m_PvPActionIdList; std::set< uint32_t > m_PvPActionSortIdList; + std::set< uint32_t > m_PvPBaseParamValueIdList; std::set< uint32_t > m_PvPRankIdList; std::set< uint32_t > m_PvPSelectTraitIdList; + std::set< uint32_t > m_PvPSeriesIdList; + std::set< uint32_t > m_PvPSeriesLevelIdList; std::set< uint32_t > m_PvPTraitIdList; std::set< uint32_t > m_QuestIdList; std::set< uint32_t > m_QuestAcceptAdditionConditionIdList; @@ -9684,9 +11191,12 @@ struct ZoneSharedGroup std::set< uint32_t > m_QuestChapterIdList; std::set< uint32_t > m_QuestClassJobRewardIdList; std::set< uint32_t > m_QuestClassJobSupplyIdList; + std::set< uint32_t > m_QuestDefineClientIdList; std::set< uint32_t > m_QuestDerivedClassIdList; std::set< uint32_t > m_QuestEffectIdList; std::set< uint32_t > m_QuestEffectDefineIdList; + std::set< uint32_t > m_QuestLinkMarkerIdList; + std::set< uint32_t > m_QuestLinkMarkerSetIdList; std::set< uint32_t > m_QuestRedoIdList; std::set< uint32_t > m_QuestRedoChapterUIIdList; std::set< uint32_t > m_QuestRedoChapterUICategoryIdList; @@ -9694,6 +11204,8 @@ struct ZoneSharedGroup std::set< uint32_t > m_QuestRedoIncompChapterIdList; std::set< uint32_t > m_QuestRepeatFlagIdList; std::set< uint32_t > m_QuestRewardOtherIdList; + std::set< uint32_t > m_QuestSelectTitleIdList; + std::set< uint32_t > m_QuestSetDefineIdList; std::set< uint32_t > m_QuickChatIdList; std::set< uint32_t > m_QuickChatTransientIdList; std::set< uint32_t > m_RaceIdList; @@ -9702,6 +11214,9 @@ struct ZoneSharedGroup std::set< uint32_t > m_RacingChocoboNameCategoryIdList; std::set< uint32_t > m_RacingChocoboNameInfoIdList; std::set< uint32_t > m_RacingChocoboParamIdList; + std::set< uint32_t > m_RaidFinderParamIdList; + std::set< uint32_t > m_ReactionEventObjectIdList; + std::set< uint32_t > m_ReactionEventObjectInfoIdList; std::set< uint32_t > m_RecastNavimeshIdList; std::set< uint32_t > m_RecipeIdList; std::set< uint32_t > m_RecipeLevelTableIdList; @@ -9726,6 +11241,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_RideShootingTextDataIdList; std::set< uint32_t > m_RPParameterIdList; std::set< uint32_t > m_SatisfactionArbitrationIdList; + std::set< uint32_t > m_SatisfactionBonusGuaranteeIdList; std::set< uint32_t > m_SatisfactionNpcIdList; std::set< uint32_t > m_SatisfactionSupplyIdList; std::set< uint32_t > m_SatisfactionSupplyRewardIdList; @@ -9735,15 +11251,21 @@ struct ZoneSharedGroup std::set< uint32_t > m_ScenarioTypeIdList; std::set< uint32_t > m_ScreenImageIdList; std::set< uint32_t > m_SecretRecipeBookIdList; + std::set< uint32_t > m_SharlayanCraftWorksIdList; + std::set< uint32_t > m_SharlayanCraftWorksSupplyIdList; + std::set< uint32_t > m_ShellFixedFromCommandIdList; std::set< uint32_t > m_SkyIsland2MissionIdList; std::set< uint32_t > m_SkyIsland2MissionDetailIdList; std::set< uint32_t > m_SkyIsland2MissionTypeIdList; std::set< uint32_t > m_SkyIsland2RangeTypeIdList; + std::set< uint32_t > m_SnipeIdList; std::set< uint32_t > m_SnipeTalkIdList; std::set< uint32_t > m_SnipeTalkNameIdList; + std::set< uint32_t > m_SpearfishingComboTargetIdList; std::set< uint32_t > m_SpearfishingItemIdList; std::set< uint32_t > m_SpearfishingNotebookIdList; std::set< uint32_t > m_SpearfishingRecordPageIdList; + std::set< uint32_t > m_SpearfishingSilhouetteIdList; std::set< uint32_t > m_SpecialShopIdList; std::set< uint32_t > m_SpecialShopItemCategoryIdList; std::set< uint32_t > m_StainIdList; @@ -9759,11 +11281,16 @@ struct ZoneSharedGroup std::set< uint32_t > m_SubmarineRankIdList; std::set< uint32_t > m_SwitchTalkIdList; std::set< uint32_t > m_SwitchTalkVariationIdList; + std::set< uint32_t > m_TelepoRelayIdList; std::set< uint32_t > m_TerritoryTypeIdList; + std::set< uint32_t > m_TerritoryTypeTelepoIdList; std::set< uint32_t > m_TerritoryTypeTransientIdList; std::set< uint32_t > m_TextCommandIdList; std::set< uint32_t > m_TextCommandParamIdList; std::set< uint32_t > m_TitleIdList; + std::set< uint32_t > m_TofuEditParamIdList; + std::set< uint32_t > m_TofuObjectIdList; + std::set< uint32_t > m_TofuObjectCategoryIdList; std::set< uint32_t > m_TomestonesIdList; std::set< uint32_t > m_TomestonesItemIdList; std::set< uint32_t > m_TopicSelectIdList; @@ -9779,6 +11306,7 @@ struct ZoneSharedGroup std::set< uint32_t > m_TribeIdList; std::set< uint32_t > m_TripleTriadIdList; std::set< uint32_t > m_TripleTriadCardIdList; + std::set< uint32_t > m_TripleTriadCardObtainIdList; std::set< uint32_t > m_TripleTriadCardRarityIdList; std::set< uint32_t > m_TripleTriadCardResidentIdList; std::set< uint32_t > m_TripleTriadCardTypeIdList; @@ -9792,8 +11320,14 @@ struct ZoneSharedGroup std::set< uint32_t > m_UDS_EventIdList; std::set< uint32_t > m_UDS_PropertyIdList; std::set< uint32_t > m_UIColorIdList; + std::set< uint32_t > m_UIConstIdList; std::set< uint32_t > m_VaseFlowerIdList; std::set< uint32_t > m_VFXIdList; + std::set< uint32_t > m_VVDDataIdList; + std::set< uint32_t > m_VVDNotebookContentsIdList; + std::set< uint32_t > m_VVDNotebookSeriesIdList; + std::set< uint32_t > m_VVDRouteDataIdList; + std::set< uint32_t > m_VVDVariantActionIdList; std::set< uint32_t > m_WarpIdList; std::set< uint32_t > m_WarpConditionIdList; std::set< uint32_t > m_WarpLogicIdList; @@ -9991,6 +11525,12 @@ const std::set< uint32_t >& getAetheryteSystemDefineIdList() loadIdList( m_AetheryteSystemDefineDat, m_AetheryteSystemDefineIdList ); return m_AetheryteSystemDefineIdList; } +const std::set< uint32_t >& getAetheryteTransientIdList() +{ + if( m_AetheryteTransientIdList.size() == 0 ) + loadIdList( m_AetheryteTransientDat, m_AetheryteTransientIdList ); + return m_AetheryteTransientIdList; +} const std::set< uint32_t >& getAirshipExplorationLevelIdList() { if( m_AirshipExplorationLevelIdList.size() == 0 ) @@ -10021,6 +11561,18 @@ const std::set< uint32_t >& getAirshipExplorationPointIdList() loadIdList( m_AirshipExplorationPointDat, m_AirshipExplorationPointIdList ); return m_AirshipExplorationPointIdList; } +const std::set< uint32_t >& getAkatsukiNoteIdList() +{ + if( m_AkatsukiNoteIdList.size() == 0 ) + loadIdList( m_AkatsukiNoteDat, m_AkatsukiNoteIdList ); + return m_AkatsukiNoteIdList; +} +const std::set< uint32_t >& getAkatsukiNoteStringIdList() +{ + if( m_AkatsukiNoteStringIdList.size() == 0 ) + loadIdList( m_AkatsukiNoteStringDat, m_AkatsukiNoteStringIdList ); + return m_AkatsukiNoteStringIdList; +} const std::set< uint32_t >& getAnimationLODIdList() { if( m_AnimationLODIdList.size() == 0 ) @@ -10147,6 +11699,12 @@ const std::set< uint32_t >& getAquariumWaterIdList() loadIdList( m_AquariumWaterDat, m_AquariumWaterIdList ); return m_AquariumWaterIdList; } +const std::set< uint32_t >& getArchiveItemIdList() +{ + if( m_ArchiveItemIdList.size() == 0 ) + loadIdList( m_ArchiveItemDat, m_ArchiveItemIdList ); + return m_ArchiveItemIdList; +} const std::set< uint32_t >& getArrayEventHandlerIdList() { if( m_ArrayEventHandlerIdList.size() == 0 ) @@ -10159,6 +11717,12 @@ const std::set< uint32_t >& getAttackTypeIdList() loadIdList( m_AttackTypeDat, m_AttackTypeIdList ); return m_AttackTypeIdList; } +const std::set< uint32_t >& getAttractIdList() +{ + if( m_AttractIdList.size() == 0 ) + loadIdList( m_AttractDat, m_AttractIdList ); + return m_AttractIdList; +} const std::set< uint32_t >& getBacklightColorIdList() { if( m_BacklightColorIdList.size() == 0 ) @@ -10177,6 +11741,60 @@ const std::set< uint32_t >& getBalloonIdList() loadIdList( m_BalloonDat, m_BalloonIdList ); return m_BalloonIdList; } +const std::set< uint32_t >& getBannerBgIdList() +{ + if( m_BannerBgIdList.size() == 0 ) + loadIdList( m_BannerBgDat, m_BannerBgIdList ); + return m_BannerBgIdList; +} +const std::set< uint32_t >& getBannerConditionIdList() +{ + if( m_BannerConditionIdList.size() == 0 ) + loadIdList( m_BannerConditionDat, m_BannerConditionIdList ); + return m_BannerConditionIdList; +} +const std::set< uint32_t >& getBannerDecorationIdList() +{ + if( m_BannerDecorationIdList.size() == 0 ) + loadIdList( m_BannerDecorationDat, m_BannerDecorationIdList ); + return m_BannerDecorationIdList; +} +const std::set< uint32_t >& getBannerDesignPresetIdList() +{ + if( m_BannerDesignPresetIdList.size() == 0 ) + loadIdList( m_BannerDesignPresetDat, m_BannerDesignPresetIdList ); + return m_BannerDesignPresetIdList; +} +const std::set< uint32_t >& getBannerFacialIdList() +{ + if( m_BannerFacialIdList.size() == 0 ) + loadIdList( m_BannerFacialDat, m_BannerFacialIdList ); + return m_BannerFacialIdList; +} +const std::set< uint32_t >& getBannerFrameIdList() +{ + if( m_BannerFrameIdList.size() == 0 ) + loadIdList( m_BannerFrameDat, m_BannerFrameIdList ); + return m_BannerFrameIdList; +} +const std::set< uint32_t >& getBannerObtainHintTypeIdList() +{ + if( m_BannerObtainHintTypeIdList.size() == 0 ) + loadIdList( m_BannerObtainHintTypeDat, m_BannerObtainHintTypeIdList ); + return m_BannerObtainHintTypeIdList; +} +const std::set< uint32_t >& getBannerPresetIdList() +{ + if( m_BannerPresetIdList.size() == 0 ) + loadIdList( m_BannerPresetDat, m_BannerPresetIdList ); + return m_BannerPresetIdList; +} +const std::set< uint32_t >& getBannerTimelineIdList() +{ + if( m_BannerTimelineIdList.size() == 0 ) + loadIdList( m_BannerTimelineDat, m_BannerTimelineIdList ); + return m_BannerTimelineIdList; +} const std::set< uint32_t >& getBaseParamIdList() { if( m_BaseParamIdList.size() == 0 ) @@ -10285,6 +11903,12 @@ const std::set< uint32_t >& getBNpcBaseIdList() loadIdList( m_BNpcBaseDat, m_BNpcBaseIdList ); return m_BNpcBaseIdList; } +const std::set< uint32_t >& getBNpcBasePopVfxIdList() +{ + if( m_BNpcBasePopVfxIdList.size() == 0 ) + loadIdList( m_BNpcBasePopVfxDat, m_BNpcBasePopVfxIdList ); + return m_BNpcBasePopVfxIdList; +} const std::set< uint32_t >& getBNpcCustomizeIdList() { if( m_BNpcCustomizeIdList.size() == 0 ) @@ -10309,6 +11933,12 @@ const std::set< uint32_t >& getBNpcStateIdList() loadIdList( m_BNpcStateDat, m_BNpcStateIdList ); return m_BNpcStateIdList; } +const std::set< uint32_t >& getBoosterIdList() +{ + if( m_BoosterIdList.size() == 0 ) + loadIdList( m_BoosterDat, m_BoosterIdList ); + return m_BoosterIdList; +} const std::set< uint32_t >& getBuddyIdList() { if( m_BuddyIdList.size() == 0 ) @@ -10375,6 +12005,42 @@ const std::set< uint32_t >& getChannelingIdList() loadIdList( m_ChannelingDat, m_ChannelingIdList ); return m_ChannelingIdList; } +const std::set< uint32_t >& getCharaCardBaseIdList() +{ + if( m_CharaCardBaseIdList.size() == 0 ) + loadIdList( m_CharaCardBaseDat, m_CharaCardBaseIdList ); + return m_CharaCardBaseIdList; +} +const std::set< uint32_t >& getCharaCardDecorationIdList() +{ + if( m_CharaCardDecorationIdList.size() == 0 ) + loadIdList( m_CharaCardDecorationDat, m_CharaCardDecorationIdList ); + return m_CharaCardDecorationIdList; +} +const std::set< uint32_t >& getCharaCardDesignPresetIdList() +{ + if( m_CharaCardDesignPresetIdList.size() == 0 ) + loadIdList( m_CharaCardDesignPresetDat, m_CharaCardDesignPresetIdList ); + return m_CharaCardDesignPresetIdList; +} +const std::set< uint32_t >& getCharaCardDesignTypeIdList() +{ + if( m_CharaCardDesignTypeIdList.size() == 0 ) + loadIdList( m_CharaCardDesignTypeDat, m_CharaCardDesignTypeIdList ); + return m_CharaCardDesignTypeIdList; +} +const std::set< uint32_t >& getCharaCardHeaderIdList() +{ + if( m_CharaCardHeaderIdList.size() == 0 ) + loadIdList( m_CharaCardHeaderDat, m_CharaCardHeaderIdList ); + return m_CharaCardHeaderIdList; +} +const std::set< uint32_t >& getCharaCardPlayStyleIdList() +{ + if( m_CharaCardPlayStyleIdList.size() == 0 ) + loadIdList( m_CharaCardPlayStyleDat, m_CharaCardPlayStyleIdList ); + return m_CharaCardPlayStyleIdList; +} const std::set< uint32_t >& getCharaMakeClassEquipIdList() { if( m_CharaMakeClassEquipIdList.size() == 0 ) @@ -10477,6 +12143,12 @@ const std::set< uint32_t >& getClassJobIdList() loadIdList( m_ClassJobDat, m_ClassJobIdList ); return m_ClassJobIdList; } +const std::set< uint32_t >& getClassJobActionSortIdList() +{ + if( m_ClassJobActionSortIdList.size() == 0 ) + loadIdList( m_ClassJobActionSortDat, m_ClassJobActionSortIdList ); + return m_ClassJobActionSortIdList; +} const std::set< uint32_t >& getClassJobCategoryIdList() { if( m_ClassJobCategoryIdList.size() == 0 ) @@ -10639,6 +12311,12 @@ const std::set< uint32_t >& getContentCloseCycleIdList() loadIdList( m_ContentCloseCycleDat, m_ContentCloseCycleIdList ); return m_ContentCloseCycleIdList; } +const std::set< uint32_t >& getContentEventItemIdList() +{ + if( m_ContentEventItemIdList.size() == 0 ) + loadIdList( m_ContentEventItemDat, m_ContentEventItemIdList ); + return m_ContentEventItemIdList; +} const std::set< uint32_t >& getContentExActionIdList() { if( m_ContentExActionIdList.size() == 0 ) @@ -10861,24 +12539,30 @@ const std::set< uint32_t >& getDawnContentIdList() loadIdList( m_DawnContentDat, m_DawnContentIdList ); return m_DawnContentIdList; } +const std::set< uint32_t >& getDawnContentParticipableIdList() +{ + if( m_DawnContentParticipableIdList.size() == 0 ) + loadIdList( m_DawnContentParticipableDat, m_DawnContentParticipableIdList ); + return m_DawnContentParticipableIdList; +} const std::set< uint32_t >& getDawnGrowMemberIdList() { if( m_DawnGrowMemberIdList.size() == 0 ) loadIdList( m_DawnGrowMemberDat, m_DawnGrowMemberIdList ); return m_DawnGrowMemberIdList; } +const std::set< uint32_t >& getDawnMemberIdList() +{ + if( m_DawnMemberIdList.size() == 0 ) + loadIdList( m_DawnMemberDat, m_DawnMemberIdList ); + return m_DawnMemberIdList; +} const std::set< uint32_t >& getDawnMemberUIParamIdList() { if( m_DawnMemberUIParamIdList.size() == 0 ) loadIdList( m_DawnMemberUIParamDat, m_DawnMemberUIParamIdList ); return m_DawnMemberUIParamIdList; } -const std::set< uint32_t >& getDawnQuestAnnounceIdList() -{ - if( m_DawnQuestAnnounceIdList.size() == 0 ) - loadIdList( m_DawnQuestAnnounceDat, m_DawnQuestAnnounceIdList ); - return m_DawnQuestAnnounceIdList; -} const std::set< uint32_t >& getDawnQuestMemberIdList() { if( m_DawnQuestMemberIdList.size() == 0 ) @@ -10903,6 +12587,12 @@ const std::set< uint32_t >& getDeepDungeonDangerIdList() loadIdList( m_DeepDungeonDangerDat, m_DeepDungeonDangerIdList ); return m_DeepDungeonDangerIdList; } +const std::set< uint32_t >& getDeepDungeonDemicloneIdList() +{ + if( m_DeepDungeonDemicloneIdList.size() == 0 ) + loadIdList( m_DeepDungeonDemicloneDat, m_DeepDungeonDemicloneIdList ); + return m_DeepDungeonDemicloneIdList; +} const std::set< uint32_t >& getDeepDungeonEquipmentIdList() { if( m_DeepDungeonEquipmentIdList.size() == 0 ) @@ -11227,6 +12917,12 @@ const std::set< uint32_t >& getEventItemTimelineIdList() loadIdList( m_EventItemTimelineDat, m_EventItemTimelineIdList ); return m_EventItemTimelineIdList; } +const std::set< uint32_t >& getEventPathMoveIdList() +{ + if( m_EventPathMoveIdList.size() == 0 ) + loadIdList( m_EventPathMoveDat, m_EventPathMoveIdList ); + return m_EventPathMoveIdList; +} const std::set< uint32_t >& getEventSystemDefineIdList() { if( m_EventSystemDefineIdList.size() == 0 ) @@ -11245,12 +12941,30 @@ const std::set< uint32_t >& getExportedSGIdList() loadIdList( m_ExportedSGDat, m_ExportedSGIdList ); return m_ExportedSGIdList; } +const std::set< uint32_t >& getExtraCommandIdList() +{ + if( m_ExtraCommandIdList.size() == 0 ) + loadIdList( m_ExtraCommandDat, m_ExtraCommandIdList ); + return m_ExtraCommandIdList; +} const std::set< uint32_t >& getExVersionIdList() { if( m_ExVersionIdList.size() == 0 ) loadIdList( m_ExVersionDat, m_ExVersionIdList ); return m_ExVersionIdList; } +const std::set< uint32_t >& getFashionCheckThemeCategoryIdList() +{ + if( m_FashionCheckThemeCategoryIdList.size() == 0 ) + loadIdList( m_FashionCheckThemeCategoryDat, m_FashionCheckThemeCategoryIdList ); + return m_FashionCheckThemeCategoryIdList; +} +const std::set< uint32_t >& getFashionCheckWeeklyThemeIdList() +{ + if( m_FashionCheckWeeklyThemeIdList.size() == 0 ) + loadIdList( m_FashionCheckWeeklyThemeDat, m_FashionCheckWeeklyThemeIdList ); + return m_FashionCheckWeeklyThemeIdList; +} const std::set< uint32_t >& getFateIdList() { if( m_FateIdList.size() == 0 ) @@ -11275,6 +12989,12 @@ const std::set< uint32_t >& getFateProgressUIIdList() loadIdList( m_FateProgressUIDat, m_FateProgressUIIdList ); return m_FateProgressUIIdList; } +const std::set< uint32_t >& getFateShopIdList() +{ + if( m_FateShopIdList.size() == 0 ) + loadIdList( m_FateShopDat, m_FateShopIdList ); + return m_FateShopIdList; +} const std::set< uint32_t >& getFateTokenTypeIdList() { if( m_FateTokenTypeIdList.size() == 0 ) @@ -11365,6 +13085,12 @@ const std::set< uint32_t >& getFieldMarkerIdList() loadIdList( m_FieldMarkerDat, m_FieldMarkerIdList ); return m_FieldMarkerIdList; } +const std::set< uint32_t >& getFishingBaitParameterIdList() +{ + if( m_FishingBaitParameterIdList.size() == 0 ) + loadIdList( m_FishingBaitParameterDat, m_FishingBaitParameterIdList ); + return m_FishingBaitParameterIdList; +} const std::set< uint32_t >& getFishingRecordTypeIdList() { if( m_FishingRecordTypeIdList.size() == 0 ) @@ -11389,6 +13115,30 @@ const std::set< uint32_t >& getFishParameterIdList() loadIdList( m_FishParameterDat, m_FishParameterIdList ); return m_FishParameterIdList; } +const std::set< uint32_t >& getFittingShopIdList() +{ + if( m_FittingShopIdList.size() == 0 ) + loadIdList( m_FittingShopDat, m_FittingShopIdList ); + return m_FittingShopIdList; +} +const std::set< uint32_t >& getFittingShopCategoryIdList() +{ + if( m_FittingShopCategoryIdList.size() == 0 ) + loadIdList( m_FittingShopCategoryDat, m_FittingShopCategoryIdList ); + return m_FittingShopCategoryIdList; +} +const std::set< uint32_t >& getFittingShopCategoryItemIdList() +{ + if( m_FittingShopCategoryItemIdList.size() == 0 ) + loadIdList( m_FittingShopCategoryItemDat, m_FittingShopCategoryItemIdList ); + return m_FittingShopCategoryItemIdList; +} +const std::set< uint32_t >& getFittingShopItemSetIdList() +{ + if( m_FittingShopItemSetIdList.size() == 0 ) + loadIdList( m_FittingShopItemSetDat, m_FittingShopItemSetIdList ); + return m_FittingShopItemSetIdList; +} const std::set< uint32_t >& getFrontline03IdList() { if( m_Frontline03IdList.size() == 0 ) @@ -11413,12 +13163,30 @@ const std::set< uint32_t >& getFurnitureCatalogItemListIdList() loadIdList( m_FurnitureCatalogItemListDat, m_FurnitureCatalogItemListIdList ); return m_FurnitureCatalogItemListIdList; } +const std::set< uint32_t >& getGameRewardObtainTypeIdList() +{ + if( m_GameRewardObtainTypeIdList.size() == 0 ) + loadIdList( m_GameRewardObtainTypeDat, m_GameRewardObtainTypeIdList ); + return m_GameRewardObtainTypeIdList; +} const std::set< uint32_t >& getGardeningSeedIdList() { if( m_GardeningSeedIdList.size() == 0 ) loadIdList( m_GardeningSeedDat, m_GardeningSeedIdList ); return m_GardeningSeedIdList; } +const std::set< uint32_t >& getGathererCrafterToolIdList() +{ + if( m_GathererCrafterToolIdList.size() == 0 ) + loadIdList( m_GathererCrafterToolDat, m_GathererCrafterToolIdList ); + return m_GathererCrafterToolIdList; +} +const std::set< uint32_t >& getGathererReductionRewardIdList() +{ + if( m_GathererReductionRewardIdList.size() == 0 ) + loadIdList( m_GathererReductionRewardDat, m_GathererReductionRewardIdList ); + return m_GathererReductionRewardIdList; +} const std::set< uint32_t >& getGatheringConditionIdList() { if( m_GatheringConditionIdList.size() == 0 ) @@ -12037,6 +13805,12 @@ const std::set< uint32_t >& getHWDSharedGroupControlParamIdList() loadIdList( m_HWDSharedGroupControlParamDat, m_HWDSharedGroupControlParamIdList ); return m_HWDSharedGroupControlParamIdList; } +const std::set< uint32_t >& getIconLanguageIdList() +{ + if( m_IconLanguageIdList.size() == 0 ) + loadIdList( m_IconLanguageDat, m_IconLanguageIdList ); + return m_IconLanguageIdList; +} const std::set< uint32_t >& getIKDContentBonusIdList() { if( m_IKDContentBonusIdList.size() == 0 ) @@ -12085,6 +13859,18 @@ const std::set< uint32_t >& getInclusionShopSeriesIdList() loadIdList( m_InclusionShopSeriesDat, m_InclusionShopSeriesIdList ); return m_InclusionShopSeriesIdList; } +const std::set< uint32_t >& getInclusionShopWelcomIdList() +{ + if( m_InclusionShopWelcomIdList.size() == 0 ) + loadIdList( m_InclusionShopWelcomDat, m_InclusionShopWelcomIdList ); + return m_InclusionShopWelcomIdList; +} +const std::set< uint32_t >& getInclusionShopWelcomTextIdList() +{ + if( m_InclusionShopWelcomTextIdList.size() == 0 ) + loadIdList( m_InclusionShopWelcomTextDat, m_InclusionShopWelcomTextIdList ); + return m_InclusionShopWelcomTextIdList; +} const std::set< uint32_t >& getIndividualWeatherIdList() { if( m_IndividualWeatherIdList.size() == 0 ) @@ -12115,6 +13901,12 @@ const std::set< uint32_t >& getInstanceContentGuideIdList() loadIdList( m_InstanceContentGuideDat, m_InstanceContentGuideIdList ); return m_InstanceContentGuideIdList; } +const std::set< uint32_t >& getInstanceContentQICDataIdList() +{ + if( m_InstanceContentQICDataIdList.size() == 0 ) + loadIdList( m_InstanceContentQICDataDat, m_InstanceContentQICDataIdList ); + return m_InstanceContentQICDataIdList; +} const std::set< uint32_t >& getInstanceContentTextDataIdList() { if( m_InstanceContentTextDataIdList.size() == 0 ) @@ -12157,6 +13949,24 @@ const std::set< uint32_t >& getItemLevelIdList() loadIdList( m_ItemLevelDat, m_ItemLevelIdList ); return m_ItemLevelIdList; } +const std::set< uint32_t >& getItemRepairPriceIdList() +{ + if( m_ItemRepairPriceIdList.size() == 0 ) + loadIdList( m_ItemRepairPriceDat, m_ItemRepairPriceIdList ); + return m_ItemRepairPriceIdList; +} +const std::set< uint32_t >& getItemRepairResourceIdList() +{ + if( m_ItemRepairResourceIdList.size() == 0 ) + loadIdList( m_ItemRepairResourceDat, m_ItemRepairResourceIdList ); + return m_ItemRepairResourceIdList; +} +const std::set< uint32_t >& getItemRetainerLevelUpIdList() +{ + if( m_ItemRetainerLevelUpIdList.size() == 0 ) + loadIdList( m_ItemRetainerLevelUpDat, m_ItemRetainerLevelUpIdList ); + return m_ItemRetainerLevelUpIdList; +} const std::set< uint32_t >& getItemSearchCategoryIdList() { if( m_ItemSearchCategoryIdList.size() == 0 ) @@ -12181,6 +13991,12 @@ const std::set< uint32_t >& getItemSpecialBonusIdList() loadIdList( m_ItemSpecialBonusDat, m_ItemSpecialBonusIdList ); return m_ItemSpecialBonusIdList; } +const std::set< uint32_t >& getItemStainConditionIdList() +{ + if( m_ItemStainConditionIdList.size() == 0 ) + loadIdList( m_ItemStainConditionDat, m_ItemStainConditionIdList ); + return m_ItemStainConditionIdList; +} const std::set< uint32_t >& getItemUICategoryIdList() { if( m_ItemUICategoryIdList.size() == 0 ) @@ -12355,6 +14171,12 @@ const std::set< uint32_t >& getMapConditionIdList() loadIdList( m_MapConditionDat, m_MapConditionIdList ); return m_MapConditionIdList; } +const std::set< uint32_t >& getMapExclusiveIdList() +{ + if( m_MapExclusiveIdList.size() == 0 ) + loadIdList( m_MapExclusiveDat, m_MapExclusiveIdList ); + return m_MapExclusiveIdList; +} const std::set< uint32_t >& getMapMarkerIdList() { if( m_MapMarkerIdList.size() == 0 ) @@ -12367,12 +14189,30 @@ const std::set< uint32_t >& getMapMarkerRegionIdList() loadIdList( m_MapMarkerRegionDat, m_MapMarkerRegionIdList ); return m_MapMarkerRegionIdList; } +const std::set< uint32_t >& getMapReplaceIdList() +{ + if( m_MapReplaceIdList.size() == 0 ) + loadIdList( m_MapReplaceDat, m_MapReplaceIdList ); + return m_MapReplaceIdList; +} const std::set< uint32_t >& getMapSymbolIdList() { if( m_MapSymbolIdList.size() == 0 ) loadIdList( m_MapSymbolDat, m_MapSymbolIdList ); return m_MapSymbolIdList; } +const std::set< uint32_t >& getMapTransientPvPMapIdList() +{ + if( m_MapTransientPvPMapIdList.size() == 0 ) + loadIdList( m_MapTransientPvPMapDat, m_MapTransientPvPMapIdList ); + return m_MapTransientPvPMapIdList; +} +const std::set< uint32_t >& getMapTypeIdList() +{ + if( m_MapTypeIdList.size() == 0 ) + loadIdList( m_MapTypeDat, m_MapTypeIdList ); + return m_MapTypeIdList; +} const std::set< uint32_t >& getMarkerIdList() { if( m_MarkerIdList.size() == 0 ) @@ -12385,6 +14225,12 @@ const std::set< uint32_t >& getMateriaIdList() loadIdList( m_MateriaDat, m_MateriaIdList ); return m_MateriaIdList; } +const std::set< uint32_t >& getMateriaGradeIdList() +{ + if( m_MateriaGradeIdList.size() == 0 ) + loadIdList( m_MateriaGradeDat, m_MateriaGradeIdList ); + return m_MateriaGradeIdList; +} const std::set< uint32_t >& getMateriaJoinRateIdList() { if( m_MateriaJoinRateIdList.size() == 0 ) @@ -12403,6 +14249,18 @@ const std::set< uint32_t >& getMateriaTomestoneRateIdList() loadIdList( m_MateriaTomestoneRateDat, m_MateriaTomestoneRateIdList ); return m_MateriaTomestoneRateIdList; } +const std::set< uint32_t >& getMcGuffinIdList() +{ + if( m_McGuffinIdList.size() == 0 ) + loadIdList( m_McGuffinDat, m_McGuffinIdList ); + return m_McGuffinIdList; +} +const std::set< uint32_t >& getMcGuffinUIDataIdList() +{ + if( m_McGuffinUIDataIdList.size() == 0 ) + loadIdList( m_McGuffinUIDataDat, m_McGuffinUIDataIdList ); + return m_McGuffinUIDataIdList; +} const std::set< uint32_t >& getMiniGameRAIdList() { if( m_MiniGameRAIdList.size() == 0 ) @@ -12427,6 +14285,228 @@ const std::set< uint32_t >& getMinionSkillTypeIdList() loadIdList( m_MinionSkillTypeDat, m_MinionSkillTypeIdList ); return m_MinionSkillTypeIdList; } +const std::set< uint32_t >& getMJIAnimalsIdList() +{ + if( m_MJIAnimalsIdList.size() == 0 ) + loadIdList( m_MJIAnimalsDat, m_MJIAnimalsIdList ); + return m_MJIAnimalsIdList; +} +const std::set< uint32_t >& getMJIBuildingIdList() +{ + if( m_MJIBuildingIdList.size() == 0 ) + loadIdList( m_MJIBuildingDat, m_MJIBuildingIdList ); + return m_MJIBuildingIdList; +} +const std::set< uint32_t >& getMJIBuildingPlaceIdList() +{ + if( m_MJIBuildingPlaceIdList.size() == 0 ) + loadIdList( m_MJIBuildingPlaceDat, m_MJIBuildingPlaceIdList ); + return m_MJIBuildingPlaceIdList; +} +const std::set< uint32_t >& getMJICraftworksObjectIdList() +{ + if( m_MJICraftworksObjectIdList.size() == 0 ) + loadIdList( m_MJICraftworksObjectDat, m_MJICraftworksObjectIdList ); + return m_MJICraftworksObjectIdList; +} +const std::set< uint32_t >& getMJICraftworksObjectThemeIdList() +{ + if( m_MJICraftworksObjectThemeIdList.size() == 0 ) + loadIdList( m_MJICraftworksObjectThemeDat, m_MJICraftworksObjectThemeIdList ); + return m_MJICraftworksObjectThemeIdList; +} +const std::set< uint32_t >& getMJICraftworksPopularityIdList() +{ + if( m_MJICraftworksPopularityIdList.size() == 0 ) + loadIdList( m_MJICraftworksPopularityDat, m_MJICraftworksPopularityIdList ); + return m_MJICraftworksPopularityIdList; +} +const std::set< uint32_t >& getMJICraftworksPopularityTypeIdList() +{ + if( m_MJICraftworksPopularityTypeIdList.size() == 0 ) + loadIdList( m_MJICraftworksPopularityTypeDat, m_MJICraftworksPopularityTypeIdList ); + return m_MJICraftworksPopularityTypeIdList; +} +const std::set< uint32_t >& getMJICraftworksRankRatioIdList() +{ + if( m_MJICraftworksRankRatioIdList.size() == 0 ) + loadIdList( m_MJICraftworksRankRatioDat, m_MJICraftworksRankRatioIdList ); + return m_MJICraftworksRankRatioIdList; +} +const std::set< uint32_t >& getMJICraftworksSupplyDefineIdList() +{ + if( m_MJICraftworksSupplyDefineIdList.size() == 0 ) + loadIdList( m_MJICraftworksSupplyDefineDat, m_MJICraftworksSupplyDefineIdList ); + return m_MJICraftworksSupplyDefineIdList; +} +const std::set< uint32_t >& getMJICraftworksTensionIdList() +{ + if( m_MJICraftworksTensionIdList.size() == 0 ) + loadIdList( m_MJICraftworksTensionDat, m_MJICraftworksTensionIdList ); + return m_MJICraftworksTensionIdList; +} +const std::set< uint32_t >& getMJICropSeedIdList() +{ + if( m_MJICropSeedIdList.size() == 0 ) + loadIdList( m_MJICropSeedDat, m_MJICropSeedIdList ); + return m_MJICropSeedIdList; +} +const std::set< uint32_t >& getMJIDisposalShopItemIdList() +{ + if( m_MJIDisposalShopItemIdList.size() == 0 ) + loadIdList( m_MJIDisposalShopItemDat, m_MJIDisposalShopItemIdList ); + return m_MJIDisposalShopItemIdList; +} +const std::set< uint32_t >& getMJIDisposalShopUICategoryIdList() +{ + if( m_MJIDisposalShopUICategoryIdList.size() == 0 ) + loadIdList( m_MJIDisposalShopUICategoryDat, m_MJIDisposalShopUICategoryIdList ); + return m_MJIDisposalShopUICategoryIdList; +} +const std::set< uint32_t >& getMJIFarmPastureRankIdList() +{ + if( m_MJIFarmPastureRankIdList.size() == 0 ) + loadIdList( m_MJIFarmPastureRankDat, m_MJIFarmPastureRankIdList ); + return m_MJIFarmPastureRankIdList; +} +const std::set< uint32_t >& getMJIFunctionIdList() +{ + if( m_MJIFunctionIdList.size() == 0 ) + loadIdList( m_MJIFunctionDat, m_MJIFunctionIdList ); + return m_MJIFunctionIdList; +} +const std::set< uint32_t >& getMJIGatheringIdList() +{ + if( m_MJIGatheringIdList.size() == 0 ) + loadIdList( m_MJIGatheringDat, m_MJIGatheringIdList ); + return m_MJIGatheringIdList; +} +const std::set< uint32_t >& getMJIGatheringItemIdList() +{ + if( m_MJIGatheringItemIdList.size() == 0 ) + loadIdList( m_MJIGatheringItemDat, m_MJIGatheringItemIdList ); + return m_MJIGatheringItemIdList; +} +const std::set< uint32_t >& getMJIGatheringObjectIdList() +{ + if( m_MJIGatheringObjectIdList.size() == 0 ) + loadIdList( m_MJIGatheringObjectDat, m_MJIGatheringObjectIdList ); + return m_MJIGatheringObjectIdList; +} +const std::set< uint32_t >& getMJIGatheringToolIdList() +{ + if( m_MJIGatheringToolIdList.size() == 0 ) + loadIdList( m_MJIGatheringToolDat, m_MJIGatheringToolIdList ); + return m_MJIGatheringToolIdList; +} +const std::set< uint32_t >& getMJIHudModeIdList() +{ + if( m_MJIHudModeIdList.size() == 0 ) + loadIdList( m_MJIHudModeDat, m_MJIHudModeIdList ); + return m_MJIHudModeIdList; +} +const std::set< uint32_t >& getMJIItemCategoryIdList() +{ + if( m_MJIItemCategoryIdList.size() == 0 ) + loadIdList( m_MJIItemCategoryDat, m_MJIItemCategoryIdList ); + return m_MJIItemCategoryIdList; +} +const std::set< uint32_t >& getMJIItemPouchIdList() +{ + if( m_MJIItemPouchIdList.size() == 0 ) + loadIdList( m_MJIItemPouchDat, m_MJIItemPouchIdList ); + return m_MJIItemPouchIdList; +} +const std::set< uint32_t >& getMJIKeyItemIdList() +{ + if( m_MJIKeyItemIdList.size() == 0 ) + loadIdList( m_MJIKeyItemDat, m_MJIKeyItemIdList ); + return m_MJIKeyItemIdList; +} +const std::set< uint32_t >& getMJILandmarkIdList() +{ + if( m_MJILandmarkIdList.size() == 0 ) + loadIdList( m_MJILandmarkDat, m_MJILandmarkIdList ); + return m_MJILandmarkIdList; +} +const std::set< uint32_t >& getMJILandmarkPlaceIdList() +{ + if( m_MJILandmarkPlaceIdList.size() == 0 ) + loadIdList( m_MJILandmarkPlaceDat, m_MJILandmarkPlaceIdList ); + return m_MJILandmarkPlaceIdList; +} +const std::set< uint32_t >& getMJILivelyActorIdList() +{ + if( m_MJILivelyActorIdList.size() == 0 ) + loadIdList( m_MJILivelyActorDat, m_MJILivelyActorIdList ); + return m_MJILivelyActorIdList; +} +const std::set< uint32_t >& getMJIMinionPopAreasIdList() +{ + if( m_MJIMinionPopAreasIdList.size() == 0 ) + loadIdList( m_MJIMinionPopAreasDat, m_MJIMinionPopAreasIdList ); + return m_MJIMinionPopAreasIdList; +} +const std::set< uint32_t >& getMJIProgressIdList() +{ + if( m_MJIProgressIdList.size() == 0 ) + loadIdList( m_MJIProgressDat, m_MJIProgressIdList ); + return m_MJIProgressIdList; +} +const std::set< uint32_t >& getMJIRankIdList() +{ + if( m_MJIRankIdList.size() == 0 ) + loadIdList( m_MJIRankDat, m_MJIRankIdList ); + return m_MJIRankIdList; +} +const std::set< uint32_t >& getMJIRecipeIdList() +{ + if( m_MJIRecipeIdList.size() == 0 ) + loadIdList( m_MJIRecipeDat, m_MJIRecipeIdList ); + return m_MJIRecipeIdList; +} +const std::set< uint32_t >& getMJIRecipeMaterialIdList() +{ + if( m_MJIRecipeMaterialIdList.size() == 0 ) + loadIdList( m_MJIRecipeMaterialDat, m_MJIRecipeMaterialIdList ); + return m_MJIRecipeMaterialIdList; +} +const std::set< uint32_t >& getMJIStockyardManagementAreaIdList() +{ + if( m_MJIStockyardManagementAreaIdList.size() == 0 ) + loadIdList( m_MJIStockyardManagementAreaDat, m_MJIStockyardManagementAreaIdList ); + return m_MJIStockyardManagementAreaIdList; +} +const std::set< uint32_t >& getMJIStockyardManagementTableIdList() +{ + if( m_MJIStockyardManagementTableIdList.size() == 0 ) + loadIdList( m_MJIStockyardManagementTableDat, m_MJIStockyardManagementTableIdList ); + return m_MJIStockyardManagementTableIdList; +} +const std::set< uint32_t >& getMJITextIdList() +{ + if( m_MJITextIdList.size() == 0 ) + loadIdList( m_MJITextDat, m_MJITextIdList ); + return m_MJITextIdList; +} +const std::set< uint32_t >& getMJIVillageAppearanceSGIdList() +{ + if( m_MJIVillageAppearanceSGIdList.size() == 0 ) + loadIdList( m_MJIVillageAppearanceSGDat, m_MJIVillageAppearanceSGIdList ); + return m_MJIVillageAppearanceSGIdList; +} +const std::set< uint32_t >& getMJIVillageAppearanceUIIdList() +{ + if( m_MJIVillageAppearanceUIIdList.size() == 0 ) + loadIdList( m_MJIVillageAppearanceUIDat, m_MJIVillageAppearanceUIIdList ); + return m_MJIVillageAppearanceUIIdList; +} +const std::set< uint32_t >& getMJIVillageDevelopmentIdList() +{ + if( m_MJIVillageDevelopmentIdList.size() == 0 ) + loadIdList( m_MJIVillageDevelopmentDat, m_MJIVillageDevelopmentIdList ); + return m_MJIVillageDevelopmentIdList; +} const std::set< uint32_t >& getMobHuntOrderIdList() { if( m_MobHuntOrderIdList.size() == 0 ) @@ -12571,6 +14651,24 @@ const std::set< uint32_t >& getMovieSubtitleVoyageIdList() loadIdList( m_MovieSubtitleVoyageDat, m_MovieSubtitleVoyageIdList ); return m_MovieSubtitleVoyageIdList; } +const std::set< uint32_t >& getMultipleHelpIdList() +{ + if( m_MultipleHelpIdList.size() == 0 ) + loadIdList( m_MultipleHelpDat, m_MultipleHelpIdList ); + return m_MultipleHelpIdList; +} +const std::set< uint32_t >& getMultipleHelpPageIdList() +{ + if( m_MultipleHelpPageIdList.size() == 0 ) + loadIdList( m_MultipleHelpPageDat, m_MultipleHelpPageIdList ); + return m_MultipleHelpPageIdList; +} +const std::set< uint32_t >& getMultipleHelpStringIdList() +{ + if( m_MultipleHelpStringIdList.size() == 0 ) + loadIdList( m_MultipleHelpStringDat, m_MultipleHelpStringIdList ); + return m_MultipleHelpStringIdList; +} const std::set< uint32_t >& getMYCTemporaryItemIdList() { if( m_MYCTemporaryItemIdList.size() == 0 ) @@ -12625,6 +14723,18 @@ const std::set< uint32_t >& getOmenIdList() loadIdList( m_OmenDat, m_OmenIdList ); return m_OmenIdList; } +const std::set< uint32_t >& getOmikujiIdList() +{ + if( m_OmikujiIdList.size() == 0 ) + loadIdList( m_OmikujiDat, m_OmikujiIdList ); + return m_OmikujiIdList; +} +const std::set< uint32_t >& getOmikujiGuidanceIdList() +{ + if( m_OmikujiGuidanceIdList.size() == 0 ) + loadIdList( m_OmikujiGuidanceDat, m_OmikujiGuidanceIdList ); + return m_OmikujiGuidanceIdList; +} const std::set< uint32_t >& getOnlineStatusIdList() { if( m_OnlineStatusIdList.size() == 0 ) @@ -12679,6 +14789,12 @@ const std::set< uint32_t >& getOrnamentIdList() loadIdList( m_OrnamentDat, m_OrnamentIdList ); return m_OrnamentIdList; } +const std::set< uint32_t >& getOrnamentActionIdList() +{ + if( m_OrnamentActionIdList.size() == 0 ) + loadIdList( m_OrnamentActionDat, m_OrnamentActionIdList ); + return m_OrnamentActionIdList; +} const std::set< uint32_t >& getParamGrowIdList() { if( m_ParamGrowIdList.size() == 0 ) @@ -12775,6 +14891,18 @@ const std::set< uint32_t >& getPlantPotFlowerSeedIdList() loadIdList( m_PlantPotFlowerSeedDat, m_PlantPotFlowerSeedIdList ); return m_PlantPotFlowerSeedIdList; } +const std::set< uint32_t >& getPlayerSearchLocationIdList() +{ + if( m_PlayerSearchLocationIdList.size() == 0 ) + loadIdList( m_PlayerSearchLocationDat, m_PlayerSearchLocationIdList ); + return m_PlayerSearchLocationIdList; +} +const std::set< uint32_t >& getPlayerSearchSubLocationIdList() +{ + if( m_PlayerSearchSubLocationIdList.size() == 0 ) + loadIdList( m_PlayerSearchSubLocationDat, m_PlayerSearchSubLocationIdList ); + return m_PlayerSearchSubLocationIdList; +} const std::set< uint32_t >& getPreHandlerIdList() { if( m_PreHandlerIdList.size() == 0 ) @@ -12793,6 +14921,12 @@ const std::set< uint32_t >& getPresetCameraAdjustIdList() loadIdList( m_PresetCameraAdjustDat, m_PresetCameraAdjustIdList ); return m_PresetCameraAdjustIdList; } +const std::set< uint32_t >& getPreviewableItemsIdList() +{ + if( m_PreviewableItemsIdList.size() == 0 ) + loadIdList( m_PreviewableItemsDat, m_PreviewableItemsIdList ); + return m_PreviewableItemsIdList; +} const std::set< uint32_t >& getPublicContentIdList() { if( m_PublicContentIdList.size() == 0 ) @@ -12823,6 +14957,12 @@ const std::set< uint32_t >& getPvPActionSortIdList() loadIdList( m_PvPActionSortDat, m_PvPActionSortIdList ); return m_PvPActionSortIdList; } +const std::set< uint32_t >& getPvPBaseParamValueIdList() +{ + if( m_PvPBaseParamValueIdList.size() == 0 ) + loadIdList( m_PvPBaseParamValueDat, m_PvPBaseParamValueIdList ); + return m_PvPBaseParamValueIdList; +} const std::set< uint32_t >& getPvPRankIdList() { if( m_PvPRankIdList.size() == 0 ) @@ -12835,6 +14975,18 @@ const std::set< uint32_t >& getPvPSelectTraitIdList() loadIdList( m_PvPSelectTraitDat, m_PvPSelectTraitIdList ); return m_PvPSelectTraitIdList; } +const std::set< uint32_t >& getPvPSeriesIdList() +{ + if( m_PvPSeriesIdList.size() == 0 ) + loadIdList( m_PvPSeriesDat, m_PvPSeriesIdList ); + return m_PvPSeriesIdList; +} +const std::set< uint32_t >& getPvPSeriesLevelIdList() +{ + if( m_PvPSeriesLevelIdList.size() == 0 ) + loadIdList( m_PvPSeriesLevelDat, m_PvPSeriesLevelIdList ); + return m_PvPSeriesLevelIdList; +} const std::set< uint32_t >& getPvPTraitIdList() { if( m_PvPTraitIdList.size() == 0 ) @@ -12877,6 +15029,12 @@ const std::set< uint32_t >& getQuestClassJobSupplyIdList() loadIdList( m_QuestClassJobSupplyDat, m_QuestClassJobSupplyIdList ); return m_QuestClassJobSupplyIdList; } +const std::set< uint32_t >& getQuestDefineClientIdList() +{ + if( m_QuestDefineClientIdList.size() == 0 ) + loadIdList( m_QuestDefineClientDat, m_QuestDefineClientIdList ); + return m_QuestDefineClientIdList; +} const std::set< uint32_t >& getQuestDerivedClassIdList() { if( m_QuestDerivedClassIdList.size() == 0 ) @@ -12895,6 +15053,18 @@ const std::set< uint32_t >& getQuestEffectDefineIdList() loadIdList( m_QuestEffectDefineDat, m_QuestEffectDefineIdList ); return m_QuestEffectDefineIdList; } +const std::set< uint32_t >& getQuestLinkMarkerIdList() +{ + if( m_QuestLinkMarkerIdList.size() == 0 ) + loadIdList( m_QuestLinkMarkerDat, m_QuestLinkMarkerIdList ); + return m_QuestLinkMarkerIdList; +} +const std::set< uint32_t >& getQuestLinkMarkerSetIdList() +{ + if( m_QuestLinkMarkerSetIdList.size() == 0 ) + loadIdList( m_QuestLinkMarkerSetDat, m_QuestLinkMarkerSetIdList ); + return m_QuestLinkMarkerSetIdList; +} const std::set< uint32_t >& getQuestRedoIdList() { if( m_QuestRedoIdList.size() == 0 ) @@ -12937,6 +15107,18 @@ const std::set< uint32_t >& getQuestRewardOtherIdList() loadIdList( m_QuestRewardOtherDat, m_QuestRewardOtherIdList ); return m_QuestRewardOtherIdList; } +const std::set< uint32_t >& getQuestSelectTitleIdList() +{ + if( m_QuestSelectTitleIdList.size() == 0 ) + loadIdList( m_QuestSelectTitleDat, m_QuestSelectTitleIdList ); + return m_QuestSelectTitleIdList; +} +const std::set< uint32_t >& getQuestSetDefineIdList() +{ + if( m_QuestSetDefineIdList.size() == 0 ) + loadIdList( m_QuestSetDefineDat, m_QuestSetDefineIdList ); + return m_QuestSetDefineIdList; +} const std::set< uint32_t >& getQuickChatIdList() { if( m_QuickChatIdList.size() == 0 ) @@ -12985,6 +15167,24 @@ const std::set< uint32_t >& getRacingChocoboParamIdList() loadIdList( m_RacingChocoboParamDat, m_RacingChocoboParamIdList ); return m_RacingChocoboParamIdList; } +const std::set< uint32_t >& getRaidFinderParamIdList() +{ + if( m_RaidFinderParamIdList.size() == 0 ) + loadIdList( m_RaidFinderParamDat, m_RaidFinderParamIdList ); + return m_RaidFinderParamIdList; +} +const std::set< uint32_t >& getReactionEventObjectIdList() +{ + if( m_ReactionEventObjectIdList.size() == 0 ) + loadIdList( m_ReactionEventObjectDat, m_ReactionEventObjectIdList ); + return m_ReactionEventObjectIdList; +} +const std::set< uint32_t >& getReactionEventObjectInfoIdList() +{ + if( m_ReactionEventObjectInfoIdList.size() == 0 ) + loadIdList( m_ReactionEventObjectInfoDat, m_ReactionEventObjectInfoIdList ); + return m_ReactionEventObjectInfoIdList; +} const std::set< uint32_t >& getRecastNavimeshIdList() { if( m_RecastNavimeshIdList.size() == 0 ) @@ -13129,6 +15329,12 @@ const std::set< uint32_t >& getSatisfactionArbitrationIdList() loadIdList( m_SatisfactionArbitrationDat, m_SatisfactionArbitrationIdList ); return m_SatisfactionArbitrationIdList; } +const std::set< uint32_t >& getSatisfactionBonusGuaranteeIdList() +{ + if( m_SatisfactionBonusGuaranteeIdList.size() == 0 ) + loadIdList( m_SatisfactionBonusGuaranteeDat, m_SatisfactionBonusGuaranteeIdList ); + return m_SatisfactionBonusGuaranteeIdList; +} const std::set< uint32_t >& getSatisfactionNpcIdList() { if( m_SatisfactionNpcIdList.size() == 0 ) @@ -13183,6 +15389,24 @@ const std::set< uint32_t >& getSecretRecipeBookIdList() loadIdList( m_SecretRecipeBookDat, m_SecretRecipeBookIdList ); return m_SecretRecipeBookIdList; } +const std::set< uint32_t >& getSharlayanCraftWorksIdList() +{ + if( m_SharlayanCraftWorksIdList.size() == 0 ) + loadIdList( m_SharlayanCraftWorksDat, m_SharlayanCraftWorksIdList ); + return m_SharlayanCraftWorksIdList; +} +const std::set< uint32_t >& getSharlayanCraftWorksSupplyIdList() +{ + if( m_SharlayanCraftWorksSupplyIdList.size() == 0 ) + loadIdList( m_SharlayanCraftWorksSupplyDat, m_SharlayanCraftWorksSupplyIdList ); + return m_SharlayanCraftWorksSupplyIdList; +} +const std::set< uint32_t >& getShellFixedFromCommandIdList() +{ + if( m_ShellFixedFromCommandIdList.size() == 0 ) + loadIdList( m_ShellFixedFromCommandDat, m_ShellFixedFromCommandIdList ); + return m_ShellFixedFromCommandIdList; +} const std::set< uint32_t >& getSkyIsland2MissionIdList() { if( m_SkyIsland2MissionIdList.size() == 0 ) @@ -13207,6 +15431,12 @@ const std::set< uint32_t >& getSkyIsland2RangeTypeIdList() loadIdList( m_SkyIsland2RangeTypeDat, m_SkyIsland2RangeTypeIdList ); return m_SkyIsland2RangeTypeIdList; } +const std::set< uint32_t >& getSnipeIdList() +{ + if( m_SnipeIdList.size() == 0 ) + loadIdList( m_SnipeDat, m_SnipeIdList ); + return m_SnipeIdList; +} const std::set< uint32_t >& getSnipeTalkIdList() { if( m_SnipeTalkIdList.size() == 0 ) @@ -13219,6 +15449,12 @@ const std::set< uint32_t >& getSnipeTalkNameIdList() loadIdList( m_SnipeTalkNameDat, m_SnipeTalkNameIdList ); return m_SnipeTalkNameIdList; } +const std::set< uint32_t >& getSpearfishingComboTargetIdList() +{ + if( m_SpearfishingComboTargetIdList.size() == 0 ) + loadIdList( m_SpearfishingComboTargetDat, m_SpearfishingComboTargetIdList ); + return m_SpearfishingComboTargetIdList; +} const std::set< uint32_t >& getSpearfishingItemIdList() { if( m_SpearfishingItemIdList.size() == 0 ) @@ -13237,6 +15473,12 @@ const std::set< uint32_t >& getSpearfishingRecordPageIdList() loadIdList( m_SpearfishingRecordPageDat, m_SpearfishingRecordPageIdList ); return m_SpearfishingRecordPageIdList; } +const std::set< uint32_t >& getSpearfishingSilhouetteIdList() +{ + if( m_SpearfishingSilhouetteIdList.size() == 0 ) + loadIdList( m_SpearfishingSilhouetteDat, m_SpearfishingSilhouetteIdList ); + return m_SpearfishingSilhouetteIdList; +} const std::set< uint32_t >& getSpecialShopIdList() { if( m_SpecialShopIdList.size() == 0 ) @@ -13327,12 +15569,24 @@ const std::set< uint32_t >& getSwitchTalkVariationIdList() loadIdList( m_SwitchTalkVariationDat, m_SwitchTalkVariationIdList ); return m_SwitchTalkVariationIdList; } +const std::set< uint32_t >& getTelepoRelayIdList() +{ + if( m_TelepoRelayIdList.size() == 0 ) + loadIdList( m_TelepoRelayDat, m_TelepoRelayIdList ); + return m_TelepoRelayIdList; +} const std::set< uint32_t >& getTerritoryTypeIdList() { if( m_TerritoryTypeIdList.size() == 0 ) loadIdList( m_TerritoryTypeDat, m_TerritoryTypeIdList ); return m_TerritoryTypeIdList; } +const std::set< uint32_t >& getTerritoryTypeTelepoIdList() +{ + if( m_TerritoryTypeTelepoIdList.size() == 0 ) + loadIdList( m_TerritoryTypeTelepoDat, m_TerritoryTypeTelepoIdList ); + return m_TerritoryTypeTelepoIdList; +} const std::set< uint32_t >& getTerritoryTypeTransientIdList() { if( m_TerritoryTypeTransientIdList.size() == 0 ) @@ -13357,6 +15611,24 @@ const std::set< uint32_t >& getTitleIdList() loadIdList( m_TitleDat, m_TitleIdList ); return m_TitleIdList; } +const std::set< uint32_t >& getTofuEditParamIdList() +{ + if( m_TofuEditParamIdList.size() == 0 ) + loadIdList( m_TofuEditParamDat, m_TofuEditParamIdList ); + return m_TofuEditParamIdList; +} +const std::set< uint32_t >& getTofuObjectIdList() +{ + if( m_TofuObjectIdList.size() == 0 ) + loadIdList( m_TofuObjectDat, m_TofuObjectIdList ); + return m_TofuObjectIdList; +} +const std::set< uint32_t >& getTofuObjectCategoryIdList() +{ + if( m_TofuObjectCategoryIdList.size() == 0 ) + loadIdList( m_TofuObjectCategoryDat, m_TofuObjectCategoryIdList ); + return m_TofuObjectCategoryIdList; +} const std::set< uint32_t >& getTomestonesIdList() { if( m_TomestonesIdList.size() == 0 ) @@ -13447,6 +15719,12 @@ const std::set< uint32_t >& getTripleTriadCardIdList() loadIdList( m_TripleTriadCardDat, m_TripleTriadCardIdList ); return m_TripleTriadCardIdList; } +const std::set< uint32_t >& getTripleTriadCardObtainIdList() +{ + if( m_TripleTriadCardObtainIdList.size() == 0 ) + loadIdList( m_TripleTriadCardObtainDat, m_TripleTriadCardObtainIdList ); + return m_TripleTriadCardObtainIdList; +} const std::set< uint32_t >& getTripleTriadCardRarityIdList() { if( m_TripleTriadCardRarityIdList.size() == 0 ) @@ -13525,6 +15803,12 @@ const std::set< uint32_t >& getUIColorIdList() loadIdList( m_UIColorDat, m_UIColorIdList ); return m_UIColorIdList; } +const std::set< uint32_t >& getUIConstIdList() +{ + if( m_UIConstIdList.size() == 0 ) + loadIdList( m_UIConstDat, m_UIConstIdList ); + return m_UIConstIdList; +} const std::set< uint32_t >& getVaseFlowerIdList() { if( m_VaseFlowerIdList.size() == 0 ) @@ -13537,6 +15821,36 @@ const std::set< uint32_t >& getVFXIdList() loadIdList( m_VFXDat, m_VFXIdList ); return m_VFXIdList; } +const std::set< uint32_t >& getVVDDataIdList() +{ + if( m_VVDDataIdList.size() == 0 ) + loadIdList( m_VVDDataDat, m_VVDDataIdList ); + return m_VVDDataIdList; +} +const std::set< uint32_t >& getVVDNotebookContentsIdList() +{ + if( m_VVDNotebookContentsIdList.size() == 0 ) + loadIdList( m_VVDNotebookContentsDat, m_VVDNotebookContentsIdList ); + return m_VVDNotebookContentsIdList; +} +const std::set< uint32_t >& getVVDNotebookSeriesIdList() +{ + if( m_VVDNotebookSeriesIdList.size() == 0 ) + loadIdList( m_VVDNotebookSeriesDat, m_VVDNotebookSeriesIdList ); + return m_VVDNotebookSeriesIdList; +} +const std::set< uint32_t >& getVVDRouteDataIdList() +{ + if( m_VVDRouteDataIdList.size() == 0 ) + loadIdList( m_VVDRouteDataDat, m_VVDRouteDataIdList ); + return m_VVDRouteDataIdList; +} +const std::set< uint32_t >& getVVDVariantActionIdList() +{ + if( m_VVDVariantActionIdList.size() == 0 ) + loadIdList( m_VVDVariantActionDat, m_VVDVariantActionIdList ); + return m_VVDVariantActionIdList; +} const std::set< uint32_t >& getWarpIdList() { if( m_WarpIdList.size() == 0 ) diff --git a/src/world/Actor/PlayerQuest.cpp b/src/world/Actor/PlayerQuest.cpp index 7029c64e..c103652b 100644 --- a/src/world/Actor/PlayerQuest.cpp +++ b/src/world/Actor/PlayerQuest.cpp @@ -1070,8 +1070,8 @@ bool Sapphire::Entity::Player::giveQuestRewards( uint32_t questId, uint32_t opti exp = questInfo->expFactor; - auto rewardItemCount = questInfo->itemReward0.size(); - uint16_t optionalItemCount = static_cast< uint16_t >( questInfo->itemReward1.size() ); + auto rewardItemCount = questInfo->itemReward.size(); + uint16_t optionalItemCount = static_cast< uint16_t >( questInfo->optionalItemReward.size() ); uint32_t gilReward = questInfo->gilReward; @@ -1083,10 +1083,10 @@ bool Sapphire::Entity::Player::giveQuestRewards( uint32_t questId, uint32_t opti { for( uint32_t i = 0; i < rewardItemCount; i++ ) { - auto itemId = questInfo->itemReward0.at( i ); + auto itemId = questInfo->itemReward.at( i ); if( itemId > 0 ) { - addItem( itemId, questInfo->itemCountReward0.at( i ), false, false, true, true ); + addItem( itemId, questInfo->itemCountReward.at( i ), false, false, true, true ); } } } @@ -1095,10 +1095,10 @@ bool Sapphire::Entity::Player::giveQuestRewards( uint32_t questId, uint32_t opti { for( uint32_t i = 0; i < optionalItemCount; i++ ) { - auto itemId = questInfo->itemReward1.at( i ); + auto itemId = questInfo->optionalItemReward.at( i ); if( itemId > 0 && itemId == optionalChoice ) { - addItem( itemId, questInfo->itemCountReward1.at( i ), false, false, true, true ); + addItem( itemId, questInfo->optionalItemCountReward.at( i ), false, false, true, true ); break; } } From 4c0087e09a6648ee61d53048177ec25d64996574 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 03:11:50 -0300 Subject: [PATCH 03/21] Bump Expac and Player Level --- src/common/Common.h | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/common/Common.h b/src/common/Common.h index 8f9c258b..66b142a6 100644 --- a/src/common/Common.h +++ b/src/common/Common.h @@ -22,8 +22,8 @@ namespace Sapphire::Common const int32_t INVALID_GAME_OBJECT_ID = 0xE0000000; const uint64_t INVALID_GAME_OBJECT_ID64 = 0xE0000000; - const uint16_t MAX_PLAYER_LEVEL = 80; - const uint8_t CURRENT_EXPANSION_ID = 3; + const uint16_t MAX_PLAYER_LEVEL = 90; + const uint8_t CURRENT_EXPANSION_ID = 4; const uint8_t CLASSJOB_TOTAL = 38; const uint8_t CLASSJOB_SLOTS = 30; From 4c473969ca5fd0416352c1cc92623f34bb554195 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 03:15:07 -0300 Subject: [PATCH 04/21] Bump more constants for 6.x --- src/common/Common.h | 7 ++++--- 1 file changed, 4 insertions(+), 3 deletions(-) diff --git a/src/common/Common.h b/src/common/Common.h index 66b142a6..a99c7dde 100644 --- a/src/common/Common.h +++ b/src/common/Common.h @@ -25,17 +25,18 @@ namespace Sapphire::Common const uint16_t MAX_PLAYER_LEVEL = 90; const uint8_t CURRENT_EXPANSION_ID = 4; - const uint8_t CLASSJOB_TOTAL = 38; + const uint8_t CLASSJOB_TOTAL = 40; const uint8_t CLASSJOB_SLOTS = 30; - const uint8_t TOWN_COUNT = 6; + const uint8_t TOWN_COUNT = 7; /*! * @brief The maximum length (in ms) of a combo before it is canceled/voided. * * The client has a combo timer of about 12 seconds, with a 0.5 second grace on top for latency considerations. + * Changed to 15 seconds in Shadowbringers, then 30 seconds in Endwalker. */ - const uint16_t MAX_COMBO_LENGTH = 12500; + const uint16_t MAX_COMBO_LENGTH = 30000; struct FFXIVARR_POSITION3_U16 { From 9e3d2127cb4530490df86b461f2b162259c92352 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 03:21:17 -0300 Subject: [PATCH 05/21] Update Player array --- src/world/Actor/Player.h | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/src/world/Actor/Player.h b/src/world/Actor/Player.h index d5cfcce6..9b93ebdd 100644 --- a/src/world/Actor/Player.h +++ b/src/world/Actor/Player.h @@ -1076,21 +1076,21 @@ namespace Sapphire::Entity uint16_t m_activeTitle; uint8_t m_titleList[48]; - uint8_t m_howTo[34]; - uint8_t m_minions[55]; + uint8_t m_howTo[35]; + uint8_t m_minions[56]; uint8_t m_mountGuide[29]; uint8_t m_homePoint; uint8_t m_startTown; uint16_t m_townWarpFstFlags; uint8_t m_questCompleteFlags[487]; - uint8_t m_discovery[445]; + uint8_t m_discovery[464]; uint32_t m_playTime; uint16_t m_classArray[ Common::CLASSJOB_SLOTS ]; uint32_t m_expArray[ Common::CLASSJOB_SLOTS ]; uint8_t m_aetheryte[21]; uint8_t m_unlocks[64]; - uint8_t m_orchestrion[40]; + uint8_t m_orchestrion[64]; uint8_t m_openingSequence; From 6389597004ca5d6a8740f9909a016676aa98b704 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 03:32:22 -0300 Subject: [PATCH 06/21] Update Loby encryption key --- src/lobby/GameConnection.cpp | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/lobby/GameConnection.cpp b/src/lobby/GameConnection.cpp index b7156cd4..8b804afe 100644 --- a/src/lobby/GameConnection.cpp +++ b/src/lobby/GameConnection.cpp @@ -452,8 +452,8 @@ void Lobby::GameConnection::generateEncryptionKey( uint32_t key, const std::stri m_baseKey[ 2 ] = 0x34; m_baseKey[ 3 ] = 0x12; memcpy( m_baseKey + 0x04, &key, 4 ); - m_baseKey[ 8 ] = 0x18; - m_baseKey[ 9 ] = 0x15; + m_baseKey[ 8 ] = 0xD4; + m_baseKey[ 9 ] = 0x17; memcpy( ( char* ) m_baseKey + 0x0C, keyPhrase.c_str(), keyPhrase.size() ); Common::Util::md5( m_baseKey, m_encKey, 0x2C ); } From 7449d16c7e76e81d60f821d0974f5119785c5ea4 Mon Sep 17 00:00:00 2001 From: Moydow <28638419+Moydow@users.noreply.github.com> Date: Sun, 12 Jun 2022 21:44:11 +0100 Subject: [PATCH 07/21] Oodle support for 6.15 Requires the oodle2base.h and oodle2net.h header files, and oo2net_9_win64.dll, to be placed in /deps/Oodle/ - they are not included here --- CMakeLists.txt | 2 ++ deps/Oodle/CMakeLists.txt | 9 +++++ src/common/CMakeLists.txt | 4 ++- src/common/Network/CommonNetwork.h | 12 ++++--- src/common/Network/GamePacketParser.cpp | 47 +++++++++++++++++++++++-- src/common/Network/GamePacketParser.h | 7 ++++ src/common/Network/Oodle.cpp | 28 +++++++++++++++ src/common/Network/Oodle.h | 28 +++++++++++++++ 8 files changed, 130 insertions(+), 7 deletions(-) create mode 100644 deps/Oodle/CMakeLists.txt create mode 100644 src/common/Network/Oodle.cpp create mode 100644 src/common/Network/Oodle.h diff --git a/CMakeLists.txt b/CMakeLists.txt index 76160f3d..6597c437 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -15,6 +15,7 @@ add_custom_target( copy_runtime_files ALL COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/web ${CMAKE_BINARY_DIR}/bin/web COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/sql_import.sh ${CMAKE_BINARY_DIR}/bin/sql_import.sh COMMAND ${CMAKE_COMMAND} -E remove_directory ${CMAKE_BINARY_DIR}/bin/data/actions + COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/deps/oo2net_9_win64.dll ${CMAKE_BINARY_DIR}/bin/oo2net_9_win64.dll COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/deps/ffxiv-actions/actions ${CMAKE_BINARY_DIR}/bin/data/actions ) ###################################### @@ -43,6 +44,7 @@ find_package( MySQL ) ############################## add_subdirectory( "deps/zlib" ) add_subdirectory( "deps/MySQL" ) +add_subdirectory( "deps/Oodle" ) add_subdirectory( "deps/datReader" ) add_subdirectory( "deps/mysqlConnector" ) add_subdirectory( "deps/recastnavigation" ) diff --git a/deps/Oodle/CMakeLists.txt b/deps/Oodle/CMakeLists.txt new file mode 100644 index 00000000..ef90dcbc --- /dev/null +++ b/deps/Oodle/CMakeLists.txt @@ -0,0 +1,9 @@ +add_library(OodleNet STATIC IMPORTED GLOBAL) + +set_target_properties( + OodleNet + PROPERTIES + IMPORTED_IMPLIB "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" + IMPORTED_LOCATION "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" + LINKER_LANGUAGE C +) \ No newline at end of file diff --git a/src/common/CMakeLists.txt b/src/common/CMakeLists.txt index 88ab338d..ed7c32bd 100644 --- a/src/common/CMakeLists.txt +++ b/src/common/CMakeLists.txt @@ -20,7 +20,8 @@ target_link_libraries( common PUBLIC xivdat mysqlConnector - mysql ) + mysql + OodleNet ) if( UNIX ) target_link_libraries( common PUBLIC @@ -32,6 +33,7 @@ target_include_directories( common PUBLIC "${CMAKE_CURRENT_SOURCE_DIR}/" "${CMAKE_CURRENT_SOURCE_DIR}/../../deps/" + "${CMAKE_CURRENT_SOURCE_DIR}/../../deps/Oodle/" "${CMAKE_CURRENT_SOURCE_DIR}/../../deps/asio/asio/include/" "${CMAKE_CURRENT_SOURCE_DIR}/../../deps/spdlog/include/" ) diff --git a/src/common/Network/CommonNetwork.h b/src/common/Network/CommonNetwork.h index 1a2bd4d6..30050164 100644 --- a/src/common/Network/CommonNetwork.h +++ b/src/common/Network/CommonNetwork.h @@ -44,7 +44,7 @@ namespace Sapphire::Network::Packets * +-------------------------------+---------------+-------+-------+ * | timestamp | size | cType | count | * +---+---+-------+---------------+---------------+-------+-------+ - * | ? |CMP| ? | ? | + * | ? |CMP| ? | oodleDcmpSize | * +---+---+-------+---------------+ * (followed by /count/ FFXIVARR_PACKET_SEGMENTs) */ @@ -62,9 +62,13 @@ namespace Sapphire::Network::Packets /** The number of packet segments that follow. */ uint16_t count; uint8_t unknown_20; - /** Indicates if the data segments of this packet are compressed. */ - uint8_t isCompressed; - uint32_t unknown_24; + /** Indicates compression method of the data segments of this packet. + * 0: none, 1: Zlib, 2: Oodle + */ + uint8_t compressionType; + uint16_t unknown_22; + /** The size of the packet payload when decompressed, only used if compressionType = Oodle */ + uint32_t oodleDecompressedSize; }; inline std::ostream& operator<<( std::ostream& os, const FFXIVARR_PACKET_HEADER& hdr ) diff --git a/src/common/Network/GamePacketParser.cpp b/src/common/Network/GamePacketParser.cpp index b14d2657..f16248f2 100644 --- a/src/common/Network/GamePacketParser.cpp +++ b/src/common/Network/GamePacketParser.cpp @@ -1,7 +1,9 @@ #include "CommonNetwork.h" #include "GamePacketParser.h" +#include "Oodle.h" #include // memcpy +#include using namespace Sapphire; using namespace Sapphire::Network::Packets; @@ -49,10 +51,51 @@ PacketParseResult Network::Packets::getPackets( const std::vector< uint8_t >& bu std::vector< FFXIVARR_PACKET_RAW >& packets ) { // sanity check: check there's enough bytes in the buffer - const auto bytesExpected = packetHeader.size - sizeof( struct FFXIVARR_PACKET_HEADER ); + auto bytesExpected = packetHeader.size - sizeof( struct FFXIVARR_PACKET_HEADER ); if( buffer.size() - offset < bytesExpected ) return Incomplete; + std::vector< uint8_t > decompBuf; + + // check compression, do decompress if Oodle/Zlib + if( packetHeader.compressionType == Oodle ) + { + std::vector< uint8_t > inBuf; + inBuf.assign( buffer.begin() + sizeof( struct FFXIVARR_PACKET_HEADER ), buffer.end() ); + + std::vector< uint8_t > outBuf; + outBuf.resize( packetHeader.oodleDecompressedSize ); + + auto _oodle = Network::Oodle(); + bool oodleSuccess = _oodle.oodleDecode( inBuf, bytesExpected, outBuf, packetHeader.oodleDecompressedSize ); + + if( !oodleSuccess ) + { + Logger::warn( "Oodle decompression failed." ); + return Malformed; + } + + bytesExpected = packetHeader.oodleDecompressedSize; + + decompBuf.assign( buffer.begin(), buffer.begin() + sizeof( struct FFXIVARR_PACKET_HEADER ) ); + decompBuf.insert( decompBuf.end(), outBuf.begin(), outBuf.end() ); + } + + else if( packetHeader.compressionType == Zlib ) + { + // to do(?): Zlib decompression should go here, + // but I don't think the client ever sends Zlib packets? So it may not be needed + } + + else if( packetHeader.compressionType == NoCompression ) + decompBuf.assign( buffer.begin(), buffer.end() ); + + else + { + Logger::warn( "Unknown packet compression type: {}", packetHeader.compressionType ); + return Malformed; + } + // Loop each message uint32_t count = 0; uint32_t bytesProcessed = 0; @@ -61,7 +104,7 @@ PacketParseResult Network::Packets::getPackets( const std::vector< uint8_t >& bu FFXIVARR_PACKET_RAW rawPacket; // Copy ipc packet message - const auto packetResult = getPacket( buffer, offset + bytesProcessed, rawPacket ); + const auto packetResult = getPacket( decompBuf, offset + bytesProcessed, rawPacket ); if( packetResult != Success ) return packetResult; diff --git a/src/common/Network/GamePacketParser.h b/src/common/Network/GamePacketParser.h index c50b486a..a8083f8b 100644 --- a/src/common/Network/GamePacketParser.h +++ b/src/common/Network/GamePacketParser.h @@ -18,6 +18,13 @@ namespace Sapphire::Network::Packets Malformed }; + enum CompressionType + { + NoCompression, + Zlib, + Oodle, + }; + /// Read packet header from buffer with given offset. /// Buffer with given offset must be pointing to start of the new FFXIV packet. PacketParseResult getHeader( const std::vector< uint8_t >& buffer, const uint32_t offset, diff --git a/src/common/Network/Oodle.cpp b/src/common/Network/Oodle.cpp new file mode 100644 index 00000000..53a2044c --- /dev/null +++ b/src/common/Network/Oodle.cpp @@ -0,0 +1,28 @@ +#include "Oodle.h" + +using namespace Sapphire; + +Network::Oodle::Oodle() : + m_htbits(19) +{ + auto stateSize = OodleNetwork1UDP_State_Size(); + auto sharedSize = OodleNetwork1_Shared_Size( m_htbits ); + + m_state = std::vector< uint8_t >( stateSize, 0 ); + m_shared = std::vector< uint8_t >( sharedSize, 0 ); + m_window = std::vector< uint8_t >( 0x8000, 0 ); + + oodleInit(); +} + +void Network::Oodle::oodleInit() +{ + OodleNetwork1_Shared_SetWindow( (OodleNetwork1_Shared*) &m_shared[0], m_htbits, &m_window[0], (int) m_window.size() ); + OodleNetwork1UDP_Train( (OodleNetwork1UDP_State*) &m_state[0], (OodleNetwork1_Shared*) &m_shared[0], nullptr, nullptr, 0 ); +} + +bool Network::Oodle::oodleDecode( const std::vector< uint8_t > &enc, uint32_t encSize, std::vector< uint8_t > &dec, uint32_t decSize ) +{ + OodleNetwork1_Shared_SetWindow( (OodleNetwork1_Shared*) &m_shared[0], m_htbits, &m_window[0], (int) m_window.size() ); + return OodleNetwork1UDP_Decode( (OodleNetwork1UDP_State*) &m_state[0], (OodleNetwork1_Shared*) &m_shared[0], &enc[0], encSize, &dec[0], decSize ); +} \ No newline at end of file diff --git a/src/common/Network/Oodle.h b/src/common/Network/Oodle.h new file mode 100644 index 00000000..b01dcf29 --- /dev/null +++ b/src/common/Network/Oodle.h @@ -0,0 +1,28 @@ +#ifndef _OODLE_H +#define _OODLE_H + +#include + +#include + +namespace Sapphire::Network +{ + class Oodle + { + private: + std::vector< uint8_t > m_state; + std::vector< uint8_t > m_shared; + std::vector< uint8_t > m_window; + + int m_htbits; + + public: + Oodle(); + virtual ~Oodle() = default; + + void oodleInit(); + bool oodleDecode( const std::vector< uint8_t > &enc, uint32_t encSize, std::vector< uint8_t > &dec, uint32_t decSize ); + }; +} + +#endif // _OODLE_H \ No newline at end of file From 064851ff2e1c2519326bd64597e5e2376c7af69b Mon Sep 17 00:00:00 2001 From: Moydow <28638419+Moydow@users.noreply.github.com> Date: Sun, 12 Jun 2022 23:54:24 +0100 Subject: [PATCH 08/21] don't need SetWindow here --- src/common/Network/Oodle.cpp | 1 - 1 file changed, 1 deletion(-) diff --git a/src/common/Network/Oodle.cpp b/src/common/Network/Oodle.cpp index 53a2044c..32e007de 100644 --- a/src/common/Network/Oodle.cpp +++ b/src/common/Network/Oodle.cpp @@ -23,6 +23,5 @@ void Network::Oodle::oodleInit() bool Network::Oodle::oodleDecode( const std::vector< uint8_t > &enc, uint32_t encSize, std::vector< uint8_t > &dec, uint32_t decSize ) { - OodleNetwork1_Shared_SetWindow( (OodleNetwork1_Shared*) &m_shared[0], m_htbits, &m_window[0], (int) m_window.size() ); return OodleNetwork1UDP_Decode( (OodleNetwork1UDP_State*) &m_state[0], (OodleNetwork1_Shared*) &m_shared[0], &enc[0], encSize, &dec[0], decSize ); } \ No newline at end of file From 432cdc0de899a2de3dae3d83793a5e38b2253488 Mon Sep 17 00:00:00 2001 From: Moydow <28638419+Moydow@users.noreply.github.com> Date: Tue, 14 Jun 2022 04:28:42 +0100 Subject: [PATCH 09/21] added a short form oodle2net.h Custom short version of oodle2net.h that only sets up the functions we need here. Still need oo2net_9_win64.dll and oo2net_9_win64.lib which won't be added here --- deps/Oodle/oodle2net.h | 32 ++++++++++++++++++++++++++++++++ src/common/Network/Oodle.cpp | 6 +++--- 2 files changed, 35 insertions(+), 3 deletions(-) create mode 100644 deps/Oodle/oodle2net.h diff --git a/deps/Oodle/oodle2net.h b/deps/Oodle/oodle2net.h new file mode 100644 index 00000000..59c718c9 --- /dev/null +++ b/deps/Oodle/oodle2net.h @@ -0,0 +1,32 @@ +#ifndef __OODLE2NET_H__ +#define __OODLE2NET_H__ + +extern "C" intptr_t __stdcall OodleNetwork1_Shared_Size( int32_t htbits ); + +extern "C" intptr_t __stdcall OodleNetwork1UDP_State_Size(); + +extern "C" void __stdcall OodleNetwork1_Shared_SetWindow( + void* shared, + int32_t htbits, + const void* window, + int32_t windowSize +); + +extern "C" void __stdcall OodleNetwork1UDP_Train( + void* state, + const void* shared, + const void** trainingPacketPointers, + const int32_t* trainingPacketSizes, + int32_t numTrainingPackets +); + +extern "C" bool __stdcall OodleNetwork1UDP_Decode( + void* state, + const void* shared, + const void* enc, + intptr_t encSize, + void* dec, + intptr_t decSize +); + +#endif \ No newline at end of file diff --git a/src/common/Network/Oodle.cpp b/src/common/Network/Oodle.cpp index 32e007de..58f65f73 100644 --- a/src/common/Network/Oodle.cpp +++ b/src/common/Network/Oodle.cpp @@ -17,11 +17,11 @@ Network::Oodle::Oodle() : void Network::Oodle::oodleInit() { - OodleNetwork1_Shared_SetWindow( (OodleNetwork1_Shared*) &m_shared[0], m_htbits, &m_window[0], (int) m_window.size() ); - OodleNetwork1UDP_Train( (OodleNetwork1UDP_State*) &m_state[0], (OodleNetwork1_Shared*) &m_shared[0], nullptr, nullptr, 0 ); + OodleNetwork1_Shared_SetWindow( &m_shared[0], m_htbits, &m_window[0], (int) m_window.size() ); + OodleNetwork1UDP_Train( &m_state[0], &m_shared[0], nullptr, nullptr, 0 ); } bool Network::Oodle::oodleDecode( const std::vector< uint8_t > &enc, uint32_t encSize, std::vector< uint8_t > &dec, uint32_t decSize ) { - return OodleNetwork1UDP_Decode( (OodleNetwork1UDP_State*) &m_state[0], (OodleNetwork1_Shared*) &m_shared[0], &enc[0], encSize, &dec[0], decSize ); + return OodleNetwork1UDP_Decode( &m_state[0], &m_shared[0], &enc[0], encSize, &dec[0], decSize ); } \ No newline at end of file From a2bdb4e3472d4c3e9f9e634815bd431abdded3f0 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 04:25:51 -0300 Subject: [PATCH 10/21] Update Network definitions to 6.30hf1 (Thanks Moydow, Reyli, Guaiguaijun) --- src/common/Network/PacketDef/Ipcs.h | 338 ++++++++--------- .../Network/PacketDef/Lobby/ServerLobbyDef.h | 5 +- .../Network/PacketDef/Zone/ServerZoneDef.h | 348 +++++++++--------- 3 files changed, 341 insertions(+), 350 deletions(-) diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index 0db60930..8c72b80d 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -43,67 +43,69 @@ namespace Sapphire::Network::Packets */ enum ServerZoneIpcType : uint16_t { - Ping = 0x02A8, // updated 5.58 hotfix - Init = 0x013C, // updated 5.58 hotfix + Ping = 0x00DA, // updated 6.30h + Init = 0x01E4, // updated 6.30h - ActorFreeSpawn = 0x00B5, // updated 5.58 hotfix - InitZone = 0x0320, // updated 5.58 hotfix + ActorFreeSpawn = 0x28a, // updated 6.30h + InitZone = 0x222, // updated 6.30h - EffectResult = 0x0387, // updated 5.58 hotfix - ActorControl = 0x00B0, // updated 5.58 hotfix - ActorControlSelf = 0x02B6, // updated 5.58 hotfix - ActorControlTarget = 0x03C5, // updated 5.58 hotfix + EffectResult = 0x22c, // updated 6.30h + EffectResultBasic = 0x384, // updated 6.30h + + ActorControl = 0x179, // updated 6.30h + ActorControlSelf = 0x26f, // updated 6.30h + ActorControlTarget = 0x220, // updated 6.30h /*! * @brief Used when resting */ - UpdateHpMpTp = 0x01A7, // updated 5.58 hotfix + UpdateHpMpTp = 0x383, // updated 6.30h /////////////////////////////////////////////////// ChatBanned = 0xF06B, - Playtime = 0x0179, // updated 5.58 hotfix - Logout = 0x0214, // updated 5.58 hotfix - CFNotify = 0x0327, // updated 5.58 hotfix + Playtime = 0x326, // updated 6.30h + Logout = 0x1d0, // updated 6.30h + CFNotify = 0x38b, // updated 6.30h CFMemberStatus = 0x0079, - CFDutyInfo = 0x03AA, // updated 5.58 hotfix + CFDutyInfo = 0x1f8, // updated 6.30h CFPlayerInNeed = 0xF07F, - CFPreferredRole = 0x024B, // updated 5.58 hotfix - CFCancel = 0x01AC, // updated 5.58 hotfix + CFPreferredRole = 0xde, // updated 6.30h + CFCancel = 0x102, // updated 6.30h SocialRequestError = 0xF0AD, CFRegistered = 0x029F, // updated 5.58 hotfix - SocialRequestResponse = 0x0082, // updated 5.58 hotfix + SocialRequestResponse = 0x95, // updated 6.30h SocialMessage = 0x03CB, // updated 5.58 hotfix SocialMessage2 = 0x01D7, // updated 5.58 hotfix CancelAllianceForming = 0xF0C6, // updated 4.2 - LogMessage = 0x0118, // updated 5.58 hotfix + LogMessage = 0x343, // updated 6.30h - Chat = 0x00FE, // updated 5.58 hotfix + Chat = 0x10a, // updated 6.30h PartyChat = 0x0065, WorldVisitList = 0xF0FE, // added 4.5 - SocialList = 0x015F, // updated 5.58 hotfix + SocialList = 0x01f1, // updated 6.30h - ExamineSearchInfo = 0x0133, // updated 5.58 hotfix - UpdateSearchInfo = 0x03E5, // updated 5.58 hotfix + ExamineSearchInfo = 0x30e, // updated 6.30h + UpdateSearchInfo = 0x34a, // updated 6.30h InitSearchInfo = 0x0321, // updated 5.58 hotfix - ExamineSearchComment = 0x03AD, // updated 5.58 hotfix + ExamineSearchComment = 0x30c, // updated 6.30h ServerNoticeShort = 0x0333, // updated 5.58 hotfix - ServerNotice = 0x0171, // updated 5.58 hotfix - SetOnlineStatus = 0x037B, // updated 5.58 hotfix + ServerNotice = 0x0363, // updated 5.58 hotfix + SetOnlineStatus = 0x324, // updated 6.30h - CountdownInitiate = 0x0111, // updated 5.58 hotfix - CountdownCancel = 0x0231, // updated 5.58 hotfix + CountdownInitiate = 0x3b1, // updated 6.30h + CountdownInitiate = 0x3b1, // updated 6.30h - PlayerAddedToBlacklist = 0x024E, // updated 5.58 hotfix - PlayerRemovedFromBlacklist = 0x011D, // updated 5.58 hotfix - BlackList = 0x03C0, // updated 5.58 hotfix + PlayerAddedToBlacklist = 0x399, // updated 6.30h + PlayerRemovedFromBlacklist = 0x1dc, // updated 6.30h + BlackList = 0x016B, // updated 6.30h - LinkshellList = 0x02E2, // updated 5.58 hotfix + LinkshellList = 0x1e2, // updated 6.30h MailDeleteRequest = 0xF12B, // updated 5.0 @@ -114,108 +116,108 @@ namespace Sapphire::Network::Packets MarketTaxRates = 0x01F8, // updated 5.35 hotfix - MarketBoardSearchResult = 0x01F1, // updated 5.58 hotfix - MarketBoardItemListingCount = 0x0068, // updated 5.58 hotfix - MarketBoardItemListingHistory = 0x01BA, // updated 5.58 hotfix - MarketBoardItemListing = 0x0076, // updated 5.58 hotfix + MarketBoardSearchResult = 0x21e, // updated 6.30h + MarketBoardItemListingCount = 0xaa, // updated 6.30h + MarketBoardItemListingHistory = 0xa8, // updated 6.30h + MarketBoardItemListing = 0x2f1, // updated 6.30h CharaFreeCompanyTag = 0x013B, // updated 4.5 FreeCompanyBoardMsg = 0x03DB, // updated 5.58 hotfix - FreeCompanyInfo = 0x01F7, // updated 5.58 hotfix - ExamineFreeCompanyInfo = 0x0324, // updated 5.58 hotfix + FreeCompanyInfo = 0x1dd, // updated 5.58 hotfix + ExamineFreeCompanyInfo = 0xcd, // updated 5.58 hotfix FreeCompanyUpdateShortMessage = 0xF157, // added 5.0 - StatusEffectList = 0x0074, // updated 5.58 hotfix - EurekaStatusEffectList = 0x0167, // updated 5.18 - BossStatusEffectList = 0x0312, // added 5.1 - Effect = 0x03CA, // updated 5.58 hotfix - AoeEffect8 = 0x03C4, // updated 5.58 hotfix - AoeEffect16 = 0x00FA, // updated 5.58 hotfix - AoeEffect24 = 0x0339, // updated 5.58 hotfix - AoeEffect32 = 0x023C, // updated 5.58 hotfix - PersistantEffect = 0x025D, // updated 5.58 hotfix + StatusEffectList = 0x2bc, // updated 6.30h + EurekaStatusEffectList = 0x353, // updated 6.30h + BossStatusEffectList = 0x1ee, // updated 6.30h + Effect = 0x1c9, // updated 6.30h + AoeEffect8 = 0x24a, // updated 6.30h + AoeEffect16 = 0x38a, // updated 6.30h + AoeEffect24 = 0xc8, // updated 6.30h + AoeEffect32 = 0x32b, // updated 6.30h + PersistantEffect = 0x24c, // updated 6.30h - GCAffiliation = 0x0094, // updated 5.58 hotfix + GCAffiliation = 0x372, // updated 6.30h - PlayerSpawn = 0x01D8, // updated 5.58 hotfix - NpcSpawn = 0x00D2, // updated 5.58 hotfix - NpcSpawn2 = 0x01CB, // ( Bigger statuseffectlist? ) updated 5.3 - ActorMove = 0x00F8, // updated 5.58 hotfix + PlayerSpawn = 0x007f, // updated 6.30h + NpcSpawn = 0x39e, // updated 6.30h + NpcSpawn2 = 0x2e5, // updated 6.30h + ActorMove = 0x1db, // updated 6.30h - ActorSetPos = 0x0299, // updated 5.58 hotfix + ActorSetPos = 0x18c, // updated 6.30h - ActorCast = 0x015D, // updated 5.58 hotfix + ActorCast = 0x29c, // updated 6.30h SomeCustomiseChangePacketProbably = 0x00CD, // added 5.18 - PartyList = 0x0349, // updated 5.58 hotfix - PartyMessage = 0x00A4, // updated 5.58 hotfix - HateRank = 0x0150, // updated 5.58 hotfix - HateList = 0x0243, // updated 5.58 hotfix - ObjectSpawn = 0x0125, // updated 5.58 hotfix - ObjectDespawn = 0x0148, // updated 5.58 hotfix - UpdateClassInfo = 0x0084, // updated 5.58 hotfix + PartyList = 0x1f6, // updated 6.30h + PartyMessage = 0x1e8, // updated 6.30h + HateRank = 0x134, // updated 6.30h + HateList = 0x2f9, // updated 6.30h + ObjectSpawn = 0x31b, // updated 6.30h + ObjectDespawn = 0x1b3, // updated 6.30h + UpdateClassInfo = 0x2d9, // updated 6.30h SilentSetClassJob = 0xF18E, // updated 5.0 - seems to be the case, not sure if it's actually used for anything - PlayerSetup = 0x01D5, // updated 5.58 hotfix - PlayerStats = 0x0295, // updated 5.58 hotfix - ActorOwner = 0x0260, // updated 5.58 hotfix - PlayerStateFlags = 0x03BF, // updated 5.58 hotfix - PlayerClassInfo = 0x0131, // updated 5.58 hotfix - CharaVisualEffect = 0x0292, // updated 5.58 hotfix + PlayerSetup = 0x2b3, // updated 6.30h + PlayerStats = 0x1b8, // updated 6.30h + ActorOwner = 0x2b3, // updated 6.30h + PlayerStateFlags = 0xd5, // updated 6.30h + PlayerClassInfo = 0x2a6, // updated 6.30h + CharaVisualEffect = 0x1e9, // updated 6.30h - ModelEquip = 0x03A2, // updated 5.58 hotfix - Examine = 0x0365, // updated 5.58 hotfix - CharaNameReq = 0x01F0, // updated 5.58 hotfix + ModelEquip = 0x286, // updated 6.30h + Examine = 0x1BC, // updated 6.30h + CharaNameReq = 0x35c, // updated 6.30h // nb: see #565 on github UpdateRetainerItemSalePrice = 0xF19F, // updated 5.0 - RetainerSaleHistory = 0x03CE, // updated 5.58 hotfix - RetainerInformation = 0x022F, // updated 5.58 hotfix + RetainerSaleHistory = 0x14a, // updated 6.30h + RetainerInformation = 0x39c, // Updated 6.30h SetLevelSync = 0x1186, // not updated for 4.4, not sure what it is anymore - ItemInfo = 0x01CC, // updated 5.58 hotfix - ContainerInfo = 0x025C, // updated 5.58 hotfix - InventoryTransactionFinish = 0x0176, // updated 5.58 hotfix - InventoryTransaction = 0x027F, // updated 5.58 hotfix - CurrencyCrystalInfo = 0x0345, // updated 5.58 hotfix + ItemInfo = 0x302, // updated 6.30h + ContainerInfo = 0x255, // updated 6.30h + InventoryTransactionFinish = 0x1be, // updated 6.30h + InventoryTransaction = 0x77, // updated 6.30h + CurrencyCrystalInfo = 0x2bb, // updated 6.30h - InventoryActionAck = 0x03B8, // updated 5.58 hotfix - UpdateInventorySlot = 0x02F7, // updated 5.58 hotfix + InventoryActionAck = 0x1eb, // updated 6.30h + UpdateInventorySlot = 0x10e, // updated 6.30h - HuntingLogEntry = 0x01D9, // updated 5.58 hotfix + HuntingLogEntry = 0x2ca, // updated 6.30h - EventPlay = 0x016B, // updated 5.58 hotfix - EventPlay4 = 0x010A, // updated 5.58 hotfix - EventPlay8 = 0x0337, // updated 5.58 hotfix - EventPlay16 = 0x0269, // updated 5.58 hotfix - EventPlay32 = 0x023E, // updated 5.58 hotfix - EventPlay64 = 0x00DE, // updated 5.58 hotfix - EventPlay128 = 0x02D0, // updated 5.58 hotfix - EventPlay255 = 0x0362, // updated 5.58 hotfix + EventPlay = 0x2de, // updated 6.30h + EventPlay4 = 0x317, // updated 6.30h + EventPlay8 = 0x1cd, // updated 6.30h + EventPlay16 = 0x1fe, // updated 6.30h + EventPlay32 = 0x2fc, // updated 6.30h + EventPlay64 = 0x7c, // updated 6.30h + EventPlay128 = 0x337, // updated 6.30h + EventPlay255 = 0x1d2, // updated 6.30h - EventContinue = 0x00B6, // updated 5.58 hotfix + EventContinue = 0x240, // updated 6.30h or 0x3a2 or 0x3c3 or 0x270 or 0x391 or 0x159 or 0x2da or 0x3bb - EventStart = 0x02DA, // updated 5.58 hotfix - EventFinish = 0x0235, // updated 5.58 hotfix + EventStart = 0x1a1, // updated 6.30h + EventFinish = 0x194, // updated 6.30h EventLinkshell = 0x1169, - QuestActiveList = 0x0097, // updated 5.58 hotfix - QuestUpdate = 0x01B2, // updated 5.58 hotfix - QuestCompleteList = 0x006D, // updated 5.58 hotfix + QuestActiveList = 0x140, // updated 6.30h + QuestUpdate = 0x382, // updated 6.30h + QuestCompleteList = 0x39a, // updated 6.30h - QuestFinish = 0x021B, // updated 5.58 hotfix - MSQTrackerComplete = 0x0348, // updated 5.58 hotfix + QuestFinish = 0x237, // updated 6.30h + MSQTrackerComplete = 0xf0, // updated 6.30h MSQTrackerProgress = 0xF1CD, // updated 4.5 ? this actually looks like the two opcodes have been combined, see #474 QuestMessage = 0x0220, // updated 5.58 hotfix - QuestTracker = 0x00D8, // updated 5.58 hotfix + QuestTracker = 0x2d5, // updated 6.30h - Mount = 0x01E1, // updated 5.58 hotfix + Mount = 0x322, // updated 6.30h - DirectorVars = 0x0154, // updated 5.58 hotfix + DirectorVars = 0x27b, // updated 6.30h SomeDirectorUnk1 = 0x0084, // updated 5.18 SomeDirectorUnk2 = 0xF0C1, // updated 5.18 SomeDirectorUnk4 = 0x03DD, // updated 5.58 hotfix @@ -227,68 +229,68 @@ namespace Sapphire::Network::Packets CFAvailableContents = 0xF1FD, // updated 4.2 - WeatherChange = 0x0323, // updated 5.58 hotfix - PlayerTitleList = 0x014E, // updated 5.58 hotfix - Discovery = 0x01C2, // updated 5.58 hotfix + WeatherChange = 0xc7, // updated 6.30h + PlayerTitleList = 0x1ab, // updated 6.30h + Discovery = 0x3ca, // updated 6.30h - EorzeaTimeOffset = 0x0070, // updated 5.58 hotfix + EorzeaTimeOffset = 0x96, // updated 6.30h - EquipDisplayFlags = 0x02C6, // updated 5.58 hotfix + EquipDisplayFlags = 0x303, // updated 6.30h MiniCactpotInit = 0x0286, // added 5.31 ShopMessage = 0x0287, // updated 5.58 hotfix - LootMessage = 0x0383, // updated 5.58 hotfix - ResultDialog = 0x0273, // updated 5.58 hotfix - DesynthResult = 0x0238, // updated 5.58 hotfix + LootMessage = 0x2c0, // updated 6.30h + ResultDialog = 0x3bb, // updated 6.30h + DesynthResult = 0x270, // updated 6.30h /// Housing ////////////////////////////////////// - LandSetInitialize = 0x0159, // updated 5.58 hotfix - LandUpdate = 0x0228, // updated 5.58 hotfix - YardObjectSpawn = 0x023D, // updated 5.58 hotfix - HousingIndoorInitialize = 0x0210, // updated 5.58 hotfix - LandPriceUpdate = 0x0300, // updated 5.58 hotfix - LandInfoSign = 0x03E7, // updated 5.58 hotfix - LandRename = 0x01BF, // updated 5.58 hotfix - HousingEstateGreeting = 0x0126, // updated 5.58 hotfix - HousingUpdateLandFlagsSlot = 0x0157, // updated 5.58 hotfix - HousingLandFlags = 0x03B1, // updated 5.58 hotfix - HousingShowEstateGuestAccess = 0x00CC, // updated 5.58 hotfix + LandSetInitialize = 0x1fc, // updated 6.30h + LandUpdate = 0x30d, // updated 6.30h + YardObjectSpawn = 0x30b, // updated 6.30h + HousingIndoorInitialize = 0xa3, // updated 6.30h + LandPriceUpdate = 0x3d2, // updated 6.30h + LandInfoSign = 0xf9, // updated 6.30h + LandRename = 0x16d, // updated 6.30h + HousingEstateGreeting = 0x193, // updated 6.30h + HousingUpdateLandFlagsSlot = 0x1ff, // updated 6.30h + HousingLandFlags = 0x1f7, // updated 6.30h + HousingShowEstateGuestAccess = 0x71, // updated 6.30h - HousingObjectInitialize = 0x0112, // updated 5.58 hotfix - HousingInternalObjectSpawn = 0x02C8, // updated 5.58 hotfix + HousingObjectInitialize = 0x11d, // updated 6.30h + HousingInternalObjectSpawn = 0x378, // updated 6.30h - HousingWardInfo = 0x012A, // updated 5.58 hotfix - HousingObjectMove = 0x0265, // updated 5.58 hotfix + HousingWardInfo = 0xe4, // updated 6.30h + HousingObjectMove = 0x2b9, // updated 6.30h - SharedEstateSettingsResponse = 0x030E, // updated 5.58 hotfix + SharedEstateSettingsResponse = 0x144, // updated 6.30h - LandUpdateHouseName = 0x017C, // updated 5.58 hotfix + LandUpdateHouseName = 0x22b, // updated 6.30h - LandSetMap = 0x02E5, // updated 5.58 hotfix + LandSetMap = 0xbc, // updated 6.30h - CeremonySetActorAppearance = 0x02ED, // updated 5.58 hotfix + CeremonySetActorAppearance = 0xba, // updated 6.30h ////////////////////////////////////////////////// DuelChallenge = 0x0277, // 4.2; this is responsible for opening the ui - PerformNote = 0x0127, // updated 5.58 hotfix + PerformNote = 0xe9, // updated 6.30h - PrepareZoning = 0x02AB, // updated 5.58 hotfix - ActorGauge = 0x01C1, // updated 5.58 hotfix + PrepareZoning = 0x195, // updated 6.30h + ActorGauge = 0x171, // updated 6.30h DutyGauge = 0x02E5, // updated 5.58 hotfix // daily quest info -> without them sent, login will take longer... - DailyQuests = 0x02D6, // updated 5.58 hotfix - DailyQuestRepeatFlags = 0x01AB, // updated 5.58 hotfix + DailyQuests = 0x17e, // updated 6.30h + DailyQuestRepeatFlags = 0x3cc, // updated 6.30h - MapUpdate = 0x0394, // updated 5.58 hotfix - MapUpdate4 = 0x036F, // updated 5.58 hotfix - MapUpdate8 = 0x0311, // updated 5.58 hotfix - MapUpdate16 = 0x0108, // updated 5.58 hotfix - MapUpdate32 = 0x007A, // updated 5.58 hotfix - MapUpdate64 = 0x02A0, // updated 5.58 hotfix - MapUpdate128 = 0x0303, // updated 5.58 hotfix + MapUpdate = 0x1b7, // updated 6.30h + MapUpdate4 = 0x1c4, // updated 6.30h + MapUpdate8 = 0x35e, // updated 6.30h + MapUpdate16 = 0x293, // updated 6.30h + MapUpdate32 = 0x67, // updated 6.30h + MapUpdate64 = 0x1ad, // updated 6.30h + MapUpdate128 = 0x323, // updated 6.30h /// Doman Mahjong ////////////////////////////////////// MahjongOpenGui = 0x02A4, // only available in mahjong instance @@ -303,14 +305,14 @@ namespace Sapphire::Network::Packets MahjongEndGame = 0x02C6, // finished oorasu(all-last) round; shows a result screen. /// Airship & Submarine ////////////////////////////////////// - AirshipExplorationResult = 0x0203, // updated 5.58 hotfix - AirshipStatus = 0x030C, // updated 5.58 hotfix - AirshipStatusList = 0x02FE, // updated 5.58 hotfix - AirshipTimers = 0x0166, // updated 5.58 hotfix - SubmarineExplorationResult = 0x00AA, // updated 5.58 hotfix - SubmarineProgressionStatus = 0x0357, // updated 5.58 hotfix - SubmarineStatusList = 0x01EF, // updated 5.58 hotfix - SubmarineTimers = 0x0247, // updated 5.58 hotfix + AirshipExplorationResult = 0x34f, // updated 6.30h + AirshipStatus = 0x142, // updated 6.30h + AirshipStatusList = 0x70, // updated 6.30h + AirshipTimers = 0x26b, // updated 6.30h + SubmarineExplorationResult = 0x1a8, // updated 6.30h + SubmarineProgressionStatus = 0x148, // updated 6.30h + SubmarineStatusList = 0x232, // updated 6.30h + SubmarineTimers = 0x103, // updated 6.30h }; /** @@ -318,10 +320,10 @@ namespace Sapphire::Network::Packets */ enum ClientZoneIpcType : uint16_t { - PingHandler = 0x0288, // updated 5.58 hotfix - InitHandler = 0x02EB, // updated 5.58 hotfix + PingHandler = 0x011B, // updated 6.30h + InitHandler = 0x01F0, // updated 6.30h - FinishLoadingHandler = 0x013C, // updated 5.58 hotfix + FinishLoadingHandler = 0x01E4, // updated 6.30h CFCommenceHandler = 0x0381, // updated 5.58 hotfix @@ -329,28 +331,28 @@ namespace Sapphire::Network::Packets CFRegisterDuty = 0x01BD, // updated 5.58 hotfix CFRegisterRoulette = 0x037A, // updated 5.58 hotfix PlayTimeHandler = 0x02B7, // updated 5.58 hotfix - LogoutHandler = 0x00A0, // updated 5.58 hotfix - CancelLogout = 0x01AC, // updated 5.58 hotfix + LogoutHandler = 0x01C7, // updated 6.30h + CancelLogout = 0x0102, // updated 6.30h CFDutyInfoHandler = 0xF078, // updated 4.2 SocialReqSendHandler = 0x00D7, // updated 5.58 hotfix SocialResponseHandler = 0x023B, // updated 5.58 hotfix CreateCrossWorldLS = 0x035D, // updated 5.58 hotfix - ChatHandler = 0x03B0, // updated 5.58 hotfix + ChatHandler = 0x02C6, // Updated 6.30h PartyChatHandler = 0x0065, PartySetLeaderHandler = 0x036C, // updated 5.58 hotfix LeavePartyHandler = 0x019D, // updated 5.58 hotfix KickPartyMemberHandler = 0x0262, // updated 5.58 hotfix DisbandPartyHandler = 0x0276, // updated 5.58 hotfix - SocialListHandler = 0x01CA, // updated 5.58 hotfix + SocialListHandler = 0x0145, // updated 6.30h SetSearchInfoHandler = 0x01D4, // updated 5.58 hotfix ReqSearchInfoHandler = 0x014F, // updated 5.58 hotfix ReqExamineSearchCommentHandler = 0x00E7, // updated 5.0 ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58 hotfix - BlackListHandler = 0x00F2, // updated 5.58 hotfix + BlackListHandler = 0x0235, // updated 6.30h PlayerSearchHandler = 0x037D, // updated 5.58 hotfix LinkshellListHandler = 0x03B6, // updated 5.58 hotfix @@ -372,34 +374,34 @@ namespace Sapphire::Network::Packets ReqCountdownInitiate = 0x02EC, // updated 5.58 hotfix ReqCountdownCancel = 0x0068, // updated 5.58 hotfix - ZoneLineHandler = 0x008D, // updated 5.58 hotfix - ClientTrigger = 0x03DB, // updated 5.58 hotfix + ZoneLineHandler = 0x01EC, // updated 6.30h + ClientTrigger = 0x0174, // updated 6.30h DiscoveryHandler = 0x038B, // updated 5.58 hotfix - PlaceFieldMarkerPreset = 0x026D, // updated 5.58 hotfix - PlaceFieldMarker = 0x0371, // updated 5.58 hotfix - SkillHandler = 0x02DC, // updated 5.58 hotfix - GMCommand1 = 0x0272, // updated 5.58 hotfix - GMCommand2 = 0x00E9, // updated 5.58 hotfix + PlaceFieldMarkerPreset = 0x204, // updated 6.30h + PlaceFieldMarker = 0x38e, // updated 6.30h + SkillHandler = 0x0249, // updated 6.30h + GMCommand1 = 0x0182, // updated 6.30h + GMCommand2 = 0x02AD, // updated 6.30h AoESkillHandler = 0x0152, // updated 5.58 hotfix - UpdatePositionHandler = 0x01AF, // updated 5.58 hotfix + UpdatePositionHandler = 0x10F, // Updated 6.30h - InventoryModifyHandler = 0x029E, // updated 5.58 hotfix + InventoryModifyHandler = 0x008F, // Updated 6.30h InventoryEquipRecommendedItems = 0x01C9, // updated 5.58 hotfix ReqPlaceHousingItem = 0x02D4, // updated 5.58 hotfix BuildPresetHandler = 0x0223, // updated 5.58 hotfix - TalkEventHandler = 0x0387, // updated 5.58 hotfix + TalkEventHandler = 0x0384, // updated 6.30h EmoteEventHandler = 0x00B0, // updated 5.58 hotfix WithinRangeEventHandler = 0x02B6, // updated 5.58 hotfix OutOfRangeEventHandler = 0x03C5, // updated 5.58 hotfix - EnterTeriEventHandler = 0x01A7, // updated 5.58 hotfix + EnterTeriEventHandler = 0x0332, // updated 6.30h ShopEventHandler = 0x0384, // updated 5.58 hotfix - ReturnEventHandler = 0x00FA, // updated 5.58 hotfix - TradeReturnEventHandler = 0x0339, // updated 5.58 hotfix + ReturnEventHandler = 0x0383, // updated 6.30h + TradeReturnEventHandler = 0x0398, // updated 6.30h TradeReturnEventHandler2 = 0x023C, // updated 5.58 hotfix EventYield2Handler = 0x021D, // updated 5.58 hotfix EventYield16Handler = 0x0207, // updated 5.58 hotfix @@ -407,7 +409,7 @@ namespace Sapphire::Network::Packets LinkshellEventHandler = 0x016B, // updated 4.5 LinkshellEventHandler1 = 0x016C, // updated 4.5 - ReqEquipDisplayFlagsChange = 0x02A5, // updated 5.58 hotfix + ReqEquipDisplayFlagsChange = 0x03BC, // updated 6.30h LandRenameHandler = 0x028E, // updated 5.58 hotfix HousingUpdateHouseGreeting = 0x0343, // updated 5.58 hotfix @@ -417,12 +419,12 @@ namespace Sapphire::Network::Packets SetSharedEstateSettings = 0x00D2, // updated 5.58 hotfix - UpdatePositionInstance = 0x00F8, // updated 5.58 hotfix + UpdatePositionInstance = 0x00DB, // Updated 6.30h PerformNoteHandler = 0x0243, // updated 5.58 hotfix WorldInteractionHandler = 0x0274, // updated 5.58 hotfix - Dive = 0x0320, // updated 5.58 hotfix + Dive = 0x018C, // updated 6.30h }; //////////////////////////////////////////////////////////////////////////////// diff --git a/src/common/Network/PacketDef/Lobby/ServerLobbyDef.h b/src/common/Network/PacketDef/Lobby/ServerLobbyDef.h index 811a6e4f..eab5498f 100644 --- a/src/common/Network/PacketDef/Lobby/ServerLobbyDef.h +++ b/src/common/Network/PacketDef/Lobby/ServerLobbyDef.h @@ -90,11 +90,12 @@ struct FFXIVIpcCharList : FFXIVIpcBasePacket< LobbyCharList > uint32_t padding2; uint16_t serverId; uint16_t serverId1; - uint8_t unknown[9]; + uint8_t unknown1[16]; char nameChara[32]; char nameServer[32]; char nameServer1[32]; - char charDetailJson[1051]; + char charDetailJson[1024]; + uint8_t unknown2[20]; } charaDetails[2]; }; diff --git a/src/common/Network/PacketDef/Zone/ServerZoneDef.h b/src/common/Network/PacketDef/Zone/ServerZoneDef.h index 87ab1c3d..125d477c 100644 --- a/src/common/Network/PacketDef/Zone/ServerZoneDef.h +++ b/src/common/Network/PacketDef/Zone/ServerZoneDef.h @@ -456,23 +456,24 @@ namespace Sapphire::Network::Packets::Server struct FFXIVIpcEffectResult : FFXIVIpcBasePacket< EffectResult > { uint32_t globalSequence; + uint32_t unknown1; uint32_t actor_id; uint32_t current_hp; uint32_t max_hp; uint16_t current_mp; - uint8_t unknown1; + uint8_t unknown2; uint8_t classId; uint8_t shieldPercentage; uint8_t entryCount; - uint16_t unknown2; + uint16_t unknown3; struct StatusEntry { uint8_t index; // which position do i display this - uint8_t unknown3; + uint8_t unknown4; uint16_t id; uint16_t param; - uint16_t unknown4; // Sort this out (old right half of power/param property) + uint16_t unknown5; // Sort this out (old right half of power/param property) float duration; uint32_t sourceActorId; } statusEntries[4]; @@ -572,7 +573,7 @@ namespace Sapphire::Network::Packets::Server uint16_t padding_22[3]; - uint8_t effects[8*8]; + uint8_t effects[65]; uint16_t padding_6A[3]; @@ -682,6 +683,8 @@ namespace Sapphire::Network::Packets::Server uint16_t rotation; uint16_t currentMount; uint16_t activeMinion; + uint8_t u23; + uint8_t u24; uint8_t spawnIndex; uint8_t state; uint8_t persistentEmote; @@ -700,7 +703,7 @@ namespace Sapphire::Network::Packets::Server uint8_t mountColor; uint8_t scale; uint8_t elementData[6]; - uint8_t unknown5_5[3]; + uint8_t unknown5_5; Common::StatusEffect effect[30]; Common::FFXIVARR_POSITION3 pos; uint32_t models[10]; @@ -756,6 +759,8 @@ namespace Sapphire::Network::Packets::Server uint16_t currentMount; uint16_t rotation; uint16_t activeMinion; + uint8_t u23; + uint8_t u24; uint8_t spawnIndex; uint8_t state; uint8_t persistantEmote; @@ -774,7 +779,7 @@ namespace Sapphire::Network::Packets::Server uint8_t mountColor; uint8_t scale; uint8_t elemental[6]; - uint8_t unknown5_5[3]; + uint8_t unknown5_5; Common::StatusEffect effect[30]; Common::FFXIVARR_POSITION3 pos; uint32_t models[10]; @@ -927,13 +932,13 @@ namespace Sapphire::Network::Packets::Server //Current instance can be confirmed at any time using the /instance text command." ( 7B F8 69 ) uint8_t unknown5; - uint32_t unknown7; uint32_t unknown8; + uint16_t festivalId; + uint16_t additionalFestivalId; uint32_t unknown9; uint32_t unknown10; - uint32_t festivalId; - uint32_t unknown12[3]; - uint32_t additionalFestivalId; + uint32_t unknown11; + uint32_t unknown12[4]; uint32_t unknown13[3]; Common::FFXIVARR_POSITION3 pos; uint32_t unknown14[3]; @@ -950,171 +955,154 @@ namespace Sapphire::Network::Packets::Server // plain C types for a bit until the packet is actually fixed. // makes conversion between different editors easier. uint64_t contentId; - unsigned int unknown8; - unsigned int unknownC; - unsigned int charId; - unsigned int restedExp; - unsigned int companionCurrentExp; - unsigned int unknown1C; - unsigned int fishCaught; - unsigned int useBaitCatalogId; - unsigned int unknown28; - unsigned short unknownPvp2C; - unsigned short unknown3; - unsigned int pvpFrontlineOverallCampaigns; - unsigned int unknownTimestamp34; - unsigned int unknownTimestamp38; - unsigned int unknown3C; - unsigned int unknown40; - unsigned int unknown44; + uint64_t crest; + uint32_t charId; + uint32_t restedExp; + uint32_t companionCurrentExp; + uint32_t unknown1C; + uint32_t fishCaught; + uint32_t useBaitCatalogId; + uint32_t unknown28; + uint16_t unknownPvp2C; + uint16_t unknown2E; + uint32_t pvpFrontlineOverallCampaigns; + uint32_t unknownTimestamp34; + uint32_t unknownTimestamp38; + uint32_t unknown3C; + uint32_t unknown40; + uint32_t unknown44; float companionTimePassed; - unsigned int unknown4C; - unsigned short unknown50; - unsigned short unknownPvp52[4]; - unsigned short playerCommendations; - unsigned short unknown5C; - unsigned short unknown5E; - unsigned short pvpFrontlineWeeklyCampaigns; - unsigned short enhancedAnimaGlassProgress; - unsigned short unknown64[4]; - unsigned short pvpRivalWingsTotalMatches; - unsigned short pvpRivalWingsTotalVictories; - unsigned short pvpRivalWingsWeeklyMatches; - unsigned short pvpRivalWingsWeeklyVictories; - unsigned char maxLevel; - unsigned char expansion; - unsigned char unknown76; - unsigned char unknown77; - unsigned char very_unknown; - unsigned char race; - unsigned char tribe; - unsigned char gender; - unsigned char currentJob; - unsigned char currentClass; - unsigned char deity; - unsigned char namedayMonth; - unsigned char namedayDay; - unsigned char cityState; - unsigned char homepoint; - unsigned char unknown82; - unsigned char petHotBar; - unsigned char companionRank; - unsigned char companionStars; - unsigned char companionSp; - unsigned char companionUnk86; - unsigned char companionColor; - unsigned char companionFavoFeed; - unsigned char unknown89; - unsigned char unknown8A[4]; - unsigned char hasRelicBook; - unsigned char relicBookId; - unsigned char unknown90[4]; - unsigned char craftingMasterMask; - unsigned char unknown95[9]; - unsigned char unknown9F[2]; - unsigned char unknownA1[6]; - unsigned int exp[Common::CLASSJOB_SLOTS]; - unsigned int unknown108; - unsigned int pvpTotalExp; - unsigned int unknownPvp110; - unsigned int pvpExp; - unsigned int pvpFrontlineOverallRanks[3]; - unsigned short levels[Common::CLASSJOB_SLOTS]; - /* - unsigned short unknown15C[9]; - unsigned short u1; - unsigned short u2; - unsigned short unknown112[23]; - unsigned short fishingRecordsFish[26]; - unsigned short beastExp[11]; - unsigned short unknown1EA[5]; - unsigned short pvpFrontlineWeeklyRanks[3]; - unsigned short unknownMask1FA[4]; - unsigned char companionName[21]; - unsigned char companionDefRank; - unsigned char companionAttRank; - unsigned char companionHealRank; - unsigned char u19[8]; - unsigned char mountGuideMask[22]; - unsigned char u19_2; - */ - unsigned char unknown5_55a[178]; - unsigned char companionName[21]; - unsigned char companionDefRank; - unsigned char companionAttRank; - unsigned char companionHealRank; - unsigned char mountGuideMask[29]; - //== + uint32_t unknown4C; + uint16_t unknown50; + uint16_t unknownPvp52[4]; + uint16_t pvpSeriesExp; + uint16_t playerCommendations; + uint16_t unknown5C; + uint16_t unknown5E; + uint16_t pvpFrontlineWeeklyCampaigns; + uint16_t enhancedAnimaGlassProgress; + uint16_t unknown64[4]; + uint16_t pvpRivalWingsTotalMatches; + uint16_t pvpRivalWingsTotalVictories; + uint16_t pvpRivalWingsWeeklyMatches; + uint16_t pvpRivalWingsWeeklyVictories; + uint8_t maxLevel; + uint8_t expansion; + uint8_t unknown76; + uint8_t unknown77; + uint8_t unknown78; + uint8_t race; + uint8_t tribe; + uint8_t gender; + uint8_t currentJob; + uint8_t currentClass; + uint8_t deity; + uint8_t namedayMonth; + uint8_t namedayDay; + uint8_t cityState; + uint8_t homepoint; + uint8_t unknown83; + uint8_t petHotBar; + uint8_t companionRank; + uint8_t companionStars; + uint8_t companionSp; + uint8_t companionUnk86; + uint8_t companionColor; + uint8_t companionFavFeed; + uint8_t favAetheryteCount; + uint8_t unknown8C[4]; + uint8_t hasRelicBook; + uint8_t relicBookId; + uint8_t sightseeing21To80Unlock; + uint8_t sightseeingHeavenswardUnlock; + uint8_t unknown94[2]; + uint8_t craftingMasterMask; + uint8_t unknown97[9]; + uint8_t unknownA0[3]; + uint8_t pvpSeriesLevel; + uint8_t pvpMalmstonesClaimed; + uint8_t lastSeasonMalmstonesEarned; + uint8_t lastSeasonMalmstonesClaimed; + uint8_t unknownA7[7]; + uint32_t exp[30]; + uint32_t pvpTotalExp; + uint32_t unknownPvp124; + uint32_t pvpExp; + uint32_t pvpFrontlineOverallRanks[3]; + uint32_t unknown138; + uint16_t levels[30]; + uint16_t unknown178[8]; + uint16_t fishingRecordsFishId[33]; + uint16_t fishingRecordsFishLength[33]; + uint16_t beastExp[17]; + uint16_t unknown21C[6]; + uint16_t pvpFrontlineWeeklyRanks[3]; + uint16_t unknownMask22C[8]; + uint8_t companionName[21]; + uint8_t companionDefRank; + uint8_t companionAttRank; + uint8_t companionHealRank; + uint8_t mountGuideMask[33]; + uint8_t ornamentMask[4]; + uint8_t unknown281[13]; char name[32]; - unsigned char unknownOword[16]; - unsigned char unknownOw; - unsigned char unlockBitmask[64]; - unsigned char aetheryte[21]; - unsigned char discovery[445]; - unsigned char howto[34]; - unsigned char minions[55]; - unsigned char chocoboTaxiMask[10]; - unsigned char watchedCutscenes[137]; - unsigned char companionBardingMask[11]; - unsigned char companionEquippedHead; - unsigned char companionEquippedBody; - unsigned char companionEquippedLegs; - /* - unsigned char unknown52A[4]; - unsigned char unknownMask52E[11]; - unsigned char fishingGuideMask[105]; - unsigned char fishingSpotVisited[31]; - unsigned char unknown59A[27]; - unsigned char unknown5A9[7]; - unsigned char beastRank[11]; - unsigned char unknownPvp5AB[11]; - unsigned char unknown5B9[5]; - */ - unsigned char unknown5_45b[236]; - //== - unsigned char pose; - /* - unsigned char unknown5B91; - unsigned char challengeLogComplete[9]; - unsigned char weaponPose; - unsigned char unknownMask673[10]; - unsigned char unknownMask5DD[28]; - unsigned char relicCompletion[12]; - unsigned char sightseeingMask[26]; - unsigned char huntingMarkMask[55]; - unsigned char tripleTriadCards[32]; - unsigned char u12[11]; - unsigned char u13; - unsigned char aetherCurrentMask[22]; - unsigned char u10[3]; - */ - unsigned char unknown5_55b[295]; - //== - unsigned char orchestrionMask[40]; // this field may already be extended, if it is, the beginning bytes are at the end of unknown5_55b - unsigned char hallOfNoviceCompletion[3]; - unsigned char animaCompletion[11]; - unsigned char unknown5_55c[35]; - unsigned char unlockedRaids[28]; - unsigned char unlockedDungeons[18]; - unsigned char unlockedGuildhests[10]; - /* - at least 8 bytes at most 10 bytes in unlockedTrials not confirmed, adjust unlockedPvp so they share a total of 15 bytes and sync with clearedTrials/clearedPvp. - */ - unsigned char unlockedTrials[9]; - unsigned char unlockedPvp[6]; - //== - unsigned char clearedRaids[28]; - unsigned char clearedDungeons[18]; - unsigned char clearedGuildhests[10]; - unsigned char clearedTrials[9]; - unsigned char clearedPvp[6]; - /* - unsigned short fishingRecordsFishWeight[26]; - unsigned int exploratoryMissionNextTimestamp; - unsigned char pvpLevel; - */ - unsigned char unknown5_55d[9]; - //== + uint8_t unknown293[16]; + uint8_t unknown2A3; + uint8_t unlockBitmask[64]; + uint8_t aetheryte[26]; + uint8_t favoriteAetheryteIds[4]; + uint8_t freeAetheryteId; + uint8_t discovery[472]; + uint8_t howto[36]; + uint8_t minions[60]; + uint8_t chocoboTaxiMask[12]; + uint8_t watchedCutscenes[152]; + uint8_t companionBardingMask[12]; + uint8_t companionEquippedHead; + uint8_t companionEquippedBody; + uint8_t companionEquippedLegs; + uint8_t unknown5D1[4]; + uint8_t unknownMask5D5[11]; + uint8_t fishingGuideMask[161]; + uint8_t fishingSpotVisited[38]; + uint8_t unknown694[34]; + uint8_t unknown6B6[7]; + uint8_t unknownPvp6BD[3]; + uint8_t beastRank[17]; + uint8_t unknownPvp6CE[12]; + uint8_t pose[7]; + uint8_t unknown6DF[3]; + uint8_t challengeLogComplete[13]; + uint8_t secretRecipeBookMask[10]; + uint8_t unknownMask6F7[29]; + uint8_t relicCompletion[12]; + uint8_t sightseeingMask[37]; + uint8_t huntingMarkMask[102]; + uint8_t tripleTriadCards[45]; + uint8_t unknown7D7[14]; + uint8_t unknown7D8; + uint8_t unknown7E6[49]; + uint8_t regionalFolkloreMask[6]; + uint8_t orchestrionMask[75]; + uint8_t hallOfNoviceCompletion[3]; + uint8_t animaCompletion[11]; + uint8_t unknown85E[16]; + uint8_t unknown86E[4]; + uint8_t unknown872[18]; + uint8_t unknown880; + uint8_t unlockedRaids[28]; + uint8_t unlockedDungeons[18]; + uint8_t unlockedGuildhests[10]; + uint8_t unlockedTrials[11]; + uint8_t unlockedPvp[5]; + uint8_t clearedRaids[28]; + uint8_t clearedDungeons[18]; + uint8_t clearedGuildhests[10]; + uint8_t clearedTrials[11]; + uint8_t clearedPvp[5]; + uint8_t unknown948[4]; + uint8_t unknown94C[2]; + uint8_t unknown94E[2]; }; @@ -1874,15 +1862,15 @@ namespace Sapphire::Network::Packets::Server struct FFXIVIpcHousingLandFlags : FFXIVIpcBasePacket< HousingLandFlags > { Common::LandFlagSet freeCompanyHouse; // 00 - uint64_t unkown1; + uint64_t unknown1; Common::LandFlagSet privateHouse; // 24 - uint64_t unkown2; + uint64_t unknown2; Common::LandFlagSet apartment; // 48 - uint64_t unkown3; + uint64_t unknown3; Common::LandFlagSet sharedHouse[2]; //72 - uint64_t unkown4; - Common::LandFlagSet unkownHouse; - uint64_t unkown5; + uint64_t unknown4; + Common::LandFlagSet unknownHouse; + uint64_t unknown5; }; //Structs From 8220d90ed6ec2d9fab0e1263b035a702af7ec6f7 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 04:42:45 -0300 Subject: [PATCH 11/21] Update CommonGen.h for Patch 6.31 --- src/common/CommonGen.h | 1541 ++++++++++++++++++++-------------------- 1 file changed, 764 insertions(+), 777 deletions(-) diff --git a/src/common/CommonGen.h b/src/common/CommonGen.h index 98ad9d71..f223268a 100644 --- a/src/common/CommonGen.h +++ b/src/common/CommonGen.h @@ -4,801 +4,788 @@ #include /* This file has been automatically generated. -Changes will be lost upon regeneration. -To change the content edit tools/exd_common_gen */ + Changes will be lost upon regeneration. + To change the content edit tools/exd_common_gen */ namespace Sapphire::Common { - /////////////////////////////////////////////////////////// - //ActionCategory.exd - enum class ActionCategory : uint8_t - { - None = 0, - Autoattack = 1, - Spell = 2, - Weaponskill = 3, - Ability = 4, - Item = 5, - DoLAbility = 6, - DoHAbility = 7, - Event = 8, - LimitBreak = 9, - System = 10, - Artillery = 11, - Mount = 12, - Special = 13, - ItemManipulation = 14, - AdrenalineRush = 15, - //1 = 16, - }; + /////////////////////////////////////////////////////////// + //ActionCategory.exd + enum class ActionCategory : uint8_t + { + None = 0, + Autoattack = 1, + Spell = 2, + Weaponskill = 3, + Ability = 4, + Item = 5, + DoLAbility = 6, + DoHAbility = 7, + Event = 8, + LimitBreak = 9, + System = 10, + System1 = 11, + Mount = 12, + Special = 13, + ItemManipulation = 14, + LimitBreak1 = 15, + //1 = 16, + Artillery = 17, + //2 = 18, + }; - /////////////////////////////////////////////////////////// - //BaseParam.exd - enum class BaseParam : uint8_t - { - None = 0, - Strength = 1, - Dexterity = 2, - Vitality = 3, - Intelligence = 4, - Mind = 5, - Piety = 6, - HP = 7, - MP = 8, - TP = 9, - GP = 10, - CP = 11, - PhysicalDamage = 12, - MagicDamage = 13, - Delay = 14, - AdditionalEffect = 15, - AttackSpeed = 16, - BlockRate = 17, - BlockStrength = 18, - Tenacity = 19, - AttackPower = 20, - Defense = 21, - DirectHitRate = 22, - Evasion = 23, - MagicDefense = 24, - CriticalHitPower = 25, - CriticalHitResilience = 26, - CriticalHit = 27, - CriticalHitEvasion = 28, - SlashingResistance = 29, - PiercingResistance = 30, - BluntResistance = 31, - ProjectileResistance = 32, - AttackMagicPotency = 33, - HealingMagicPotency = 34, - EnhancementMagicPotency = 35, - ElementalBonus = 36, - FireResistance = 37, - IceResistance = 38, - WindResistance = 39, - EarthResistance = 40, - LightningResistance = 41, - WaterResistance = 42, - MagicResistance = 43, - Determination = 44, - SkillSpeed = 45, - SpellSpeed = 46, - Haste = 47, - Morale = 48, - Enmity = 49, - EnmityReduction = 50, - DesynthesisSkillGain = 51, - EXPBonus = 52, - Regen = 53, - Refresh = 54, - MainAttribute = 55, - SecondaryAttribute = 56, - SlowResistance = 57, - PetrificationResistance = 58, - ParalysisResistance = 59, - SilenceResistance = 60, - BlindResistance = 61, - PoisonResistance = 62, - StunResistance = 63, - SleepResistance = 64, - BindResistance = 65, - HeavyResistance = 66, - DoomResistance = 67, - ReducedDurabilityLoss = 68, - IncreasedSpiritbondGain = 69, - Craftsmanship = 70, - Control = 71, - Gathering = 72, - Perception = 73, - }; + /////////////////////////////////////////////////////////// + //BaseParam.exd + enum class BaseParam : uint8_t + { + None = 0, + Strength = 1, + Dexterity = 2, + Vitality = 3, + Intelligence = 4, + Mind = 5, + Piety = 6, + HP = 7, + MP = 8, + TP = 9, + GP = 10, + CP = 11, + PhysicalDamage = 12, + MagicDamage = 13, + Delay = 14, + AdditionalEffect = 15, + AttackSpeed = 16, + BlockRate = 17, + BlockStrength = 18, + Tenacity = 19, + AttackPower = 20, + Defense = 21, + DirectHitRate = 22, + Evasion = 23, + MagicDefense = 24, + CriticalHitPower = 25, + CriticalHitResilience = 26, + CriticalHit = 27, + CriticalHitEvasion = 28, + SlashingResistance = 29, + PiercingResistance = 30, + BluntResistance = 31, + ProjectileResistance = 32, + AttackMagicPotency = 33, + HealingMagicPotency = 34, + EnhancementMagicPotency = 35, + ElementalBonus = 36, + FireResistance = 37, + IceResistance = 38, + WindResistance = 39, + EarthResistance = 40, + LightningResistance = 41, + WaterResistance = 42, + MagicResistance = 43, + Determination = 44, + SkillSpeed = 45, + SpellSpeed = 46, + Haste = 47, + Morale = 48, + Enmity = 49, + EnmityReduction = 50, + DesynthesisSkillGain = 51, + EXPBonus = 52, + Regen = 53, + Refresh = 54, + MainAttribute = 55, + SecondaryAttribute = 56, + SlowResistance = 57, + PetrificationResistance = 58, + ParalysisResistance = 59, + SilenceResistance = 60, + BlindResistance = 61, + PoisonResistance = 62, + StunResistance = 63, + SleepResistance = 64, + BindResistance = 65, + HeavyResistance = 66, + DoomResistance = 67, + ReducedDurabilityLoss = 68, + IncreasedSpiritbondGain = 69, + Craftsmanship = 70, + Control = 71, + Gathering = 72, + Perception = 73, + }; - /////////////////////////////////////////////////////////// - //BeastReputationRank.exd - enum class BeastReputationRank : uint8_t - { - None = 0, - Neutral = 1, - Recognized = 2, - Friendly = 3, - Trusted = 4, - Respected = 5, - Honored = 6, - Sworn = 7, - Allied = 8, - }; + /////////////////////////////////////////////////////////// + //BeastReputationRank.exd + enum class BeastReputationRank : uint8_t + { + None = 0, + Neutral = 1, + Recognized = 2, + Friendly = 3, + Trusted = 4, + Respected = 5, + Honored = 6, + Sworn = 7, + Allied = 8, + }; - /////////////////////////////////////////////////////////// - //BeastTribe.exd - enum class BeastTribe : uint8_t - { - /* = 0, - 1 = 1, - 2 = 2, - 3 = 3, - 4 = 4, - 5 = 5, - 6 = 6, - 7 = 7, - 8 = 8, - 9 = 9, - 10 = 10, - 11 = 11, - 12 = 12, - 13 = 13, - 14 = 14,*/ - }; + /////////////////////////////////////////////////////////// + //BeastTribe.exd + enum class BeastTribe : uint8_t + { + None = 0, + Amaljaa = 1, + Sylphs = 2, + Kobolds = 3, + Sahagin = 4, + Ixal = 5, + VanuVanu = 6, + Vath = 7, + Moogles = 8, + Kojin = 9, + Ananta = 10, + Namazu = 11, + Pixies = 12, + Qitari = 13, + Dwarves = 14, + Arkasodara = 15, + Omicrons = 16, + Loporrits = 17, + }; - /////////////////////////////////////////////////////////// - //ClassJob.exd - enum class ClassJob : uint8_t - { - Adventurer = 0, - Gladiator = 1, - Pugilist = 2, - Marauder = 3, - Lancer = 4, - Archer = 5, - Conjurer = 6, - Thaumaturge = 7, - Carpenter = 8, - Blacksmith = 9, - Armorer = 10, - Goldsmith = 11, - Leatherworker = 12, - Weaver = 13, - Alchemist = 14, - Culinarian = 15, - Miner = 16, - Botanist = 17, - Fisher = 18, - Paladin = 19, - Monk = 20, - Warrior = 21, - Dragoon = 22, - Bard = 23, - Whitemage = 24, - Blackmage = 25, - Arcanist = 26, - Summoner = 27, - Scholar = 28, - Rogue = 29, - Ninja = 30, - Machinist = 31, - Darkknight = 32, - Astrologian = 33, - Samurai = 34, - Redmage = 35, - Bluemage = 36, - Gunbreaker = 37, - Dancer = 38, - // = 39, - //1 = 40, - }; + /////////////////////////////////////////////////////////// + //ClassJob.exd + enum class ClassJob : uint8_t + { + Adventurer = 0, + Gladiator = 1, + Pugilist = 2, + Marauder = 3, + Lancer = 4, + Archer = 5, + Conjurer = 6, + Thaumaturge = 7, + Carpenter = 8, + Blacksmith = 9, + Armorer = 10, + Goldsmith = 11, + Leatherworker = 12, + Weaver = 13, + Alchemist = 14, + Culinarian = 15, + Miner = 16, + Botanist = 17, + Fisher = 18, + Paladin = 19, + Monk = 20, + Warrior = 21, + Dragoon = 22, + Bard = 23, + Whitemage = 24, + Blackmage = 25, + Arcanist = 26, + Summoner = 27, + Scholar = 28, + Rogue = 29, + Ninja = 30, + Machinist = 31, + Darkknight = 32, + Astrologian = 33, + Samurai = 34, + Redmage = 35, + Bluemage = 36, + Gunbreaker = 37, + Dancer = 38, + Reaper = 39, + Sage = 40, + }; - /////////////////////////////////////////////////////////// - //ContentType.exd - enum class ContentType : uint8_t - { - None = 0, - DutyRoulette = 1, - Dungeons = 2, - Guildhests = 3, - Trials = 4, - Raids = 5, - PvP = 6, - QuestBattles = 7, - FATEs = 8, - TreasureHunt = 9, - Levequests = 10, - GrandCompany = 11, - Companions = 12, - BeastTribeQuests = 13, - OverallCompletion = 14, - PlayerCommendation = 15, - DisciplesoftheLand = 16, - DisciplesoftheHand = 17, - RetainerVentures = 18, - GoldSaucer = 19, - //1 = 20, - DeepDungeons = 21, - //2 = 22, - //3 = 23, - WondrousTails = 24, - CustomDeliveries = 25, - Eureka = 26, - //4 = 27, - UltimateRaids = 28, - //5 = 29, - }; + /////////////////////////////////////////////////////////// + //ContentType.exd + enum class ContentType : uint8_t + { + None = 0, + DutyRoulette = 1, + Dungeons = 2, + Guildhests = 3, + Trials = 4, + Raids = 5, + PvP = 6, + QuestBattles = 7, + FATEs = 8, + TreasureHunt = 9, + Levequests = 10, + GrandCompany = 11, + Companions = 12, + TribalQuests = 13, + OverallCompletion = 14, + PlayerCommendation = 15, + DisciplesoftheLand = 16, + DisciplesoftheHand = 17, + RetainerVentures = 18, + GoldSaucer = 19, + //1 = 20, + DeepDungeons = 21, + //2 = 22, + //3 = 23, + WondrousTails = 24, + CustomDeliveries = 25, + Eureka = 26, + //4 = 27, + UltimateRaids = 28, + //5 = 29, + VCDungeonFinder = 30, + }; - /////////////////////////////////////////////////////////// - //EmoteCategory.exd - enum class EmoteCategory : uint8_t - { - None = 0, - General = 1, - Special = 2, - Expressions = 3, - //1 = 4, - }; + /////////////////////////////////////////////////////////// + //EmoteCategory.exd + enum class EmoteCategory : uint8_t + { + None = 0, + General = 1, + Special = 2, + Expressions = 3, + //1 = 4, + }; - /////////////////////////////////////////////////////////// - //ExVersion.exd - enum class ExVersion : uint8_t - { - ARealmReborn = 0, - Heavensward = 1, - Stormblood = 2, - Shadowbringers = 3, - }; + /////////////////////////////////////////////////////////// + //ExVersion.exd + enum class ExVersion : uint8_t + { + ARealmReborn = 0, + Heavensward = 1, + Stormblood = 2, + Shadowbringers = 3, + Endwalker = 4, + }; - /////////////////////////////////////////////////////////// - //GrandCompany.exd - enum class GrandCompany : uint8_t - { - None = 0, - Maelstrom = 1, - OrderoftheTwinAdder = 2, - ImmortalFlames = 3, - }; + /////////////////////////////////////////////////////////// + //GrandCompany.exd + enum class GrandCompany : uint8_t + { + None = 0, + Maelstrom = 1, + OrderoftheTwinAdder = 2, + ImmortalFlames = 3, + }; - /////////////////////////////////////////////////////////// - //GuardianDeity.exd - enum class GuardianDeity : uint8_t - { - None = 0, - HalonetheFury = 1, - MenphinatheLover = 2, - ThaliaktheScholar = 3, - NymeiatheSpinner = 4, - LlymlaentheNavigator = 5, - OschontheWanderer = 6, - ByregottheBuilder = 7, - RhalgrtheDestroyer = 8, - AzeymatheWarden = 9, - NaldthaltheTraders = 10, - NophicatheMatron = 11, - AlthyktheKeeper = 12, - }; + /////////////////////////////////////////////////////////// + //GuardianDeity.exd + enum class GuardianDeity : uint8_t + { + None = 0, + HalonetheFury = 1, + MenphinatheLover = 2, + ThaliaktheScholar = 3, + NymeiatheSpinner = 4, + LlymlaentheNavigator = 5, + OschontheWanderer = 6, + ByregottheBuilder = 7, + RhalgrtheDestroyer = 8, + AzeymatheWarden = 9, + NaldthaltheTraders = 10, + NophicatheMatron = 11, + AlthyktheKeeper = 12, + }; - /////////////////////////////////////////////////////////// - //ItemUICategory.exd - enum class ItemUICategory : uint8_t - { - None = 0, - PugilistsArm = 1, - GladiatorsArm = 2, - MaraudersArm = 3, - ArchersArm = 4, - LancersArm = 5, - OnehandedThaumaturgesArm = 6, - TwohandedThaumaturgesArm = 7, - OnehandedConjurersArm = 8, - TwohandedConjurersArm = 9, - ArcanistsGrimoire = 10, - Shield = 11, - CarpentersPrimaryTool = 12, - CarpentersSecondaryTool = 13, - BlacksmithsPrimaryTool = 14, - BlacksmithsSecondaryTool = 15, - ArmorersPrimaryTool = 16, - ArmorersSecondaryTool = 17, - GoldsmithsPrimaryTool = 18, - GoldsmithsSecondaryTool = 19, - LeatherworkersPrimaryTool = 20, - LeatherworkersSecondaryTool = 21, - WeaversPrimaryTool = 22, - WeaversSecondaryTool = 23, - AlchemistsPrimaryTool = 24, - AlchemistsSecondaryTool = 25, - CulinariansPrimaryTool = 26, - CulinariansSecondaryTool = 27, - MinersPrimaryTool = 28, - MinersSecondaryTool = 29, - BotanistsPrimaryTool = 30, - BotanistsSecondaryTool = 31, - FishersPrimaryTool = 32, - FishingTackle = 33, - Head = 34, - Body = 35, - Legs = 36, - Hands = 37, - Feet = 38, - Waist = 39, - Necklace = 40, - Earrings = 41, - Bracelets = 42, - Ring = 43, - Medicine = 44, - Ingredient = 45, - Meal = 46, - Seafood = 47, - Stone = 48, - Metal = 49, - Lumber = 50, - Cloth = 51, - Leather = 52, - Bone = 53, - Reagent = 54, - Dye = 55, - Part = 56, - Furnishing = 57, - Materia = 58, - Crystal = 59, - Catalyst = 60, - Miscellany = 61, - SoulCrystal = 62, - Other = 63, - ConstructionPermit = 64, - Roof = 65, - ExteriorWall = 66, - Window = 67, - Door = 68, - RoofDecoration = 69, - ExteriorWallDecoration = 70, - Placard = 71, - Fence = 72, - InteriorWall = 73, - Flooring = 74, - CeilingLight = 75, - OutdoorFurnishing = 76, - Table = 77, - Tabletop = 78, - Wallmounted = 79, - Rug = 80, - Minion = 81, - Gardening = 82, - Demimateria = 83, - RoguesArm = 84, - SeasonalMiscellany = 85, - TripleTriadCard = 86, - DarkKnightsArm = 87, - MachinistsArm = 88, - AstrologiansArm = 89, - AirshipHull = 90, - AirshipRigging = 91, - AirshipAftcastle = 92, - AirshipForecastle = 93, - OrchestrionRoll = 94, - Painting = 95, - SamuraisArm = 96, - RedMagesArm = 97, - ScholarsArm = 98, - FishersSecondaryTool = 99, - Currency = 100, - SubmersibleHull = 101, - SubmersibleStern = 102, - SubmersibleBow = 103, - SubmersibleBridge = 104, - BlueMagesArm = 105, - GunbreakersArm = 106, - DancersArm = 107, - }; + /////////////////////////////////////////////////////////// + //ItemUICategory.exd + enum class ItemUICategory : uint8_t + { + None = 0, + PugilistsArm = 1, + GladiatorsArm = 2, + MaraudersArm = 3, + ArchersArm = 4, + LancersArm = 5, + OnehandedThaumaturgesArm = 6, + TwohandedThaumaturgesArm = 7, + OnehandedConjurersArm = 8, + TwohandedConjurersArm = 9, + ArcanistsGrimoire = 10, + Shield = 11, + CarpentersPrimaryTool = 12, + CarpentersSecondaryTool = 13, + BlacksmithsPrimaryTool = 14, + BlacksmithsSecondaryTool = 15, + ArmorersPrimaryTool = 16, + ArmorersSecondaryTool = 17, + GoldsmithsPrimaryTool = 18, + GoldsmithsSecondaryTool = 19, + LeatherworkersPrimaryTool = 20, + LeatherworkersSecondaryTool = 21, + WeaversPrimaryTool = 22, + WeaversSecondaryTool = 23, + AlchemistsPrimaryTool = 24, + AlchemistsSecondaryTool = 25, + CulinariansPrimaryTool = 26, + CulinariansSecondaryTool = 27, + MinersPrimaryTool = 28, + MinersSecondaryTool = 29, + BotanistsPrimaryTool = 30, + BotanistsSecondaryTool = 31, + FishersPrimaryTool = 32, + FishingTackle = 33, + Head = 34, + Body = 35, + Legs = 36, + Hands = 37, + Feet = 38, + Unobtainable = 39, + Necklace = 40, + Earrings = 41, + Bracelets = 42, + Ring = 43, + Medicine = 44, + Ingredient = 45, + Meal = 46, + Seafood = 47, + Stone = 48, + Metal = 49, + Lumber = 50, + Cloth = 51, + Leather = 52, + Bone = 53, + Reagent = 54, + Dye = 55, + Part = 56, + Furnishing = 57, + Materia = 58, + Crystal = 59, + Catalyst = 60, + Miscellany = 61, + SoulCrystal = 62, + Other = 63, + ConstructionPermit = 64, + Roof = 65, + ExteriorWall = 66, + Window = 67, + Door = 68, + RoofDecoration = 69, + ExteriorWallDecoration = 70, + Placard = 71, + Fence = 72, + InteriorWall = 73, + Flooring = 74, + CeilingLight = 75, + OutdoorFurnishing = 76, + Table = 77, + Tabletop = 78, + Wallmounted = 79, + Rug = 80, + Minion = 81, + Gardening = 82, + Demimateria = 83, + RoguesArm = 84, + SeasonalMiscellany = 85, + TripleTriadCard = 86, + DarkKnightsArm = 87, + MachinistsArm = 88, + AstrologiansArm = 89, + AirshipHull = 90, + AirshipRigging = 91, + AirshipAftcastle = 92, + AirshipForecastle = 93, + OrchestrionRoll = 94, + Painting = 95, + SamuraisArm = 96, + RedMagesArm = 97, + ScholarsArm = 98, + FishersSecondaryTool = 99, + Currency = 100, + SubmersibleHull = 101, + SubmersibleStern = 102, + SubmersibleBow = 103, + SubmersibleBridge = 104, + BlueMagesArm = 105, + GunbreakersArm = 106, + DancersArm = 107, + ReapersArm = 108, + SagesArm = 109, + }; - /////////////////////////////////////////////////////////// - //ItemSearchCategory.exd - enum class ItemSearchCategory : uint8_t - { - None = 0, - PrimaryArms = 1, - PrimaryTools = 2, - PrimaryTools1 = 3, - Armor = 4, - Accessories = 5, - Medicines = 6, - Materials = 7, - Other = 8, - PugilistsArms = 9, - GladiatorsArms = 10, - MaraudersArms = 11, - ArchersArms = 12, - LancersArms = 13, - ThaumaturgesArms = 14, - ConjurersArms = 15, - ArcanistsArms = 16, - Shields = 17, - DancersArms = 18, - CarpentersTools = 19, - BlacksmithsTools = 20, - ArmorersTools = 21, - GoldsmithsTools = 22, - LeatherworkersTools = 23, - WeaversTools = 24, - AlchemistsTools = 25, - CulinariansTools = 26, - MinersTools = 27, - BotanistsTools = 28, - FishersTools = 29, - FishingTackle = 30, - Head = 31, - Undershirts = 32, - Body = 33, - Undergarments = 34, - Legs = 35, - Hands = 36, - Feet = 37, - Waist = 38, - Necklaces = 39, - Earrings = 40, - Bracelets = 41, - Rings = 42, - Medicine = 43, - Ingredients = 44, - Meals = 45, - Seafood = 46, - Stone = 47, - Metal = 48, - Lumber = 49, - Cloth = 50, - Leather = 51, - Bone = 52, - Reagents = 53, - Dyes = 54, - WeaponParts = 55, - Furnishings = 56, - Materia = 57, - Crystals = 58, - Catalysts = 59, - Miscellany = 60, - SoulCrystals = 61, - Arrows = 62, - QuestItems = 63, - Other1 = 64, - ExteriorFixtures = 65, - InteriorFixtures = 66, - OutdoorFurnishings = 67, - ChairsandBeds = 68, - Tables = 69, - Tabletop = 70, - Wallmounted = 71, - Rugs = 72, - RoguesArms = 73, - SeasonalMiscellany = 74, - Minions = 75, - DarkKnightsArms = 76, - MachinistsArms = 77, - AstrologiansArms = 78, - AirshipSubmersibleComponents = 79, - OrchestrionComponents = 80, - GardeningItems = 81, - Paintings = 82, - SamuraisArms = 83, - RedMagesArms = 84, - ScholarsArms = 85, - GunbreakersArms = 86, - DancersArms1 = 87, - /*1 = 88, - 2 = 89, - 3 = 90, - 4 = 91, - 5 = 92, - 6 = 93, - 7 = 94, - 8 = 95, - 9 = 96, - 10 = 97, - 11 = 98, - 12 = 99, - 13 = 100,*/ - }; + /////////////////////////////////////////////////////////// + //ItemSearchCategory.exd + enum class ItemSearchCategory : uint8_t + { + None = 0, + PrimaryArms = 1, + PrimaryTools = 2, + PrimaryTools1 = 3, + Armor = 4, + Accessories = 5, + Medicines = 6, + Materials = 7, + Other = 8, + PugilistsArms = 9, + GladiatorsArms = 10, + MaraudersArms = 11, + ArchersArms = 12, + LancersArms = 13, + ThaumaturgesArms = 14, + ConjurersArms = 15, + ArcanistsArms = 16, + Shields = 17, + DancersArms = 18, + CarpentersTools = 19, + BlacksmithsTools = 20, + ArmorersTools = 21, + GoldsmithsTools = 22, + LeatherworkersTools = 23, + WeaversTools = 24, + AlchemistsTools = 25, + CulinariansTools = 26, + MinersTools = 27, + BotanistsTools = 28, + FishersTools = 29, + FishingTackle = 30, + Head = 31, + Undershirts = 32, + Body = 33, + Undergarments = 34, + Legs = 35, + Hands = 36, + Feet = 37, + Waist = 38, + Necklaces = 39, + Earrings = 40, + Bracelets = 41, + Rings = 42, + Medicine = 43, + Ingredients = 44, + Meals = 45, + Seafood = 46, + Stone = 47, + Metal = 48, + Lumber = 49, + Cloth = 50, + Leather = 51, + Bone = 52, + Reagents = 53, + Dyes = 54, + WeaponParts = 55, + Furnishings = 56, + Materia = 57, + Crystals = 58, + Catalysts = 59, + Miscellany = 60, + SoulCrystals = 61, + Arrows = 62, + QuestItems = 63, + Other1 = 64, + ExteriorFixtures = 65, + InteriorFixtures = 66, + OutdoorFurnishings = 67, + ChairsandBeds = 68, + Tables = 69, + Tabletop = 70, + Wallmounted = 71, + Rugs = 72, + RoguesArms = 73, + SeasonalMiscellany = 74, + Minions = 75, + DarkKnightsArms = 76, + MachinistsArms = 77, + AstrologiansArms = 78, + AirshipSubmersibleComponents = 79, + OrchestrionComponents = 80, + GardeningItems = 81, + Paintings = 82, + SamuraisArms = 83, + RedMagesArms = 84, + ScholarsArms = 85, + GunbreakersArms = 86, + DancersArms1 = 87, + ReapersArms = 88, + SagesArms = 89, + RegistrableMiscellany = 90, + /*1 = 91, + 2 = 92, + 3 = 93, + 4 = 94, + 5 = 95, + 6 = 96, + 7 = 97, + 8 = 98, + 9 = 99, + 10 = 100,*/ + }; - /////////////////////////////////////////////////////////// - //OnlineStatus.exd - enum class OnlineStatus : uint8_t - { - Producer = 1, - GameMaster = 2, - GameMaster1 = 3, - GameMaster2 = 4, - Disconnected = 5, - WaitingforFriendListApproval = 6, - WaitingforLinkshellApproval = 7, - WaitingforFreeCompanyApproval = 8, - NotFound = 9, - Offline = 10, - Mentor = 11, - Busy = 12, - PvP = 13, - PlayingTripleTriad = 14, - ViewingCutscene = 15, - UsingaChocoboPorter = 16, - AwayfromKeyboard = 17, - CameraMode = 18, - LookingforRepairs = 19, - LookingtoRepair = 20, - LookingtoMeldMateria = 21, - Roleplaying = 22, - LookingforParty = 23, - SwordforHire = 24, - WaitingforDutyFinder = 25, - RecruitingPartyMembers = 26, - Mentor1 = 27, - PvEMentor = 28, - TradeMentor = 29, - PvPMentor = 30, - Returner = 31, - NewAdventurer = 32, - AllianceLeader = 33, - AlliancePartyLeader = 34, - AlliancePartyMember = 35, - PartyLeader = 36, - PartyMember = 37, - PartyLeaderCrossworld = 38, - PartyMemberCrossworld = 39, - AnotherWorld = 40, - SharingDuty = 41, - SimilarDuty = 42, - InDuty = 43, - TrialAdventurer = 44, - FreeCompany = 45, - GrandCompany = 46, - Online = 47, - }; + /////////////////////////////////////////////////////////// + //OnlineStatus.exd + enum class OnlineStatus : uint8_t + { + }; - /////////////////////////////////////////////////////////// - //Race.exd - enum class Race : uint8_t - { - None = 0, - Hyur = 1, - Elezen = 2, - Lalafell = 3, - Miqote = 4, - Roegadyn = 5, - AuRa = 6, - Hrothgar = 7, - Viera = 8, - }; + /////////////////////////////////////////////////////////// + //Race.exd + enum class Race : uint8_t + { + None = 0, + Hyur = 1, + Elezen = 2, + Lalafell = 3, + Miqote = 4, + Roegadyn = 5, + AuRa = 6, + Hrothgar = 7, + Viera = 8, + }; - /////////////////////////////////////////////////////////// - //Tribe.exd - enum class Tribe : uint8_t - { - None = 0, - Midlander = 1, - Highlander = 2, - Wildwood = 3, - Duskwight = 4, - Plainsfolk = 5, - Dunesfolk = 6, - SeekeroftheSun = 7, - KeeperoftheMoon = 8, - SeaWolf = 9, - Hellsguard = 10, - Raen = 11, - Xaela = 12, - Helions = 13, - TheLost = 14, - Rava = 15, - Veena = 16, - }; + /////////////////////////////////////////////////////////// + //Tribe.exd + enum class Tribe : uint8_t + { + None = 0, + Midlander = 1, + Highlander = 2, + Wildwood = 3, + Duskwight = 4, + Plainsfolk = 5, + Dunesfolk = 6, + SeekeroftheSun = 7, + KeeperoftheMoon = 8, + SeaWolf = 9, + Hellsguard = 10, + Raen = 11, + Xaela = 12, + Helions = 13, + TheLost = 14, + Rava = 15, + Veena = 16, + }; - /////////////////////////////////////////////////////////// - //Town.exd - enum class Town : uint8_t - { - Nowheresville = 0, - LimsaLominsa = 1, - Gridania = 2, - Uldah = 3, - Ishgard = 4, - // = 5, - //1 = 6, - Kugane = 7, - //2 = 8, - //3 = 9, - Crystarium = 10, - //4 = 11, - }; + /////////////////////////////////////////////////////////// + //Town.exd + enum class Town : uint8_t + { + Nowheresville = 0, + LimsaLominsa = 1, + Gridania = 2, + Uldah = 3, + Ishgard = 4, + // = 5, + //1 = 6, + Kugane = 7, + //2 = 8, + //3 = 9, + Crystarium = 10, + //4 = 11, + OldSharlayan = 12, + //5 = 13, + }; - /////////////////////////////////////////////////////////// - //Weather.exd - enum class Weather : uint8_t - { - None = 0, - ClearSkies = 1, - FairSkies = 2, - Clouds = 3, - Fog = 4, - Wind = 5, - Gales = 6, - Rain = 7, - Showers = 8, - Thunder = 9, - Thunderstorms = 10, - DustStorms = 11, - Sandstorms = 12, - HotSpells = 13, - HeatWaves = 14, - Snow = 15, - Blizzards = 16, - Gloom = 17, - Auroras = 18, - Darkness = 19, - Tension = 20, - Clouds1 = 21, - StormClouds = 22, - RoughSeas = 23, - RoughSeas1 = 24, - Louring = 25, - HeatWaves1 = 26, - Gloom1 = 27, - Gales1 = 28, - Eruptions = 29, - FairSkies1 = 30, - FairSkies2 = 31, - FairSkies3 = 32, - FairSkies4 = 33, - FairSkies5 = 34, - Irradiance = 35, - CoreRadiation = 36, - CoreRadiation1 = 37, - CoreRadiation2 = 38, - CoreRadiation3 = 39, - ShelfClouds = 40, - ShelfClouds1 = 41, - ShelfClouds2 = 42, - ShelfClouds3 = 43, - Oppression = 44, - Oppression1 = 45, - Oppression2 = 46, - Oppression3 = 47, - Oppression4 = 48, - UmbralWind = 49, - UmbralStatic = 50, - Smoke = 51, - FairSkies6 = 52, - RoyalLevin = 53, - Hyperelectricity = 54, - RoyalLevin1 = 55, - Oppression5 = 56, - Thunder1 = 57, - Thunder2 = 58, - CutScene = 59, - Multiplicity = 60, - Multiplicity1 = 61, - Rain1 = 62, - FairSkies7 = 63, - Rain2 = 64, - FairSkies8 = 65, - Dragonstorms = 66, - Dragonstorms1 = 67, - Subterrain = 68, - Concordance = 69, - Concordance1 = 70, - BeyondTime = 71, - BeyondTime1 = 72, - BeyondTime2 = 73, - DemonicInfinity = 74, - DemonicInfinity1 = 75, - DemonicInfinity2 = 76, - DimensionalDisruption = 77, - DimensionalDisruption1 = 78, - DimensionalDisruption2 = 79, - Revelstorms = 80, - Revelstorms1 = 81, - EternalBliss = 82, - EternalBliss1 = 83, - Wyrmstorms = 84, - Wyrmstorms1 = 85, - Revelstorms2 = 86, - Quicklevin = 87, - Thunder3 = 88, - DimensionalDisruption3 = 89, - FairSkies9 = 90, - ClearSkies1 = 91, - WhiteCyclones = 92, - WhiteCyclones1 = 93, - WhiteCyclones2 = 94, - Ultimania = 95, - WhiteCyclones3 = 96, - Moonlight = 97, - Moonlight1 = 98, - Moonlight2 = 99, - Moonlight3 = 100, - RedMoon = 101, - Scarlet = 102, - Scarlet1 = 103, - Scarlet2 = 104, - FairSkies10 = 105, - FairSkies11 = 106, - FairSkies12 = 107, - FairSkies13 = 108, - Flames = 109, - Tsunamis = 110, - Cyclones = 111, - Geostorms = 112, - TrueBlue = 113, - TrueBlue1 = 114, - TrueBlue2 = 115, - UmbralTurbulence = 116, - TrueBlue3 = 117, - EverlastingLight = 118, - Gales2 = 119, - Termination = 120, - Termination1 = 121, - Dreams = 122, - Dreams1 = 123, - Dreams2 = 124, - Brilliance = 125, - Brilliance1 = 126, - Termination2 = 127, - Termination3 = 128, - EverlastingLight1 = 129, - Eruptions1 = 130, - Termination4 = 131, - FairSkies14 = 132, - UmbralFlare = 133, - UmbralDuststorm = 134, - UmbralLevin = 135, - UmbralTempest = 136, - Starshower = 137, - Delirium = 138, - Clouds2 = 139, - Clouds3 = 140, - Irradiance1 = 141, - Irradiance2 = 142, - StormClouds1 = 143, - Firestorm = 144, - SpectralCurrent = 145, - //1 = 146, - Climactic = 147, - //2 = 148, - //3 = 149, - //4 = 150, - //5 = 151, - //6 = 152, - //7 = 153, - }; + /////////////////////////////////////////////////////////// + //Weather.exd + enum class Weather : uint8_t + { + None = 0, + ClearSkies = 1, + FairSkies = 2, + Clouds = 3, + Fog = 4, + Wind = 5, + Gales = 6, + Rain = 7, + Showers = 8, + Thunder = 9, + Thunderstorms = 10, + DustStorms = 11, + Sandstorms = 12, + HotSpells = 13, + HeatWaves = 14, + Snow = 15, + Blizzards = 16, + Gloom = 17, + Auroras = 18, + Darkness = 19, + Tension = 20, + Clouds1 = 21, + StormClouds = 22, + RoughSeas = 23, + RoughSeas1 = 24, + Louring = 25, + HeatWaves1 = 26, + Gloom1 = 27, + Gales1 = 28, + Eruptions = 29, + FairSkies1 = 30, + FairSkies2 = 31, + FairSkies3 = 32, + FairSkies4 = 33, + FairSkies5 = 34, + Irradiance = 35, + CoreRadiation = 36, + CoreRadiation1 = 37, + CoreRadiation2 = 38, + CoreRadiation3 = 39, + ShelfClouds = 40, + ShelfClouds1 = 41, + ShelfClouds2 = 42, + ShelfClouds3 = 43, + Oppression = 44, + Oppression1 = 45, + Oppression2 = 46, + Oppression3 = 47, + Oppression4 = 48, + UmbralWind = 49, + UmbralStatic = 50, + Smoke = 51, + FairSkies6 = 52, + RoyalLevin = 53, + Hyperelectricity = 54, + RoyalLevin1 = 55, + Oppression5 = 56, + Thunder1 = 57, + Thunder2 = 58, + CutScene = 59, + Multiplicity = 60, + Multiplicity1 = 61, + Rain1 = 62, + FairSkies7 = 63, + Rain2 = 64, + FairSkies8 = 65, + Dragonstorms = 66, + Dragonstorms1 = 67, + Subterrain = 68, + Concordance = 69, + Concordance1 = 70, + BeyondTime = 71, + BeyondTime1 = 72, + BeyondTime2 = 73, + DemonicInfinity = 74, + DemonicInfinity1 = 75, + DemonicInfinity2 = 76, + DimensionalDisruption = 77, + DimensionalDisruption1 = 78, + DimensionalDisruption2 = 79, + Revelstorms = 80, + Revelstorms1 = 81, + EternalBliss = 82, + EternalBliss1 = 83, + Wyrmstorms = 84, + Wyrmstorms1 = 85, + Revelstorms2 = 86, + Quicklevin = 87, + Thunder3 = 88, + DimensionalDisruption3 = 89, + FairSkies9 = 90, + ClearSkies1 = 91, + WhiteCyclones = 92, + WhiteCyclones1 = 93, + WhiteCyclones2 = 94, + Ultimania = 95, + WhiteCyclones3 = 96, + Moonlight = 97, + Moonlight1 = 98, + Moonlight2 = 99, + Moonlight3 = 100, + RedMoon = 101, + Scarlet = 102, + Scarlet1 = 103, + Scarlet2 = 104, + FairSkies10 = 105, + FairSkies11 = 106, + FairSkies12 = 107, + FairSkies13 = 108, + Flames = 109, + Tsunamis = 110, + Cyclones = 111, + Geostorms = 112, + TrueBlue = 113, + TrueBlue1 = 114, + TrueBlue2 = 115, + UmbralTurbulence = 116, + TrueBlue3 = 117, + EverlastingLight = 118, + Gales2 = 119, + Termination = 120, + Termination1 = 121, + Dreams = 122, + Dreams1 = 123, + Dreams2 = 124, + Brilliance = 125, + Brilliance1 = 126, + Termination2 = 127, + Termination3 = 128, + EverlastingLight1 = 129, + Eruptions1 = 130, + Termination4 = 131, + FairSkies14 = 132, + UmbralFlare = 133, + UmbralDuststorm = 134, + UmbralLevin = 135, + UmbralTempest = 136, + Starshower = 137, + Delirium = 138, + Clouds2 = 139, + Clouds3 = 140, + Irradiance1 = 141, + Irradiance2 = 142, + StormClouds1 = 143, + Firestorm = 144, + SpectralCurrent = 145, + //1 = 146, + Climactic = 147, + MoonDust = 148, + AstromagneticStorm = 149, + Apocalypse = 150, + Polarization = 151, + Polarization1 = 152, + Polarization2 = 153, + Polarization3 = 154, + Polarization4 = 155, + Projection = 156, + Pandæmonium = 157, + Pandæmonium1 = 158, + Pandæmonium2 = 159, + Ultimatum = 160, + Inevitability = 161, + Transcendence = 162, + Transcendence1 = 163, + Transcendence2 = 164, + Transcendence3 = 165, + Transcendence4 = 166, + Transcendence5 = 167, + Transcendence6 = 168, + Transcendence7 = 169, + Dragonstorms2 = 170, + Vacuity = 171, + Vacuity1 = 172, + Vacuity2 = 173, + //2 = 174, + //3 = 175, + //4 = 176, + }; - /////////////////////////////////////////////////////////// - //HousingAppeal.exd - enum class HousingAppeal : uint8_t - { - None = 0, - Emporium = 1, - Boutique = 2, - DesignerHome = 3, - MessageBook = 4, - Tavern = 5, - Eatery = 6, - ImmersiveExperience = 7, - Cafe = 8, - Aquarium = 9, - Sanctum = 10, - Venue = 11, - Florist = 12, - // = 13, - Library = 14, - PhotoStudio = 15, - HauntedHouse = 16, - Atelier = 17, - Bathhouse = 18, - Garden = 19, - FarEastern = 20, - VisitorsWelcome = 21, - Bakery = 22, - UnderRenovation = 23, - ConcertHall = 24, - }; + /////////////////////////////////////////////////////////// + //HousingAppeal.exd + enum class HousingAppeal : uint8_t + { + None = 0, + Emporium = 1, + Boutique = 2, + DesignerHome = 3, + MessageBook = 4, + Tavern = 5, + Eatery = 6, + ImmersiveExperience = 7, + Café = 8, + Aquarium = 9, + Sanctum = 10, + Venue = 11, + Florist = 12, + // = 13, + Library = 14, + PhotoStudio = 15, + HauntedHouse = 16, + Atelier = 17, + Bathhouse = 18, + Garden = 19, + FarEastern = 20, + VisitorsWelcome = 21, + Bakery = 22, + UnderRenovation = 23, + ConcertHall = 24, + }; } #endif \ No newline at end of file From 5b63cfb023bc456c44d015b5b072e70b7c453b6f Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 04:45:38 -0300 Subject: [PATCH 12/21] Re-add CountdownCancel opcode --- src/common/Network/PacketDef/Ipcs.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index 8c72b80d..9916d3c5 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -99,7 +99,7 @@ namespace Sapphire::Network::Packets SetOnlineStatus = 0x324, // updated 6.30h CountdownInitiate = 0x3b1, // updated 6.30h - CountdownInitiate = 0x3b1, // updated 6.30h + CountdownCancel = 0xb6, // updated 6.30h PlayerAddedToBlacklist = 0x399, // updated 6.30h PlayerRemovedFromBlacklist = 0x1dc, // updated 6.30h From 81bbe690a86c74fd67c90aefdf41f9d8fecdecc6 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 07:10:45 -0300 Subject: [PATCH 13/21] Fix Oodle on Linux (todo:: make this not suck) --- CMakeLists.txt | 1 - deps/Oodle/CMakeLists.txt | 4 ++-- deps/Oodle/oodle2net.h | 11 ++++++----- src/common/Network/Oodle.h | 2 +- 4 files changed, 9 insertions(+), 9 deletions(-) diff --git a/CMakeLists.txt b/CMakeLists.txt index 6597c437..d8ec5a1c 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -15,7 +15,6 @@ add_custom_target( copy_runtime_files ALL COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/web ${CMAKE_BINARY_DIR}/bin/web COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/sql_import.sh ${CMAKE_BINARY_DIR}/bin/sql_import.sh COMMAND ${CMAKE_COMMAND} -E remove_directory ${CMAKE_BINARY_DIR}/bin/data/actions - COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/deps/oo2net_9_win64.dll ${CMAKE_BINARY_DIR}/bin/oo2net_9_win64.dll COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/deps/ffxiv-actions/actions ${CMAKE_BINARY_DIR}/bin/data/actions ) ###################################### diff --git a/deps/Oodle/CMakeLists.txt b/deps/Oodle/CMakeLists.txt index ef90dcbc..7473ec68 100644 --- a/deps/Oodle/CMakeLists.txt +++ b/deps/Oodle/CMakeLists.txt @@ -3,7 +3,7 @@ add_library(OodleNet STATIC IMPORTED GLOBAL) set_target_properties( OodleNet PROPERTIES - IMPORTED_IMPLIB "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" - IMPORTED_LOCATION "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" + IMPORTED_IMPLIB "${CMAKE_SOURCE_DIR}/deps/Oodle/liboo2netlinux64.a" + IMPORTED_LOCATION "${CMAKE_SOURCE_DIR}/deps/Oodle/liboo2netlinux64.a" LINKER_LANGUAGE C ) \ No newline at end of file diff --git a/deps/Oodle/oodle2net.h b/deps/Oodle/oodle2net.h index 59c718c9..604f5e35 100644 --- a/deps/Oodle/oodle2net.h +++ b/deps/Oodle/oodle2net.h @@ -1,18 +1,19 @@ #ifndef __OODLE2NET_H__ #define __OODLE2NET_H__ +#include -extern "C" intptr_t __stdcall OodleNetwork1_Shared_Size( int32_t htbits ); +extern "C" intptr_t OodleNetwork1_Shared_Size( int32_t htbits ); -extern "C" intptr_t __stdcall OodleNetwork1UDP_State_Size(); +extern "C" intptr_t OodleNetwork1UDP_State_Size(); -extern "C" void __stdcall OodleNetwork1_Shared_SetWindow( +extern "C" void OodleNetwork1_Shared_SetWindow( void* shared, int32_t htbits, const void* window, int32_t windowSize ); -extern "C" void __stdcall OodleNetwork1UDP_Train( +extern "C" void OodleNetwork1UDP_Train( void* state, const void* shared, const void** trainingPacketPointers, @@ -20,7 +21,7 @@ extern "C" void __stdcall OodleNetwork1UDP_Train( int32_t numTrainingPackets ); -extern "C" bool __stdcall OodleNetwork1UDP_Decode( +extern "C" bool OodleNetwork1UDP_Decode( void* state, const void* shared, const void* enc, diff --git a/src/common/Network/Oodle.h b/src/common/Network/Oodle.h index b01dcf29..536980cb 100644 --- a/src/common/Network/Oodle.h +++ b/src/common/Network/Oodle.h @@ -2,7 +2,7 @@ #define _OODLE_H #include - +#include #include namespace Sapphire::Network From 79f58a36aac2cf5981a7011cee38977f7c6aa48d Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 07:11:41 -0300 Subject: [PATCH 14/21] Add missing OnlineStatus.exd to CommonGen.h --- src/common/CommonGen.h | 48 ++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 48 insertions(+) diff --git a/src/common/CommonGen.h b/src/common/CommonGen.h index f223268a..836e260e 100644 --- a/src/common/CommonGen.h +++ b/src/common/CommonGen.h @@ -514,6 +514,54 @@ namespace Sapphire::Common { //OnlineStatus.exd enum class OnlineStatus : uint8_t { + None = 0, + GameQA = 1, + GameMaster = 2, + GameMaster1 = 3, + EventParticipant = 4, + Disconnected = 5, + WaitingforFriendListApproval = 6, + WaitingforLinkshellApproval = 7, + WaitingforFreeCompanyApproval = 8, + NotFound = 9, + Offline = 10, + BattleMentor = 11, + Busy = 12, + PvP = 13, + PlayingTripleTriad = 14, + ViewingCutscene = 15, + UsingaChocoboPorter = 16, + AwayfromKeyboard = 17, + CameraMode = 18, + LookingforRepairs = 19, + LookingtoRepair = 20, + LookingtoMeldMateria = 21, + Roleplaying = 22, + LookingforParty = 23, + SwordforHire = 24, + WaitingforDutyFinder = 25, + RecruitingPartyMembers = 26, + Mentor = 27, + PvEMentor = 28, + TradeMentor = 29, + PvPMentor = 30, + Returner = 31, + NewAdventurer = 32, + AllianceLeader = 33, + AlliancePartyLeader = 34, + AlliancePartyMember = 35, + PartyLeader = 36, + PartyMember = 37, + PartyLeaderCrossworld = 38, + PartyMemberCrossworld = 39, + AnotherWorld = 40, + SharingDuty = 41, + SimilarDuty = 42, + InDuty = 43, + TrialAdventurer = 44, + FreeCompany = 45, + GrandCompany = 46, + Online = 47, }; /////////////////////////////////////////////////////////// From f13bae27f77384afa73d8f282c1f9aed478a8e24 Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 07:11:56 -0300 Subject: [PATCH 15/21] Minor player fixes --- src/api/PlayerMinimal.cpp | 3 +++ src/world/Actor/Player.cpp | 2 +- src/world/Network/PacketWrappers/PlayerSetupPacket.h | 2 +- 3 files changed, 5 insertions(+), 2 deletions(-) diff --git a/src/api/PlayerMinimal.cpp b/src/api/PlayerMinimal.cpp index 2bda842b..e796b47e 100644 --- a/src/api/PlayerMinimal.cpp +++ b/src/api/PlayerMinimal.cpp @@ -87,6 +87,9 @@ std::string PlayerMinimal::getInfoJson() // DisplayName c.push_back( getName() ); + // Unknown + c.push_back( "36" ); + // class levels auto levelsArray = nlohmann::json(); for( int i = 0; i < Common::CLASSJOB_SLOTS; ++i ) diff --git a/src/world/Actor/Player.cpp b/src/world/Actor/Player.cpp index 1ef07103..a90cd0be 100644 --- a/src/world/Actor/Player.cpp +++ b/src/world/Actor/Player.cpp @@ -176,7 +176,7 @@ bool Sapphire::Entity::Player::isActingAsGm() const { auto status = getOnlineStatus(); return status == OnlineStatus::GameMaster || status == OnlineStatus::GameMaster1 || - status == OnlineStatus::GameMaster2; + status == OnlineStatus::GameQA; } uint8_t Sapphire::Entity::Player::getMode() const diff --git a/src/world/Network/PacketWrappers/PlayerSetupPacket.h b/src/world/Network/PacketWrappers/PlayerSetupPacket.h index dc176dce..c7c8ce41 100644 --- a/src/world/Network/PacketWrappers/PlayerSetupPacket.h +++ b/src/world/Network/PacketWrappers/PlayerSetupPacket.h @@ -45,7 +45,7 @@ namespace Sapphire::Network::Packets::Server //m_data.gcRank = GCRank::None; m_data.homepoint = player.getHomepoint(); - m_data.pose = player.getPose(); + m_data.pose[0] = player.getPose(); memset( &m_data.name[ 0 ], 0, sizeof( m_data.name ) ); strcpy( &m_data.name[ 0 ], player.getName().c_str() ); From 206b98e1dff32a67b6021fa9d6bd6452af2eee9e Mon Sep 17 00:00:00 2001 From: Maple Date: Thu, 26 Jan 2023 23:59:41 -0300 Subject: [PATCH 16/21] Actually update exd to 6.31 --- src/common/CommonGen.h | 6 +++--- src/tools/exd_common_gen/main.cpp | 4 ++-- 2 files changed, 5 insertions(+), 5 deletions(-) diff --git a/src/common/CommonGen.h b/src/common/CommonGen.h index 836e260e..fbec22e4 100644 --- a/src/common/CommonGen.h +++ b/src/common/CommonGen.h @@ -800,9 +800,9 @@ namespace Sapphire::Common { Vacuity = 171, Vacuity1 = 172, Vacuity2 = 173, - //2 = 174, - //3 = 175, - //4 = 176, + DimensionalDisruption4 = 174, + DimensionalDisruption5 = 175, + DimensionalDisruption6 = 176, }; /////////////////////////////////////////////////////////// diff --git a/src/tools/exd_common_gen/main.cpp b/src/tools/exd_common_gen/main.cpp index 0f88b8a9..15cfa2f6 100644 --- a/src/tools/exd_common_gen/main.cpp +++ b/src/tools/exd_common_gen/main.cpp @@ -118,7 +118,7 @@ int main( int argc, char** argv ) result += generateEnum( "ActionCategory", 0, "uint8_t" ); result += generateEnum( "BaseParam", 1, "uint8_t" ); result += generateEnum( "BeastReputationRank", 1, "uint8_t" ); - result += generateEnum( "BeastTribe", 11, "uint8_t" ); + result += generateEnum( "BeastTribe", 9, "uint8_t" ); result += generateEnum( "ClassJob", 0, "uint8_t" ); result += generateEnum( "ContentType", 0, "uint8_t" ); result += generateEnum( "EmoteCategory", 0, "uint8_t" ); @@ -127,7 +127,7 @@ int main( int argc, char** argv ) result += generateEnum( "GuardianDeity", 0, "uint8_t" ); result += generateEnum( "ItemUICategory", 0, "uint8_t" ); result += generateEnum( "ItemSearchCategory", 0, "uint8_t" ); - result += generateEnum( "OnlineStatus", 2, "uint8_t" ); + result += generateEnum( "OnlineStatus", 3, "uint8_t" ); result += generateEnum( "Race", 1, "uint8_t" ); result += generateEnum( "Tribe", 0, "uint8_t" ); result += generateEnum( "Town", 0, "uint8_t" ); From 7dfbe76436b36aafc33f5e5444f425fbe2850e82 Mon Sep 17 00:00:00 2001 From: Maple Date: Fri, 27 Jan 2023 00:33:31 -0300 Subject: [PATCH 17/21] Update server opcodes to 6.31 (Thanks Flawed!) --- src/common/Network/PacketDef/Ipcs.h | 475 ++++++++++++++-------------- 1 file changed, 243 insertions(+), 232 deletions(-) diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index 9916d3c5..e66bf2db 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -1,16 +1,16 @@ #ifndef _CORE_NETWORK_PACKETS_IPCS_H #define _CORE_NETWORK_PACKETS_IPCS_H - + #include - + namespace Sapphire::Network::Packets { //////////////////////////////////////////////////////////////////////////////// /// Lobby Connection IPC Codes /** - * Server IPC Lobby Type Codes. - */ + * Server IPC Lobby Type Codes. + */ enum ServerLobbyIpcType : uint16_t { LobbyError = 0x0002, @@ -24,8 +24,8 @@ namespace Sapphire::Network::Packets }; /** - * Client IPC Lobby Type Codes. - */ + * Client IPC Lobby Type Codes. + */ enum ClientLobbyIpcType : uint16_t { ReqCharList = 0x0003, @@ -39,285 +39,297 @@ namespace Sapphire::Network::Packets //////////////////////////////////////////////////////////////////////////////// /// Zone Connection IPC Codes /** - * Server IPC Zone Type Codes. - */ + * Server IPC Zone Type Codes. + */ enum ServerZoneIpcType : uint16_t { - Ping = 0x00DA, // updated 6.30h - Init = 0x01E4, // updated 6.30h + Ping = 0x0108, // updated 6.31 + Init = 0x03d4, // updated 6.31 - ActorFreeSpawn = 0x28a, // updated 6.30h - InitZone = 0x222, // updated 6.30h + ActorFreeSpawn = 0x1c3, // updated 6.31 - EffectResult = 0x22c, // updated 6.30h - EffectResultBasic = 0x384, // updated 6.30h - - ActorControl = 0x179, // updated 6.30h - ActorControlSelf = 0x26f, // updated 6.30h - ActorControlTarget = 0x220, // updated 6.30h + InitZone = 0x94, // updated 6.31 + PrepareZoning = 0x1d7, // updated 6.31 + + EffectResult = 0x36c, // updated 6.31 + EffectResultBasic = 0x2e9, // updated 6.31 + + ActorControl = 0x363, // updated 6.31 + ActorControlTarget = 0x1ec, // updated 6.31 + ActorControlSelf = 0x267, // updated 6.31 + ActorCast = 0x207, // updated 6.31 + ActorSetPos = 0x186, // updated 6.31 + ActorMove = 0x2a1, // updated 6.31 + ActorGauge = 0xa9, // updated 6.31 /*! * @brief Used when resting */ - UpdateHpMpTp = 0x383, // updated 6.30h + UpdateHpMpTp = 0x10d, // updated 6.31 + UpdateClassInfo = 0xbd, // updated 6.31 /////////////////////////////////////////////////// ChatBanned = 0xF06B, - Playtime = 0x326, // updated 6.30h - Logout = 0x1d0, // updated 6.30h - CFNotify = 0x38b, // updated 6.30h + Playtime = 0x171, // updated 6.31 + Logout = 0x243, // updated 6.31 + CFNotify = 0x3a0, // updated 6.31 CFMemberStatus = 0x0079, - CFDutyInfo = 0x1f8, // updated 6.30h + CFDutyInfo = 0x3a9, // updated 6.31 CFPlayerInNeed = 0xF07F, - CFPreferredRole = 0xde, // updated 6.30h - CFCancel = 0x102, // updated 6.30h + CFPreferredRole = 0x2ef, // updated 6.31 + CFCancel = 0x39a, // updated 6.31 SocialRequestError = 0xF0AD, - CFRegistered = 0x029F, // updated 5.58 hotfix - SocialRequestResponse = 0x95, // updated 6.30h - SocialMessage = 0x03CB, // updated 5.58 hotfix - SocialMessage2 = 0x01D7, // updated 5.58 hotfix + CFRegistered = 0x029F, // updated 5.58 hotfix + SocialRequestResponse = 0x18c, // updated 6.31 + SocialMessage = 0x03CB, // updated 5.58 hotfix + SocialMessage2 = 0x01D7, // updated 5.58 hotfix CancelAllianceForming = 0xF0C6, // updated 4.2 - LogMessage = 0x343, // updated 6.30h + LogMessage = 0x27f, // updated 6.31 - Chat = 0x10a, // updated 6.30h + Chat = 0x353, // updated 6.31 PartyChat = 0x0065, WorldVisitList = 0xF0FE, // added 4.5 - SocialList = 0x01f1, // updated 6.30h + SocialList = 0x1f4, // updated 6.31 - ExamineSearchInfo = 0x30e, // updated 6.30h - UpdateSearchInfo = 0x34a, // updated 6.30h - InitSearchInfo = 0x0321, // updated 5.58 hotfix - ExamineSearchComment = 0x30c, // updated 6.30h + ExamineSearchInfo = 0x33e, // updated 6.31 + UpdateSearchInfo = 0x226, // updated 6.31 + InitSearchInfo = 0x0321, // updated 5.58 hotfix + ExamineSearchComment = 0x279, // updated 6.31 ServerNoticeShort = 0x0333, // updated 5.58 hotfix - ServerNotice = 0x0363, // updated 5.58 hotfix - SetOnlineStatus = 0x324, // updated 6.30h + ServerNotice = 0x0363, // updated 5.58 hotfix + SystemLogMessage = 0x174, // updated 6.31 + SetOnlineStatus = 0x3da, // updated 6.31 - CountdownInitiate = 0x3b1, // updated 6.30h - CountdownCancel = 0xb6, // updated 6.30h + CountdownInitiate = 0x1ff, // updated 6.31 + CountdownCancel = 0x140, // updated 6.31 - PlayerAddedToBlacklist = 0x399, // updated 6.30h - PlayerRemovedFromBlacklist = 0x1dc, // updated 6.30h - BlackList = 0x016B, // updated 6.30h + PlayerAddedToBlacklist = 0x27c, // updated 6.31 + PlayerRemovedFromBlacklist = 0x21e, // updated 6.31 + BlackList = 0x0282, // updated 6.31 - LinkshellList = 0x1e2, // updated 6.30h + LinkshellList = 0xf2, // updated 6.31 + CrossWorldLinkshellList = 0x262, // updated 6.31 or 0x2a5 or 0xa7 or 0x168 or 0x1a8 or 0x238 or 0x32b or 0x133 or 0x1b4 or 0x2d4 or 0x218 MailDeleteRequest = 0xF12B, // updated 5.0 // 12D - 137 - constant gap between 4.5x -> 5.0 - ReqMoogleMailList = 0xF138, // updated 5.0 - ReqMoogleMailLetter = 0xF139, // updated 5.0 + ReqMoogleMailList = 0xF138, // updated 5.0 + ReqMoogleMailLetter = 0xF139, // updated 5.0 MailLetterNotification = 0x013A, // updated 5.0 MarketTaxRates = 0x01F8, // updated 5.35 hotfix - MarketBoardSearchResult = 0x21e, // updated 6.30h - MarketBoardItemListingCount = 0xaa, // updated 6.30h - MarketBoardItemListingHistory = 0xa8, // updated 6.30h - MarketBoardItemListing = 0x2f1, // updated 6.30h + MarketBoardSearchResult = 0x233, // updated 6.31 + MarketBoardItemListingCount = 0x3bf, // updated 6.31 + MarketBoardItemListingHistory = 0x296, // updated 6.31 + MarketBoardItemListing = 0x155, // updated 6.31 + MarketBoardPurchase = 0x312, // updated 6.31 + ItemMarketBoardInfo = 0x308, // updated 6.31 - CharaFreeCompanyTag = 0x013B, // updated 4.5 - FreeCompanyBoardMsg = 0x03DB, // updated 5.58 hotfix - FreeCompanyInfo = 0x1dd, // updated 5.58 hotfix - ExamineFreeCompanyInfo = 0xcd, // updated 5.58 hotfix + CharaFreeCompanyTag = 0x013B, // updated 4.5 + FreeCompanyBoardMsg = 0x03DB, // updated 5.58 hotfix + FreeCompanyInfo = 0x68, // updated 6.31 + FreeCompanyDialog = 0x184, // updated 6.31 + ExamineFreeCompanyInfo = 0x177, // updated 6.31 FreeCompanyUpdateShortMessage = 0xF157, // added 5.0 - StatusEffectList = 0x2bc, // updated 6.30h - EurekaStatusEffectList = 0x353, // updated 6.30h - BossStatusEffectList = 0x1ee, // updated 6.30h - Effect = 0x1c9, // updated 6.30h - AoeEffect8 = 0x24a, // updated 6.30h - AoeEffect16 = 0x38a, // updated 6.30h - AoeEffect24 = 0xc8, // updated 6.30h - AoeEffect32 = 0x32b, // updated 6.30h - PersistantEffect = 0x24c, // updated 6.30h + StatusEffectList = 0x2a4, // updated 6.31 + EurekaStatusEffectList = 0x1de, // updated 6.31 + BossStatusEffectList = 0xa6, // updated 6.31 + StatusEffectList2 = 0x9c, // updated 6.31 + StatusEffectList3 = 0x24d, // updated 6.31 + Effect = 0x3c1, // updated 6.31 + AoeEffect8 = 0x78, // updated 6.31 + AoeEffect16 = 0x398, // updated 6.31 + AoeEffect24 = 0x2ea, // updated 6.31 + AoeEffect32 = 0x210, // updated 6.31 + PersistantEffect = 0x24d, // updated 6.31 - GCAffiliation = 0x372, // updated 6.30h + GCAffiliation = 0x114, // updated 6.31 - PlayerSpawn = 0x007f, // updated 6.30h - NpcSpawn = 0x39e, // updated 6.30h - NpcSpawn2 = 0x2e5, // updated 6.30h - ActorMove = 0x1db, // updated 6.30h + PlayerSpawn = 0x187, // updated 6.31 + NpcSpawn = 0x391, // updated 6.31 + NpcSpawn2 = 0x225, // updated 6.31 - ActorSetPos = 0x18c, // updated 6.30h - - ActorCast = 0x29c, // updated 6.30h SomeCustomiseChangePacketProbably = 0x00CD, // added 5.18 - PartyList = 0x1f6, // updated 6.30h - PartyMessage = 0x1e8, // updated 6.30h - HateRank = 0x134, // updated 6.30h - HateList = 0x2f9, // updated 6.30h - ObjectSpawn = 0x31b, // updated 6.30h - ObjectDespawn = 0x1b3, // updated 6.30h - UpdateClassInfo = 0x2d9, // updated 6.30h + PartyList = 0x211, // updated 6.31 + PartyMessage = 0x349, // updated 6.31 + HateRank = 0x250, // updated 6.31 + HateList = 0x359, // updated 6.31 + ObjectSpawn = 0x11a, // updated 6.31 + ObjectDespawn = 0xa4, // updated 6.31 SilentSetClassJob = 0xF18E, // updated 5.0 - seems to be the case, not sure if it's actually used for anything - PlayerSetup = 0x2b3, // updated 6.30h - PlayerStats = 0x1b8, // updated 6.30h - ActorOwner = 0x2b3, // updated 6.30h - PlayerStateFlags = 0xd5, // updated 6.30h - PlayerClassInfo = 0x2a6, // updated 6.30h - CharaVisualEffect = 0x1e9, // updated 6.30h + PlayerSetup = 0x373, // updated 6.31 + PlayerStats = 0x272, // updated 6.31 + ActorOwner = 0x373, // updated 6.31 + PlayerStateFlags = 0x1b7, // updated 6.31 + PlayerClassInfo = 0x3a5, // updated 6.31 + PlayerUpdateLook = 0x1ba, // updated 6.31 + CharaVisualEffect = 0x180, // updated 6.31 - ModelEquip = 0x286, // updated 6.30h - Examine = 0x1BC, // updated 6.30h - CharaNameReq = 0x35c, // updated 6.30h + ModelEquip = 0x212, // updated 6.31 + Examine = 0x121, // updated 6.31 + CharaNameReq = 0x2e7, // updated 6.31 // nb: see #565 on github UpdateRetainerItemSalePrice = 0xF19F, // updated 5.0 - RetainerSaleHistory = 0x14a, // updated 6.30h - RetainerInformation = 0x39c, // Updated 6.30h + RetainerSaleHistory = 0x37c, // updated 6.31 + RetainerInformation = 0xb0, // updated 6.31 SetLevelSync = 0x1186, // not updated for 4.4, not sure what it is anymore - ItemInfo = 0x302, // updated 6.30h - ContainerInfo = 0x255, // updated 6.30h - InventoryTransactionFinish = 0x1be, // updated 6.30h - InventoryTransaction = 0x77, // updated 6.30h - CurrencyCrystalInfo = 0x2bb, // updated 6.30h + ItemInfo = 0x335, // updated 6.31 + ContainerInfo = 0x3c3, // updated 6.31 + InventoryTransactionFinish = 0x317, // updated 6.31 + InventoryTransaction = 0xd3, // updated 6.31 + CurrencyCrystalInfo = 0x37b, // updated 6.31 - InventoryActionAck = 0x1eb, // updated 6.30h - UpdateInventorySlot = 0x10e, // updated 6.30h + InventoryActionAck = 0x34a, // updated 6.31 + UpdateInventorySlot = 0x3e7, // updated 6.31 - HuntingLogEntry = 0x2ca, // updated 6.30h + HuntingLogEntry = 0x266, // updated 6.31 - EventPlay = 0x2de, // updated 6.30h - EventPlay4 = 0x317, // updated 6.30h - EventPlay8 = 0x1cd, // updated 6.30h - EventPlay16 = 0x1fe, // updated 6.30h - EventPlay32 = 0x2fc, // updated 6.30h - EventPlay64 = 0x7c, // updated 6.30h - EventPlay128 = 0x337, // updated 6.30h - EventPlay255 = 0x1d2, // updated 6.30h + EventPlay = 0x1f5, // updated 6.31 + EventPlay4 = 0x357, // updated 6.31 + EventPlay8 = 0x269, // updated 6.31 + EventPlay16 = 0x278, // updated 6.31 + EventPlay32 = 0x36b, // updated 6.31 + EventPlay64 = 0x288, // updated 6.31 + EventPlay128 = 0x73, // updated 6.31 + EventPlay255 = 0x23a, // updated 6.31 + EventStart = 0x1c5, // updated 6.31 + EventFinish = 0xb6, // updated 6.31 - EventContinue = 0x240, // updated 6.30h or 0x3a2 or 0x3c3 or 0x270 or 0x391 or 0x159 or 0x2da or 0x3bb - - EventStart = 0x1a1, // updated 6.30h - EventFinish = 0x194, // updated 6.30h + EventContinue = 0x89, // updated 6.31 or 0x2ac or 0x290 or 0x331 or 0x1db or 0x37a or 0x11b or 0x31f EventLinkshell = 0x1169, - QuestActiveList = 0x140, // updated 6.30h - QuestUpdate = 0x382, // updated 6.30h - QuestCompleteList = 0x39a, // updated 6.30h + QuestActiveList = 0xf3, // updated 6.31 + QuestUpdate = 0xa3, // updated 6.31 + QuestCompleteList = 0x31b, // updated 6.31 - QuestFinish = 0x237, // updated 6.30h - MSQTrackerComplete = 0xf0, // updated 6.30h + QuestFinish = 0x93, // updated 6.31 + MSQTrackerComplete = 0x9a, // updated 6.31 MSQTrackerProgress = 0xF1CD, // updated 4.5 ? this actually looks like the two opcodes have been combined, see #474 QuestMessage = 0x0220, // updated 5.58 hotfix - QuestTracker = 0x2d5, // updated 6.30h + QuestTracker = 0x379, // updated 6.31 - Mount = 0x322, // updated 6.30h + Mount = 0x16b, // updated 6.31 - DirectorVars = 0x27b, // updated 6.30h - SomeDirectorUnk1 = 0x0084, // updated 5.18 - SomeDirectorUnk2 = 0xF0C1, // updated 5.18 - SomeDirectorUnk4 = 0x03DD, // updated 5.58 hotfix - SomeDirectorUnk8 = 0x028A, // updated 5.18 + DirectorVars = 0x126, // updated 6.31 + SomeDirectorUnk1 = 0x0084, // updated 5.18 + SomeDirectorUnk2 = 0xF0C1, // updated 5.18 + SomeDirectorUnk4 = 0x03DD, // updated 5.58 hotfix + SomeDirectorUnk8 = 0x028A, // updated 5.18 SomeDirectorUnk16 = 0x028C, // updated 5.18 - DirectorPopUp = 0x03DF, // updated 5.58 hotfix - DirectorPopUp4 = 0x019B, // updated 5.58 hotfix - DirectorPopUp8 = 0x0271, // updated 5.58 hotfix + DirectorPopUp = 0x03DF, // updated 5.58 hotfix + DirectorPopUp4 = 0x019B, // updated 5.58 hotfix + DirectorPopUp8 = 0x0271, // updated 5.58 hotfix CFAvailableContents = 0xF1FD, // updated 4.2 - WeatherChange = 0xc7, // updated 6.30h - PlayerTitleList = 0x1ab, // updated 6.30h - Discovery = 0x3ca, // updated 6.30h + WeatherChange = 0x163, // updated 6.31 + PlayerTitleList = 0xe9, // updated 6.31 + Discovery = 0x3d8, // updated 6.31 - EorzeaTimeOffset = 0x96, // updated 6.30h + EorzeaTimeOffset = 0x2a8, // updated 6.31 - EquipDisplayFlags = 0x303, // updated 6.30h + EquipDisplayFlags = 0x1bf, // updated 6.31 MiniCactpotInit = 0x0286, // added 5.31 - ShopMessage = 0x0287, // updated 5.58 hotfix - LootMessage = 0x2c0, // updated 6.30h - ResultDialog = 0x3bb, // updated 6.30h - DesynthResult = 0x270, // updated 6.30h + ShopMessage = 0x0287, // updated 5.58 hotfix + LootMessage = 0x1ac, // updated 6.31 + ResultDialog = 0x2ac, // updated 6.31 + DesynthResult = 0x89, // updated 6.31 /// Housing ////////////////////////////////////// - LandSetInitialize = 0x1fc, // updated 6.30h - LandUpdate = 0x30d, // updated 6.30h - YardObjectSpawn = 0x30b, // updated 6.30h - HousingIndoorInitialize = 0xa3, // updated 6.30h - LandPriceUpdate = 0x3d2, // updated 6.30h - LandInfoSign = 0xf9, // updated 6.30h - LandRename = 0x16d, // updated 6.30h - HousingEstateGreeting = 0x193, // updated 6.30h - HousingUpdateLandFlagsSlot = 0x1ff, // updated 6.30h - HousingLandFlags = 0x1f7, // updated 6.30h - HousingShowEstateGuestAccess = 0x71, // updated 6.30h + LandSetInitialize = 0x336, // updated 6.31 + LandUpdate = 0x29b, // updated 6.31 + YardObjectSpawn = 0x2fa, // updated 6.31 + HousingIndoorInitialize = 0x195, // updated 6.31 + LandPriceUpdate = 0x2ce, // updated 6.31 + LandInfoSign = 0x122, // updated 6.31 + LandRename = 0x36e, // updated 6.31 + HousingEstateGreeting = 0x29e, // updated 6.31 + HousingUpdateLandFlagsSlot = 0x16e, // updated 6.31 + HousingLandFlags = 0x232, // updated 6.31 + HousingShowEstateGuestAccess = 0xaf, // updated 6.31 - HousingObjectInitialize = 0x11d, // updated 6.30h - HousingInternalObjectSpawn = 0x378, // updated 6.30h + HousingObjectInitialize = 0x33b, // updated 6.31 + HousingInternalObjectSpawn = 0xb9, // updated 6.31 - HousingWardInfo = 0xe4, // updated 6.30h - HousingObjectMove = 0x2b9, // updated 6.30h + HousingWardInfo = 0xdd, // updated 6.31 + HousingObjectMove = 0x3c4, // updated 6.31 + HousingObjectDye = 0x2d8, // updated 6.31 - SharedEstateSettingsResponse = 0x144, // updated 6.30h + SharedEstateSettingsResponse = 0x8f, // updated 6.31 - LandUpdateHouseName = 0x22b, // updated 6.30h + LandUpdateHouseName = 0x214, // updated 6.31 + LandSetMap = 0x2af, // updated 6.31 - LandSetMap = 0xbc, // updated 6.30h - - CeremonySetActorAppearance = 0xba, // updated 6.30h + CeremonySetActorAppearance = 0x2f0, // updated 6.31 ////////////////////////////////////////////////// DuelChallenge = 0x0277, // 4.2; this is responsible for opening the ui - PerformNote = 0xe9, // updated 6.30h + PerformNote = 0x2ab, // updated 6.31 - PrepareZoning = 0x195, // updated 6.30h - ActorGauge = 0x171, // updated 6.30h DutyGauge = 0x02E5, // updated 5.58 hotfix // daily quest info -> without them sent, login will take longer... - DailyQuests = 0x17e, // updated 6.30h - DailyQuestRepeatFlags = 0x3cc, // updated 6.30h + DailyQuests = 0x343, // updated 6.31 + DailyQuestRepeatFlags = 0x97, // updated 6.31 - MapUpdate = 0x1b7, // updated 6.30h - MapUpdate4 = 0x1c4, // updated 6.30h - MapUpdate8 = 0x35e, // updated 6.30h - MapUpdate16 = 0x293, // updated 6.30h - MapUpdate32 = 0x67, // updated 6.30h - MapUpdate64 = 0x1ad, // updated 6.30h - MapUpdate128 = 0x323, // updated 6.30h + MapUpdate = 0x191, // updated 6.31 + MapUpdate4 = 0x1a1, // updated 6.31 + MapUpdate8 = 0x77, // updated 6.31 + MapUpdate16 = 0x2d0, // updated 6.31 + MapUpdate32 = 0x82, // updated 6.31 + MapUpdate64 = 0x372, // updated 6.31 + MapUpdate128 = 0xc2, // updated 6.31 /// Doman Mahjong ////////////////////////////////////// - MahjongOpenGui = 0x02A4, // only available in mahjong instance - MahjongNextRound = 0x02BD, // initial hands(baipai), # of riichi(wat), winds, honba, score and stuff - MahjongPlayerAction = 0x02BE, // tsumo(as in drawing a tile) called chi/pon/kan/riichi + MahjongOpenGui = 0x02A4, // only available in mahjong instance + MahjongNextRound = 0x02BD, // initial hands(baipai), # of riichi(wat), winds, honba, score and stuff + MahjongPlayerAction = 0x02BE, // tsumo(as in drawing a tile) called chi/pon/kan/riichi MahjongEndRoundTsumo = 0x02BF, // called tsumo - MahjongEndRoundRon = 0x2C0, // called ron or double ron (waiting for action must be flagged from discard packet to call) - MahjongTileDiscard = 0x02C1, // giri (discarding a tile.) chi(1)/pon(2)/kan(4)/ron(8) flags etc.. - MahjongPlayersInfo = 0xF2C2, // actor id, name, rating and stuff.. + MahjongEndRoundRon = 0x2C0, // called ron or double ron (waiting for action must be flagged from discard packet to call) + MahjongTileDiscard = 0x02C1, // giri (discarding a tile.) chi(1)/pon(2)/kan(4)/ron(8) flags etc.. + MahjongPlayersInfo = 0xF2C2, // actor id, name, rating and stuff.. // 2C3 and 2C4 are currently unknown MahjongEndRoundDraw = 0x02C5, // self explanatory - MahjongEndGame = 0x02C6, // finished oorasu(all-last) round; shows a result screen. + MahjongEndGame = 0x02C6, // finished oorasu(all-last) round; shows a result screen. /// Airship & Submarine ////////////////////////////////////// - AirshipExplorationResult = 0x34f, // updated 6.30h - AirshipStatus = 0x142, // updated 6.30h - AirshipStatusList = 0x70, // updated 6.30h - AirshipTimers = 0x26b, // updated 6.30h - SubmarineExplorationResult = 0x1a8, // updated 6.30h - SubmarineProgressionStatus = 0x148, // updated 6.30h - SubmarineStatusList = 0x232, // updated 6.30h - SubmarineTimers = 0x103, // updated 6.30h + AirshipTimers = 0xad, // updated 6.31 + AirshipStatus = 0x28b, // updated 6.31 + AirshipStatusList = 0x234, // updated 6.31 + AirshipExplorationResult = 0x1e4, // updated 6.31 + + SubmarineTimers = 0x9d, // updated 6.31 + SubmarineProgressionStatus = 0x30c, // updated 6.31 + SubmarineStatusList = 0x283, // updated 6.31 + SubmarineExplorationResult = 0x154, // updated 6.31 + + EnvironmentControl = 0x2d9, // updated 6.31 + IslandWorkshopSupplyDemand = 0x80, // updated 6.31 + }; /** - * Client IPC Zone Type Codes. - */ + * Client IPC Zone Type Codes. + */ enum ClientZoneIpcType : uint16_t { PingHandler = 0x011B, // updated 6.30h @@ -327,39 +339,39 @@ namespace Sapphire::Network::Packets CFCommenceHandler = 0x0381, // updated 5.58 hotfix - CFCancelHandler = 0x02B2, // updated 5.58 hotfix - CFRegisterDuty = 0x01BD, // updated 5.58 hotfix + CFCancelHandler = 0x02B2, // updated 5.58 hotfix + CFRegisterDuty = 0x01BD, // updated 5.58 hotfix CFRegisterRoulette = 0x037A, // updated 5.58 hotfix - PlayTimeHandler = 0x02B7, // updated 5.58 hotfix - LogoutHandler = 0x01C7, // updated 6.30h - CancelLogout = 0x0102, // updated 6.30h - CFDutyInfoHandler = 0xF078, // updated 4.2 + PlayTimeHandler = 0x02B7, // updated 5.58 hotfix + LogoutHandler = 0x01C7, // updated 6.30h + CancelLogout = 0x0102, // updated 6.30h + CFDutyInfoHandler = 0xF078, // updated 4.2 - SocialReqSendHandler = 0x00D7, // updated 5.58 hotfix + SocialReqSendHandler = 0x00D7, // updated 5.58 hotfix SocialResponseHandler = 0x023B, // updated 5.58 hotfix - CreateCrossWorldLS = 0x035D, // updated 5.58 hotfix + CreateCrossWorldLS = 0x035D, // updated 5.58 hotfix ChatHandler = 0x02C6, // Updated 6.30h PartyChatHandler = 0x0065, - PartySetLeaderHandler = 0x036C, // updated 5.58 hotfix - LeavePartyHandler = 0x019D, // updated 5.58 hotfix + PartySetLeaderHandler = 0x036C, // updated 5.58 hotfix + LeavePartyHandler = 0x019D, // updated 5.58 hotfix KickPartyMemberHandler = 0x0262, // updated 5.58 hotfix - DisbandPartyHandler = 0x0276, // updated 5.58 hotfix + DisbandPartyHandler = 0x0276, // updated 5.58 hotfix - SocialListHandler = 0x0145, // updated 6.30h - SetSearchInfoHandler = 0x01D4, // updated 5.58 hotfix - ReqSearchInfoHandler = 0x014F, // updated 5.58 hotfix + SocialListHandler = 0x0145, // updated 6.30h + SetSearchInfoHandler = 0x01D4, // updated 5.58 hotfix + ReqSearchInfoHandler = 0x014F, // updated 5.58 hotfix ReqExamineSearchCommentHandler = 0x00E7, // updated 5.0 ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58 hotfix - BlackListHandler = 0x0235, // updated 6.30h - PlayerSearchHandler = 0x037D, // updated 5.58 hotfix + BlackListHandler = 0x0235, // updated 6.30h + PlayerSearchHandler = 0x037D, // updated 5.58 hotfix LinkshellListHandler = 0x03B6, // updated 5.58 hotfix MarketBoardRequestItemListingInfo = 0x00F4, // updated 5.58 hotfix - MarketBoardRequestItemListings = 0x0122, // updated 5.58 hotfix - MarketBoardSearch = 0x0082, // updated 5.58 hotfix + MarketBoardRequestItemListings = 0x0122, // updated 5.58 hotfix + MarketBoardSearch = 0x0082, // updated 5.58 hotfix ReqExamineFcInfo = 0x037B, // updated 5.58 hotfix @@ -372,18 +384,18 @@ namespace Sapphire::Network::Packets ReqJoinNoviceNetwork = 0x0129, // updated 4.2 ReqCountdownInitiate = 0x02EC, // updated 5.58 hotfix - ReqCountdownCancel = 0x0068, // updated 5.58 hotfix + ReqCountdownCancel = 0x0068, // updated 5.58 hotfix - ZoneLineHandler = 0x01EC, // updated 6.30h - ClientTrigger = 0x0174, // updated 6.30h + ZoneLineHandler = 0x01EC, // updated 6.30h + ClientTrigger = 0x0174, // updated 6.30h DiscoveryHandler = 0x038B, // updated 5.58 hotfix PlaceFieldMarkerPreset = 0x204, // updated 6.30h - PlaceFieldMarker = 0x38e, // updated 6.30h - SkillHandler = 0x0249, // updated 6.30h - GMCommand1 = 0x0182, // updated 6.30h - GMCommand2 = 0x02AD, // updated 6.30h - AoESkillHandler = 0x0152, // updated 5.58 hotfix + PlaceFieldMarker = 0x38e, // updated 6.30h + SkillHandler = 0x0249, // updated 6.30h + GMCommand1 = 0x0182, // updated 6.30h + GMCommand2 = 0x02AD, // updated 6.30h + AoESkillHandler = 0x0152, // updated 5.58 hotfix UpdatePositionHandler = 0x10F, // Updated 6.30h @@ -392,30 +404,30 @@ namespace Sapphire::Network::Packets InventoryEquipRecommendedItems = 0x01C9, // updated 5.58 hotfix ReqPlaceHousingItem = 0x02D4, // updated 5.58 hotfix - BuildPresetHandler = 0x0223, // updated 5.58 hotfix + BuildPresetHandler = 0x0223, // updated 5.58 hotfix - TalkEventHandler = 0x0384, // updated 6.30h - EmoteEventHandler = 0x00B0, // updated 5.58 hotfix - WithinRangeEventHandler = 0x02B6, // updated 5.58 hotfix - OutOfRangeEventHandler = 0x03C5, // updated 5.58 hotfix - EnterTeriEventHandler = 0x0332, // updated 6.30h - ShopEventHandler = 0x0384, // updated 5.58 hotfix - ReturnEventHandler = 0x0383, // updated 6.30h - TradeReturnEventHandler = 0x0398, // updated 6.30h + TalkEventHandler = 0x0384, // updated 6.30h + EmoteEventHandler = 0x00B0, // updated 5.58 hotfix + WithinRangeEventHandler = 0x02B6, // updated 5.58 hotfix + OutOfRangeEventHandler = 0x03C5, // updated 5.58 hotfix + EnterTeriEventHandler = 0x0332, // updated 6.30h + ShopEventHandler = 0x0384, // updated 5.58 hotfix + ReturnEventHandler = 0x0383, // updated 6.30h + TradeReturnEventHandler = 0x0398, // updated 6.30h TradeReturnEventHandler2 = 0x023C, // updated 5.58 hotfix - EventYield2Handler = 0x021D, // updated 5.58 hotfix - EventYield16Handler = 0x0207, // updated 5.58 hotfix + EventYield2Handler = 0x021D, // updated 5.58 hotfix + EventYield16Handler = 0x0207, // updated 5.58 hotfix - LinkshellEventHandler = 0x016B, // updated 4.5 + LinkshellEventHandler = 0x016B, // updated 4.5 LinkshellEventHandler1 = 0x016C, // updated 4.5 ReqEquipDisplayFlagsChange = 0x03BC, // updated 6.30h - LandRenameHandler = 0x028E, // updated 5.58 hotfix - HousingUpdateHouseGreeting = 0x0343, // updated 5.58 hotfix + LandRenameHandler = 0x028E, // updated 5.58 hotfix + HousingUpdateHouseGreeting = 0x0343, // updated 5.58 hotfix HousingUpdateObjectPosition = 0x012C, // updated 5.58 hotfix - HousingEditExterior = 0x027B, // updated 5.58 hotfix - HousingEditInterior = 0x02E3, // updated 5.58 hotfix + HousingEditExterior = 0x027B, // updated 5.58 hotfix + HousingEditInterior = 0x02E3, // updated 5.58 hotfix SetSharedEstateSettings = 0x00D2, // updated 5.58 hotfix @@ -424,17 +436,17 @@ namespace Sapphire::Network::Packets PerformNoteHandler = 0x0243, // updated 5.58 hotfix WorldInteractionHandler = 0x0274, // updated 5.58 hotfix - Dive = 0x018C, // updated 6.30h + Dive = 0x018C, // updated 6.30h }; //////////////////////////////////////////////////////////////////////////////// /// Chat Connection IPC Codes /** - * Server IPC Chat Type Codes. - */ + * Server IPC Chat Type Codes. + */ enum ServerChatIpcType : uint16_t { - Tell = 0x0064, // updated for sb + Tell = 0x0064, // updated for sb PublicContentTell = 0x00FB, // added 4.5, this is used when receiving a /tell in PublicContent instances such as Eureka or Bozja TellErrNotFound = 0x0066, @@ -442,15 +454,14 @@ namespace Sapphire::Network::Packets }; /** - * Client IPC Chat Type Codes. - */ + * Client IPC Chat Type Codes. + */ enum ClientChatIpcType : uint16_t { TellReq = 0x0064, PublicContentTellReq = 0x0326, // updated 5.35 hotfix, this is used when sending a /tell in PublicContent instances such as Eureka or Bozja }; - } - + #endif /*_CORE_NETWORK_PACKETS_IPCS_H*/ From 2c5c403172116411acce6f922a67f94fb817cca7 Mon Sep 17 00:00:00 2001 From: Maple Date: Fri, 27 Jan 2023 18:47:24 -0300 Subject: [PATCH 18/21] Add partial client opcodes for 6.31, client can login --- src/common/Network/PacketDef/Ipcs.h | 44 ++++++++++++++--------------- 1 file changed, 22 insertions(+), 22 deletions(-) diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index e66bf2db..564769bb 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -98,11 +98,11 @@ namespace Sapphire::Network::Packets ExamineSearchInfo = 0x33e, // updated 6.31 UpdateSearchInfo = 0x226, // updated 6.31 - InitSearchInfo = 0x0321, // updated 5.58 hotfix + InitSearchInfo = 0x00B4, // updated 6.31 ExamineSearchComment = 0x279, // updated 6.31 ServerNoticeShort = 0x0333, // updated 5.58 hotfix - ServerNotice = 0x0363, // updated 5.58 hotfix + ServerNotice = 0x02A6, // updated 6.31 SystemLogMessage = 0x174, // updated 6.31 SetOnlineStatus = 0x3da, // updated 6.31 @@ -113,8 +113,8 @@ namespace Sapphire::Network::Packets PlayerRemovedFromBlacklist = 0x21e, // updated 6.31 BlackList = 0x0282, // updated 6.31 - LinkshellList = 0xf2, // updated 6.31 - CrossWorldLinkshellList = 0x262, // updated 6.31 or 0x2a5 or 0xa7 or 0x168 or 0x1a8 or 0x238 or 0x32b or 0x133 or 0x1b4 or 0x2d4 or 0x218 + LinkshellList = 0xf2, // updated 6.31 + CrossWorldLinkshellList = 0x1a8, // updated 6.31 MailDeleteRequest = 0xF12B, // updated 5.0 @@ -332,10 +332,10 @@ namespace Sapphire::Network::Packets */ enum ClientZoneIpcType : uint16_t { - PingHandler = 0x011B, // updated 6.30h - InitHandler = 0x01F0, // updated 6.30h + PingHandler = 0x01CD, // updated 6.31 + InitHandler = 0x0231, // updated 6.31 - FinishLoadingHandler = 0x01E4, // updated 6.30h + FinishLoadingHandler = 0x03d4, // updated 6.31 CFCommenceHandler = 0x0381, // updated 5.58 hotfix @@ -343,7 +343,7 @@ namespace Sapphire::Network::Packets CFRegisterDuty = 0x01BD, // updated 5.58 hotfix CFRegisterRoulette = 0x037A, // updated 5.58 hotfix PlayTimeHandler = 0x02B7, // updated 5.58 hotfix - LogoutHandler = 0x01C7, // updated 6.30h + LogoutHandler = 0x028A, // updated 6.31 CancelLogout = 0x0102, // updated 6.30h CFDutyInfoHandler = 0xF078, // updated 4.2 @@ -351,20 +351,20 @@ namespace Sapphire::Network::Packets SocialResponseHandler = 0x023B, // updated 5.58 hotfix CreateCrossWorldLS = 0x035D, // updated 5.58 hotfix - ChatHandler = 0x02C6, // Updated 6.30h + ChatHandler = 0x0206, // Updated 6.31 PartyChatHandler = 0x0065, PartySetLeaderHandler = 0x036C, // updated 5.58 hotfix LeavePartyHandler = 0x019D, // updated 5.58 hotfix KickPartyMemberHandler = 0x0262, // updated 5.58 hotfix DisbandPartyHandler = 0x0276, // updated 5.58 hotfix - SocialListHandler = 0x0145, // updated 6.30h - SetSearchInfoHandler = 0x01D4, // updated 5.58 hotfix + SocialListHandler = 0x0200, // updated 6.31 + SetSearchInfoHandler = 0x035C, // updated 6.31 ReqSearchInfoHandler = 0x014F, // updated 5.58 hotfix ReqExamineSearchCommentHandler = 0x00E7, // updated 5.0 ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58 hotfix - BlackListHandler = 0x0235, // updated 6.30h + BlackListHandler = 0x021B, // updated 6.31 PlayerSearchHandler = 0x037D, // updated 5.58 hotfix LinkshellListHandler = 0x03B6, // updated 5.58 hotfix @@ -375,7 +375,7 @@ namespace Sapphire::Network::Packets ReqExamineFcInfo = 0x037B, // updated 5.58 hotfix - FcInfoReqHandler = 0x03D4, // updated 5.58 hotfix + FcInfoReqHandler = 0x9999, // unknown FreeCompanyUpdateShortMessageHandler = 0x0123, // added 5.0 @@ -383,23 +383,23 @@ namespace Sapphire::Network::Packets ReqJoinNoviceNetwork = 0x0129, // updated 4.2 - ReqCountdownInitiate = 0x02EC, // updated 5.58 hotfix - ReqCountdownCancel = 0x0068, // updated 5.58 hotfix + ReqCountdownInitiate = 0x01FF, // updated 6.31 + ReqCountdownCancel = 0x0140, // updated 6.31 ZoneLineHandler = 0x01EC, // updated 6.30h - ClientTrigger = 0x0174, // updated 6.30h + ClientTrigger = 0x0165, // updated 6.31 DiscoveryHandler = 0x038B, // updated 5.58 hotfix PlaceFieldMarkerPreset = 0x204, // updated 6.30h PlaceFieldMarker = 0x38e, // updated 6.30h - SkillHandler = 0x0249, // updated 6.30h + SkillHandler = 0x0383, // updated 6.31 GMCommand1 = 0x0182, // updated 6.30h GMCommand2 = 0x02AD, // updated 6.30h AoESkillHandler = 0x0152, // updated 5.58 hotfix - UpdatePositionHandler = 0x10F, // Updated 6.30h + UpdatePositionHandler = 0x00EE, // updated 6.31 - InventoryModifyHandler = 0x008F, // Updated 6.30h + InventoryModifyHandler = 0x01D3, // updated 6.31 InventoryEquipRecommendedItems = 0x01C9, // updated 5.58 hotfix @@ -418,8 +418,8 @@ namespace Sapphire::Network::Packets EventYield2Handler = 0x021D, // updated 5.58 hotfix EventYield16Handler = 0x0207, // updated 5.58 hotfix - LinkshellEventHandler = 0x016B, // updated 4.5 - LinkshellEventHandler1 = 0x016C, // updated 4.5 + LinkshellEventHandler = 0x9999, // unknown + LinkshellEventHandler1 = 0x9999, // unknown ReqEquipDisplayFlagsChange = 0x03BC, // updated 6.30h @@ -431,7 +431,7 @@ namespace Sapphire::Network::Packets SetSharedEstateSettings = 0x00D2, // updated 5.58 hotfix - UpdatePositionInstance = 0x00DB, // Updated 6.30h + UpdatePositionInstance = 0x00E8, // Updated 6.31 PerformNoteHandler = 0x0243, // updated 5.58 hotfix From 95897dffc2a3ea8530140689ce787060619c64f4 Mon Sep 17 00:00:00 2001 From: Maple Date: Fri, 27 Jan 2023 20:55:25 -0300 Subject: [PATCH 19/21] Add more client side opcodes, new characters can progress past opening now. --- src/common/Network/PacketDef/Ipcs.h | 22 +++++++++++----------- 1 file changed, 11 insertions(+), 11 deletions(-) diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index 564769bb..d33214f4 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -360,7 +360,7 @@ namespace Sapphire::Network::Packets SocialListHandler = 0x0200, // updated 6.31 SetSearchInfoHandler = 0x035C, // updated 6.31 - ReqSearchInfoHandler = 0x014F, // updated 5.58 hotfix + ReqSearchInfoHandler = 0x02A6, // updated 6.31 ReqExamineSearchCommentHandler = 0x00E7, // updated 5.0 ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58 hotfix @@ -386,15 +386,15 @@ namespace Sapphire::Network::Packets ReqCountdownInitiate = 0x01FF, // updated 6.31 ReqCountdownCancel = 0x0140, // updated 6.31 - ZoneLineHandler = 0x01EC, // updated 6.30h + ZoneLineHandler = 0x01E6, // updated 6.31 ClientTrigger = 0x0165, // updated 6.31 DiscoveryHandler = 0x038B, // updated 5.58 hotfix PlaceFieldMarkerPreset = 0x204, // updated 6.30h PlaceFieldMarker = 0x38e, // updated 6.30h SkillHandler = 0x0383, // updated 6.31 - GMCommand1 = 0x0182, // updated 6.30h - GMCommand2 = 0x02AD, // updated 6.30h + GMCommand1 = 0x026E, // updated 6.31 + GMCommand2 = 0x012C, // updated 6.31 AoESkillHandler = 0x0152, // updated 5.58 hotfix UpdatePositionHandler = 0x00EE, // updated 6.31 @@ -406,26 +406,26 @@ namespace Sapphire::Network::Packets ReqPlaceHousingItem = 0x02D4, // updated 5.58 hotfix BuildPresetHandler = 0x0223, // updated 5.58 hotfix - TalkEventHandler = 0x0384, // updated 6.30h + TalkEventHandler = 0x02E9, // updated 6.31 EmoteEventHandler = 0x00B0, // updated 5.58 hotfix WithinRangeEventHandler = 0x02B6, // updated 5.58 hotfix - OutOfRangeEventHandler = 0x03C5, // updated 5.58 hotfix - EnterTeriEventHandler = 0x0332, // updated 6.30h + OutOfRangeEventHandler = 0x01CC, // updated 6.31 + EnterTeriEventHandler = 0x01ED, // updated 6.31 ShopEventHandler = 0x0384, // updated 5.58 hotfix - ReturnEventHandler = 0x0383, // updated 6.30h - TradeReturnEventHandler = 0x0398, // updated 6.30h + ReturnEventHandler = 0x010D, // updated 6.31 + TradeReturnEventHandler = 0x03C1, // updated 6.31 TradeReturnEventHandler2 = 0x023C, // updated 5.58 hotfix EventYield2Handler = 0x021D, // updated 5.58 hotfix EventYield16Handler = 0x0207, // updated 5.58 hotfix LinkshellEventHandler = 0x9999, // unknown - LinkshellEventHandler1 = 0x9999, // unknown + LinkshellEventHandler1 = 0x9999, // unknown ReqEquipDisplayFlagsChange = 0x03BC, // updated 6.30h LandRenameHandler = 0x028E, // updated 5.58 hotfix HousingUpdateHouseGreeting = 0x0343, // updated 5.58 hotfix - HousingUpdateObjectPosition = 0x012C, // updated 5.58 hotfix + HousingUpdateObjectPosition = 0x9999, // unknown HousingEditExterior = 0x027B, // updated 5.58 hotfix HousingEditInterior = 0x02E3, // updated 5.58 hotfix From 762a35f8b9024c9698029f6c3e69f358c962667e Mon Sep 17 00:00:00 2001 From: Rey Date: Tue, 28 Feb 2023 00:09:56 -0600 Subject: [PATCH 20/21] Revert "Fix Oodle on Linux (todo:: make this not suck)" This reverts commit 81bbe690a86c74fd67c90aefdf41f9d8fecdecc6. --- CMakeLists.txt | 1 + deps/Oodle/CMakeLists.txt | 4 ++-- deps/Oodle/oodle2net.h | 11 +++++------ src/common/Network/Oodle.h | 2 +- 4 files changed, 9 insertions(+), 9 deletions(-) diff --git a/CMakeLists.txt b/CMakeLists.txt index d8ec5a1c..6597c437 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -15,6 +15,7 @@ add_custom_target( copy_runtime_files ALL COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/web ${CMAKE_BINARY_DIR}/bin/web COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/sql_import.sh ${CMAKE_BINARY_DIR}/bin/sql_import.sh COMMAND ${CMAKE_COMMAND} -E remove_directory ${CMAKE_BINARY_DIR}/bin/data/actions + COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/deps/oo2net_9_win64.dll ${CMAKE_BINARY_DIR}/bin/oo2net_9_win64.dll COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/deps/ffxiv-actions/actions ${CMAKE_BINARY_DIR}/bin/data/actions ) ###################################### diff --git a/deps/Oodle/CMakeLists.txt b/deps/Oodle/CMakeLists.txt index 7473ec68..ef90dcbc 100644 --- a/deps/Oodle/CMakeLists.txt +++ b/deps/Oodle/CMakeLists.txt @@ -3,7 +3,7 @@ add_library(OodleNet STATIC IMPORTED GLOBAL) set_target_properties( OodleNet PROPERTIES - IMPORTED_IMPLIB "${CMAKE_SOURCE_DIR}/deps/Oodle/liboo2netlinux64.a" - IMPORTED_LOCATION "${CMAKE_SOURCE_DIR}/deps/Oodle/liboo2netlinux64.a" + IMPORTED_IMPLIB "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" + IMPORTED_LOCATION "${CMAKE_SOURCE_DIR}/deps/Oodle/oo2net_9_win64.lib" LINKER_LANGUAGE C ) \ No newline at end of file diff --git a/deps/Oodle/oodle2net.h b/deps/Oodle/oodle2net.h index 604f5e35..59c718c9 100644 --- a/deps/Oodle/oodle2net.h +++ b/deps/Oodle/oodle2net.h @@ -1,19 +1,18 @@ #ifndef __OODLE2NET_H__ #define __OODLE2NET_H__ -#include -extern "C" intptr_t OodleNetwork1_Shared_Size( int32_t htbits ); +extern "C" intptr_t __stdcall OodleNetwork1_Shared_Size( int32_t htbits ); -extern "C" intptr_t OodleNetwork1UDP_State_Size(); +extern "C" intptr_t __stdcall OodleNetwork1UDP_State_Size(); -extern "C" void OodleNetwork1_Shared_SetWindow( +extern "C" void __stdcall OodleNetwork1_Shared_SetWindow( void* shared, int32_t htbits, const void* window, int32_t windowSize ); -extern "C" void OodleNetwork1UDP_Train( +extern "C" void __stdcall OodleNetwork1UDP_Train( void* state, const void* shared, const void** trainingPacketPointers, @@ -21,7 +20,7 @@ extern "C" void OodleNetwork1UDP_Train( int32_t numTrainingPackets ); -extern "C" bool OodleNetwork1UDP_Decode( +extern "C" bool __stdcall OodleNetwork1UDP_Decode( void* state, const void* shared, const void* enc, diff --git a/src/common/Network/Oodle.h b/src/common/Network/Oodle.h index 536980cb..b01dcf29 100644 --- a/src/common/Network/Oodle.h +++ b/src/common/Network/Oodle.h @@ -2,7 +2,7 @@ #define _OODLE_H #include -#include + #include namespace Sapphire::Network From b431e3bf13bbcc3ba9912c63609bca8d9583c27f Mon Sep 17 00:00:00 2001 From: Rey Date: Thu, 2 Mar 2023 00:19:08 -0600 Subject: [PATCH 21/21] Patch 6.31 Hotfix works and you can login. --- src/common/CommonGen.h | 8 +- src/common/Network/PacketDef/Ipcs.h | 467 ++++++++++++++-------------- src/world/Territory/HousingZone.cpp | 2 + 3 files changed, 240 insertions(+), 237 deletions(-) diff --git a/src/common/CommonGen.h b/src/common/CommonGen.h index fbec22e4..7dfa3dd2 100644 --- a/src/common/CommonGen.h +++ b/src/common/CommonGen.h @@ -783,9 +783,9 @@ namespace Sapphire::Common { Polarization3 = 154, Polarization4 = 155, Projection = 156, - Pandæmonium = 157, - Pandæmonium1 = 158, - Pandæmonium2 = 159, + Pandæmonium = 157, + Pandæmonium1 = 158, + Pandæmonium2 = 159, Ultimatum = 160, Inevitability = 161, Transcendence = 162, @@ -817,7 +817,7 @@ namespace Sapphire::Common { Tavern = 5, Eatery = 6, ImmersiveExperience = 7, - Café = 8, + Café = 8, Aquarium = 9, Sanctum = 10, Venue = 11, diff --git a/src/common/Network/PacketDef/Ipcs.h b/src/common/Network/PacketDef/Ipcs.h index d33214f4..3458741d 100644 --- a/src/common/Network/PacketDef/Ipcs.h +++ b/src/common/Network/PacketDef/Ipcs.h @@ -43,261 +43,262 @@ namespace Sapphire::Network::Packets */ enum ServerZoneIpcType : uint16_t { - Ping = 0x0108, // updated 6.31 - Init = 0x03d4, // updated 6.31 + Ping = 0x020a, // updated 6.31h + Init = 0x032d, // updated 6.31h - ActorFreeSpawn = 0x1c3, // updated 6.31 + ActorFreeSpawn = 0x282, // updated 6.31h - InitZone = 0x94, // updated 6.31 - PrepareZoning = 0x1d7, // updated 6.31 + InitZone = 0x118, // updated 6.31h + PrepareZoning = 0x27c, // updated 6.31h - EffectResult = 0x36c, // updated 6.31 - EffectResultBasic = 0x2e9, // updated 6.31 + EffectResult = 0x214, // updated 6.31h + EffectResultBasic = 0x205, // updated 6.31h - ActorControl = 0x363, // updated 6.31 - ActorControlTarget = 0x1ec, // updated 6.31 - ActorControlSelf = 0x267, // updated 6.31 - ActorCast = 0x207, // updated 6.31 - ActorSetPos = 0x186, // updated 6.31 - ActorMove = 0x2a1, // updated 6.31 - ActorGauge = 0xa9, // updated 6.31 + ActorControl = 0x1a4, // updated 6.31h + ActorControlTarget = 0x7e, // updated 6.31h + ActorControlSelf = 0x203, // updated 6.31h + ActorCast = 0x185, // updated 6.31h + ActorSetPos = 0x99, // updated 6.31h + ActorMove = 0x155, // updated 6.31h + ActorGauge = 0x238, // updated 6.31h /*! * @brief Used when resting */ - UpdateHpMpTp = 0x10d, // updated 6.31 - UpdateClassInfo = 0xbd, // updated 6.31 + UpdateHpMpTp = 0x119, // updated 6.31h + UpdateClassInfo = 0x2c5, // updated 6.31h /////////////////////////////////////////////////// ChatBanned = 0xF06B, - Playtime = 0x171, // updated 6.31 - Logout = 0x243, // updated 6.31 - CFNotify = 0x3a0, // updated 6.31 + Playtime = 0x26c, // updated 6.31h + Logout = 0x072, // updated 6.31h + CFNotify = 0x2a1, // updated 6.31h CFMemberStatus = 0x0079, - CFDutyInfo = 0x3a9, // updated 6.31 + CFDutyInfo = 0x21a, // updated 6.31h CFPlayerInNeed = 0xF07F, - CFPreferredRole = 0x2ef, // updated 6.31 - CFCancel = 0x39a, // updated 6.31 + CFPreferredRole = 0x26b, // updated 6.31h + CFCancel = 0x1e3, // updated 6.31h SocialRequestError = 0xF0AD, - CFRegistered = 0x029F, // updated 5.58 hotfix - SocialRequestResponse = 0x18c, // updated 6.31 - SocialMessage = 0x03CB, // updated 5.58 hotfix - SocialMessage2 = 0x01D7, // updated 5.58 hotfix + CFRegistered = 0x029F, // updated 5.58h + SocialRequestResponse = 0x2c3, // updated 6.31h + SocialMessage = 0x03CB, // updated 5.58h + SocialMessage2 = 0x01D7, // updated 5.58h CancelAllianceForming = 0xF0C6, // updated 4.2 - LogMessage = 0x27f, // updated 6.31 + LogMessage = 0x1a7, // updated 6.31h - Chat = 0x353, // updated 6.31 + Chat = 0x00c5, // updated 6.31h PartyChat = 0x0065, WorldVisitList = 0xF0FE, // added 4.5 - SocialList = 0x1f4, // updated 6.31 + SocialList = 0x1f4, // updated 6.31h - ExamineSearchInfo = 0x33e, // updated 6.31 - UpdateSearchInfo = 0x226, // updated 6.31 - InitSearchInfo = 0x00B4, // updated 6.31 - ExamineSearchComment = 0x279, // updated 6.31 + ExamineSearchInfo = 0x156, // updated 6.31h + UpdateSearchInfo = 0xc8, // updated 6.31h + InitSearchInfo = 0x00b7, // updated 6.31h + ExamineSearchComment = 0x102, // updated 6.31h - ServerNoticeShort = 0x0333, // updated 5.58 hotfix - ServerNotice = 0x02A6, // updated 6.31 - SystemLogMessage = 0x174, // updated 6.31 - SetOnlineStatus = 0x3da, // updated 6.31 + ServerNoticeShort = 0x0333, // updated 5.58h + ServerNotice = 0x03b0, // updated 6.31h + SystemLogMessage = 0x1a6, // updated 6.31h + SetOnlineStatus = 0x2b7, // updated 6.31h - CountdownInitiate = 0x1ff, // updated 6.31 - CountdownCancel = 0x140, // updated 6.31 + CountdownInitiate = 0x3e1, // updated 6.31h + CountdownCancel = 0x23a, // updated 6.31h - PlayerAddedToBlacklist = 0x27c, // updated 6.31 - PlayerRemovedFromBlacklist = 0x21e, // updated 6.31 - BlackList = 0x0282, // updated 6.31 + PlayerAddedToBlacklist = 0x1cb, // updated 6.31h + PlayerRemovedFromBlacklist = 0x37c, // updated 6.31h + BlackList = 0x033d, // updated 6.31h - LinkshellList = 0xf2, // updated 6.31 - CrossWorldLinkshellList = 0x1a8, // updated 6.31 + LinkshellList = 0x3be, // updated 6.31h + CrossWorldLinkshellList = 0xb8, // updated 6.31h + FellowshipList = 0x2a3, // updated 6.31h - MailDeleteRequest = 0xF12B, // updated 5.0 + MailDeleteRequest = 0x0117, // updated 6.31h // 12D - 137 - constant gap between 4.5x -> 5.0 ReqMoogleMailList = 0xF138, // updated 5.0 ReqMoogleMailLetter = 0xF139, // updated 5.0 MailLetterNotification = 0x013A, // updated 5.0 - MarketTaxRates = 0x01F8, // updated 5.35 hotfix + MarketTaxRates = 0x01F8, // updated 5.35h - MarketBoardSearchResult = 0x233, // updated 6.31 - MarketBoardItemListingCount = 0x3bf, // updated 6.31 - MarketBoardItemListingHistory = 0x296, // updated 6.31 - MarketBoardItemListing = 0x155, // updated 6.31 - MarketBoardPurchase = 0x312, // updated 6.31 - ItemMarketBoardInfo = 0x308, // updated 6.31 + MarketBoardSearchResult = 0x115, // updated 6.31h + MarketBoardItemListingCount = 0x31a, // updated 6.31h + MarketBoardItemListingHistory = 0x176, // updated 6.31h + MarketBoardItemListing = 0x1ed, // updated 6.31h + MarketBoardPurchase = 0x30b, // updated 6.31h + ItemMarketBoardInfo = 0x23f, // updated 6.31h CharaFreeCompanyTag = 0x013B, // updated 4.5 - FreeCompanyBoardMsg = 0x03DB, // updated 5.58 hotfix - FreeCompanyInfo = 0x68, // updated 6.31 - FreeCompanyDialog = 0x184, // updated 6.31 - ExamineFreeCompanyInfo = 0x177, // updated 6.31 + FreeCompanyBoardMsg = 0x03DB, // updated 5.58h + FreeCompanyInfo = 0x29c, // updated 6.31h + FreeCompanyDialog = 0x285, // updated 6.31h + ExamineFreeCompanyInfo = 0x171, // updated 6.31h FreeCompanyUpdateShortMessage = 0xF157, // added 5.0 - StatusEffectList = 0x2a4, // updated 6.31 - EurekaStatusEffectList = 0x1de, // updated 6.31 - BossStatusEffectList = 0xa6, // updated 6.31 - StatusEffectList2 = 0x9c, // updated 6.31 - StatusEffectList3 = 0x24d, // updated 6.31 - Effect = 0x3c1, // updated 6.31 - AoeEffect8 = 0x78, // updated 6.31 - AoeEffect16 = 0x398, // updated 6.31 - AoeEffect24 = 0x2ea, // updated 6.31 - AoeEffect32 = 0x210, // updated 6.31 - PersistantEffect = 0x24d, // updated 6.31 + StatusEffectList = 0x305, // updated 6.31h + EurekaStatusEffectList = 0x3a6, // updated 6.31h + BossStatusEffectList = 0x1e4, // updated 6.31h + StatusEffectList2 = 0x197, // updated 6.31h + StatusEffectList3 = 0x2a7, // updated 6.31h + Effect = 0x100, // updated 6.31h + AoeEffect8 = 0x2b9, // updated 6.31h + AoeEffect16 = 0x390, // updated 6.31h + AoeEffect24 = 0x22a, // updated 6.31h + AoeEffect32 = 0x120, // updated 6.31h + PersistantEffect = 0x2a7, // updated 6.31h - GCAffiliation = 0x114, // updated 6.31 + GCAffiliation = 0x184, // updated 6.31h - PlayerSpawn = 0x187, // updated 6.31 - NpcSpawn = 0x391, // updated 6.31 - NpcSpawn2 = 0x225, // updated 6.31 + PlayerSpawn = 0xf9, // updated 6.31h + NpcSpawn = 0x3d5, // updated 6.31h + NpcSpawn2 = 0x3b6, // updated 6.31h SomeCustomiseChangePacketProbably = 0x00CD, // added 5.18 - PartyList = 0x211, // updated 6.31 - PartyMessage = 0x349, // updated 6.31 - HateRank = 0x250, // updated 6.31 - HateList = 0x359, // updated 6.31 - ObjectSpawn = 0x11a, // updated 6.31 - ObjectDespawn = 0xa4, // updated 6.31 + PartyList = 0x24e, // updated 6.31h + PartyMessage = 0x297, // updated 6.31h + HateRank = 0x1dd, // updated 6.31h + HateList = 0x3a5, // updated 6.31h + ObjectSpawn = 0x277, // updated 6.31h + ObjectDespawn = 0x2de, // updated 6.31h SilentSetClassJob = 0xF18E, // updated 5.0 - seems to be the case, not sure if it's actually used for anything - PlayerSetup = 0x373, // updated 6.31 - PlayerStats = 0x272, // updated 6.31 - ActorOwner = 0x373, // updated 6.31 - PlayerStateFlags = 0x1b7, // updated 6.31 - PlayerClassInfo = 0x3a5, // updated 6.31 - PlayerUpdateLook = 0x1ba, // updated 6.31 - CharaVisualEffect = 0x180, // updated 6.31 + PlayerSetup = 0x287, // updated 6.31h + PlayerStats = 0x2b6, // updated 6.31h + ActorOwner = 0x287, // updated 6.31h + PlayerStateFlags = 0x395, // updated 6.31h + PlayerClassInfo = 0x17c, // updated 6.31h + PlayerUpdateLook = 0x1cc, // updated 6.31h + CharaVisualEffect = 0x355, // updated 6.31h - ModelEquip = 0x212, // updated 6.31 - Examine = 0x121, // updated 6.31 - CharaNameReq = 0x2e7, // updated 6.31 + ModelEquip = 0xe1, // updated 6.31h + Examine = 0x246, // updated 6.31h + CharaNameReq = 0x1c4, // updated 6.31h // nb: see #565 on github UpdateRetainerItemSalePrice = 0xF19F, // updated 5.0 - RetainerSaleHistory = 0x37c, // updated 6.31 - RetainerInformation = 0xb0, // updated 6.31 + RetainerSaleHistory = 0x1ae, // updated 6.31h + RetainerInformation = 0x139, // updated 6.31h SetLevelSync = 0x1186, // not updated for 4.4, not sure what it is anymore - ItemInfo = 0x335, // updated 6.31 - ContainerInfo = 0x3c3, // updated 6.31 - InventoryTransactionFinish = 0x317, // updated 6.31 - InventoryTransaction = 0xd3, // updated 6.31 - CurrencyCrystalInfo = 0x37b, // updated 6.31 + ItemInfo = 0x1c2, // updated 6.31h + ContainerInfo = 0x93, // updated 6.31h + InventoryTransactionFinish = 0x290, // updated 6.31h + InventoryTransaction = 0x6e, // updated 6.31h + CurrencyCrystalInfo = 0x385, // updated 6.31h - InventoryActionAck = 0x34a, // updated 6.31 - UpdateInventorySlot = 0x3e7, // updated 6.31 + InventoryActionAck = 0xd0, // updated 6.31h + UpdateInventorySlot = 0xc2, // updated 6.31h - HuntingLogEntry = 0x266, // updated 6.31 + HuntingLogEntry = 0xb0, // updated 6.31h - EventPlay = 0x1f5, // updated 6.31 - EventPlay4 = 0x357, // updated 6.31 - EventPlay8 = 0x269, // updated 6.31 - EventPlay16 = 0x278, // updated 6.31 - EventPlay32 = 0x36b, // updated 6.31 - EventPlay64 = 0x288, // updated 6.31 - EventPlay128 = 0x73, // updated 6.31 - EventPlay255 = 0x23a, // updated 6.31 - EventStart = 0x1c5, // updated 6.31 - EventFinish = 0xb6, // updated 6.31 + EventPlay = 0x3b8, // updated 6.31h + EventPlay4 = 0x1ec, // updated 6.31h + EventPlay8 = 0x333, // updated 6.31h + EventPlay16 = 0x3ae, // updated 6.31h + EventPlay32 = 0x160, // updated 6.31h + EventPlay64 = 0x2f2, // updated 6.31h + EventPlay128 = 0x8b, // updated 6.31h + EventPlay255 = 0x10b, // updated 6.31h + EventStart = 0x92, // updated 6.31h + EventFinish = 0x8c, // updated 6.31h - EventContinue = 0x89, // updated 6.31 or 0x2ac or 0x290 or 0x331 or 0x1db or 0x37a or 0x11b or 0x31f + EventContinue = 0x200, // updated 6.31h EventLinkshell = 0x1169, - QuestActiveList = 0xf3, // updated 6.31 - QuestUpdate = 0xa3, // updated 6.31 - QuestCompleteList = 0x31b, // updated 6.31 + QuestActiveList = 0x82, // updated 6.31h + QuestUpdate = 0xa7, // updated 6.31h + QuestCompleteList = 0x227, // updated 6.31h - QuestFinish = 0x93, // updated 6.31 - MSQTrackerComplete = 0x9a, // updated 6.31 + QuestFinish = 0x30a, // updated 6.31h + MSQTrackerComplete = 0xba, // updated 6.31h MSQTrackerProgress = 0xF1CD, // updated 4.5 ? this actually looks like the two opcodes have been combined, see #474 - QuestMessage = 0x0220, // updated 5.58 hotfix + QuestMessage = 0x0220, // updated 5.58h - QuestTracker = 0x379, // updated 6.31 + QuestTracker = 0x1c1, // updated 6.31h - Mount = 0x16b, // updated 6.31 + Mount = 0x116, // updated 6.31h - DirectorVars = 0x126, // updated 6.31 + DirectorVars = 0x105, // updated 6.31h SomeDirectorUnk1 = 0x0084, // updated 5.18 SomeDirectorUnk2 = 0xF0C1, // updated 5.18 - SomeDirectorUnk4 = 0x03DD, // updated 5.58 hotfix + SomeDirectorUnk4 = 0x03DD, // updated 5.58h SomeDirectorUnk8 = 0x028A, // updated 5.18 SomeDirectorUnk16 = 0x028C, // updated 5.18 - DirectorPopUp = 0x03DF, // updated 5.58 hotfix - DirectorPopUp4 = 0x019B, // updated 5.58 hotfix - DirectorPopUp8 = 0x0271, // updated 5.58 hotfix + DirectorPopUp = 0x03DF, // updated 5.58h + DirectorPopUp4 = 0x019B, // updated 5.58h + DirectorPopUp8 = 0x0271, // updated 5.58h CFAvailableContents = 0xF1FD, // updated 4.2 - WeatherChange = 0x163, // updated 6.31 - PlayerTitleList = 0xe9, // updated 6.31 - Discovery = 0x3d8, // updated 6.31 + WeatherChange = 0x148, // updated 6.31h + PlayerTitleList = 0x365, // updated 6.31h + Discovery = 0x14b, // updated 6.31h - EorzeaTimeOffset = 0x2a8, // updated 6.31 + EorzeaTimeOffset = 0x3d2, // updated 6.31h - EquipDisplayFlags = 0x1bf, // updated 6.31 + EquipDisplayFlags = 0x35e, // updated 6.31h MiniCactpotInit = 0x0286, // added 5.31 - ShopMessage = 0x0287, // updated 5.58 hotfix - LootMessage = 0x1ac, // updated 6.31 - ResultDialog = 0x2ac, // updated 6.31 - DesynthResult = 0x89, // updated 6.31 + ShopMessage = 0x0287, // updated 5.58h + LootMessage = 0x191, // updated 6.31h + ResultDialog = 0x394, // updated 6.31h + DesynthResult = 0x16a, // updated 6.31h /// Housing ////////////////////////////////////// - LandSetInitialize = 0x336, // updated 6.31 - LandUpdate = 0x29b, // updated 6.31 - YardObjectSpawn = 0x2fa, // updated 6.31 - HousingIndoorInitialize = 0x195, // updated 6.31 - LandPriceUpdate = 0x2ce, // updated 6.31 - LandInfoSign = 0x122, // updated 6.31 - LandRename = 0x36e, // updated 6.31 - HousingEstateGreeting = 0x29e, // updated 6.31 - HousingUpdateLandFlagsSlot = 0x16e, // updated 6.31 - HousingLandFlags = 0x232, // updated 6.31 - HousingShowEstateGuestAccess = 0xaf, // updated 6.31 + LandSetInitialize = 0x69, // updated 6.31h + LandUpdate = 0x32a, // updated 6.31h + YardObjectSpawn = 0x183, // updated 6.31h + HousingIndoorInitialize = 0x206, // updated 6.31h + LandPriceUpdate = 0x330, // updated 6.31h + LandInfoSign = 0x220, // updated 6.31h + LandRename = 0x304, // updated 6.31h + HousingEstateGreeting = 0x1b6, // updated 6.31h + HousingUpdateLandFlagsSlot = 0x2a2, // updated 6.31h + HousingLandFlags = 0x1a0, // updated 6.31h + HousingShowEstateGuestAccess = 0x369, // updated 6.31h - HousingObjectInitialize = 0x33b, // updated 6.31 - HousingInternalObjectSpawn = 0xb9, // updated 6.31 + HousingObjectInitialize = 0x3a7, // updated 6.31h + HousingInternalObjectSpawn = 0x251, // updated 6.31h - HousingWardInfo = 0xdd, // updated 6.31 - HousingObjectMove = 0x3c4, // updated 6.31 - HousingObjectDye = 0x2d8, // updated 6.31 + HousingWardInfo = 0x2bb, // updated 6.31h + HousingObjectMove = 0xcb, // updated 6.31h + HousingObjectDye = 0x328, // updated 6.31h - SharedEstateSettingsResponse = 0x8f, // updated 6.31 + SharedEstateSettingsResponse = 0x3a1, // updated 6.31h - LandUpdateHouseName = 0x214, // updated 6.31 - LandSetMap = 0x2af, // updated 6.31 + LandUpdateHouseName = 0x24d, // updated 6.31h + LandSetMap = 0x2ce, // updated 6.31h - CeremonySetActorAppearance = 0x2f0, // updated 6.31 + CeremonySetActorAppearance = 0x2cb, // updated 6.31h ////////////////////////////////////////////////// DuelChallenge = 0x0277, // 4.2; this is responsible for opening the ui - PerformNote = 0x2ab, // updated 6.31 + PerformNote = 0x1e1, // updated 6.31h - DutyGauge = 0x02E5, // updated 5.58 hotfix + DutyGauge = 0x02E5, // updated 5.58h // daily quest info -> without them sent, login will take longer... - DailyQuests = 0x343, // updated 6.31 - DailyQuestRepeatFlags = 0x97, // updated 6.31 + DailyQuests = 0xd4, // updated 6.31h + DailyQuestRepeatFlags = 0x21c, // updated 6.31h - MapUpdate = 0x191, // updated 6.31 - MapUpdate4 = 0x1a1, // updated 6.31 - MapUpdate8 = 0x77, // updated 6.31 - MapUpdate16 = 0x2d0, // updated 6.31 - MapUpdate32 = 0x82, // updated 6.31 - MapUpdate64 = 0x372, // updated 6.31 - MapUpdate128 = 0xc2, // updated 6.31 + MapUpdate = 0x31f, // updated 6.31h + MapUpdate4 = 0x2ff, // updated 6.31h + MapUpdate8 = 0xff, // updated 6.31h + MapUpdate16 = 0x1d0, // updated 6.31h + MapUpdate32 = 0x151, // updated 6.31h + MapUpdate64 = 0x392, // updated 6.31h + MapUpdate128 = 0x222, // updated 6.31h /// Doman Mahjong ////////////////////////////////////// MahjongOpenGui = 0x02A4, // only available in mahjong instance @@ -312,18 +313,18 @@ namespace Sapphire::Network::Packets MahjongEndGame = 0x02C6, // finished oorasu(all-last) round; shows a result screen. /// Airship & Submarine ////////////////////////////////////// - AirshipTimers = 0xad, // updated 6.31 - AirshipStatus = 0x28b, // updated 6.31 - AirshipStatusList = 0x234, // updated 6.31 - AirshipExplorationResult = 0x1e4, // updated 6.31 + AirshipTimers = 0xda, // updated 6.31h + AirshipStatus = 0x2f1, // updated 6.31h + AirshipStatusList = 0x39d, // updated 6.31h + AirshipExplorationResult = 0x3c4, // updated 6.31h - SubmarineTimers = 0x9d, // updated 6.31 - SubmarineProgressionStatus = 0x30c, // updated 6.31 - SubmarineStatusList = 0x283, // updated 6.31 - SubmarineExplorationResult = 0x154, // updated 6.31 + SubmarineTimers = 0x263, // updated 6.31h + SubmarineProgressionStatus = 0x25a, // updated 6.31h + SubmarineStatusList = 0xac, // updated 6.31h + SubmarineExplorationResult = 0x194, // updated 6.31h - EnvironmentControl = 0x2d9, // updated 6.31 - IslandWorkshopSupplyDemand = 0x80, // updated 6.31 + EnvironmentControl = 0xef, // updated 6.31h + IslandWorkshopSupplyDemand = 0x190, // updated 6.31h }; @@ -332,110 +333,110 @@ namespace Sapphire::Network::Packets */ enum ClientZoneIpcType : uint16_t { - PingHandler = 0x01CD, // updated 6.31 - InitHandler = 0x0231, // updated 6.31 + PingHandler = 0x0273, // updated 6.31h + InitHandler = 0x03a8, // updated 6.31h - FinishLoadingHandler = 0x03d4, // updated 6.31 + FinishLoadingHandler = 0x032d, // updated 6.31h - CFCommenceHandler = 0x0381, // updated 5.58 hotfix + CFCommenceHandler = 0x0381, // updated 5.58h - CFCancelHandler = 0x02B2, // updated 5.58 hotfix - CFRegisterDuty = 0x01BD, // updated 5.58 hotfix - CFRegisterRoulette = 0x037A, // updated 5.58 hotfix - PlayTimeHandler = 0x02B7, // updated 5.58 hotfix - LogoutHandler = 0x028A, // updated 6.31 - CancelLogout = 0x0102, // updated 6.30h + CFCancelHandler = 0x02B2, // updated 5.58h + CFRegisterDuty = 0x01BD, // updated 5.58h + CFRegisterRoulette = 0x037A, // updated 5.58h + PlayTimeHandler = 0x02B7, // updated 5.58h + LogoutHandler = 0x0387, // updated 6.31h + CancelLogout = 0x01e3, // updated 6.31h CFDutyInfoHandler = 0xF078, // updated 4.2 - SocialReqSendHandler = 0x00D7, // updated 5.58 hotfix - SocialResponseHandler = 0x023B, // updated 5.58 hotfix - CreateCrossWorldLS = 0x035D, // updated 5.58 hotfix + SocialReqSendHandler = 0x00D7, // updated 5.58h + SocialResponseHandler = 0x023B, // updated 5.58h + CreateCrossWorldLS = 0x035D, // updated 5.58h - ChatHandler = 0x0206, // Updated 6.31 + ChatHandler = 0x00f1, // Updated 6.31h PartyChatHandler = 0x0065, - PartySetLeaderHandler = 0x036C, // updated 5.58 hotfix - LeavePartyHandler = 0x019D, // updated 5.58 hotfix - KickPartyMemberHandler = 0x0262, // updated 5.58 hotfix - DisbandPartyHandler = 0x0276, // updated 5.58 hotfix + PartySetLeaderHandler = 0x036C, // updated 5.58h + LeavePartyHandler = 0x019D, // updated 5.58h + KickPartyMemberHandler = 0x0262, // updated 5.58h + DisbandPartyHandler = 0x0276, // updated 5.58h SocialListHandler = 0x0200, // updated 6.31 - SetSearchInfoHandler = 0x035C, // updated 6.31 - ReqSearchInfoHandler = 0x02A6, // updated 6.31 + SetSearchInfoHandler = 0x0368, // updated 6.31h + ReqSearchInfoHandler = 0x03b0, // updated 6.31h ReqExamineSearchCommentHandler = 0x00E7, // updated 5.0 - ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58 hotfix - BlackListHandler = 0x021B, // updated 6.31 - PlayerSearchHandler = 0x037D, // updated 5.58 hotfix + ReqRemovePlayerFromBlacklist = 0x00B4, // updated 5.58h + BlackListHandler = 0x010c, // updated 6.31h + PlayerSearchHandler = 0x037D, // updated 5.58h - LinkshellListHandler = 0x03B6, // updated 5.58 hotfix + LinkshellListHandler = 0x03B6, // updated 5.58h - MarketBoardRequestItemListingInfo = 0x00F4, // updated 5.58 hotfix - MarketBoardRequestItemListings = 0x0122, // updated 5.58 hotfix - MarketBoardSearch = 0x0082, // updated 5.58 hotfix + MarketBoardRequestItemListingInfo = 0x00F4, // updated 5.58h + MarketBoardRequestItemListings = 0x0122, // updated 5.58h + MarketBoardSearch = 0x0082, // updated 5.58h - ReqExamineFcInfo = 0x037B, // updated 5.58 hotfix + ReqExamineFcInfo = 0x037B, // updated 5.58h FcInfoReqHandler = 0x9999, // unknown FreeCompanyUpdateShortMessageHandler = 0x0123, // added 5.0 - ReqMarketWishList = 0x00C3, // updated 5.58 hotfix + ReqMarketWishList = 0x00C3, // updated 5.58h ReqJoinNoviceNetwork = 0x0129, // updated 4.2 - ReqCountdownInitiate = 0x01FF, // updated 6.31 - ReqCountdownCancel = 0x0140, // updated 6.31 + ReqCountdownInitiate = 0x03e1, // updated 6.31h + ReqCountdownCancel = 0x023a, // updated 6.31h - ZoneLineHandler = 0x01E6, // updated 6.31 - ClientTrigger = 0x0165, // updated 6.31 - DiscoveryHandler = 0x038B, // updated 5.58 hotfix + ZoneLineHandler = 0x00ce, // updated 6.31h + ClientTrigger = 0x0244, // updated 6.31h + DiscoveryHandler = 0x038B, // updated 5.58h PlaceFieldMarkerPreset = 0x204, // updated 6.30h PlaceFieldMarker = 0x38e, // updated 6.30h - SkillHandler = 0x0383, // updated 6.31 - GMCommand1 = 0x026E, // updated 6.31 - GMCommand2 = 0x012C, // updated 6.31 - AoESkillHandler = 0x0152, // updated 5.58 hotfix + SkillHandler = 0x0133, // updated 6.31h + GMCommand1 = 0x0278, // updated 6.31h + GMCommand2 = 0x03d8, // updated 6.31h + AoESkillHandler = 0x0152, // updated 5.58h - UpdatePositionHandler = 0x00EE, // updated 6.31 + UpdatePositionHandler = 0x01f7, // updated 6.31h - InventoryModifyHandler = 0x01D3, // updated 6.31 + InventoryModifyHandler = 0x01a2, // updated 6.31h - InventoryEquipRecommendedItems = 0x01C9, // updated 5.58 hotfix + InventoryEquipRecommendedItems = 0x01C9, // updated 5.58h - ReqPlaceHousingItem = 0x02D4, // updated 5.58 hotfix - BuildPresetHandler = 0x0223, // updated 5.58 hotfix + ReqPlaceHousingItem = 0x02D4, // updated 5.58h + BuildPresetHandler = 0x0223, // updated 5.58h - TalkEventHandler = 0x02E9, // updated 6.31 - EmoteEventHandler = 0x00B0, // updated 5.58 hotfix - WithinRangeEventHandler = 0x02B6, // updated 5.58 hotfix - OutOfRangeEventHandler = 0x01CC, // updated 6.31 - EnterTeriEventHandler = 0x01ED, // updated 6.31 - ShopEventHandler = 0x0384, // updated 5.58 hotfix - ReturnEventHandler = 0x010D, // updated 6.31 - TradeReturnEventHandler = 0x03C1, // updated 6.31 - TradeReturnEventHandler2 = 0x023C, // updated 5.58 hotfix - EventYield2Handler = 0x021D, // updated 5.58 hotfix - EventYield16Handler = 0x0207, // updated 5.58 hotfix + TalkEventHandler = 0x0205, // updated 6.31h + EmoteEventHandler = 0x00B0, // updated 5.58h + WithinRangeEventHandler = 0x02B6, // updated 5.58h + OutOfRangeEventHandler = 0x00b4, // updated 6.31h + EnterTeriEventHandler = 0x014e, // updated 6.31h + ShopEventHandler = 0x0384, // updated 5.58h + ReturnEventHandler = 0x0119, // updated 6.31h + TradeReturnEventHandler = 0x0100, // updated 6.31h + TradeReturnEventHandler2 = 0x023C, // updated 5.58h + EventYield2Handler = 0x021D, // updated 5.58h + EventYield16Handler = 0x0207, // updated 5.58h LinkshellEventHandler = 0x9999, // unknown LinkshellEventHandler1 = 0x9999, // unknown ReqEquipDisplayFlagsChange = 0x03BC, // updated 6.30h - LandRenameHandler = 0x028E, // updated 5.58 hotfix - HousingUpdateHouseGreeting = 0x0343, // updated 5.58 hotfix + LandRenameHandler = 0x028E, // updated 5.58h + HousingUpdateHouseGreeting = 0x0343, // updated 5.58h HousingUpdateObjectPosition = 0x9999, // unknown - HousingEditExterior = 0x027B, // updated 5.58 hotfix - HousingEditInterior = 0x02E3, // updated 5.58 hotfix + HousingEditExterior = 0x027B, // updated 5.58h + HousingEditInterior = 0x02E3, // updated 5.58h - SetSharedEstateSettings = 0x00D2, // updated 5.58 hotfix + SetSharedEstateSettings = 0x00D2, // updated 5.58h - UpdatePositionInstance = 0x00E8, // Updated 6.31 + UpdatePositionInstance = 0x03bd, // Updated 6.31h - PerformNoteHandler = 0x0243, // updated 5.58 hotfix + PerformNoteHandler = 0x0243, // updated 5.58h - WorldInteractionHandler = 0x0274, // updated 5.58 hotfix + WorldInteractionHandler = 0x0274, // updated 5.58h Dive = 0x018C, // updated 6.30h }; diff --git a/src/world/Territory/HousingZone.cpp b/src/world/Territory/HousingZone.cpp index 8443da8e..61cbfb3f 100644 --- a/src/world/Territory/HousingZone.cpp +++ b/src/world/Territory/HousingZone.cpp @@ -62,6 +62,8 @@ bool Sapphire::HousingZone::init() housingIndex = 2; else if( m_territoryTypeId == 641 ) housingIndex = 3; + else if (m_territoryTypeId == 979 ) + housingIndex = 4; auto& exdData = Common::Service< Data::ExdDataGenerated >::ref(); auto info = exdData.get< Sapphire::Data::HousingLandSet >( housingIndex );